18228 lines
681 KiB
18228 lines
681 KiB
/*! jQuery UI - v1.12.1 - 2016-09-14
|
|
* http://jqueryui.com
|
|
* Includes: widget.js, position.js, data.js, disable-selection.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js, focusable.js, form-reset-mixin.js, jquery-1-7.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/draggable.js, widgets/droppable.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/resizable.js, widgets/selectable.js, widgets/selectmenu.js, widgets/slider.js, widgets/sortable.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js
|
|
* Copyright jQuery Foundation and other contributors; Licensed MIT */
|
|
|
|
(function (factory) {
|
|
if (typeof define === "function" && define.amd) {
|
|
// AMD. Register as an anonymous module.
|
|
define(["jquery"], factory);
|
|
} else {
|
|
// Browser globals
|
|
factory(jQuery);
|
|
}
|
|
}(function ($) {
|
|
$.ui = $.ui || {};
|
|
|
|
var version = $.ui.version = "1.12.1";
|
|
|
|
/*!
|
|
* jQuery UI Widget 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Widget
|
|
//>>group: Core
|
|
//>>description: Provides a factory for creating stateful widgets with a common API.
|
|
//>>docs: http://api.jqueryui.com/jQuery.widget/
|
|
//>>demos: http://jqueryui.com/widget/
|
|
|
|
var widgetUuid = 0;
|
|
var widgetSlice = Array.prototype.slice;
|
|
|
|
$.cleanData = (function (orig) {
|
|
return function (elems) {
|
|
var events, elem, i;
|
|
for (i = 0; (elem = elems[i]) != null; i++) {
|
|
try {
|
|
// Only trigger remove when necessary to save time
|
|
events = $._data(elem, "events");
|
|
if (events && events.remove) {
|
|
$(elem).triggerHandler("remove");
|
|
}
|
|
|
|
// Http://bugs.jquery.com/ticket/8235
|
|
} catch (e) { }
|
|
}
|
|
orig(elems);
|
|
};
|
|
})($.cleanData);
|
|
|
|
$.widget = function (name, base, prototype) {
|
|
var existingConstructor, constructor, basePrototype;
|
|
|
|
// ProxiedPrototype allows the provided prototype to remain unmodified
|
|
// so that it can be used as a mixin for multiple widgets (#8876)
|
|
var proxiedPrototype = {};
|
|
|
|
var namespace = name.split(".")[0];
|
|
name = name.split(".")[1];
|
|
var fullName = namespace + "-" + name;
|
|
|
|
if (!prototype) {
|
|
prototype = base;
|
|
base = $.Widget;
|
|
}
|
|
|
|
if ($.isArray(prototype)) {
|
|
prototype = $.extend.apply(null, [{}].concat(prototype));
|
|
}
|
|
|
|
// Create selector for plugin
|
|
$.expr[":"][fullName.toLowerCase()] = function (elem) {
|
|
return !!$.data(elem, fullName);
|
|
};
|
|
|
|
$[namespace] = $[namespace] || {};
|
|
existingConstructor = $[namespace][name];
|
|
constructor = $[namespace][name] = function (options, element) {
|
|
// Allow instantiation without "new" keyword
|
|
if (!this._createWidget) {
|
|
return new constructor(options, element);
|
|
}
|
|
|
|
// Allow instantiation without initializing for simple inheritance
|
|
// must use "new" keyword (the code above always passes args)
|
|
if (arguments.length) {
|
|
this._createWidget(options, element);
|
|
}
|
|
};
|
|
|
|
// Extend with the existing constructor to carry over any static properties
|
|
$.extend(constructor, existingConstructor, {
|
|
version: prototype.version,
|
|
|
|
// Copy the object used to create the prototype in case we need to
|
|
// redefine the widget later
|
|
_proto: $.extend({}, prototype),
|
|
|
|
// Track widgets that inherit from this widget in case this widget is
|
|
// redefined after a widget inherits from it
|
|
_childConstructors: []
|
|
});
|
|
|
|
basePrototype = new base();
|
|
|
|
// We need to make the options hash a property directly on the new instance
|
|
// otherwise we'll modify the options hash on the prototype that we're
|
|
// inheriting from
|
|
basePrototype.options = $.widget.extend({}, basePrototype.options);
|
|
$.each(prototype, function (prop, value) {
|
|
if (!$.isFunction(value)) {
|
|
proxiedPrototype[prop] = value;
|
|
return;
|
|
}
|
|
proxiedPrototype[prop] = (function () {
|
|
function _super() {
|
|
return base.prototype[prop].apply(this, arguments);
|
|
}
|
|
|
|
function _superApply(args) {
|
|
return base.prototype[prop].apply(this, args);
|
|
}
|
|
|
|
return function () {
|
|
var __super = this._super;
|
|
var __superApply = this._superApply;
|
|
var returnValue;
|
|
|
|
this._super = _super;
|
|
this._superApply = _superApply;
|
|
|
|
returnValue = value.apply(this, arguments);
|
|
|
|
this._super = __super;
|
|
this._superApply = __superApply;
|
|
|
|
return returnValue;
|
|
};
|
|
})();
|
|
});
|
|
constructor.prototype = $.widget.extend(basePrototype, {
|
|
// TODO: remove support for widgetEventPrefix
|
|
// always use the name + a colon as the prefix, e.g., draggable:start
|
|
// don't prefix for widgets that aren't DOM-based
|
|
widgetEventPrefix: existingConstructor ? (basePrototype.widgetEventPrefix || name) : name
|
|
}, proxiedPrototype, {
|
|
constructor: constructor,
|
|
namespace: namespace,
|
|
widgetName: name,
|
|
widgetFullName: fullName
|
|
});
|
|
|
|
// If this widget is being redefined then we need to find all widgets that
|
|
// are inheriting from it and redefine all of them so that they inherit from
|
|
// the new version of this widget. We're essentially trying to replace one
|
|
// level in the prototype chain.
|
|
if (existingConstructor) {
|
|
$.each(existingConstructor._childConstructors, function (i, child) {
|
|
var childPrototype = child.prototype;
|
|
|
|
// Redefine the child widget using the same prototype that was
|
|
// originally used, but inherit from the new version of the base
|
|
$.widget(childPrototype.namespace + "." + childPrototype.widgetName, constructor,
|
|
child._proto);
|
|
});
|
|
|
|
// Remove the list of existing child constructors from the old constructor
|
|
// so the old child constructors can be garbage collected
|
|
delete existingConstructor._childConstructors;
|
|
} else {
|
|
base._childConstructors.push(constructor);
|
|
}
|
|
|
|
$.widget.bridge(name, constructor);
|
|
|
|
return constructor;
|
|
};
|
|
|
|
$.widget.extend = function (target) {
|
|
var input = widgetSlice.call(arguments, 1);
|
|
var inputIndex = 0;
|
|
var inputLength = input.length;
|
|
var key;
|
|
var value;
|
|
|
|
for (; inputIndex < inputLength; inputIndex++) {
|
|
for (key in input[inputIndex]) {
|
|
value = input[inputIndex][key];
|
|
if (input[inputIndex].hasOwnProperty(key) && value !== undefined) {
|
|
// Clone objects
|
|
if ($.isPlainObject(value)) {
|
|
target[key] = $.isPlainObject(target[key]) ?
|
|
$.widget.extend({}, target[key], value) :
|
|
|
|
// Don't extend strings, arrays, etc. with objects
|
|
$.widget.extend({}, value);
|
|
|
|
// Copy everything else by reference
|
|
} else {
|
|
target[key] = value;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return target;
|
|
};
|
|
|
|
$.widget.bridge = function (name, object) {
|
|
var fullName = object.prototype.widgetFullName || name;
|
|
$.fn[name] = function (options) {
|
|
var isMethodCall = typeof options === "string";
|
|
var args = widgetSlice.call(arguments, 1);
|
|
var returnValue = this;
|
|
|
|
if (isMethodCall) {
|
|
// If this is an empty collection, we need to have the instance method
|
|
// return undefined instead of the jQuery instance
|
|
if (!this.length && options === "instance") {
|
|
returnValue = undefined;
|
|
} else {
|
|
this.each(function () {
|
|
var methodValue;
|
|
var instance = $.data(this, fullName);
|
|
|
|
if (options === "instance") {
|
|
returnValue = instance;
|
|
return false;
|
|
}
|
|
|
|
if (!instance) {
|
|
return $.error("cannot call methods on " + name +
|
|
" prior to initialization; " +
|
|
"attempted to call method '" + options + "'");
|
|
}
|
|
|
|
if (!$.isFunction(instance[options]) || options.charAt(0) === "_") {
|
|
return $.error("no such method '" + options + "' for " + name +
|
|
" widget instance");
|
|
}
|
|
|
|
methodValue = instance[options].apply(instance, args);
|
|
|
|
if (methodValue !== instance && methodValue !== undefined) {
|
|
returnValue = methodValue && methodValue.jquery ?
|
|
returnValue.pushStack(methodValue.get()) :
|
|
methodValue;
|
|
return false;
|
|
}
|
|
});
|
|
}
|
|
} else {
|
|
// Allow multiple hashes to be passed on init
|
|
if (args.length) {
|
|
options = $.widget.extend.apply(null, [options].concat(args));
|
|
}
|
|
|
|
this.each(function () {
|
|
var instance = $.data(this, fullName);
|
|
if (instance) {
|
|
instance.option(options || {});
|
|
if (instance._init) {
|
|
instance._init();
|
|
}
|
|
} else {
|
|
$.data(this, fullName, new object(options, this));
|
|
}
|
|
});
|
|
}
|
|
|
|
return returnValue;
|
|
};
|
|
};
|
|
|
|
$.Widget = function ( /* options, element */) { };
|
|
$.Widget._childConstructors = [];
|
|
|
|
$.Widget.prototype = {
|
|
widgetName: "widget",
|
|
widgetEventPrefix: "",
|
|
defaultElement: "<div>",
|
|
|
|
options: {
|
|
classes: {},
|
|
disabled: false,
|
|
|
|
// Callbacks
|
|
create: null
|
|
},
|
|
|
|
_createWidget: function (options, element) {
|
|
element = $(element || this.defaultElement || this)[0];
|
|
this.element = $(element);
|
|
this.uuid = widgetUuid++;
|
|
this.eventNamespace = "." + this.widgetName + this.uuid;
|
|
|
|
this.bindings = $();
|
|
this.hoverable = $();
|
|
this.focusable = $();
|
|
this.classesElementLookup = {};
|
|
|
|
if (element !== this) {
|
|
$.data(element, this.widgetFullName, this);
|
|
this._on(true, this.element, {
|
|
remove: function (event) {
|
|
if (event.target === element) {
|
|
this.destroy();
|
|
}
|
|
}
|
|
});
|
|
this.document = $(element.style ?
|
|
|
|
// Element within the document
|
|
element.ownerDocument :
|
|
|
|
// Element is window or document
|
|
element.document || element);
|
|
this.window = $(this.document[0].defaultView || this.document[0].parentWindow);
|
|
}
|
|
|
|
this.options = $.widget.extend({},
|
|
this.options,
|
|
this._getCreateOptions(),
|
|
options);
|
|
|
|
this._create();
|
|
|
|
if (this.options.disabled) {
|
|
this._setOptionDisabled(this.options.disabled);
|
|
}
|
|
|
|
this._trigger("create", null, this._getCreateEventData());
|
|
this._init();
|
|
},
|
|
|
|
_getCreateOptions: function () {
|
|
return {};
|
|
},
|
|
|
|
_getCreateEventData: $.noop,
|
|
|
|
_create: $.noop,
|
|
|
|
_init: $.noop,
|
|
|
|
destroy: function () {
|
|
var that = this;
|
|
|
|
this._destroy();
|
|
$.each(this.classesElementLookup, function (key, value) {
|
|
that._removeClass(value, key);
|
|
});
|
|
|
|
// We can probably remove the unbind calls in 2.0
|
|
// all event bindings should go through this._on()
|
|
this.element
|
|
.off(this.eventNamespace)
|
|
.removeData(this.widgetFullName);
|
|
this.widget()
|
|
.off(this.eventNamespace)
|
|
.removeAttr("aria-disabled");
|
|
|
|
// Clean up events and states
|
|
this.bindings.off(this.eventNamespace);
|
|
},
|
|
|
|
_destroy: $.noop,
|
|
|
|
widget: function () {
|
|
return this.element;
|
|
},
|
|
|
|
option: function (key, value) {
|
|
var options = key;
|
|
var parts;
|
|
var curOption;
|
|
var i;
|
|
|
|
if (arguments.length === 0) {
|
|
// Don't return a reference to the internal hash
|
|
return $.widget.extend({}, this.options);
|
|
}
|
|
|
|
if (typeof key === "string") {
|
|
// Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
|
|
options = {};
|
|
parts = key.split(".");
|
|
key = parts.shift();
|
|
if (parts.length) {
|
|
curOption = options[key] = $.widget.extend({}, this.options[key]);
|
|
for (i = 0; i < parts.length - 1; i++) {
|
|
curOption[parts[i]] = curOption[parts[i]] || {};
|
|
curOption = curOption[parts[i]];
|
|
}
|
|
key = parts.pop();
|
|
if (arguments.length === 1) {
|
|
return curOption[key] === undefined ? null : curOption[key];
|
|
}
|
|
curOption[key] = value;
|
|
} else {
|
|
if (arguments.length === 1) {
|
|
return this.options[key] === undefined ? null : this.options[key];
|
|
}
|
|
options[key] = value;
|
|
}
|
|
}
|
|
|
|
this._setOptions(options);
|
|
|
|
return this;
|
|
},
|
|
|
|
_setOptions: function (options) {
|
|
var key;
|
|
|
|
for (key in options) {
|
|
this._setOption(key, options[key]);
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "classes") {
|
|
this._setOptionClasses(value);
|
|
}
|
|
|
|
this.options[key] = value;
|
|
|
|
if (key === "disabled") {
|
|
this._setOptionDisabled(value);
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
_setOptionClasses: function (value) {
|
|
var classKey, elements, currentElements;
|
|
|
|
for (classKey in value) {
|
|
currentElements = this.classesElementLookup[classKey];
|
|
if (value[classKey] === this.options.classes[classKey] ||
|
|
!currentElements ||
|
|
!currentElements.length) {
|
|
continue;
|
|
}
|
|
|
|
// We are doing this to create a new jQuery object because the _removeClass() call
|
|
// on the next line is going to destroy the reference to the current elements being
|
|
// tracked. We need to save a copy of this collection so that we can add the new classes
|
|
// below.
|
|
elements = $(currentElements.get());
|
|
this._removeClass(currentElements, classKey);
|
|
|
|
// We don't use _addClass() here, because that uses this.options.classes
|
|
// for generating the string of classes. We want to use the value passed in from
|
|
// _setOption(), this is the new value of the classes option which was passed to
|
|
// _setOption(). We pass this value directly to _classes().
|
|
elements.addClass(this._classes({
|
|
element: elements,
|
|
keys: classKey,
|
|
classes: value,
|
|
add: true
|
|
}));
|
|
}
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this._toggleClass(this.widget(), this.widgetFullName + "-disabled", null, !!value);
|
|
|
|
// If the widget is becoming disabled, then nothing is interactive
|
|
if (value) {
|
|
this._removeClass(this.hoverable, null, "ui-state-hover");
|
|
this._removeClass(this.focusable, null, "ui-state-focus");
|
|
}
|
|
},
|
|
|
|
enable: function () {
|
|
return this._setOptions({ disabled: false });
|
|
},
|
|
|
|
disable: function () {
|
|
return this._setOptions({ disabled: true });
|
|
},
|
|
|
|
_classes: function (options) {
|
|
var full = [];
|
|
var that = this;
|
|
|
|
options = $.extend({
|
|
element: this.element,
|
|
classes: this.options.classes || {}
|
|
}, options);
|
|
|
|
function processClassString(classes, checkOption) {
|
|
var current, i;
|
|
for (i = 0; i < classes.length; i++) {
|
|
current = that.classesElementLookup[classes[i]] || $();
|
|
if (options.add) {
|
|
current = $($.unique(current.get().concat(options.element.get())));
|
|
} else {
|
|
current = $(current.not(options.element).get());
|
|
}
|
|
that.classesElementLookup[classes[i]] = current;
|
|
full.push(classes[i]);
|
|
if (checkOption && options.classes[classes[i]]) {
|
|
full.push(options.classes[classes[i]]);
|
|
}
|
|
}
|
|
}
|
|
|
|
this._on(options.element, {
|
|
"remove": "_untrackClassesElement"
|
|
});
|
|
|
|
if (options.keys) {
|
|
processClassString(options.keys.match(/\S+/g) || [], true);
|
|
}
|
|
if (options.extra) {
|
|
processClassString(options.extra.match(/\S+/g) || []);
|
|
}
|
|
|
|
return full.join(" ");
|
|
},
|
|
|
|
_untrackClassesElement: function (event) {
|
|
var that = this;
|
|
$.each(that.classesElementLookup, function (key, value) {
|
|
if ($.inArray(event.target, value) !== -1) {
|
|
that.classesElementLookup[key] = $(value.not(event.target).get());
|
|
}
|
|
});
|
|
},
|
|
|
|
_removeClass: function (element, keys, extra) {
|
|
return this._toggleClass(element, keys, extra, false);
|
|
},
|
|
|
|
_addClass: function (element, keys, extra) {
|
|
return this._toggleClass(element, keys, extra, true);
|
|
},
|
|
|
|
_toggleClass: function (element, keys, extra, add) {
|
|
add = (typeof add === "boolean") ? add : extra;
|
|
var shift = (typeof element === "string" || element === null),
|
|
options = {
|
|
extra: shift ? keys : extra,
|
|
keys: shift ? element : keys,
|
|
element: shift ? this.element : element,
|
|
add: add
|
|
};
|
|
options.element.toggleClass(this._classes(options), add);
|
|
return this;
|
|
},
|
|
|
|
_on: function (suppressDisabledCheck, element, handlers) {
|
|
var delegateElement;
|
|
var instance = this;
|
|
|
|
// No suppressDisabledCheck flag, shuffle arguments
|
|
if (typeof suppressDisabledCheck !== "boolean") {
|
|
handlers = element;
|
|
element = suppressDisabledCheck;
|
|
suppressDisabledCheck = false;
|
|
}
|
|
|
|
// No element argument, shuffle and use this.element
|
|
if (!handlers) {
|
|
handlers = element;
|
|
element = this.element;
|
|
delegateElement = this.widget();
|
|
} else {
|
|
element = delegateElement = $(element);
|
|
this.bindings = this.bindings.add(element);
|
|
}
|
|
|
|
$.each(handlers, function (event, handler) {
|
|
function handlerProxy() {
|
|
// Allow widgets to customize the disabled handling
|
|
// - disabled as an array instead of boolean
|
|
// - disabled class as method for disabling individual parts
|
|
if (!suppressDisabledCheck &&
|
|
(instance.options.disabled === true ||
|
|
$(this).hasClass("ui-state-disabled"))) {
|
|
return;
|
|
}
|
|
return (typeof handler === "string" ? instance[handler] : handler)
|
|
.apply(instance, arguments);
|
|
}
|
|
|
|
// Copy the guid so direct unbinding works
|
|
if (typeof handler !== "string") {
|
|
handlerProxy.guid = handler.guid =
|
|
handler.guid || handlerProxy.guid || $.guid++;
|
|
}
|
|
|
|
var match = event.match(/^([\w:-]*)\s*(.*)$/);
|
|
var eventName = match[1] + instance.eventNamespace;
|
|
var selector = match[2];
|
|
|
|
if (selector) {
|
|
delegateElement.on(eventName, selector, handlerProxy);
|
|
} else {
|
|
element.on(eventName, handlerProxy);
|
|
}
|
|
});
|
|
},
|
|
|
|
_off: function (element, eventName) {
|
|
eventName = (eventName || "").split(" ").join(this.eventNamespace + " ") +
|
|
this.eventNamespace;
|
|
element.off(eventName).off(eventName);
|
|
|
|
// Clear the stack to avoid memory leaks (#10056)
|
|
this.bindings = $(this.bindings.not(element).get());
|
|
this.focusable = $(this.focusable.not(element).get());
|
|
this.hoverable = $(this.hoverable.not(element).get());
|
|
},
|
|
|
|
_delay: function (handler, delay) {
|
|
function handlerProxy() {
|
|
return (typeof handler === "string" ? instance[handler] : handler)
|
|
.apply(instance, arguments);
|
|
}
|
|
var instance = this;
|
|
return setTimeout(handlerProxy, delay || 0);
|
|
},
|
|
|
|
_hoverable: function (element) {
|
|
this.hoverable = this.hoverable.add(element);
|
|
this._on(element, {
|
|
mouseenter: function (event) {
|
|
this._addClass($(event.currentTarget), null, "ui-state-hover");
|
|
},
|
|
mouseleave: function (event) {
|
|
this._removeClass($(event.currentTarget), null, "ui-state-hover");
|
|
}
|
|
});
|
|
},
|
|
|
|
_focusable: function (element) {
|
|
this.focusable = this.focusable.add(element);
|
|
this._on(element, {
|
|
focusin: function (event) {
|
|
this._addClass($(event.currentTarget), null, "ui-state-focus");
|
|
},
|
|
focusout: function (event) {
|
|
this._removeClass($(event.currentTarget), null, "ui-state-focus");
|
|
}
|
|
});
|
|
},
|
|
|
|
_trigger: function (type, event, data) {
|
|
var prop, orig;
|
|
var callback = this.options[type];
|
|
|
|
data = data || {};
|
|
event = $.Event(event);
|
|
event.type = (type === this.widgetEventPrefix ?
|
|
type :
|
|
this.widgetEventPrefix + type).toLowerCase();
|
|
|
|
// The original event may come from any element
|
|
// so we need to reset the target on the new event
|
|
event.target = this.element[0];
|
|
|
|
// Copy original event properties over to the new event
|
|
orig = event.originalEvent;
|
|
if (orig) {
|
|
for (prop in orig) {
|
|
if (!(prop in event)) {
|
|
event[prop] = orig[prop];
|
|
}
|
|
}
|
|
}
|
|
|
|
this.element.trigger(event, data);
|
|
return !($.isFunction(callback) &&
|
|
callback.apply(this.element[0], [event].concat(data)) === false ||
|
|
event.isDefaultPrevented());
|
|
}
|
|
};
|
|
|
|
$.each({ show: "fadeIn", hide: "fadeOut" }, function (method, defaultEffect) {
|
|
$.Widget.prototype["_" + method] = function (element, options, callback) {
|
|
if (typeof options === "string") {
|
|
options = { effect: options };
|
|
}
|
|
|
|
var hasOptions;
|
|
var effectName = !options ?
|
|
method :
|
|
options === true || typeof options === "number" ?
|
|
defaultEffect :
|
|
options.effect || defaultEffect;
|
|
|
|
options = options || {};
|
|
if (typeof options === "number") {
|
|
options = { duration: options };
|
|
}
|
|
|
|
hasOptions = !$.isEmptyObject(options);
|
|
options.complete = callback;
|
|
|
|
if (options.delay) {
|
|
element.delay(options.delay);
|
|
}
|
|
|
|
if (hasOptions && $.effects && $.effects.effect[effectName]) {
|
|
element[method](options);
|
|
} else if (effectName !== method && element[effectName]) {
|
|
element[effectName](options.duration, options.easing, callback);
|
|
} else {
|
|
element.queue(function (next) {
|
|
$(this)[method]();
|
|
if (callback) {
|
|
callback.call(element[0]);
|
|
}
|
|
next();
|
|
});
|
|
}
|
|
};
|
|
});
|
|
|
|
var widget = $.widget;
|
|
|
|
/*!
|
|
* jQuery UI Position 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*
|
|
* http://api.jqueryui.com/position/
|
|
*/
|
|
|
|
//>>label: Position
|
|
//>>group: Core
|
|
//>>description: Positions elements relative to other elements.
|
|
//>>docs: http://api.jqueryui.com/position/
|
|
//>>demos: http://jqueryui.com/position/
|
|
|
|
(function () {
|
|
var cachedScrollbarWidth,
|
|
max = Math.max,
|
|
abs = Math.abs,
|
|
rhorizontal = /left|center|right/,
|
|
rvertical = /top|center|bottom/,
|
|
roffset = /[\+\-]\d+(\.[\d]+)?%?/,
|
|
rposition = /^\w+/,
|
|
rpercent = /%$/,
|
|
_position = $.fn.position;
|
|
|
|
function getOffsets(offsets, width, height) {
|
|
return [
|
|
parseFloat(offsets[0]) * (rpercent.test(offsets[0]) ? width / 100 : 1),
|
|
parseFloat(offsets[1]) * (rpercent.test(offsets[1]) ? height / 100 : 1)
|
|
];
|
|
}
|
|
|
|
function parseCss(element, property) {
|
|
return parseInt($.css(element, property), 10) || 0;
|
|
}
|
|
|
|
function getDimensions(elem) {
|
|
var raw = elem[0];
|
|
if (raw.nodeType === 9) {
|
|
return {
|
|
width: elem.width(),
|
|
height: elem.height(),
|
|
offset: { top: 0, left: 0 }
|
|
};
|
|
}
|
|
if ($.isWindow(raw)) {
|
|
return {
|
|
width: elem.width(),
|
|
height: elem.height(),
|
|
offset: { top: elem.scrollTop(), left: elem.scrollLeft() }
|
|
};
|
|
}
|
|
if (raw.preventDefault) {
|
|
return {
|
|
width: 0,
|
|
height: 0,
|
|
offset: { top: raw.pageY, left: raw.pageX }
|
|
};
|
|
}
|
|
return {
|
|
width: elem.outerWidth(),
|
|
height: elem.outerHeight(),
|
|
offset: elem.offset()
|
|
};
|
|
}
|
|
|
|
$.position = {
|
|
scrollbarWidth: function () {
|
|
if (cachedScrollbarWidth !== undefined) {
|
|
return cachedScrollbarWidth;
|
|
}
|
|
var w1, w2,
|
|
div = $("<div " +
|
|
"style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'>" +
|
|
"<div style='height:100px;width:auto;'></div></div>"),
|
|
innerDiv = div.children()[0];
|
|
|
|
$("body").append(div);
|
|
w1 = innerDiv.offsetWidth;
|
|
div.css("overflow", "scroll");
|
|
|
|
w2 = innerDiv.offsetWidth;
|
|
|
|
if (w1 === w2) {
|
|
w2 = div[0].clientWidth;
|
|
}
|
|
|
|
div.remove();
|
|
|
|
return (cachedScrollbarWidth = w1 - w2);
|
|
},
|
|
getScrollInfo: function (within) {
|
|
var overflowX = within.isWindow || within.isDocument ? "" :
|
|
within.element.css("overflow-x"),
|
|
overflowY = within.isWindow || within.isDocument ? "" :
|
|
within.element.css("overflow-y"),
|
|
hasOverflowX = overflowX === "scroll" ||
|
|
(overflowX === "auto" && within.width < within.element[0].scrollWidth),
|
|
hasOverflowY = overflowY === "scroll" ||
|
|
(overflowY === "auto" && within.height < within.element[0].scrollHeight);
|
|
return {
|
|
width: hasOverflowY ? $.position.scrollbarWidth() : 0,
|
|
height: hasOverflowX ? $.position.scrollbarWidth() : 0
|
|
};
|
|
},
|
|
getWithinInfo: function (element) {
|
|
var withinElement = $(element || window),
|
|
isWindow = $.isWindow(withinElement[0]),
|
|
isDocument = !!withinElement[0] && withinElement[0].nodeType === 9,
|
|
hasOffset = !isWindow && !isDocument;
|
|
return {
|
|
element: withinElement,
|
|
isWindow: isWindow,
|
|
isDocument: isDocument,
|
|
offset: hasOffset ? $(element).offset() : { left: 0, top: 0 },
|
|
scrollLeft: withinElement.scrollLeft(),
|
|
scrollTop: withinElement.scrollTop(),
|
|
width: withinElement.outerWidth(),
|
|
height: withinElement.outerHeight()
|
|
};
|
|
}
|
|
};
|
|
|
|
$.fn.position = function (options) {
|
|
if (!options || !options.of) {
|
|
return _position.apply(this, arguments);
|
|
}
|
|
|
|
// Make a copy, we don't want to modify arguments
|
|
options = $.extend({}, options);
|
|
|
|
var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
|
|
target = $(options.of),
|
|
within = $.position.getWithinInfo(options.within),
|
|
scrollInfo = $.position.getScrollInfo(within),
|
|
collision = (options.collision || "flip").split(" "),
|
|
offsets = {};
|
|
|
|
dimensions = getDimensions(target);
|
|
if (target[0].preventDefault) {
|
|
// Force left top to allow flipping
|
|
options.at = "left top";
|
|
}
|
|
targetWidth = dimensions.width;
|
|
targetHeight = dimensions.height;
|
|
targetOffset = dimensions.offset;
|
|
|
|
// Clone to reuse original targetOffset later
|
|
basePosition = $.extend({}, targetOffset);
|
|
|
|
// Force my and at to have valid horizontal and vertical positions
|
|
// if a value is missing or invalid, it will be converted to center
|
|
$.each(["my", "at"], function () {
|
|
var pos = (options[this] || "").split(" "),
|
|
horizontalOffset,
|
|
verticalOffset;
|
|
|
|
if (pos.length === 1) {
|
|
pos = rhorizontal.test(pos[0]) ?
|
|
pos.concat(["center"]) :
|
|
rvertical.test(pos[0]) ?
|
|
["center"].concat(pos) :
|
|
["center", "center"];
|
|
}
|
|
pos[0] = rhorizontal.test(pos[0]) ? pos[0] : "center";
|
|
pos[1] = rvertical.test(pos[1]) ? pos[1] : "center";
|
|
|
|
// Calculate offsets
|
|
horizontalOffset = roffset.exec(pos[0]);
|
|
verticalOffset = roffset.exec(pos[1]);
|
|
offsets[this] = [
|
|
horizontalOffset ? horizontalOffset[0] : 0,
|
|
verticalOffset ? verticalOffset[0] : 0
|
|
];
|
|
|
|
// Reduce to just the positions without the offsets
|
|
options[this] = [
|
|
rposition.exec(pos[0])[0],
|
|
rposition.exec(pos[1])[0]
|
|
];
|
|
});
|
|
|
|
// Normalize collision option
|
|
if (collision.length === 1) {
|
|
collision[1] = collision[0];
|
|
}
|
|
|
|
if (options.at[0] === "right") {
|
|
basePosition.left += targetWidth;
|
|
} else if (options.at[0] === "center") {
|
|
basePosition.left += targetWidth / 2;
|
|
}
|
|
|
|
if (options.at[1] === "bottom") {
|
|
basePosition.top += targetHeight;
|
|
} else if (options.at[1] === "center") {
|
|
basePosition.top += targetHeight / 2;
|
|
}
|
|
|
|
atOffset = getOffsets(offsets.at, targetWidth, targetHeight);
|
|
basePosition.left += atOffset[0];
|
|
basePosition.top += atOffset[1];
|
|
|
|
return this.each(function () {
|
|
var collisionPosition, using,
|
|
elem = $(this),
|
|
elemWidth = elem.outerWidth(),
|
|
elemHeight = elem.outerHeight(),
|
|
marginLeft = parseCss(this, "marginLeft"),
|
|
marginTop = parseCss(this, "marginTop"),
|
|
collisionWidth = elemWidth + marginLeft + parseCss(this, "marginRight") +
|
|
scrollInfo.width,
|
|
collisionHeight = elemHeight + marginTop + parseCss(this, "marginBottom") +
|
|
scrollInfo.height,
|
|
position = $.extend({}, basePosition),
|
|
myOffset = getOffsets(offsets.my, elem.outerWidth(), elem.outerHeight());
|
|
|
|
if (options.my[0] === "right") {
|
|
position.left -= elemWidth;
|
|
} else if (options.my[0] === "center") {
|
|
position.left -= elemWidth / 2;
|
|
}
|
|
|
|
if (options.my[1] === "bottom") {
|
|
position.top -= elemHeight;
|
|
} else if (options.my[1] === "center") {
|
|
position.top -= elemHeight / 2;
|
|
}
|
|
|
|
position.left += myOffset[0];
|
|
position.top += myOffset[1];
|
|
|
|
collisionPosition = {
|
|
marginLeft: marginLeft,
|
|
marginTop: marginTop
|
|
};
|
|
|
|
$.each(["left", "top"], function (i, dir) {
|
|
if ($.ui.position[collision[i]]) {
|
|
$.ui.position[collision[i]][dir](position, {
|
|
targetWidth: targetWidth,
|
|
targetHeight: targetHeight,
|
|
elemWidth: elemWidth,
|
|
elemHeight: elemHeight,
|
|
collisionPosition: collisionPosition,
|
|
collisionWidth: collisionWidth,
|
|
collisionHeight: collisionHeight,
|
|
offset: [atOffset[0] + myOffset[0], atOffset[1] + myOffset[1]],
|
|
my: options.my,
|
|
at: options.at,
|
|
within: within,
|
|
elem: elem
|
|
});
|
|
}
|
|
});
|
|
|
|
if (options.using) {
|
|
// Adds feedback as second argument to using callback, if present
|
|
using = function (props) {
|
|
var left = targetOffset.left - position.left,
|
|
right = left + targetWidth - elemWidth,
|
|
top = targetOffset.top - position.top,
|
|
bottom = top + targetHeight - elemHeight,
|
|
feedback = {
|
|
target: {
|
|
element: target,
|
|
left: targetOffset.left,
|
|
top: targetOffset.top,
|
|
width: targetWidth,
|
|
height: targetHeight
|
|
},
|
|
element: {
|
|
element: elem,
|
|
left: position.left,
|
|
top: position.top,
|
|
width: elemWidth,
|
|
height: elemHeight
|
|
},
|
|
horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
|
|
vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
|
|
};
|
|
if (targetWidth < elemWidth && abs(left + right) < targetWidth) {
|
|
feedback.horizontal = "center";
|
|
}
|
|
if (targetHeight < elemHeight && abs(top + bottom) < targetHeight) {
|
|
feedback.vertical = "middle";
|
|
}
|
|
if (max(abs(left), abs(right)) > max(abs(top), abs(bottom))) {
|
|
feedback.important = "horizontal";
|
|
} else {
|
|
feedback.important = "vertical";
|
|
}
|
|
options.using.call(this, props, feedback);
|
|
};
|
|
}
|
|
|
|
elem.offset($.extend(position, { using: using }));
|
|
});
|
|
};
|
|
|
|
$.ui.position = {
|
|
fit: {
|
|
left: function (position, data) {
|
|
var within = data.within,
|
|
withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
|
|
outerWidth = within.width,
|
|
collisionPosLeft = position.left - data.collisionPosition.marginLeft,
|
|
overLeft = withinOffset - collisionPosLeft,
|
|
overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
|
|
newOverRight;
|
|
|
|
// Element is wider than within
|
|
if (data.collisionWidth > outerWidth) {
|
|
// Element is initially over the left side of within
|
|
if (overLeft > 0 && overRight <= 0) {
|
|
newOverRight = position.left + overLeft + data.collisionWidth - outerWidth -
|
|
withinOffset;
|
|
position.left += overLeft - newOverRight;
|
|
|
|
// Element is initially over right side of within
|
|
} else if (overRight > 0 && overLeft <= 0) {
|
|
position.left = withinOffset;
|
|
|
|
// Element is initially over both left and right sides of within
|
|
} else {
|
|
if (overLeft > overRight) {
|
|
position.left = withinOffset + outerWidth - data.collisionWidth;
|
|
} else {
|
|
position.left = withinOffset;
|
|
}
|
|
}
|
|
|
|
// Too far left -> align with left edge
|
|
} else if (overLeft > 0) {
|
|
position.left += overLeft;
|
|
|
|
// Too far right -> align with right edge
|
|
} else if (overRight > 0) {
|
|
position.left -= overRight;
|
|
|
|
// Adjust based on position and margin
|
|
} else {
|
|
position.left = max(position.left - collisionPosLeft, position.left);
|
|
}
|
|
},
|
|
top: function (position, data) {
|
|
var within = data.within,
|
|
withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
|
|
outerHeight = data.within.height,
|
|
collisionPosTop = position.top - data.collisionPosition.marginTop,
|
|
overTop = withinOffset - collisionPosTop,
|
|
overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
|
|
newOverBottom;
|
|
|
|
// Element is taller than within
|
|
if (data.collisionHeight > outerHeight) {
|
|
// Element is initially over the top of within
|
|
if (overTop > 0 && overBottom <= 0) {
|
|
newOverBottom = position.top + overTop + data.collisionHeight - outerHeight -
|
|
withinOffset;
|
|
position.top += overTop - newOverBottom;
|
|
|
|
// Element is initially over bottom of within
|
|
} else if (overBottom > 0 && overTop <= 0) {
|
|
position.top = withinOffset;
|
|
|
|
// Element is initially over both top and bottom of within
|
|
} else {
|
|
if (overTop > overBottom) {
|
|
position.top = withinOffset + outerHeight - data.collisionHeight;
|
|
} else {
|
|
position.top = withinOffset;
|
|
}
|
|
}
|
|
|
|
// Too far up -> align with top
|
|
} else if (overTop > 0) {
|
|
position.top += overTop;
|
|
|
|
// Too far down -> align with bottom edge
|
|
} else if (overBottom > 0) {
|
|
position.top -= overBottom;
|
|
|
|
// Adjust based on position and margin
|
|
} else {
|
|
position.top = max(position.top - collisionPosTop, position.top);
|
|
}
|
|
}
|
|
},
|
|
flip: {
|
|
left: function (position, data) {
|
|
var within = data.within,
|
|
withinOffset = within.offset.left + within.scrollLeft,
|
|
outerWidth = within.width,
|
|
offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
|
|
collisionPosLeft = position.left - data.collisionPosition.marginLeft,
|
|
overLeft = collisionPosLeft - offsetLeft,
|
|
overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
|
|
myOffset = data.my[0] === "left" ?
|
|
-data.elemWidth :
|
|
data.my[0] === "right" ?
|
|
data.elemWidth :
|
|
0,
|
|
atOffset = data.at[0] === "left" ?
|
|
data.targetWidth :
|
|
data.at[0] === "right" ?
|
|
-data.targetWidth :
|
|
0,
|
|
offset = -2 * data.offset[0],
|
|
newOverRight,
|
|
newOverLeft;
|
|
|
|
if (overLeft < 0) {
|
|
newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth -
|
|
outerWidth - withinOffset;
|
|
if (newOverRight < 0 || newOverRight < abs(overLeft)) {
|
|
position.left += myOffset + atOffset + offset;
|
|
}
|
|
} else if (overRight > 0) {
|
|
newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset +
|
|
atOffset + offset - offsetLeft;
|
|
if (newOverLeft > 0 || abs(newOverLeft) < overRight) {
|
|
position.left += myOffset + atOffset + offset;
|
|
}
|
|
}
|
|
},
|
|
top: function (position, data) {
|
|
var within = data.within,
|
|
withinOffset = within.offset.top + within.scrollTop,
|
|
outerHeight = within.height,
|
|
offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
|
|
collisionPosTop = position.top - data.collisionPosition.marginTop,
|
|
overTop = collisionPosTop - offsetTop,
|
|
overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
|
|
top = data.my[1] === "top",
|
|
myOffset = top ?
|
|
-data.elemHeight :
|
|
data.my[1] === "bottom" ?
|
|
data.elemHeight :
|
|
0,
|
|
atOffset = data.at[1] === "top" ?
|
|
data.targetHeight :
|
|
data.at[1] === "bottom" ?
|
|
-data.targetHeight :
|
|
0,
|
|
offset = -2 * data.offset[1],
|
|
newOverTop,
|
|
newOverBottom;
|
|
if (overTop < 0) {
|
|
newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight -
|
|
outerHeight - withinOffset;
|
|
if (newOverBottom < 0 || newOverBottom < abs(overTop)) {
|
|
position.top += myOffset + atOffset + offset;
|
|
}
|
|
} else if (overBottom > 0) {
|
|
newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset +
|
|
offset - offsetTop;
|
|
if (newOverTop > 0 || abs(newOverTop) < overBottom) {
|
|
position.top += myOffset + atOffset + offset;
|
|
}
|
|
}
|
|
}
|
|
},
|
|
flipfit: {
|
|
left: function () {
|
|
$.ui.position.flip.left.apply(this, arguments);
|
|
$.ui.position.fit.left.apply(this, arguments);
|
|
},
|
|
top: function () {
|
|
$.ui.position.flip.top.apply(this, arguments);
|
|
$.ui.position.fit.top.apply(this, arguments);
|
|
}
|
|
}
|
|
};
|
|
})();
|
|
|
|
var position = $.ui.position;
|
|
|
|
/*!
|
|
* jQuery UI :data 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: :data Selector
|
|
//>>group: Core
|
|
//>>description: Selects elements which have data stored under the specified key.
|
|
//>>docs: http://api.jqueryui.com/data-selector/
|
|
|
|
var data = $.extend($.expr[":"], {
|
|
data: $.expr.createPseudo ?
|
|
$.expr.createPseudo(function (dataName) {
|
|
return function (elem) {
|
|
return !!$.data(elem, dataName);
|
|
};
|
|
}) :
|
|
|
|
// Support: jQuery <1.8
|
|
function (elem, i, match) {
|
|
return !!$.data(elem, match[3]);
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Disable Selection 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: disableSelection
|
|
//>>group: Core
|
|
//>>description: Disable selection of text content within the set of matched elements.
|
|
//>>docs: http://api.jqueryui.com/disableSelection/
|
|
|
|
// This file is deprecated
|
|
|
|
var disableSelection = $.fn.extend({
|
|
disableSelection: (function () {
|
|
var eventType = "onselectstart" in document.createElement("div") ?
|
|
"selectstart" :
|
|
"mousedown";
|
|
|
|
return function () {
|
|
return this.on(eventType + ".ui-disableSelection", function (event) {
|
|
event.preventDefault();
|
|
});
|
|
};
|
|
})(),
|
|
|
|
enableSelection: function () {
|
|
return this.off(".ui-disableSelection");
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Effects Core
|
|
//>>group: Effects
|
|
// jscs:disable maximumLineLength
|
|
//>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects.
|
|
// jscs:enable maximumLineLength
|
|
//>>docs: http://api.jqueryui.com/category/effects-core/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var dataSpace = "ui-effects-",
|
|
dataSpaceStyle = "ui-effects-style",
|
|
dataSpaceAnimated = "ui-effects-animated",
|
|
|
|
// Create a local jQuery because jQuery Color relies on it and the
|
|
// global may not exist with AMD and a custom build (#10199)
|
|
jQuery = $;
|
|
|
|
$.effects = {
|
|
effect: {}
|
|
};
|
|
|
|
/*!
|
|
* jQuery Color Animations v2.1.2
|
|
* https://github.com/jquery/jquery-color
|
|
*
|
|
* Copyright 2014 jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*
|
|
* Date: Wed Jan 16 08:47:09 2013 -0600
|
|
*/
|
|
(function (jQuery, undefined) {
|
|
var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor " +
|
|
"borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
|
|
|
|
// Plusequals test for += 100 -= 100
|
|
rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
|
|
|
|
// A set of RE's that can match strings and generate color tuples.
|
|
stringParsers = [{
|
|
re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
|
|
parse: function (execResult) {
|
|
return [
|
|
execResult[1],
|
|
execResult[2],
|
|
execResult[3],
|
|
execResult[4]
|
|
];
|
|
}
|
|
}, {
|
|
re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
|
|
parse: function (execResult) {
|
|
return [
|
|
execResult[1] * 2.55,
|
|
execResult[2] * 2.55,
|
|
execResult[3] * 2.55,
|
|
execResult[4]
|
|
];
|
|
}
|
|
}, {
|
|
// This regex ignores A-F because it's compared against an already lowercased string
|
|
re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
|
|
parse: function (execResult) {
|
|
return [
|
|
parseInt(execResult[1], 16),
|
|
parseInt(execResult[2], 16),
|
|
parseInt(execResult[3], 16)
|
|
];
|
|
}
|
|
}, {
|
|
// This regex ignores A-F because it's compared against an already lowercased string
|
|
re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
|
|
parse: function (execResult) {
|
|
return [
|
|
parseInt(execResult[1] + execResult[1], 16),
|
|
parseInt(execResult[2] + execResult[2], 16),
|
|
parseInt(execResult[3] + execResult[3], 16)
|
|
];
|
|
}
|
|
}, {
|
|
re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
|
|
space: "hsla",
|
|
parse: function (execResult) {
|
|
return [
|
|
execResult[1],
|
|
execResult[2] / 100,
|
|
execResult[3] / 100,
|
|
execResult[4]
|
|
];
|
|
}
|
|
}],
|
|
|
|
// JQuery.Color( )
|
|
color = jQuery.Color = function (color, green, blue, alpha) {
|
|
return new jQuery.Color.fn.parse(color, green, blue, alpha);
|
|
},
|
|
spaces = {
|
|
rgba: {
|
|
props: {
|
|
red: {
|
|
idx: 0,
|
|
type: "byte"
|
|
},
|
|
green: {
|
|
idx: 1,
|
|
type: "byte"
|
|
},
|
|
blue: {
|
|
idx: 2,
|
|
type: "byte"
|
|
}
|
|
}
|
|
},
|
|
|
|
hsla: {
|
|
props: {
|
|
hue: {
|
|
idx: 0,
|
|
type: "degrees"
|
|
},
|
|
saturation: {
|
|
idx: 1,
|
|
type: "percent"
|
|
},
|
|
lightness: {
|
|
idx: 2,
|
|
type: "percent"
|
|
}
|
|
}
|
|
}
|
|
},
|
|
propTypes = {
|
|
"byte": {
|
|
floor: true,
|
|
max: 255
|
|
},
|
|
"percent": {
|
|
max: 1
|
|
},
|
|
"degrees": {
|
|
mod: 360,
|
|
floor: true
|
|
}
|
|
},
|
|
support = color.support = {},
|
|
|
|
// Element for support tests
|
|
supportElem = jQuery("<p>")[0],
|
|
|
|
// Colors = jQuery.Color.names
|
|
colors,
|
|
|
|
// Local aliases of functions called often
|
|
each = jQuery.each;
|
|
|
|
// Determine rgba support immediately
|
|
supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
|
|
support.rgba = supportElem.style.backgroundColor.indexOf("rgba") > -1;
|
|
|
|
// Define cache name and alpha properties
|
|
// for rgba and hsla spaces
|
|
each(spaces, function (spaceName, space) {
|
|
space.cache = "_" + spaceName;
|
|
space.props.alpha = {
|
|
idx: 3,
|
|
type: "percent",
|
|
def: 1
|
|
};
|
|
});
|
|
|
|
function clamp(value, prop, allowEmpty) {
|
|
var type = propTypes[prop.type] || {};
|
|
|
|
if (value == null) {
|
|
return (allowEmpty || !prop.def) ? null : prop.def;
|
|
}
|
|
|
|
// ~~ is an short way of doing floor for positive numbers
|
|
value = type.floor ? ~~value : parseFloat(value);
|
|
|
|
// IE will pass in empty strings as value for alpha,
|
|
// which will hit this case
|
|
if (isNaN(value)) {
|
|
return prop.def;
|
|
}
|
|
|
|
if (type.mod) {
|
|
// We add mod before modding to make sure that negatives values
|
|
// get converted properly: -10 -> 350
|
|
return (value + type.mod) % type.mod;
|
|
}
|
|
|
|
// For now all property types without mod have min and max
|
|
return 0 > value ? 0 : type.max < value ? type.max : value;
|
|
}
|
|
|
|
function stringParse(string) {
|
|
var inst = color(),
|
|
rgba = inst._rgba = [];
|
|
|
|
string = string.toLowerCase();
|
|
|
|
each(stringParsers, function (i, parser) {
|
|
var parsed,
|
|
match = parser.re.exec(string),
|
|
values = match && parser.parse(match),
|
|
spaceName = parser.space || "rgba";
|
|
|
|
if (values) {
|
|
parsed = inst[spaceName](values);
|
|
|
|
// If this was an rgba parse the assignment might happen twice
|
|
// oh well....
|
|
inst[spaces[spaceName].cache] = parsed[spaces[spaceName].cache];
|
|
rgba = inst._rgba = parsed._rgba;
|
|
|
|
// Exit each( stringParsers ) here because we matched
|
|
return false;
|
|
}
|
|
});
|
|
|
|
// Found a stringParser that handled it
|
|
if (rgba.length) {
|
|
// If this came from a parsed string, force "transparent" when alpha is 0
|
|
// chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
|
|
if (rgba.join() === "0,0,0,0") {
|
|
jQuery.extend(rgba, colors.transparent);
|
|
}
|
|
return inst;
|
|
}
|
|
|
|
// Named colors
|
|
return colors[string];
|
|
}
|
|
|
|
color.fn = jQuery.extend(color.prototype, {
|
|
parse: function (red, green, blue, alpha) {
|
|
if (red === undefined) {
|
|
this._rgba = [null, null, null, null];
|
|
return this;
|
|
}
|
|
if (red.jquery || red.nodeType) {
|
|
red = jQuery(red).css(green);
|
|
green = undefined;
|
|
}
|
|
|
|
var inst = this,
|
|
type = jQuery.type(red),
|
|
rgba = this._rgba = [];
|
|
|
|
// More than 1 argument specified - assume ( red, green, blue, alpha )
|
|
if (green !== undefined) {
|
|
red = [red, green, blue, alpha];
|
|
type = "array";
|
|
}
|
|
|
|
if (type === "string") {
|
|
return this.parse(stringParse(red) || colors._default);
|
|
}
|
|
|
|
if (type === "array") {
|
|
each(spaces.rgba.props, function (key, prop) {
|
|
rgba[prop.idx] = clamp(red[prop.idx], prop);
|
|
});
|
|
return this;
|
|
}
|
|
|
|
if (type === "object") {
|
|
if (red instanceof color) {
|
|
each(spaces, function (spaceName, space) {
|
|
if (red[space.cache]) {
|
|
inst[space.cache] = red[space.cache].slice();
|
|
}
|
|
});
|
|
} else {
|
|
each(spaces, function (spaceName, space) {
|
|
var cache = space.cache;
|
|
each(space.props, function (key, prop) {
|
|
// If the cache doesn't exist, and we know how to convert
|
|
if (!inst[cache] && space.to) {
|
|
// If the value was null, we don't need to copy it
|
|
// if the key was alpha, we don't need to copy it either
|
|
if (key === "alpha" || red[key] == null) {
|
|
return;
|
|
}
|
|
inst[cache] = space.to(inst._rgba);
|
|
}
|
|
|
|
// This is the only case where we allow nulls for ALL properties.
|
|
// call clamp with alwaysAllowEmpty
|
|
inst[cache][prop.idx] = clamp(red[key], prop, true);
|
|
});
|
|
|
|
// Everything defined but alpha?
|
|
if (inst[cache] &&
|
|
jQuery.inArray(null, inst[cache].slice(0, 3)) < 0) {
|
|
// Use the default of 1
|
|
inst[cache][3] = 1;
|
|
if (space.from) {
|
|
inst._rgba = space.from(inst[cache]);
|
|
}
|
|
}
|
|
});
|
|
}
|
|
return this;
|
|
}
|
|
},
|
|
is: function (compare) {
|
|
var is = color(compare),
|
|
same = true,
|
|
inst = this;
|
|
|
|
each(spaces, function (_, space) {
|
|
var localCache,
|
|
isCache = is[space.cache];
|
|
if (isCache) {
|
|
localCache = inst[space.cache] || space.to && space.to(inst._rgba) || [];
|
|
each(space.props, function (_, prop) {
|
|
if (isCache[prop.idx] != null) {
|
|
same = (isCache[prop.idx] === localCache[prop.idx]);
|
|
return same;
|
|
}
|
|
});
|
|
}
|
|
return same;
|
|
});
|
|
return same;
|
|
},
|
|
_space: function () {
|
|
var used = [],
|
|
inst = this;
|
|
each(spaces, function (spaceName, space) {
|
|
if (inst[space.cache]) {
|
|
used.push(spaceName);
|
|
}
|
|
});
|
|
return used.pop();
|
|
},
|
|
transition: function (other, distance) {
|
|
var end = color(other),
|
|
spaceName = end._space(),
|
|
space = spaces[spaceName],
|
|
startColor = this.alpha() === 0 ? color("transparent") : this,
|
|
start = startColor[space.cache] || space.to(startColor._rgba),
|
|
result = start.slice();
|
|
|
|
end = end[space.cache];
|
|
each(space.props, function (key, prop) {
|
|
var index = prop.idx,
|
|
startValue = start[index],
|
|
endValue = end[index],
|
|
type = propTypes[prop.type] || {};
|
|
|
|
// If null, don't override start value
|
|
if (endValue === null) {
|
|
return;
|
|
}
|
|
|
|
// If null - use end
|
|
if (startValue === null) {
|
|
result[index] = endValue;
|
|
} else {
|
|
if (type.mod) {
|
|
if (endValue - startValue > type.mod / 2) {
|
|
startValue += type.mod;
|
|
} else if (startValue - endValue > type.mod / 2) {
|
|
startValue -= type.mod;
|
|
}
|
|
}
|
|
result[index] = clamp((endValue - startValue) * distance + startValue, prop);
|
|
}
|
|
});
|
|
return this[spaceName](result);
|
|
},
|
|
blend: function (opaque) {
|
|
// If we are already opaque - return ourself
|
|
if (this._rgba[3] === 1) {
|
|
return this;
|
|
}
|
|
|
|
var rgb = this._rgba.slice(),
|
|
a = rgb.pop(),
|
|
blend = color(opaque)._rgba;
|
|
|
|
return color(jQuery.map(rgb, function (v, i) {
|
|
return (1 - a) * blend[i] + a * v;
|
|
}));
|
|
},
|
|
toRgbaString: function () {
|
|
var prefix = "rgba(",
|
|
rgba = jQuery.map(this._rgba, function (v, i) {
|
|
return v == null ? (i > 2 ? 1 : 0) : v;
|
|
});
|
|
|
|
if (rgba[3] === 1) {
|
|
rgba.pop();
|
|
prefix = "rgb(";
|
|
}
|
|
|
|
return prefix + rgba.join() + ")";
|
|
},
|
|
toHslaString: function () {
|
|
var prefix = "hsla(",
|
|
hsla = jQuery.map(this.hsla(), function (v, i) {
|
|
if (v == null) {
|
|
v = i > 2 ? 1 : 0;
|
|
}
|
|
|
|
// Catch 1 and 2
|
|
if (i && i < 3) {
|
|
v = Math.round(v * 100) + "%";
|
|
}
|
|
return v;
|
|
});
|
|
|
|
if (hsla[3] === 1) {
|
|
hsla.pop();
|
|
prefix = "hsl(";
|
|
}
|
|
return prefix + hsla.join() + ")";
|
|
},
|
|
toHexString: function (includeAlpha) {
|
|
var rgba = this._rgba.slice(),
|
|
alpha = rgba.pop();
|
|
|
|
if (includeAlpha) {
|
|
rgba.push(~~(alpha * 255));
|
|
}
|
|
|
|
return "#" + jQuery.map(rgba, function (v) {
|
|
// Default to 0 when nulls exist
|
|
v = (v || 0).toString(16);
|
|
return v.length === 1 ? "0" + v : v;
|
|
}).join("");
|
|
},
|
|
toString: function () {
|
|
return this._rgba[3] === 0 ? "transparent" : this.toRgbaString();
|
|
}
|
|
});
|
|
color.fn.parse.prototype = color.fn;
|
|
|
|
// Hsla conversions adapted from:
|
|
// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
|
|
|
|
function hue2rgb(p, q, h) {
|
|
h = (h + 1) % 1;
|
|
if (h * 6 < 1) {
|
|
return p + (q - p) * h * 6;
|
|
}
|
|
if (h * 2 < 1) {
|
|
return q;
|
|
}
|
|
if (h * 3 < 2) {
|
|
return p + (q - p) * ((2 / 3) - h) * 6;
|
|
}
|
|
return p;
|
|
}
|
|
|
|
spaces.hsla.to = function (rgba) {
|
|
if (rgba[0] == null || rgba[1] == null || rgba[2] == null) {
|
|
return [null, null, null, rgba[3]];
|
|
}
|
|
var r = rgba[0] / 255,
|
|
g = rgba[1] / 255,
|
|
b = rgba[2] / 255,
|
|
a = rgba[3],
|
|
max = Math.max(r, g, b),
|
|
min = Math.min(r, g, b),
|
|
diff = max - min,
|
|
add = max + min,
|
|
l = add * 0.5,
|
|
h, s;
|
|
|
|
if (min === max) {
|
|
h = 0;
|
|
} else if (r === max) {
|
|
h = (60 * (g - b) / diff) + 360;
|
|
} else if (g === max) {
|
|
h = (60 * (b - r) / diff) + 120;
|
|
} else {
|
|
h = (60 * (r - g) / diff) + 240;
|
|
}
|
|
|
|
// Chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
|
|
// otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
|
|
if (diff === 0) {
|
|
s = 0;
|
|
} else if (l <= 0.5) {
|
|
s = diff / add;
|
|
} else {
|
|
s = diff / (2 - add);
|
|
}
|
|
return [Math.round(h) % 360, s, l, a == null ? 1 : a];
|
|
};
|
|
|
|
spaces.hsla.from = function (hsla) {
|
|
if (hsla[0] == null || hsla[1] == null || hsla[2] == null) {
|
|
return [null, null, null, hsla[3]];
|
|
}
|
|
var h = hsla[0] / 360,
|
|
s = hsla[1],
|
|
l = hsla[2],
|
|
a = hsla[3],
|
|
q = l <= 0.5 ? l * (1 + s) : l + s - l * s,
|
|
p = 2 * l - q;
|
|
|
|
return [
|
|
Math.round(hue2rgb(p, q, h + (1 / 3)) * 255),
|
|
Math.round(hue2rgb(p, q, h) * 255),
|
|
Math.round(hue2rgb(p, q, h - (1 / 3)) * 255),
|
|
a
|
|
];
|
|
};
|
|
|
|
each(spaces, function (spaceName, space) {
|
|
var props = space.props,
|
|
cache = space.cache,
|
|
to = space.to,
|
|
from = space.from;
|
|
|
|
// Makes rgba() and hsla()
|
|
color.fn[spaceName] = function (value) {
|
|
// Generate a cache for this space if it doesn't exist
|
|
if (to && !this[cache]) {
|
|
this[cache] = to(this._rgba);
|
|
}
|
|
if (value === undefined) {
|
|
return this[cache].slice();
|
|
}
|
|
|
|
var ret,
|
|
type = jQuery.type(value),
|
|
arr = (type === "array" || type === "object") ? value : arguments,
|
|
local = this[cache].slice();
|
|
|
|
each(props, function (key, prop) {
|
|
var val = arr[type === "object" ? key : prop.idx];
|
|
if (val == null) {
|
|
val = local[prop.idx];
|
|
}
|
|
local[prop.idx] = clamp(val, prop);
|
|
});
|
|
|
|
if (from) {
|
|
ret = color(from(local));
|
|
ret[cache] = local;
|
|
return ret;
|
|
} else {
|
|
return color(local);
|
|
}
|
|
};
|
|
|
|
// Makes red() green() blue() alpha() hue() saturation() lightness()
|
|
each(props, function (key, prop) {
|
|
// Alpha is included in more than one space
|
|
if (color.fn[key]) {
|
|
return;
|
|
}
|
|
color.fn[key] = function (value) {
|
|
var vtype = jQuery.type(value),
|
|
fn = (key === "alpha" ? (this._hsla ? "hsla" : "rgba") : spaceName),
|
|
local = this[fn](),
|
|
cur = local[prop.idx],
|
|
match;
|
|
|
|
if (vtype === "undefined") {
|
|
return cur;
|
|
}
|
|
|
|
if (vtype === "function") {
|
|
value = value.call(this, cur);
|
|
vtype = jQuery.type(value);
|
|
}
|
|
if (value == null && prop.empty) {
|
|
return this;
|
|
}
|
|
if (vtype === "string") {
|
|
match = rplusequals.exec(value);
|
|
if (match) {
|
|
value = cur + parseFloat(match[2]) * (match[1] === "+" ? 1 : -1);
|
|
}
|
|
}
|
|
local[prop.idx] = value;
|
|
return this[fn](local);
|
|
};
|
|
});
|
|
});
|
|
|
|
// Add cssHook and .fx.step function for each named hook.
|
|
// accept a space separated string of properties
|
|
color.hook = function (hook) {
|
|
var hooks = hook.split(" ");
|
|
each(hooks, function (i, hook) {
|
|
jQuery.cssHooks[hook] = {
|
|
set: function (elem, value) {
|
|
var parsed, curElem,
|
|
backgroundColor = "";
|
|
|
|
if (value !== "transparent" && (jQuery.type(value) !== "string" ||
|
|
(parsed = stringParse(value)))) {
|
|
value = color(parsed || value);
|
|
if (!support.rgba && value._rgba[3] !== 1) {
|
|
curElem = hook === "backgroundColor" ? elem.parentNode : elem;
|
|
while (
|
|
(backgroundColor === "" || backgroundColor === "transparent") &&
|
|
curElem && curElem.style
|
|
) {
|
|
try {
|
|
backgroundColor = jQuery.css(curElem, "backgroundColor");
|
|
curElem = curElem.parentNode;
|
|
} catch (e) {
|
|
}
|
|
}
|
|
|
|
value = value.blend(backgroundColor && backgroundColor !== "transparent" ?
|
|
backgroundColor :
|
|
"_default");
|
|
}
|
|
|
|
value = value.toRgbaString();
|
|
}
|
|
try {
|
|
elem.style[hook] = value;
|
|
} catch (e) {
|
|
// Wrapped to prevent IE from throwing errors on "invalid" values like
|
|
// 'auto' or 'inherit'
|
|
}
|
|
}
|
|
};
|
|
jQuery.fx.step[hook] = function (fx) {
|
|
if (!fx.colorInit) {
|
|
fx.start = color(fx.elem, hook);
|
|
fx.end = color(fx.end);
|
|
fx.colorInit = true;
|
|
}
|
|
jQuery.cssHooks[hook].set(fx.elem, fx.start.transition(fx.end, fx.pos));
|
|
};
|
|
});
|
|
};
|
|
|
|
color.hook(stepHooks);
|
|
|
|
jQuery.cssHooks.borderColor = {
|
|
expand: function (value) {
|
|
var expanded = {};
|
|
|
|
each(["Top", "Right", "Bottom", "Left"], function (i, part) {
|
|
expanded["border" + part + "Color"] = value;
|
|
});
|
|
return expanded;
|
|
}
|
|
};
|
|
|
|
// Basic color names only.
|
|
// Usage of any of the other color names requires adding yourself or including
|
|
// jquery.color.svg-names.js.
|
|
colors = jQuery.Color.names = {
|
|
// 4.1. Basic color keywords
|
|
aqua: "#00ffff",
|
|
black: "#000000",
|
|
blue: "#0000ff",
|
|
fuchsia: "#ff00ff",
|
|
gray: "#808080",
|
|
green: "#008000",
|
|
lime: "#00ff00",
|
|
maroon: "#800000",
|
|
navy: "#000080",
|
|
olive: "#808000",
|
|
purple: "#800080",
|
|
red: "#ff0000",
|
|
silver: "#c0c0c0",
|
|
teal: "#008080",
|
|
white: "#ffffff",
|
|
yellow: "#ffff00",
|
|
|
|
// 4.2.3. "transparent" color keyword
|
|
transparent: [null, null, null, 0],
|
|
|
|
_default: "#ffffff"
|
|
};
|
|
})(jQuery);
|
|
|
|
/******************************************************************************/
|
|
/****************************** CLASS ANIMATIONS ******************************/
|
|
/******************************************************************************/
|
|
(function () {
|
|
var classAnimationActions = ["add", "remove", "toggle"],
|
|
shorthandStyles = {
|
|
border: 1,
|
|
borderBottom: 1,
|
|
borderColor: 1,
|
|
borderLeft: 1,
|
|
borderRight: 1,
|
|
borderTop: 1,
|
|
borderWidth: 1,
|
|
margin: 1,
|
|
padding: 1
|
|
};
|
|
|
|
$.each(
|
|
["borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle"],
|
|
function (_, prop) {
|
|
$.fx.step[prop] = function (fx) {
|
|
if (fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr) {
|
|
jQuery.style(fx.elem, prop, fx.end);
|
|
fx.setAttr = true;
|
|
}
|
|
};
|
|
}
|
|
);
|
|
|
|
function getElementStyles(elem) {
|
|
var key, len,
|
|
style = elem.ownerDocument.defaultView ?
|
|
elem.ownerDocument.defaultView.getComputedStyle(elem, null) :
|
|
elem.currentStyle,
|
|
styles = {};
|
|
|
|
if (style && style.length && style[0] && style[style[0]]) {
|
|
len = style.length;
|
|
while (len--) {
|
|
key = style[len];
|
|
if (typeof style[key] === "string") {
|
|
styles[$.camelCase(key)] = style[key];
|
|
}
|
|
}
|
|
|
|
// Support: Opera, IE <9
|
|
} else {
|
|
for (key in style) {
|
|
if (typeof style[key] === "string") {
|
|
styles[key] = style[key];
|
|
}
|
|
}
|
|
}
|
|
|
|
return styles;
|
|
}
|
|
|
|
function styleDifference(oldStyle, newStyle) {
|
|
var diff = {},
|
|
name, value;
|
|
|
|
for (name in newStyle) {
|
|
value = newStyle[name];
|
|
if (oldStyle[name] !== value) {
|
|
if (!shorthandStyles[name]) {
|
|
if ($.fx.step[name] || !isNaN(parseFloat(value))) {
|
|
diff[name] = value;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return diff;
|
|
}
|
|
|
|
// Support: jQuery <1.8
|
|
if (!$.fn.addBack) {
|
|
$.fn.addBack = function (selector) {
|
|
return this.add(selector == null ?
|
|
this.prevObject : this.prevObject.filter(selector)
|
|
);
|
|
};
|
|
}
|
|
|
|
$.effects.animateClass = function (value, duration, easing, callback) {
|
|
var o = $.speed(duration, easing, callback);
|
|
|
|
return this.queue(function () {
|
|
var animated = $(this),
|
|
baseClass = animated.attr("class") || "",
|
|
applyClassChange,
|
|
allAnimations = o.children ? animated.find("*").addBack() : animated;
|
|
|
|
// Map the animated objects to store the original styles.
|
|
allAnimations = allAnimations.map(function () {
|
|
var el = $(this);
|
|
return {
|
|
el: el,
|
|
start: getElementStyles(this)
|
|
};
|
|
});
|
|
|
|
// Apply class change
|
|
applyClassChange = function () {
|
|
$.each(classAnimationActions, function (i, action) {
|
|
if (value[action]) {
|
|
animated[action + "Class"](value[action]);
|
|
}
|
|
});
|
|
};
|
|
applyClassChange();
|
|
|
|
// Map all animated objects again - calculate new styles and diff
|
|
allAnimations = allAnimations.map(function () {
|
|
this.end = getElementStyles(this.el[0]);
|
|
this.diff = styleDifference(this.start, this.end);
|
|
return this;
|
|
});
|
|
|
|
// Apply original class
|
|
animated.attr("class", baseClass);
|
|
|
|
// Map all animated objects again - this time collecting a promise
|
|
allAnimations = allAnimations.map(function () {
|
|
var styleInfo = this,
|
|
dfd = $.Deferred(),
|
|
opts = $.extend({}, o, {
|
|
queue: false,
|
|
complete: function () {
|
|
dfd.resolve(styleInfo);
|
|
}
|
|
});
|
|
|
|
this.el.animate(this.diff, opts);
|
|
return dfd.promise();
|
|
});
|
|
|
|
// Once all animations have completed:
|
|
$.when.apply($, allAnimations.get()).done(function () {
|
|
// Set the final class
|
|
applyClassChange();
|
|
|
|
// For each animated element,
|
|
// clear all css properties that were animated
|
|
$.each(arguments, function () {
|
|
var el = this.el;
|
|
$.each(this.diff, function (key) {
|
|
el.css(key, "");
|
|
});
|
|
});
|
|
|
|
// This is guarnteed to be there if you use jQuery.speed()
|
|
// it also handles dequeuing the next anim...
|
|
o.complete.call(animated[0]);
|
|
});
|
|
});
|
|
};
|
|
|
|
$.fn.extend({
|
|
addClass: (function (orig) {
|
|
return function (classNames, speed, easing, callback) {
|
|
return speed ?
|
|
$.effects.animateClass.call(this,
|
|
{ add: classNames }, speed, easing, callback) :
|
|
orig.apply(this, arguments);
|
|
};
|
|
})($.fn.addClass),
|
|
|
|
removeClass: (function (orig) {
|
|
return function (classNames, speed, easing, callback) {
|
|
return arguments.length > 1 ?
|
|
$.effects.animateClass.call(this,
|
|
{ remove: classNames }, speed, easing, callback) :
|
|
orig.apply(this, arguments);
|
|
};
|
|
})($.fn.removeClass),
|
|
|
|
toggleClass: (function (orig) {
|
|
return function (classNames, force, speed, easing, callback) {
|
|
if (typeof force === "boolean" || force === undefined) {
|
|
if (!speed) {
|
|
// Without speed parameter
|
|
return orig.apply(this, arguments);
|
|
} else {
|
|
return $.effects.animateClass.call(this,
|
|
(force ? { add: classNames } : { remove: classNames }),
|
|
speed, easing, callback);
|
|
}
|
|
} else {
|
|
// Without force parameter
|
|
return $.effects.animateClass.call(this,
|
|
{ toggle: classNames }, force, speed, easing);
|
|
}
|
|
};
|
|
})($.fn.toggleClass),
|
|
|
|
switchClass: function (remove, add, speed, easing, callback) {
|
|
return $.effects.animateClass.call(this, {
|
|
add: add,
|
|
remove: remove
|
|
}, speed, easing, callback);
|
|
}
|
|
});
|
|
})();
|
|
|
|
/******************************************************************************/
|
|
/*********************************** EFFECTS **********************************/
|
|
/******************************************************************************/
|
|
|
|
(function () {
|
|
if ($.expr && $.expr.filters && $.expr.filters.animated) {
|
|
$.expr.filters.animated = (function (orig) {
|
|
return function (elem) {
|
|
return !!$(elem).data(dataSpaceAnimated) || orig(elem);
|
|
};
|
|
})($.expr.filters.animated);
|
|
}
|
|
|
|
if ($.uiBackCompat !== false) {
|
|
$.extend($.effects, {
|
|
// Saves a set of properties in a data storage
|
|
save: function (element, set) {
|
|
var i = 0, length = set.length;
|
|
for (; i < length; i++) {
|
|
if (set[i] !== null) {
|
|
element.data(dataSpace + set[i], element[0].style[set[i]]);
|
|
}
|
|
}
|
|
},
|
|
|
|
// Restores a set of previously saved properties from a data storage
|
|
restore: function (element, set) {
|
|
var val, i = 0, length = set.length;
|
|
for (; i < length; i++) {
|
|
if (set[i] !== null) {
|
|
val = element.data(dataSpace + set[i]);
|
|
element.css(set[i], val);
|
|
}
|
|
}
|
|
},
|
|
|
|
setMode: function (el, mode) {
|
|
if (mode === "toggle") {
|
|
mode = el.is(":hidden") ? "show" : "hide";
|
|
}
|
|
return mode;
|
|
},
|
|
|
|
// Wraps the element around a wrapper that copies position properties
|
|
createWrapper: function (element) {
|
|
// If the element is already wrapped, return it
|
|
if (element.parent().is(".ui-effects-wrapper")) {
|
|
return element.parent();
|
|
}
|
|
|
|
// Wrap the element
|
|
var props = {
|
|
width: element.outerWidth(true),
|
|
height: element.outerHeight(true),
|
|
"float": element.css("float")
|
|
},
|
|
wrapper = $("<div></div>")
|
|
.addClass("ui-effects-wrapper")
|
|
.css({
|
|
fontSize: "100%",
|
|
background: "transparent",
|
|
border: "none",
|
|
margin: 0,
|
|
padding: 0
|
|
}),
|
|
|
|
// Store the size in case width/height are defined in % - Fixes #5245
|
|
size = {
|
|
width: element.width(),
|
|
height: element.height()
|
|
},
|
|
active = document.activeElement;
|
|
|
|
// Support: Firefox
|
|
// Firefox incorrectly exposes anonymous content
|
|
// https://bugzilla.mozilla.org/show_bug.cgi?id=561664
|
|
try {
|
|
active.id;
|
|
} catch (e) {
|
|
active = document.body;
|
|
}
|
|
|
|
element.wrap(wrapper);
|
|
|
|
// Fixes #7595 - Elements lose focus when wrapped.
|
|
if (element[0] === active || $.contains(element[0], active)) {
|
|
$(active).trigger("focus");
|
|
}
|
|
|
|
// Hotfix for jQuery 1.4 since some change in wrap() seems to actually
|
|
// lose the reference to the wrapped element
|
|
wrapper = element.parent();
|
|
|
|
// Transfer positioning properties to the wrapper
|
|
if (element.css("position") === "static") {
|
|
wrapper.css({ position: "relative" });
|
|
element.css({ position: "relative" });
|
|
} else {
|
|
$.extend(props, {
|
|
position: element.css("position"),
|
|
zIndex: element.css("z-index")
|
|
});
|
|
$.each(["top", "left", "bottom", "right"], function (i, pos) {
|
|
props[pos] = element.css(pos);
|
|
if (isNaN(parseInt(props[pos], 10))) {
|
|
props[pos] = "auto";
|
|
}
|
|
});
|
|
element.css({
|
|
position: "relative",
|
|
top: 0,
|
|
left: 0,
|
|
right: "auto",
|
|
bottom: "auto"
|
|
});
|
|
}
|
|
element.css(size);
|
|
|
|
return wrapper.css(props).show();
|
|
},
|
|
|
|
removeWrapper: function (element) {
|
|
var active = document.activeElement;
|
|
|
|
if (element.parent().is(".ui-effects-wrapper")) {
|
|
element.parent().replaceWith(element);
|
|
|
|
// Fixes #7595 - Elements lose focus when wrapped.
|
|
if (element[0] === active || $.contains(element[0], active)) {
|
|
$(active).trigger("focus");
|
|
}
|
|
}
|
|
|
|
return element;
|
|
}
|
|
});
|
|
}
|
|
|
|
$.extend($.effects, {
|
|
version: "1.12.1",
|
|
|
|
define: function (name, mode, effect) {
|
|
if (!effect) {
|
|
effect = mode;
|
|
mode = "effect";
|
|
}
|
|
|
|
$.effects.effect[name] = effect;
|
|
$.effects.effect[name].mode = mode;
|
|
|
|
return effect;
|
|
},
|
|
|
|
scaledDimensions: function (element, percent, direction) {
|
|
if (percent === 0) {
|
|
return {
|
|
height: 0,
|
|
width: 0,
|
|
outerHeight: 0,
|
|
outerWidth: 0
|
|
};
|
|
}
|
|
|
|
var x = direction !== "horizontal" ? ((percent || 100) / 100) : 1,
|
|
y = direction !== "vertical" ? ((percent || 100) / 100) : 1;
|
|
|
|
return {
|
|
height: element.height() * y,
|
|
width: element.width() * x,
|
|
outerHeight: element.outerHeight() * y,
|
|
outerWidth: element.outerWidth() * x
|
|
};
|
|
},
|
|
|
|
clipToBox: function (animation) {
|
|
return {
|
|
width: animation.clip.right - animation.clip.left,
|
|
height: animation.clip.bottom - animation.clip.top,
|
|
left: animation.clip.left,
|
|
top: animation.clip.top
|
|
};
|
|
},
|
|
|
|
// Injects recently queued functions to be first in line (after "inprogress")
|
|
unshift: function (element, queueLength, count) {
|
|
var queue = element.queue();
|
|
|
|
if (queueLength > 1) {
|
|
queue.splice.apply(queue,
|
|
[1, 0].concat(queue.splice(queueLength, count)));
|
|
}
|
|
element.dequeue();
|
|
},
|
|
|
|
saveStyle: function (element) {
|
|
element.data(dataSpaceStyle, element[0].style.cssText);
|
|
},
|
|
|
|
restoreStyle: function (element) {
|
|
element[0].style.cssText = element.data(dataSpaceStyle) || "";
|
|
element.removeData(dataSpaceStyle);
|
|
},
|
|
|
|
mode: function (element, mode) {
|
|
var hidden = element.is(":hidden");
|
|
|
|
if (mode === "toggle") {
|
|
mode = hidden ? "show" : "hide";
|
|
}
|
|
if (hidden ? mode === "hide" : mode === "show") {
|
|
mode = "none";
|
|
}
|
|
return mode;
|
|
},
|
|
|
|
// Translates a [top,left] array into a baseline value
|
|
getBaseline: function (origin, original) {
|
|
var y, x;
|
|
|
|
switch (origin[0]) {
|
|
case "top":
|
|
y = 0;
|
|
break;
|
|
case "middle":
|
|
y = 0.5;
|
|
break;
|
|
case "bottom":
|
|
y = 1;
|
|
break;
|
|
default:
|
|
y = origin[0] / original.height;
|
|
}
|
|
|
|
switch (origin[1]) {
|
|
case "left":
|
|
x = 0;
|
|
break;
|
|
case "center":
|
|
x = 0.5;
|
|
break;
|
|
case "right":
|
|
x = 1;
|
|
break;
|
|
default:
|
|
x = origin[1] / original.width;
|
|
}
|
|
|
|
return {
|
|
x: x,
|
|
y: y
|
|
};
|
|
},
|
|
|
|
// Creates a placeholder element so that the original element can be made absolute
|
|
createPlaceholder: function (element) {
|
|
var placeholder,
|
|
cssPosition = element.css("position"),
|
|
position = element.position();
|
|
|
|
// Lock in margins first to account for form elements, which
|
|
// will change margin if you explicitly set height
|
|
// see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380
|
|
// Support: Safari
|
|
element.css({
|
|
marginTop: element.css("marginTop"),
|
|
marginBottom: element.css("marginBottom"),
|
|
marginLeft: element.css("marginLeft"),
|
|
marginRight: element.css("marginRight")
|
|
})
|
|
.outerWidth(element.outerWidth())
|
|
.outerHeight(element.outerHeight());
|
|
|
|
if (/^(static|relative)/.test(cssPosition)) {
|
|
cssPosition = "absolute";
|
|
|
|
placeholder = $("<" + element[0].nodeName + ">").insertAfter(element).css({
|
|
// Convert inline to inline block to account for inline elements
|
|
// that turn to inline block based on content (like img)
|
|
display: /^(inline|ruby)/.test(element.css("display")) ?
|
|
"inline-block" :
|
|
"block",
|
|
visibility: "hidden",
|
|
|
|
// Margins need to be set to account for margin collapse
|
|
marginTop: element.css("marginTop"),
|
|
marginBottom: element.css("marginBottom"),
|
|
marginLeft: element.css("marginLeft"),
|
|
marginRight: element.css("marginRight"),
|
|
"float": element.css("float")
|
|
})
|
|
.outerWidth(element.outerWidth())
|
|
.outerHeight(element.outerHeight())
|
|
.addClass("ui-effects-placeholder");
|
|
|
|
element.data(dataSpace + "placeholder", placeholder);
|
|
}
|
|
|
|
element.css({
|
|
position: cssPosition,
|
|
left: position.left,
|
|
top: position.top
|
|
});
|
|
|
|
return placeholder;
|
|
},
|
|
|
|
removePlaceholder: function (element) {
|
|
var dataKey = dataSpace + "placeholder",
|
|
placeholder = element.data(dataKey);
|
|
|
|
if (placeholder) {
|
|
placeholder.remove();
|
|
element.removeData(dataKey);
|
|
}
|
|
},
|
|
|
|
// Removes a placeholder if it exists and restores
|
|
// properties that were modified during placeholder creation
|
|
cleanUp: function (element) {
|
|
$.effects.restoreStyle(element);
|
|
$.effects.removePlaceholder(element);
|
|
},
|
|
|
|
setTransition: function (element, list, factor, value) {
|
|
value = value || {};
|
|
$.each(list, function (i, x) {
|
|
var unit = element.cssUnit(x);
|
|
if (unit[0] > 0) {
|
|
value[x] = unit[0] * factor + unit[1];
|
|
}
|
|
});
|
|
return value;
|
|
}
|
|
});
|
|
|
|
// Return an effect options object for the given parameters:
|
|
function _normalizeArguments(effect, options, speed, callback) {
|
|
// Allow passing all options as the first parameter
|
|
if ($.isPlainObject(effect)) {
|
|
options = effect;
|
|
effect = effect.effect;
|
|
}
|
|
|
|
// Convert to an object
|
|
effect = { effect: effect };
|
|
|
|
// Catch (effect, null, ...)
|
|
if (options == null) {
|
|
options = {};
|
|
}
|
|
|
|
// Catch (effect, callback)
|
|
if ($.isFunction(options)) {
|
|
callback = options;
|
|
speed = null;
|
|
options = {};
|
|
}
|
|
|
|
// Catch (effect, speed, ?)
|
|
if (typeof options === "number" || $.fx.speeds[options]) {
|
|
callback = speed;
|
|
speed = options;
|
|
options = {};
|
|
}
|
|
|
|
// Catch (effect, options, callback)
|
|
if ($.isFunction(speed)) {
|
|
callback = speed;
|
|
speed = null;
|
|
}
|
|
|
|
// Add options to effect
|
|
if (options) {
|
|
$.extend(effect, options);
|
|
}
|
|
|
|
speed = speed || options.duration;
|
|
effect.duration = $.fx.off ? 0 :
|
|
typeof speed === "number" ? speed :
|
|
speed in $.fx.speeds ? $.fx.speeds[speed] :
|
|
$.fx.speeds._default;
|
|
|
|
effect.complete = callback || options.complete;
|
|
|
|
return effect;
|
|
}
|
|
|
|
function standardAnimationOption(option) {
|
|
// Valid standard speeds (nothing, number, named speed)
|
|
if (!option || typeof option === "number" || $.fx.speeds[option]) {
|
|
return true;
|
|
}
|
|
|
|
// Invalid strings - treat as "normal" speed
|
|
if (typeof option === "string" && !$.effects.effect[option]) {
|
|
return true;
|
|
}
|
|
|
|
// Complete callback
|
|
if ($.isFunction(option)) {
|
|
return true;
|
|
}
|
|
|
|
// Options hash (but not naming an effect)
|
|
if (typeof option === "object" && !option.effect) {
|
|
return true;
|
|
}
|
|
|
|
// Didn't match any standard API
|
|
return false;
|
|
}
|
|
|
|
$.fn.extend({
|
|
effect: function ( /* effect, options, speed, callback */) {
|
|
var args = _normalizeArguments.apply(this, arguments),
|
|
effectMethod = $.effects.effect[args.effect],
|
|
defaultMode = effectMethod.mode,
|
|
queue = args.queue,
|
|
queueName = queue || "fx",
|
|
complete = args.complete,
|
|
mode = args.mode,
|
|
modes = [],
|
|
prefilter = function (next) {
|
|
var el = $(this),
|
|
normalizedMode = $.effects.mode(el, mode) || defaultMode;
|
|
|
|
// Sentinel for duck-punching the :animated psuedo-selector
|
|
el.data(dataSpaceAnimated, true);
|
|
|
|
// Save effect mode for later use,
|
|
// we can't just call $.effects.mode again later,
|
|
// as the .show() below destroys the initial state
|
|
modes.push(normalizedMode);
|
|
|
|
// See $.uiBackCompat inside of run() for removal of defaultMode in 1.13
|
|
if (defaultMode && (normalizedMode === "show" ||
|
|
(normalizedMode === defaultMode && normalizedMode === "hide"))) {
|
|
el.show();
|
|
}
|
|
|
|
if (!defaultMode || normalizedMode !== "none") {
|
|
$.effects.saveStyle(el);
|
|
}
|
|
|
|
if ($.isFunction(next)) {
|
|
next();
|
|
}
|
|
};
|
|
|
|
if ($.fx.off || !effectMethod) {
|
|
// Delegate to the original method (e.g., .show()) if possible
|
|
if (mode) {
|
|
return this[mode](args.duration, complete);
|
|
} else {
|
|
return this.each(function () {
|
|
if (complete) {
|
|
complete.call(this);
|
|
}
|
|
});
|
|
}
|
|
}
|
|
|
|
function run(next) {
|
|
var elem = $(this);
|
|
|
|
function cleanup() {
|
|
elem.removeData(dataSpaceAnimated);
|
|
|
|
$.effects.cleanUp(elem);
|
|
|
|
if (args.mode === "hide") {
|
|
elem.hide();
|
|
}
|
|
|
|
done();
|
|
}
|
|
|
|
function done() {
|
|
if ($.isFunction(complete)) {
|
|
complete.call(elem[0]);
|
|
}
|
|
|
|
if ($.isFunction(next)) {
|
|
next();
|
|
}
|
|
}
|
|
|
|
// Override mode option on a per element basis,
|
|
// as toggle can be either show or hide depending on element state
|
|
args.mode = modes.shift();
|
|
|
|
if ($.uiBackCompat !== false && !defaultMode) {
|
|
if (elem.is(":hidden") ? mode === "hide" : mode === "show") {
|
|
// Call the core method to track "olddisplay" properly
|
|
elem[mode]();
|
|
done();
|
|
} else {
|
|
effectMethod.call(elem[0], args, done);
|
|
}
|
|
} else {
|
|
if (args.mode === "none") {
|
|
// Call the core method to track "olddisplay" properly
|
|
elem[mode]();
|
|
done();
|
|
} else {
|
|
effectMethod.call(elem[0], args, cleanup);
|
|
}
|
|
}
|
|
}
|
|
|
|
// Run prefilter on all elements first to ensure that
|
|
// any showing or hiding happens before placeholder creation,
|
|
// which ensures that any layout changes are correctly captured.
|
|
return queue === false ?
|
|
this.each(prefilter).each(run) :
|
|
this.queue(queueName, prefilter).queue(queueName, run);
|
|
},
|
|
|
|
show: (function (orig) {
|
|
return function (option) {
|
|
if (standardAnimationOption(option)) {
|
|
return orig.apply(this, arguments);
|
|
} else {
|
|
var args = _normalizeArguments.apply(this, arguments);
|
|
args.mode = "show";
|
|
return this.effect.call(this, args);
|
|
}
|
|
};
|
|
})($.fn.show),
|
|
|
|
hide: (function (orig) {
|
|
return function (option) {
|
|
if (standardAnimationOption(option)) {
|
|
return orig.apply(this, arguments);
|
|
} else {
|
|
var args = _normalizeArguments.apply(this, arguments);
|
|
args.mode = "hide";
|
|
return this.effect.call(this, args);
|
|
}
|
|
};
|
|
})($.fn.hide),
|
|
|
|
toggle: (function (orig) {
|
|
return function (option) {
|
|
if (standardAnimationOption(option) || typeof option === "boolean") {
|
|
return orig.apply(this, arguments);
|
|
} else {
|
|
var args = _normalizeArguments.apply(this, arguments);
|
|
args.mode = "toggle";
|
|
return this.effect.call(this, args);
|
|
}
|
|
};
|
|
})($.fn.toggle),
|
|
|
|
cssUnit: function (key) {
|
|
var style = this.css(key),
|
|
val = [];
|
|
|
|
$.each(["em", "px", "%", "pt"], function (i, unit) {
|
|
if (style.indexOf(unit) > 0) {
|
|
val = [parseFloat(style), unit];
|
|
}
|
|
});
|
|
return val;
|
|
},
|
|
|
|
cssClip: function (clipObj) {
|
|
if (clipObj) {
|
|
return this.css("clip", "rect(" + clipObj.top + "px " + clipObj.right + "px " +
|
|
clipObj.bottom + "px " + clipObj.left + "px)");
|
|
}
|
|
return parseClip(this.css("clip"), this);
|
|
},
|
|
|
|
transfer: function (options, done) {
|
|
var element = $(this),
|
|
target = $(options.to),
|
|
targetFixed = target.css("position") === "fixed",
|
|
body = $("body"),
|
|
fixTop = targetFixed ? body.scrollTop() : 0,
|
|
fixLeft = targetFixed ? body.scrollLeft() : 0,
|
|
endPosition = target.offset(),
|
|
animation = {
|
|
top: endPosition.top - fixTop,
|
|
left: endPosition.left - fixLeft,
|
|
height: target.innerHeight(),
|
|
width: target.innerWidth()
|
|
},
|
|
startPosition = element.offset(),
|
|
transfer = $("<div class='ui-effects-transfer'></div>")
|
|
.appendTo("body")
|
|
.addClass(options.className)
|
|
.css({
|
|
top: startPosition.top - fixTop,
|
|
left: startPosition.left - fixLeft,
|
|
height: element.innerHeight(),
|
|
width: element.innerWidth(),
|
|
position: targetFixed ? "fixed" : "absolute"
|
|
})
|
|
.animate(animation, options.duration, options.easing, function () {
|
|
transfer.remove();
|
|
if ($.isFunction(done)) {
|
|
done();
|
|
}
|
|
});
|
|
}
|
|
});
|
|
|
|
function parseClip(str, element) {
|
|
var outerWidth = element.outerWidth(),
|
|
outerHeight = element.outerHeight(),
|
|
clipRegex = /^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/,
|
|
values = clipRegex.exec(str) || ["", 0, outerWidth, outerHeight, 0];
|
|
|
|
return {
|
|
top: parseFloat(values[1]) || 0,
|
|
right: values[2] === "auto" ? outerWidth : parseFloat(values[2]),
|
|
bottom: values[3] === "auto" ? outerHeight : parseFloat(values[3]),
|
|
left: parseFloat(values[4]) || 0
|
|
};
|
|
}
|
|
|
|
$.fx.step.clip = function (fx) {
|
|
if (!fx.clipInit) {
|
|
fx.start = $(fx.elem).cssClip();
|
|
if (typeof fx.end === "string") {
|
|
fx.end = parseClip(fx.end, fx.elem);
|
|
}
|
|
fx.clipInit = true;
|
|
}
|
|
|
|
$(fx.elem).cssClip({
|
|
top: fx.pos * (fx.end.top - fx.start.top) + fx.start.top,
|
|
right: fx.pos * (fx.end.right - fx.start.right) + fx.start.right,
|
|
bottom: fx.pos * (fx.end.bottom - fx.start.bottom) + fx.start.bottom,
|
|
left: fx.pos * (fx.end.left - fx.start.left) + fx.start.left
|
|
});
|
|
};
|
|
})();
|
|
|
|
/******************************************************************************/
|
|
/*********************************** EASING ***********************************/
|
|
/******************************************************************************/
|
|
|
|
(function () {
|
|
// Based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
|
|
|
|
var baseEasings = {};
|
|
|
|
$.each(["Quad", "Cubic", "Quart", "Quint", "Expo"], function (i, name) {
|
|
baseEasings[name] = function (p) {
|
|
return Math.pow(p, i + 2);
|
|
};
|
|
});
|
|
|
|
$.extend(baseEasings, {
|
|
Sine: function (p) {
|
|
return 1 - Math.cos(p * Math.PI / 2);
|
|
},
|
|
Circ: function (p) {
|
|
return 1 - Math.sqrt(1 - p * p);
|
|
},
|
|
Elastic: function (p) {
|
|
return p === 0 || p === 1 ? p :
|
|
-Math.pow(2, 8 * (p - 1)) * Math.sin(((p - 1) * 80 - 7.5) * Math.PI / 15);
|
|
},
|
|
Back: function (p) {
|
|
return p * p * (3 * p - 2);
|
|
},
|
|
Bounce: function (p) {
|
|
var pow2,
|
|
bounce = 4;
|
|
|
|
while (p < ((pow2 = Math.pow(2, --bounce)) - 1) / 11) { }
|
|
return 1 / Math.pow(4, 3 - bounce) - 7.5625 * Math.pow((pow2 * 3 - 2) / 22 - p, 2);
|
|
}
|
|
});
|
|
|
|
$.each(baseEasings, function (name, easeIn) {
|
|
$.easing["easeIn" + name] = easeIn;
|
|
$.easing["easeOut" + name] = function (p) {
|
|
return 1 - easeIn(1 - p);
|
|
};
|
|
$.easing["easeInOut" + name] = function (p) {
|
|
return p < 0.5 ?
|
|
easeIn(p * 2) / 2 :
|
|
1 - easeIn(p * -2 + 2) / 2;
|
|
};
|
|
});
|
|
})();
|
|
|
|
var effect = $.effects;
|
|
|
|
/*!
|
|
* jQuery UI Effects Blind 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Blind Effect
|
|
//>>group: Effects
|
|
//>>description: Blinds the element.
|
|
//>>docs: http://api.jqueryui.com/blind-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectBlind = $.effects.define("blind", "hide", function (options, done) {
|
|
var map = {
|
|
up: ["bottom", "top"],
|
|
vertical: ["bottom", "top"],
|
|
down: ["top", "bottom"],
|
|
left: ["right", "left"],
|
|
horizontal: ["right", "left"],
|
|
right: ["left", "right"]
|
|
},
|
|
element = $(this),
|
|
direction = options.direction || "up",
|
|
start = element.cssClip(),
|
|
animate = { clip: $.extend({}, start) },
|
|
placeholder = $.effects.createPlaceholder(element);
|
|
|
|
animate.clip[map[direction][0]] = animate.clip[map[direction][1]];
|
|
|
|
if (options.mode === "show") {
|
|
element.cssClip(animate.clip);
|
|
if (placeholder) {
|
|
placeholder.css($.effects.clipToBox(animate));
|
|
}
|
|
|
|
animate.clip = start;
|
|
}
|
|
|
|
if (placeholder) {
|
|
placeholder.animate($.effects.clipToBox(animate), options.duration, options.easing);
|
|
}
|
|
|
|
element.animate(animate, {
|
|
queue: false,
|
|
duration: options.duration,
|
|
easing: options.easing,
|
|
complete: done
|
|
});
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Bounce 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Bounce Effect
|
|
//>>group: Effects
|
|
//>>description: Bounces an element horizontally or vertically n times.
|
|
//>>docs: http://api.jqueryui.com/bounce-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectBounce = $.effects.define("bounce", function (options, done) {
|
|
var upAnim, downAnim, refValue,
|
|
element = $(this),
|
|
|
|
// Defaults:
|
|
mode = options.mode,
|
|
hide = mode === "hide",
|
|
show = mode === "show",
|
|
direction = options.direction || "up",
|
|
distance = options.distance,
|
|
times = options.times || 5,
|
|
|
|
// Number of internal animations
|
|
anims = times * 2 + (show || hide ? 1 : 0),
|
|
speed = options.duration / anims,
|
|
easing = options.easing,
|
|
|
|
// Utility:
|
|
ref = (direction === "up" || direction === "down") ? "top" : "left",
|
|
motion = (direction === "up" || direction === "left"),
|
|
i = 0,
|
|
|
|
queuelen = element.queue().length;
|
|
|
|
$.effects.createPlaceholder(element);
|
|
|
|
refValue = element.css(ref);
|
|
|
|
// Default distance for the BIGGEST bounce is the outer Distance / 3
|
|
if (!distance) {
|
|
distance = element[ref === "top" ? "outerHeight" : "outerWidth"]() / 3;
|
|
}
|
|
|
|
if (show) {
|
|
downAnim = { opacity: 1 };
|
|
downAnim[ref] = refValue;
|
|
|
|
// If we are showing, force opacity 0 and set the initial position
|
|
// then do the "first" animation
|
|
element
|
|
.css("opacity", 0)
|
|
.css(ref, motion ? -distance * 2 : distance * 2)
|
|
.animate(downAnim, speed, easing);
|
|
}
|
|
|
|
// Start at the smallest distance if we are hiding
|
|
if (hide) {
|
|
distance = distance / Math.pow(2, times - 1);
|
|
}
|
|
|
|
downAnim = {};
|
|
downAnim[ref] = refValue;
|
|
|
|
// Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
|
|
for (; i < times; i++) {
|
|
upAnim = {};
|
|
upAnim[ref] = (motion ? "-=" : "+=") + distance;
|
|
|
|
element
|
|
.animate(upAnim, speed, easing)
|
|
.animate(downAnim, speed, easing);
|
|
|
|
distance = hide ? distance * 2 : distance / 2;
|
|
}
|
|
|
|
// Last Bounce when Hiding
|
|
if (hide) {
|
|
upAnim = { opacity: 0 };
|
|
upAnim[ref] = (motion ? "-=" : "+=") + distance;
|
|
|
|
element.animate(upAnim, speed, easing);
|
|
}
|
|
|
|
element.queue(done);
|
|
|
|
$.effects.unshift(element, queuelen, anims + 1);
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Clip 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Clip Effect
|
|
//>>group: Effects
|
|
//>>description: Clips the element on and off like an old TV.
|
|
//>>docs: http://api.jqueryui.com/clip-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectClip = $.effects.define("clip", "hide", function (options, done) {
|
|
var start,
|
|
animate = {},
|
|
element = $(this),
|
|
direction = options.direction || "vertical",
|
|
both = direction === "both",
|
|
horizontal = both || direction === "horizontal",
|
|
vertical = both || direction === "vertical";
|
|
|
|
start = element.cssClip();
|
|
animate.clip = {
|
|
top: vertical ? (start.bottom - start.top) / 2 : start.top,
|
|
right: horizontal ? (start.right - start.left) / 2 : start.right,
|
|
bottom: vertical ? (start.bottom - start.top) / 2 : start.bottom,
|
|
left: horizontal ? (start.right - start.left) / 2 : start.left
|
|
};
|
|
|
|
$.effects.createPlaceholder(element);
|
|
|
|
if (options.mode === "show") {
|
|
element.cssClip(animate.clip);
|
|
animate.clip = start;
|
|
}
|
|
|
|
element.animate(animate, {
|
|
queue: false,
|
|
duration: options.duration,
|
|
easing: options.easing,
|
|
complete: done
|
|
});
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Drop 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Drop Effect
|
|
//>>group: Effects
|
|
//>>description: Moves an element in one direction and hides it at the same time.
|
|
//>>docs: http://api.jqueryui.com/drop-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectDrop = $.effects.define("drop", "hide", function (options, done) {
|
|
var distance,
|
|
element = $(this),
|
|
mode = options.mode,
|
|
show = mode === "show",
|
|
direction = options.direction || "left",
|
|
ref = (direction === "up" || direction === "down") ? "top" : "left",
|
|
motion = (direction === "up" || direction === "left") ? "-=" : "+=",
|
|
oppositeMotion = (motion === "+=") ? "-=" : "+=",
|
|
animation = {
|
|
opacity: 0
|
|
};
|
|
|
|
$.effects.createPlaceholder(element);
|
|
|
|
distance = options.distance ||
|
|
element[ref === "top" ? "outerHeight" : "outerWidth"](true) / 2;
|
|
|
|
animation[ref] = motion + distance;
|
|
|
|
if (show) {
|
|
element.css(animation);
|
|
|
|
animation[ref] = oppositeMotion + distance;
|
|
animation.opacity = 1;
|
|
}
|
|
|
|
// Animate
|
|
element.animate(animation, {
|
|
queue: false,
|
|
duration: options.duration,
|
|
easing: options.easing,
|
|
complete: done
|
|
});
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Explode 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Explode Effect
|
|
//>>group: Effects
|
|
// jscs:disable maximumLineLength
|
|
//>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness.
|
|
// jscs:enable maximumLineLength
|
|
//>>docs: http://api.jqueryui.com/explode-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectExplode = $.effects.define("explode", "hide", function (options, done) {
|
|
var i, j, left, top, mx, my,
|
|
rows = options.pieces ? Math.round(Math.sqrt(options.pieces)) : 3,
|
|
cells = rows,
|
|
element = $(this),
|
|
mode = options.mode,
|
|
show = mode === "show",
|
|
|
|
// Show and then visibility:hidden the element before calculating offset
|
|
offset = element.show().css("visibility", "hidden").offset(),
|
|
|
|
// Width and height of a piece
|
|
width = Math.ceil(element.outerWidth() / cells),
|
|
height = Math.ceil(element.outerHeight() / rows),
|
|
pieces = [];
|
|
|
|
// Children animate complete:
|
|
function childComplete() {
|
|
pieces.push(this);
|
|
if (pieces.length === rows * cells) {
|
|
animComplete();
|
|
}
|
|
}
|
|
|
|
// Clone the element for each row and cell.
|
|
for (i = 0; i < rows; i++) { // ===>
|
|
top = offset.top + i * height;
|
|
my = i - (rows - 1) / 2;
|
|
|
|
for (j = 0; j < cells; j++) { // |||
|
|
left = offset.left + j * width;
|
|
mx = j - (cells - 1) / 2;
|
|
|
|
// Create a clone of the now hidden main element that will be absolute positioned
|
|
// within a wrapper div off the -left and -top equal to size of our pieces
|
|
element
|
|
.clone()
|
|
.appendTo("body")
|
|
.wrap("<div></div>")
|
|
.css({
|
|
position: "absolute",
|
|
visibility: "visible",
|
|
left: -j * width,
|
|
top: -i * height
|
|
})
|
|
|
|
// Select the wrapper - make it overflow: hidden and absolute positioned based on
|
|
// where the original was located +left and +top equal to the size of pieces
|
|
.parent()
|
|
.addClass("ui-effects-explode")
|
|
.css({
|
|
position: "absolute",
|
|
overflow: "hidden",
|
|
width: width,
|
|
height: height,
|
|
left: left + (show ? mx * width : 0),
|
|
top: top + (show ? my * height : 0),
|
|
opacity: show ? 0 : 1
|
|
})
|
|
.animate({
|
|
left: left + (show ? 0 : mx * width),
|
|
top: top + (show ? 0 : my * height),
|
|
opacity: show ? 1 : 0
|
|
}, options.duration || 500, options.easing, childComplete);
|
|
}
|
|
}
|
|
|
|
function animComplete() {
|
|
element.css({
|
|
visibility: "visible"
|
|
});
|
|
$(pieces).remove();
|
|
done();
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Fade 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Fade Effect
|
|
//>>group: Effects
|
|
//>>description: Fades the element.
|
|
//>>docs: http://api.jqueryui.com/fade-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectFade = $.effects.define("fade", "toggle", function (options, done) {
|
|
var show = options.mode === "show";
|
|
|
|
$(this)
|
|
.css("opacity", show ? 0 : 1)
|
|
.animate({
|
|
opacity: show ? 1 : 0
|
|
}, {
|
|
queue: false,
|
|
duration: options.duration,
|
|
easing: options.easing,
|
|
complete: done
|
|
});
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Fold 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Fold Effect
|
|
//>>group: Effects
|
|
//>>description: Folds an element first horizontally and then vertically.
|
|
//>>docs: http://api.jqueryui.com/fold-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectFold = $.effects.define("fold", "hide", function (options, done) {
|
|
// Create element
|
|
var element = $(this),
|
|
mode = options.mode,
|
|
show = mode === "show",
|
|
hide = mode === "hide",
|
|
size = options.size || 15,
|
|
percent = /([0-9]+)%/.exec(size),
|
|
horizFirst = !!options.horizFirst,
|
|
ref = horizFirst ? ["right", "bottom"] : ["bottom", "right"],
|
|
duration = options.duration / 2,
|
|
|
|
placeholder = $.effects.createPlaceholder(element),
|
|
|
|
start = element.cssClip(),
|
|
animation1 = { clip: $.extend({}, start) },
|
|
animation2 = { clip: $.extend({}, start) },
|
|
|
|
distance = [start[ref[0]], start[ref[1]]],
|
|
|
|
queuelen = element.queue().length;
|
|
|
|
if (percent) {
|
|
size = parseInt(percent[1], 10) / 100 * distance[hide ? 0 : 1];
|
|
}
|
|
animation1.clip[ref[0]] = size;
|
|
animation2.clip[ref[0]] = size;
|
|
animation2.clip[ref[1]] = 0;
|
|
|
|
if (show) {
|
|
element.cssClip(animation2.clip);
|
|
if (placeholder) {
|
|
placeholder.css($.effects.clipToBox(animation2));
|
|
}
|
|
|
|
animation2.clip = start;
|
|
}
|
|
|
|
// Animate
|
|
element
|
|
.queue(function (next) {
|
|
if (placeholder) {
|
|
placeholder
|
|
.animate($.effects.clipToBox(animation1), duration, options.easing)
|
|
.animate($.effects.clipToBox(animation2), duration, options.easing);
|
|
}
|
|
|
|
next();
|
|
})
|
|
.animate(animation1, duration, options.easing)
|
|
.animate(animation2, duration, options.easing)
|
|
.queue(done);
|
|
|
|
$.effects.unshift(element, queuelen, 4);
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Highlight 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Highlight Effect
|
|
//>>group: Effects
|
|
//>>description: Highlights the background of an element in a defined color for a custom duration.
|
|
//>>docs: http://api.jqueryui.com/highlight-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectHighlight = $.effects.define("highlight", "show", function (options, done) {
|
|
var element = $(this),
|
|
animation = {
|
|
backgroundColor: element.css("backgroundColor")
|
|
};
|
|
|
|
if (options.mode === "hide") {
|
|
animation.opacity = 0;
|
|
}
|
|
|
|
$.effects.saveStyle(element);
|
|
|
|
element
|
|
.css({
|
|
backgroundImage: "none",
|
|
backgroundColor: options.color || "#ffff99"
|
|
})
|
|
.animate(animation, {
|
|
queue: false,
|
|
duration: options.duration,
|
|
easing: options.easing,
|
|
complete: done
|
|
});
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Size 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Size Effect
|
|
//>>group: Effects
|
|
//>>description: Resize an element to a specified width and height.
|
|
//>>docs: http://api.jqueryui.com/size-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectSize = $.effects.define("size", function (options, done) {
|
|
// Create element
|
|
var baseline, factor, temp,
|
|
element = $(this),
|
|
|
|
// Copy for children
|
|
cProps = ["fontSize"],
|
|
vProps = ["borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom"],
|
|
hProps = ["borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight"],
|
|
|
|
// Set options
|
|
mode = options.mode,
|
|
restore = mode !== "effect",
|
|
scale = options.scale || "both",
|
|
origin = options.origin || ["middle", "center"],
|
|
position = element.css("position"),
|
|
pos = element.position(),
|
|
original = $.effects.scaledDimensions(element),
|
|
from = options.from || original,
|
|
to = options.to || $.effects.scaledDimensions(element, 0);
|
|
|
|
$.effects.createPlaceholder(element);
|
|
|
|
if (mode === "show") {
|
|
temp = from;
|
|
from = to;
|
|
to = temp;
|
|
}
|
|
|
|
// Set scaling factor
|
|
factor = {
|
|
from: {
|
|
y: from.height / original.height,
|
|
x: from.width / original.width
|
|
},
|
|
to: {
|
|
y: to.height / original.height,
|
|
x: to.width / original.width
|
|
}
|
|
};
|
|
|
|
// Scale the css box
|
|
if (scale === "box" || scale === "both") {
|
|
// Vertical props scaling
|
|
if (factor.from.y !== factor.to.y) {
|
|
from = $.effects.setTransition(element, vProps, factor.from.y, from);
|
|
to = $.effects.setTransition(element, vProps, factor.to.y, to);
|
|
}
|
|
|
|
// Horizontal props scaling
|
|
if (factor.from.x !== factor.to.x) {
|
|
from = $.effects.setTransition(element, hProps, factor.from.x, from);
|
|
to = $.effects.setTransition(element, hProps, factor.to.x, to);
|
|
}
|
|
}
|
|
|
|
// Scale the content
|
|
if (scale === "content" || scale === "both") {
|
|
// Vertical props scaling
|
|
if (factor.from.y !== factor.to.y) {
|
|
from = $.effects.setTransition(element, cProps, factor.from.y, from);
|
|
to = $.effects.setTransition(element, cProps, factor.to.y, to);
|
|
}
|
|
}
|
|
|
|
// Adjust the position properties based on the provided origin points
|
|
if (origin) {
|
|
baseline = $.effects.getBaseline(origin, original);
|
|
from.top = (original.outerHeight - from.outerHeight) * baseline.y + pos.top;
|
|
from.left = (original.outerWidth - from.outerWidth) * baseline.x + pos.left;
|
|
to.top = (original.outerHeight - to.outerHeight) * baseline.y + pos.top;
|
|
to.left = (original.outerWidth - to.outerWidth) * baseline.x + pos.left;
|
|
}
|
|
element.css(from);
|
|
|
|
// Animate the children if desired
|
|
if (scale === "content" || scale === "both") {
|
|
vProps = vProps.concat(["marginTop", "marginBottom"]).concat(cProps);
|
|
hProps = hProps.concat(["marginLeft", "marginRight"]);
|
|
|
|
// Only animate children with width attributes specified
|
|
// TODO: is this right? should we include anything with css width specified as well
|
|
element.find("*[width]").each(function () {
|
|
var child = $(this),
|
|
childOriginal = $.effects.scaledDimensions(child),
|
|
childFrom = {
|
|
height: childOriginal.height * factor.from.y,
|
|
width: childOriginal.width * factor.from.x,
|
|
outerHeight: childOriginal.outerHeight * factor.from.y,
|
|
outerWidth: childOriginal.outerWidth * factor.from.x
|
|
},
|
|
childTo = {
|
|
height: childOriginal.height * factor.to.y,
|
|
width: childOriginal.width * factor.to.x,
|
|
outerHeight: childOriginal.height * factor.to.y,
|
|
outerWidth: childOriginal.width * factor.to.x
|
|
};
|
|
|
|
// Vertical props scaling
|
|
if (factor.from.y !== factor.to.y) {
|
|
childFrom = $.effects.setTransition(child, vProps, factor.from.y, childFrom);
|
|
childTo = $.effects.setTransition(child, vProps, factor.to.y, childTo);
|
|
}
|
|
|
|
// Horizontal props scaling
|
|
if (factor.from.x !== factor.to.x) {
|
|
childFrom = $.effects.setTransition(child, hProps, factor.from.x, childFrom);
|
|
childTo = $.effects.setTransition(child, hProps, factor.to.x, childTo);
|
|
}
|
|
|
|
if (restore) {
|
|
$.effects.saveStyle(child);
|
|
}
|
|
|
|
// Animate children
|
|
child.css(childFrom);
|
|
child.animate(childTo, options.duration, options.easing, function () {
|
|
// Restore children
|
|
if (restore) {
|
|
$.effects.restoreStyle(child);
|
|
}
|
|
});
|
|
});
|
|
}
|
|
|
|
// Animate
|
|
element.animate(to, {
|
|
queue: false,
|
|
duration: options.duration,
|
|
easing: options.easing,
|
|
complete: function () {
|
|
var offset = element.offset();
|
|
|
|
if (to.opacity === 0) {
|
|
element.css("opacity", from.opacity);
|
|
}
|
|
|
|
if (!restore) {
|
|
element
|
|
.css("position", position === "static" ? "relative" : position)
|
|
.offset(offset);
|
|
|
|
// Need to save style here so that automatic style restoration
|
|
// doesn't restore to the original styles from before the animation.
|
|
$.effects.saveStyle(element);
|
|
}
|
|
|
|
done();
|
|
}
|
|
});
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Scale 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Scale Effect
|
|
//>>group: Effects
|
|
//>>description: Grows or shrinks an element and its content.
|
|
//>>docs: http://api.jqueryui.com/scale-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectScale = $.effects.define("scale", function (options, done) {
|
|
// Create element
|
|
var el = $(this),
|
|
mode = options.mode,
|
|
percent = parseInt(options.percent, 10) ||
|
|
(parseInt(options.percent, 10) === 0 ? 0 : (mode !== "effect" ? 0 : 100)),
|
|
|
|
newOptions = $.extend(true, {
|
|
from: $.effects.scaledDimensions(el),
|
|
to: $.effects.scaledDimensions(el, percent, options.direction || "both"),
|
|
origin: options.origin || ["middle", "center"]
|
|
}, options);
|
|
|
|
// Fade option to support puff
|
|
if (options.fade) {
|
|
newOptions.from.opacity = 1;
|
|
newOptions.to.opacity = 0;
|
|
}
|
|
|
|
$.effects.effect.size.call(this, newOptions, done);
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Puff 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Puff Effect
|
|
//>>group: Effects
|
|
//>>description: Creates a puff effect by scaling the element up and hiding it at the same time.
|
|
//>>docs: http://api.jqueryui.com/puff-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectPuff = $.effects.define("puff", "hide", function (options, done) {
|
|
var newOptions = $.extend(true, {}, options, {
|
|
fade: true,
|
|
percent: parseInt(options.percent, 10) || 150
|
|
});
|
|
|
|
$.effects.effect.scale.call(this, newOptions, done);
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Pulsate 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Pulsate Effect
|
|
//>>group: Effects
|
|
//>>description: Pulsates an element n times by changing the opacity to zero and back.
|
|
//>>docs: http://api.jqueryui.com/pulsate-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectPulsate = $.effects.define("pulsate", "show", function (options, done) {
|
|
var element = $(this),
|
|
mode = options.mode,
|
|
show = mode === "show",
|
|
hide = mode === "hide",
|
|
showhide = show || hide,
|
|
|
|
// Showing or hiding leaves off the "last" animation
|
|
anims = ((options.times || 5) * 2) + (showhide ? 1 : 0),
|
|
duration = options.duration / anims,
|
|
animateTo = 0,
|
|
i = 1,
|
|
queuelen = element.queue().length;
|
|
|
|
if (show || !element.is(":visible")) {
|
|
element.css("opacity", 0).show();
|
|
animateTo = 1;
|
|
}
|
|
|
|
// Anims - 1 opacity "toggles"
|
|
for (; i < anims; i++) {
|
|
element.animate({ opacity: animateTo }, duration, options.easing);
|
|
animateTo = 1 - animateTo;
|
|
}
|
|
|
|
element.animate({ opacity: animateTo }, duration, options.easing);
|
|
|
|
element.queue(done);
|
|
|
|
$.effects.unshift(element, queuelen, anims + 1);
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Shake 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Shake Effect
|
|
//>>group: Effects
|
|
//>>description: Shakes an element horizontally or vertically n times.
|
|
//>>docs: http://api.jqueryui.com/shake-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectShake = $.effects.define("shake", function (options, done) {
|
|
var i = 1,
|
|
element = $(this),
|
|
direction = options.direction || "left",
|
|
distance = options.distance || 20,
|
|
times = options.times || 3,
|
|
anims = times * 2 + 1,
|
|
speed = Math.round(options.duration / anims),
|
|
ref = (direction === "up" || direction === "down") ? "top" : "left",
|
|
positiveMotion = (direction === "up" || direction === "left"),
|
|
animation = {},
|
|
animation1 = {},
|
|
animation2 = {},
|
|
|
|
queuelen = element.queue().length;
|
|
|
|
$.effects.createPlaceholder(element);
|
|
|
|
// Animation
|
|
animation[ref] = (positiveMotion ? "-=" : "+=") + distance;
|
|
animation1[ref] = (positiveMotion ? "+=" : "-=") + distance * 2;
|
|
animation2[ref] = (positiveMotion ? "-=" : "+=") + distance * 2;
|
|
|
|
// Animate
|
|
element.animate(animation, speed, options.easing);
|
|
|
|
// Shakes
|
|
for (; i < times; i++) {
|
|
element
|
|
.animate(animation1, speed, options.easing)
|
|
.animate(animation2, speed, options.easing);
|
|
}
|
|
|
|
element
|
|
.animate(animation1, speed, options.easing)
|
|
.animate(animation, speed / 2, options.easing)
|
|
.queue(done);
|
|
|
|
$.effects.unshift(element, queuelen, anims + 1);
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Slide 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Slide Effect
|
|
//>>group: Effects
|
|
//>>description: Slides an element in and out of the viewport.
|
|
//>>docs: http://api.jqueryui.com/slide-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effectsEffectSlide = $.effects.define("slide", "show", function (options, done) {
|
|
var startClip, startRef,
|
|
element = $(this),
|
|
map = {
|
|
up: ["bottom", "top"],
|
|
down: ["top", "bottom"],
|
|
left: ["right", "left"],
|
|
right: ["left", "right"]
|
|
},
|
|
mode = options.mode,
|
|
direction = options.direction || "left",
|
|
ref = (direction === "up" || direction === "down") ? "top" : "left",
|
|
positiveMotion = (direction === "up" || direction === "left"),
|
|
distance = options.distance ||
|
|
element[ref === "top" ? "outerHeight" : "outerWidth"](true),
|
|
animation = {};
|
|
|
|
$.effects.createPlaceholder(element);
|
|
|
|
startClip = element.cssClip();
|
|
startRef = element.position()[ref];
|
|
|
|
// Define hide animation
|
|
animation[ref] = (positiveMotion ? -1 : 1) * distance + startRef;
|
|
animation.clip = element.cssClip();
|
|
animation.clip[map[direction][1]] = animation.clip[map[direction][0]];
|
|
|
|
// Reverse the animation if we're showing
|
|
if (mode === "show") {
|
|
element.cssClip(animation.clip);
|
|
element.css(ref, animation[ref]);
|
|
animation.clip = startClip;
|
|
animation[ref] = startRef;
|
|
}
|
|
|
|
// Actually animate
|
|
element.animate(animation, {
|
|
queue: false,
|
|
duration: options.duration,
|
|
easing: options.easing,
|
|
complete: done
|
|
});
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Effects Transfer 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Transfer Effect
|
|
//>>group: Effects
|
|
//>>description: Displays a transfer effect from one element to another.
|
|
//>>docs: http://api.jqueryui.com/transfer-effect/
|
|
//>>demos: http://jqueryui.com/effect/
|
|
|
|
var effect;
|
|
if ($.uiBackCompat !== false) {
|
|
effect = $.effects.define("transfer", function (options, done) {
|
|
$(this).transfer(options, done);
|
|
});
|
|
}
|
|
var effectsEffectTransfer = effect;
|
|
|
|
/*!
|
|
* jQuery UI Focusable 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: :focusable Selector
|
|
//>>group: Core
|
|
//>>description: Selects elements which can be focused.
|
|
//>>docs: http://api.jqueryui.com/focusable-selector/
|
|
|
|
// Selectors
|
|
$.ui.focusable = function (element, hasTabindex) {
|
|
var map, mapName, img, focusableIfVisible, fieldset,
|
|
nodeName = element.nodeName.toLowerCase();
|
|
|
|
if ("area" === nodeName) {
|
|
map = element.parentNode;
|
|
mapName = map.name;
|
|
if (!element.href || !mapName || map.nodeName.toLowerCase() !== "map") {
|
|
return false;
|
|
}
|
|
img = $("img[usemap='#" + mapName + "']");
|
|
return img.length > 0 && img.is(":visible");
|
|
}
|
|
|
|
if (/^(input|select|textarea|button|object)$/.test(nodeName)) {
|
|
focusableIfVisible = !element.disabled;
|
|
|
|
if (focusableIfVisible) {
|
|
// Form controls within a disabled fieldset are disabled.
|
|
// However, controls within the fieldset's legend do not get disabled.
|
|
// Since controls generally aren't placed inside legends, we skip
|
|
// this portion of the check.
|
|
fieldset = $(element).closest("fieldset")[0];
|
|
if (fieldset) {
|
|
focusableIfVisible = !fieldset.disabled;
|
|
}
|
|
}
|
|
} else if ("a" === nodeName) {
|
|
focusableIfVisible = element.href || hasTabindex;
|
|
} else {
|
|
focusableIfVisible = hasTabindex;
|
|
}
|
|
|
|
return focusableIfVisible && $(element).is(":visible") && visible($(element));
|
|
};
|
|
|
|
// Support: IE 8 only
|
|
// IE 8 doesn't resolve inherit to visible/hidden for computed values
|
|
function visible(element) {
|
|
var visibility = element.css("visibility");
|
|
while (visibility === "inherit") {
|
|
element = element.parent();
|
|
visibility = element.css("visibility");
|
|
}
|
|
return visibility !== "hidden";
|
|
}
|
|
|
|
$.extend($.expr[":"], {
|
|
focusable: function (element) {
|
|
return $.ui.focusable(element, $.attr(element, "tabindex") != null);
|
|
}
|
|
});
|
|
|
|
var focusable = $.ui.focusable;
|
|
|
|
// Support: IE8 Only
|
|
// IE8 does not support the form attribute and when it is supplied. It overwrites the form prop
|
|
// with a string, so we need to find the proper form.
|
|
var form = $.fn.form = function () {
|
|
return typeof this[0].form === "string" ? this.closest("form") : $(this[0].form);
|
|
};
|
|
|
|
/*!
|
|
* jQuery UI Form Reset Mixin 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Form Reset Mixin
|
|
//>>group: Core
|
|
//>>description: Refresh input widgets when their form is reset
|
|
//>>docs: http://api.jqueryui.com/form-reset-mixin/
|
|
|
|
var formResetMixin = $.ui.formResetMixin = {
|
|
_formResetHandler: function () {
|
|
var form = $(this);
|
|
|
|
// Wait for the form reset to actually happen before refreshing
|
|
setTimeout(function () {
|
|
var instances = form.data("ui-form-reset-instances");
|
|
$.each(instances, function () {
|
|
this.refresh();
|
|
});
|
|
});
|
|
},
|
|
|
|
_bindFormResetHandler: function () {
|
|
this.form = this.element.form();
|
|
if (!this.form.length) {
|
|
return;
|
|
}
|
|
|
|
var instances = this.form.data("ui-form-reset-instances") || [];
|
|
if (!instances.length) {
|
|
// We don't use _on() here because we use a single event handler per form
|
|
this.form.on("reset.ui-form-reset", this._formResetHandler);
|
|
}
|
|
instances.push(this);
|
|
this.form.data("ui-form-reset-instances", instances);
|
|
},
|
|
|
|
_unbindFormResetHandler: function () {
|
|
if (!this.form.length) {
|
|
return;
|
|
}
|
|
|
|
var instances = this.form.data("ui-form-reset-instances");
|
|
instances.splice($.inArray(this, instances), 1);
|
|
if (instances.length) {
|
|
this.form.data("ui-form-reset-instances", instances);
|
|
} else {
|
|
this.form
|
|
.removeData("ui-form-reset-instances")
|
|
.off("reset.ui-form-reset");
|
|
}
|
|
}
|
|
};
|
|
|
|
/*!
|
|
* jQuery UI Support for jQuery core 1.7.x 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*
|
|
*/
|
|
|
|
//>>label: jQuery 1.7 Support
|
|
//>>group: Core
|
|
//>>description: Support version 1.7.x of jQuery core
|
|
|
|
// Support: jQuery 1.7 only
|
|
// Not a great way to check versions, but since we only support 1.7+ and only
|
|
// need to detect <1.8, this is a simple check that should suffice. Checking
|
|
// for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0
|
|
// and we'll never reach 1.70.0 (if we do, we certainly won't be supporting
|
|
// 1.7 anymore). See #11197 for why we're not using feature detection.
|
|
if ($.fn.jquery.substring(0, 3) === "1.7") {
|
|
// Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight()
|
|
// Unlike jQuery Core 1.8+, these only support numeric values to set the
|
|
// dimensions in pixels
|
|
$.each(["Width", "Height"], function (i, name) {
|
|
var side = name === "Width" ? ["Left", "Right"] : ["Top", "Bottom"],
|
|
type = name.toLowerCase(),
|
|
orig = {
|
|
innerWidth: $.fn.innerWidth,
|
|
innerHeight: $.fn.innerHeight,
|
|
outerWidth: $.fn.outerWidth,
|
|
outerHeight: $.fn.outerHeight
|
|
};
|
|
|
|
function reduce(elem, size, border, margin) {
|
|
$.each(side, function () {
|
|
size -= parseFloat($.css(elem, "padding" + this)) || 0;
|
|
if (border) {
|
|
size -= parseFloat($.css(elem, "border" + this + "Width")) || 0;
|
|
}
|
|
if (margin) {
|
|
size -= parseFloat($.css(elem, "margin" + this)) || 0;
|
|
}
|
|
});
|
|
return size;
|
|
}
|
|
|
|
$.fn["inner" + name] = function (size) {
|
|
if (size === undefined) {
|
|
return orig["inner" + name].call(this);
|
|
}
|
|
|
|
return this.each(function () {
|
|
$(this).css(type, reduce(this, size) + "px");
|
|
});
|
|
};
|
|
|
|
$.fn["outer" + name] = function (size, margin) {
|
|
if (typeof size !== "number") {
|
|
return orig["outer" + name].call(this, size);
|
|
}
|
|
|
|
return this.each(function () {
|
|
$(this).css(type, reduce(this, size, true, margin) + "px");
|
|
});
|
|
};
|
|
});
|
|
|
|
$.fn.addBack = function (selector) {
|
|
return this.add(selector == null ?
|
|
this.prevObject : this.prevObject.filter(selector)
|
|
);
|
|
};
|
|
}
|
|
|
|
;
|
|
/*!
|
|
* jQuery UI Keycode 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Keycode
|
|
//>>group: Core
|
|
//>>description: Provide keycodes as keynames
|
|
//>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/
|
|
|
|
var keycode = $.ui.keyCode = {
|
|
BACKSPACE: 8,
|
|
COMMA: 188,
|
|
DELETE: 46,
|
|
DOWN: 40,
|
|
END: 35,
|
|
ENTER: 13,
|
|
ESCAPE: 27,
|
|
HOME: 36,
|
|
LEFT: 37,
|
|
PAGE_DOWN: 34,
|
|
PAGE_UP: 33,
|
|
PERIOD: 190,
|
|
RIGHT: 39,
|
|
SPACE: 32,
|
|
TAB: 9,
|
|
UP: 38
|
|
};
|
|
|
|
// Internal use only
|
|
var escapeSelector = $.ui.escapeSelector = (function () {
|
|
var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g;
|
|
return function (selector) {
|
|
return selector.replace(selectorEscape, "\\$1");
|
|
};
|
|
})();
|
|
|
|
/*!
|
|
* jQuery UI Labels 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: labels
|
|
//>>group: Core
|
|
//>>description: Find all the labels associated with a given input
|
|
//>>docs: http://api.jqueryui.com/labels/
|
|
|
|
var labels = $.fn.labels = function () {
|
|
var ancestor, selector, id, labels, ancestors;
|
|
|
|
// Check control.labels first
|
|
if (this[0].labels && this[0].labels.length) {
|
|
return this.pushStack(this[0].labels);
|
|
}
|
|
|
|
// Support: IE <= 11, FF <= 37, Android <= 2.3 only
|
|
// Above browsers do not support control.labels. Everything below is to support them
|
|
// as well as document fragments. control.labels does not work on document fragments
|
|
labels = this.eq(0).parents("label");
|
|
|
|
// Look for the label based on the id
|
|
id = this.attr("id");
|
|
if (id) {
|
|
// We don't search against the document in case the element
|
|
// is disconnected from the DOM
|
|
ancestor = this.eq(0).parents().last();
|
|
|
|
// Get a full set of top level ancestors
|
|
ancestors = ancestor.add(ancestor.length ? ancestor.siblings() : this.siblings());
|
|
|
|
// Create a selector for the label based on the id
|
|
selector = "label[for='" + $.ui.escapeSelector(id) + "']";
|
|
|
|
labels = labels.add(ancestors.find(selector).addBack(selector));
|
|
}
|
|
|
|
// Return whatever we have found for labels
|
|
return this.pushStack(labels);
|
|
};
|
|
|
|
/*!
|
|
* jQuery UI Scroll Parent 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: scrollParent
|
|
//>>group: Core
|
|
//>>description: Get the closest ancestor element that is scrollable.
|
|
//>>docs: http://api.jqueryui.com/scrollParent/
|
|
|
|
var scrollParent = $.fn.scrollParent = function (includeHidden) {
|
|
var position = this.css("position"),
|
|
excludeStaticParent = position === "absolute",
|
|
overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/,
|
|
scrollParent = this.parents().filter(function () {
|
|
var parent = $(this);
|
|
if (excludeStaticParent && parent.css("position") === "static") {
|
|
return false;
|
|
}
|
|
return overflowRegex.test(parent.css("overflow") + parent.css("overflow-y") +
|
|
parent.css("overflow-x"));
|
|
}).eq(0);
|
|
|
|
return position === "fixed" || !scrollParent.length ?
|
|
$(this[0].ownerDocument || document) :
|
|
scrollParent;
|
|
};
|
|
|
|
/*!
|
|
* jQuery UI Tabbable 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: :tabbable Selector
|
|
//>>group: Core
|
|
//>>description: Selects elements which can be tabbed to.
|
|
//>>docs: http://api.jqueryui.com/tabbable-selector/
|
|
|
|
var tabbable = $.extend($.expr[":"], {
|
|
tabbable: function (element) {
|
|
var tabIndex = $.attr(element, "tabindex"),
|
|
hasTabindex = tabIndex != null;
|
|
return (!hasTabindex || tabIndex >= 0) && $.ui.focusable(element, hasTabindex);
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Unique ID 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: uniqueId
|
|
//>>group: Core
|
|
//>>description: Functions to generate and remove uniqueId's
|
|
//>>docs: http://api.jqueryui.com/uniqueId/
|
|
|
|
var uniqueId = $.fn.extend({
|
|
uniqueId: (function () {
|
|
var uuid = 0;
|
|
|
|
return function () {
|
|
return this.each(function () {
|
|
if (!this.id) {
|
|
this.id = "ui-id-" + (++uuid);
|
|
}
|
|
});
|
|
};
|
|
})(),
|
|
|
|
removeUniqueId: function () {
|
|
return this.each(function () {
|
|
if (/^ui-id-\d+$/.test(this.id)) {
|
|
$(this).removeAttr("id");
|
|
}
|
|
});
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Accordion 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Accordion
|
|
//>>group: Widgets
|
|
// jscs:disable maximumLineLength
|
|
//>>description: Displays collapsible content panels for presenting information in a limited amount of space.
|
|
// jscs:enable maximumLineLength
|
|
//>>docs: http://api.jqueryui.com/accordion/
|
|
//>>demos: http://jqueryui.com/accordion/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/accordion.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
var widgetsAccordion = $.widget("ui.accordion", {
|
|
version: "1.12.1",
|
|
options: {
|
|
active: 0,
|
|
animate: {},
|
|
classes: {
|
|
"ui-accordion-header": "ui-corner-top",
|
|
"ui-accordion-header-collapsed": "ui-corner-all",
|
|
"ui-accordion-content": "ui-corner-bottom"
|
|
},
|
|
collapsible: false,
|
|
event: "click",
|
|
header: "> li > :first-child, > :not(li):even",
|
|
heightStyle: "auto",
|
|
icons: {
|
|
activeHeader: "ui-icon-triangle-1-s",
|
|
header: "ui-icon-triangle-1-e"
|
|
},
|
|
|
|
// Callbacks
|
|
activate: null,
|
|
beforeActivate: null
|
|
},
|
|
|
|
hideProps: {
|
|
borderTopWidth: "hide",
|
|
borderBottomWidth: "hide",
|
|
paddingTop: "hide",
|
|
paddingBottom: "hide",
|
|
height: "hide"
|
|
},
|
|
|
|
showProps: {
|
|
borderTopWidth: "show",
|
|
borderBottomWidth: "show",
|
|
paddingTop: "show",
|
|
paddingBottom: "show",
|
|
height: "show"
|
|
},
|
|
|
|
_create: function () {
|
|
var options = this.options;
|
|
|
|
this.prevShow = this.prevHide = $();
|
|
this._addClass("ui-accordion", "ui-widget ui-helper-reset");
|
|
this.element.attr("role", "tablist");
|
|
|
|
// Don't allow collapsible: false and active: false / null
|
|
if (!options.collapsible && (options.active === false || options.active == null)) {
|
|
options.active = 0;
|
|
}
|
|
|
|
this._processPanels();
|
|
|
|
// handle negative values
|
|
if (options.active < 0) {
|
|
options.active += this.headers.length;
|
|
}
|
|
this._refresh();
|
|
},
|
|
|
|
_getCreateEventData: function () {
|
|
return {
|
|
header: this.active,
|
|
panel: !this.active.length ? $() : this.active.next()
|
|
};
|
|
},
|
|
|
|
_createIcons: function () {
|
|
var icon, children,
|
|
icons = this.options.icons;
|
|
|
|
if (icons) {
|
|
icon = $("<span>");
|
|
this._addClass(icon, "ui-accordion-header-icon", "ui-icon " + icons.header);
|
|
icon.prependTo(this.headers);
|
|
children = this.active.children(".ui-accordion-header-icon");
|
|
this._removeClass(children, icons.header)
|
|
._addClass(children, null, icons.activeHeader)
|
|
._addClass(this.headers, "ui-accordion-icons");
|
|
}
|
|
},
|
|
|
|
_destroyIcons: function () {
|
|
this._removeClass(this.headers, "ui-accordion-icons");
|
|
this.headers.children(".ui-accordion-header-icon").remove();
|
|
},
|
|
|
|
_destroy: function () {
|
|
var contents;
|
|
|
|
// Clean up main element
|
|
this.element.removeAttr("role");
|
|
|
|
// Clean up headers
|
|
this.headers
|
|
.removeAttr("role aria-expanded aria-selected aria-controls tabIndex")
|
|
.removeUniqueId();
|
|
|
|
this._destroyIcons();
|
|
|
|
// Clean up content panels
|
|
contents = this.headers.next()
|
|
.css("display", "")
|
|
.removeAttr("role aria-hidden aria-labelledby")
|
|
.removeUniqueId();
|
|
|
|
if (this.options.heightStyle !== "content") {
|
|
contents.css("height", "");
|
|
}
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "active") {
|
|
// _activate() will handle invalid values and update this.options
|
|
this._activate(value);
|
|
return;
|
|
}
|
|
|
|
if (key === "event") {
|
|
if (this.options.event) {
|
|
this._off(this.headers, this.options.event);
|
|
}
|
|
this._setupEvents(value);
|
|
}
|
|
|
|
this._super(key, value);
|
|
|
|
// Setting collapsible: false while collapsed; open first panel
|
|
if (key === "collapsible" && !value && this.options.active === false) {
|
|
this._activate(0);
|
|
}
|
|
|
|
if (key === "icons") {
|
|
this._destroyIcons();
|
|
if (value) {
|
|
this._createIcons();
|
|
}
|
|
}
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this._super(value);
|
|
|
|
this.element.attr("aria-disabled", value);
|
|
|
|
// Support: IE8 Only
|
|
// #5332 / #6059 - opacity doesn't cascade to positioned elements in IE
|
|
// so we need to add the disabled class to the headers and panels
|
|
this._toggleClass(null, "ui-state-disabled", !!value);
|
|
this._toggleClass(this.headers.add(this.headers.next()), null, "ui-state-disabled",
|
|
!!value);
|
|
},
|
|
|
|
_keydown: function (event) {
|
|
if (event.altKey || event.ctrlKey) {
|
|
return;
|
|
}
|
|
|
|
var keyCode = $.ui.keyCode,
|
|
length = this.headers.length,
|
|
currentIndex = this.headers.index(event.target),
|
|
toFocus = false;
|
|
|
|
switch (event.keyCode) {
|
|
case keyCode.RIGHT:
|
|
case keyCode.DOWN:
|
|
toFocus = this.headers[(currentIndex + 1) % length];
|
|
break;
|
|
case keyCode.LEFT:
|
|
case keyCode.UP:
|
|
toFocus = this.headers[(currentIndex - 1 + length) % length];
|
|
break;
|
|
case keyCode.SPACE:
|
|
case keyCode.ENTER:
|
|
this._eventHandler(event);
|
|
break;
|
|
case keyCode.HOME:
|
|
toFocus = this.headers[0];
|
|
break;
|
|
case keyCode.END:
|
|
toFocus = this.headers[length - 1];
|
|
break;
|
|
}
|
|
|
|
if (toFocus) {
|
|
$(event.target).attr("tabIndex", -1);
|
|
$(toFocus).attr("tabIndex", 0);
|
|
$(toFocus).trigger("focus");
|
|
event.preventDefault();
|
|
}
|
|
},
|
|
|
|
_panelKeyDown: function (event) {
|
|
if (event.keyCode === $.ui.keyCode.UP && event.ctrlKey) {
|
|
$(event.currentTarget).prev().trigger("focus");
|
|
}
|
|
},
|
|
|
|
refresh: function () {
|
|
var options = this.options;
|
|
this._processPanels();
|
|
|
|
// Was collapsed or no panel
|
|
if ((options.active === false && options.collapsible === true) ||
|
|
!this.headers.length) {
|
|
options.active = false;
|
|
this.active = $();
|
|
|
|
// active false only when collapsible is true
|
|
} else if (options.active === false) {
|
|
this._activate(0);
|
|
|
|
// was active, but active panel is gone
|
|
} else if (this.active.length && !$.contains(this.element[0], this.active[0])) {
|
|
// all remaining panel are disabled
|
|
if (this.headers.length === this.headers.find(".ui-state-disabled").length) {
|
|
options.active = false;
|
|
this.active = $();
|
|
|
|
// activate previous panel
|
|
} else {
|
|
this._activate(Math.max(0, options.active - 1));
|
|
}
|
|
|
|
// was active, active panel still exists
|
|
} else {
|
|
// make sure active index is correct
|
|
options.active = this.headers.index(this.active);
|
|
}
|
|
|
|
this._destroyIcons();
|
|
|
|
this._refresh();
|
|
},
|
|
|
|
_processPanels: function () {
|
|
var prevHeaders = this.headers,
|
|
prevPanels = this.panels;
|
|
|
|
this.headers = this.element.find(this.options.header);
|
|
this._addClass(this.headers, "ui-accordion-header ui-accordion-header-collapsed",
|
|
"ui-state-default");
|
|
|
|
this.panels = this.headers.next().filter(":not(.ui-accordion-content-active)").hide();
|
|
this._addClass(this.panels, "ui-accordion-content", "ui-helper-reset ui-widget-content");
|
|
|
|
// Avoid memory leaks (#10056)
|
|
if (prevPanels) {
|
|
this._off(prevHeaders.not(this.headers));
|
|
this._off(prevPanels.not(this.panels));
|
|
}
|
|
},
|
|
|
|
_refresh: function () {
|
|
var maxHeight,
|
|
options = this.options,
|
|
heightStyle = options.heightStyle,
|
|
parent = this.element.parent();
|
|
|
|
this.active = this._findActive(options.active);
|
|
this._addClass(this.active, "ui-accordion-header-active", "ui-state-active")
|
|
._removeClass(this.active, "ui-accordion-header-collapsed");
|
|
this._addClass(this.active.next(), "ui-accordion-content-active");
|
|
this.active.next().show();
|
|
|
|
this.headers
|
|
.attr("role", "tab")
|
|
.each(function () {
|
|
var header = $(this),
|
|
headerId = header.uniqueId().attr("id"),
|
|
panel = header.next(),
|
|
panelId = panel.uniqueId().attr("id");
|
|
header.attr("aria-controls", panelId);
|
|
panel.attr("aria-labelledby", headerId);
|
|
})
|
|
.next()
|
|
.attr("role", "tabpanel");
|
|
|
|
this.headers
|
|
.not(this.active)
|
|
.attr({
|
|
"aria-selected": "false",
|
|
"aria-expanded": "false",
|
|
tabIndex: -1
|
|
})
|
|
.next()
|
|
.attr({
|
|
"aria-hidden": "true"
|
|
})
|
|
.hide();
|
|
|
|
// Make sure at least one header is in the tab order
|
|
if (!this.active.length) {
|
|
this.headers.eq(0).attr("tabIndex", 0);
|
|
} else {
|
|
this.active.attr({
|
|
"aria-selected": "true",
|
|
"aria-expanded": "true",
|
|
tabIndex: 0
|
|
})
|
|
.next()
|
|
.attr({
|
|
"aria-hidden": "false"
|
|
});
|
|
}
|
|
|
|
this._createIcons();
|
|
|
|
this._setupEvents(options.event);
|
|
|
|
if (heightStyle === "fill") {
|
|
maxHeight = parent.height();
|
|
this.element.siblings(":visible").each(function () {
|
|
var elem = $(this),
|
|
position = elem.css("position");
|
|
|
|
if (position === "absolute" || position === "fixed") {
|
|
return;
|
|
}
|
|
maxHeight -= elem.outerHeight(true);
|
|
});
|
|
|
|
this.headers.each(function () {
|
|
maxHeight -= $(this).outerHeight(true);
|
|
});
|
|
|
|
this.headers.next()
|
|
.each(function () {
|
|
$(this).height(Math.max(0, maxHeight -
|
|
$(this).innerHeight() + $(this).height()));
|
|
})
|
|
.css("overflow", "auto");
|
|
} else if (heightStyle === "auto") {
|
|
maxHeight = 0;
|
|
this.headers.next()
|
|
.each(function () {
|
|
var isVisible = $(this).is(":visible");
|
|
if (!isVisible) {
|
|
$(this).show();
|
|
}
|
|
maxHeight = Math.max(maxHeight, $(this).css("height", "").height());
|
|
if (!isVisible) {
|
|
$(this).hide();
|
|
}
|
|
})
|
|
.height(maxHeight);
|
|
}
|
|
},
|
|
|
|
_activate: function (index) {
|
|
var active = this._findActive(index)[0];
|
|
|
|
// Trying to activate the already active panel
|
|
if (active === this.active[0]) {
|
|
return;
|
|
}
|
|
|
|
// Trying to collapse, simulate a click on the currently active header
|
|
active = active || this.active[0];
|
|
|
|
this._eventHandler({
|
|
target: active,
|
|
currentTarget: active,
|
|
preventDefault: $.noop
|
|
});
|
|
},
|
|
|
|
_findActive: function (selector) {
|
|
return typeof selector === "number" ? this.headers.eq(selector) : $();
|
|
},
|
|
|
|
_setupEvents: function (event) {
|
|
var events = {
|
|
keydown: "_keydown"
|
|
};
|
|
if (event) {
|
|
$.each(event.split(" "), function (index, eventName) {
|
|
events[eventName] = "_eventHandler";
|
|
});
|
|
}
|
|
|
|
this._off(this.headers.add(this.headers.next()));
|
|
this._on(this.headers, events);
|
|
this._on(this.headers.next(), { keydown: "_panelKeyDown" });
|
|
this._hoverable(this.headers);
|
|
this._focusable(this.headers);
|
|
},
|
|
|
|
_eventHandler: function (event) {
|
|
var activeChildren, clickedChildren,
|
|
options = this.options,
|
|
active = this.active,
|
|
clicked = $(event.currentTarget),
|
|
clickedIsActive = clicked[0] === active[0],
|
|
collapsing = clickedIsActive && options.collapsible,
|
|
toShow = collapsing ? $() : clicked.next(),
|
|
toHide = active.next(),
|
|
eventData = {
|
|
oldHeader: active,
|
|
oldPanel: toHide,
|
|
newHeader: collapsing ? $() : clicked,
|
|
newPanel: toShow
|
|
};
|
|
|
|
event.preventDefault();
|
|
|
|
if (
|
|
|
|
// click on active header, but not collapsible
|
|
(clickedIsActive && !options.collapsible) ||
|
|
|
|
// allow canceling activation
|
|
(this._trigger("beforeActivate", event, eventData) === false)) {
|
|
return;
|
|
}
|
|
|
|
options.active = collapsing ? false : this.headers.index(clicked);
|
|
|
|
// When the call to ._toggle() comes after the class changes
|
|
// it causes a very odd bug in IE 8 (see #6720)
|
|
this.active = clickedIsActive ? $() : clicked;
|
|
this._toggle(eventData);
|
|
|
|
// Switch classes
|
|
// corner classes on the previously active header stay after the animation
|
|
this._removeClass(active, "ui-accordion-header-active", "ui-state-active");
|
|
if (options.icons) {
|
|
activeChildren = active.children(".ui-accordion-header-icon");
|
|
this._removeClass(activeChildren, null, options.icons.activeHeader)
|
|
._addClass(activeChildren, null, options.icons.header);
|
|
}
|
|
|
|
if (!clickedIsActive) {
|
|
this._removeClass(clicked, "ui-accordion-header-collapsed")
|
|
._addClass(clicked, "ui-accordion-header-active", "ui-state-active");
|
|
if (options.icons) {
|
|
clickedChildren = clicked.children(".ui-accordion-header-icon");
|
|
this._removeClass(clickedChildren, null, options.icons.header)
|
|
._addClass(clickedChildren, null, options.icons.activeHeader);
|
|
}
|
|
|
|
this._addClass(clicked.next(), "ui-accordion-content-active");
|
|
}
|
|
},
|
|
|
|
_toggle: function (data) {
|
|
var toShow = data.newPanel,
|
|
toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
|
|
|
|
// Handle activating a panel during the animation for another activation
|
|
this.prevShow.add(this.prevHide).stop(true, true);
|
|
this.prevShow = toShow;
|
|
this.prevHide = toHide;
|
|
|
|
if (this.options.animate) {
|
|
this._animate(toShow, toHide, data);
|
|
} else {
|
|
toHide.hide();
|
|
toShow.show();
|
|
this._toggleComplete(data);
|
|
}
|
|
|
|
toHide.attr({
|
|
"aria-hidden": "true"
|
|
});
|
|
toHide.prev().attr({
|
|
"aria-selected": "false",
|
|
"aria-expanded": "false"
|
|
});
|
|
|
|
// if we're switching panels, remove the old header from the tab order
|
|
// if we're opening from collapsed state, remove the previous header from the tab order
|
|
// if we're collapsing, then keep the collapsing header in the tab order
|
|
if (toShow.length && toHide.length) {
|
|
toHide.prev().attr({
|
|
"tabIndex": -1,
|
|
"aria-expanded": "false"
|
|
});
|
|
} else if (toShow.length) {
|
|
this.headers.filter(function () {
|
|
return parseInt($(this).attr("tabIndex"), 10) === 0;
|
|
})
|
|
.attr("tabIndex", -1);
|
|
}
|
|
|
|
toShow
|
|
.attr("aria-hidden", "false")
|
|
.prev()
|
|
.attr({
|
|
"aria-selected": "true",
|
|
"aria-expanded": "true",
|
|
tabIndex: 0
|
|
});
|
|
},
|
|
|
|
_animate: function (toShow, toHide, data) {
|
|
var total, easing, duration,
|
|
that = this,
|
|
adjust = 0,
|
|
boxSizing = toShow.css("box-sizing"),
|
|
down = toShow.length &&
|
|
(!toHide.length || (toShow.index() < toHide.index())),
|
|
animate = this.options.animate || {},
|
|
options = down && animate.down || animate,
|
|
complete = function () {
|
|
that._toggleComplete(data);
|
|
};
|
|
|
|
if (typeof options === "number") {
|
|
duration = options;
|
|
}
|
|
if (typeof options === "string") {
|
|
easing = options;
|
|
}
|
|
|
|
// fall back from options to animation in case of partial down settings
|
|
easing = easing || options.easing || animate.easing;
|
|
duration = duration || options.duration || animate.duration;
|
|
|
|
if (!toHide.length) {
|
|
return toShow.animate(this.showProps, duration, easing, complete);
|
|
}
|
|
if (!toShow.length) {
|
|
return toHide.animate(this.hideProps, duration, easing, complete);
|
|
}
|
|
|
|
total = toShow.show().outerHeight();
|
|
toHide.animate(this.hideProps, {
|
|
duration: duration,
|
|
easing: easing,
|
|
step: function (now, fx) {
|
|
fx.now = Math.round(now);
|
|
}
|
|
});
|
|
toShow
|
|
.hide()
|
|
.animate(this.showProps, {
|
|
duration: duration,
|
|
easing: easing,
|
|
complete: complete,
|
|
step: function (now, fx) {
|
|
fx.now = Math.round(now);
|
|
if (fx.prop !== "height") {
|
|
if (boxSizing === "content-box") {
|
|
adjust += fx.now;
|
|
}
|
|
} else if (that.options.heightStyle !== "content") {
|
|
fx.now = Math.round(total - toHide.outerHeight() - adjust);
|
|
adjust = 0;
|
|
}
|
|
}
|
|
});
|
|
},
|
|
|
|
_toggleComplete: function (data) {
|
|
var toHide = data.oldPanel,
|
|
prev = toHide.prev();
|
|
|
|
this._removeClass(toHide, "ui-accordion-content-active");
|
|
this._removeClass(prev, "ui-accordion-header-active")
|
|
._addClass(prev, "ui-accordion-header-collapsed");
|
|
|
|
// Work around for rendering bug in IE (#5421)
|
|
if (toHide.length) {
|
|
toHide.parent()[0].className = toHide.parent()[0].className;
|
|
}
|
|
this._trigger("activate", null, data);
|
|
}
|
|
});
|
|
|
|
var safeActiveElement = $.ui.safeActiveElement = function (document) {
|
|
var activeElement;
|
|
|
|
// Support: IE 9 only
|
|
// IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
|
|
try {
|
|
activeElement = document.activeElement;
|
|
} catch (error) {
|
|
activeElement = document.body;
|
|
}
|
|
|
|
// Support: IE 9 - 11 only
|
|
// IE may return null instead of an element
|
|
// Interestingly, this only seems to occur when NOT in an iframe
|
|
if (!activeElement) {
|
|
activeElement = document.body;
|
|
}
|
|
|
|
// Support: IE 11 only
|
|
// IE11 returns a seemingly empty object in some cases when accessing
|
|
// document.activeElement from an <iframe>
|
|
if (!activeElement.nodeName) {
|
|
activeElement = document.body;
|
|
}
|
|
|
|
return activeElement;
|
|
};
|
|
|
|
/*!
|
|
* jQuery UI Menu 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Menu
|
|
//>>group: Widgets
|
|
//>>description: Creates nestable menus.
|
|
//>>docs: http://api.jqueryui.com/menu/
|
|
//>>demos: http://jqueryui.com/menu/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/menu.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
var widgetsMenu = $.widget("ui.menu", {
|
|
version: "1.12.1",
|
|
defaultElement: "<ul>",
|
|
delay: 300,
|
|
options: {
|
|
icons: {
|
|
submenu: "ui-icon-caret-1-e"
|
|
},
|
|
items: "> *",
|
|
menus: "ul",
|
|
position: {
|
|
my: "left top",
|
|
at: "right top"
|
|
},
|
|
role: "menu",
|
|
|
|
// Callbacks
|
|
blur: null,
|
|
focus: null,
|
|
select: null
|
|
},
|
|
|
|
_create: function () {
|
|
this.activeMenu = this.element;
|
|
|
|
// Flag used to prevent firing of the click handler
|
|
// as the event bubbles up through nested menus
|
|
this.mouseHandled = false;
|
|
this.element
|
|
.uniqueId()
|
|
.attr({
|
|
role: this.options.role,
|
|
tabIndex: 0
|
|
});
|
|
|
|
this._addClass("ui-menu", "ui-widget ui-widget-content");
|
|
this._on({
|
|
// Prevent focus from sticking to links inside menu after clicking
|
|
// them (focus should always stay on UL during navigation).
|
|
"mousedown .ui-menu-item": function (event) {
|
|
event.preventDefault();
|
|
},
|
|
"click .ui-menu-item": function (event) {
|
|
var target = $(event.target);
|
|
var active = $($.ui.safeActiveElement(this.document[0]));
|
|
if (!this.mouseHandled && target.not(".ui-state-disabled").length) {
|
|
this.select(event);
|
|
|
|
// Only set the mouseHandled flag if the event will bubble, see #9469.
|
|
if (!event.isPropagationStopped()) {
|
|
this.mouseHandled = true;
|
|
}
|
|
|
|
// Open submenu on click
|
|
if (target.has(".ui-menu").length) {
|
|
this.expand(event);
|
|
} else if (!this.element.is(":focus") &&
|
|
active.closest(".ui-menu").length) {
|
|
// Redirect focus to the menu
|
|
this.element.trigger("focus", [true]);
|
|
|
|
// If the active item is on the top level, let it stay active.
|
|
// Otherwise, blur the active item since it is no longer visible.
|
|
if (this.active && this.active.parents(".ui-menu").length === 1) {
|
|
clearTimeout(this.timer);
|
|
}
|
|
}
|
|
}
|
|
},
|
|
"mouseenter .ui-menu-item": function (event) {
|
|
// Ignore mouse events while typeahead is active, see #10458.
|
|
// Prevents focusing the wrong item when typeahead causes a scroll while the mouse
|
|
// is over an item in the menu
|
|
if (this.previousFilter) {
|
|
return;
|
|
}
|
|
|
|
var actualTarget = $(event.target).closest(".ui-menu-item"),
|
|
target = $(event.currentTarget);
|
|
|
|
// Ignore bubbled events on parent items, see #11641
|
|
if (actualTarget[0] !== target[0]) {
|
|
return;
|
|
}
|
|
|
|
// Remove ui-state-active class from siblings of the newly focused menu item
|
|
// to avoid a jump caused by adjacent elements both having a class with a border
|
|
this._removeClass(target.siblings().children(".ui-state-active"),
|
|
null, "ui-state-active");
|
|
this.focus(event, target);
|
|
},
|
|
mouseleave: "collapseAll",
|
|
"mouseleave .ui-menu": "collapseAll",
|
|
focus: function (event, keepActiveItem) {
|
|
// If there's already an active item, keep it active
|
|
// If not, activate the first item
|
|
var item = this.active || this.element.find(this.options.items).eq(0);
|
|
|
|
if (!keepActiveItem) {
|
|
this.focus(event, item);
|
|
}
|
|
},
|
|
blur: function (event) {
|
|
this._delay(function () {
|
|
var notContained = !$.contains(
|
|
this.element[0],
|
|
$.ui.safeActiveElement(this.document[0])
|
|
);
|
|
if (notContained) {
|
|
this.collapseAll(event);
|
|
}
|
|
});
|
|
},
|
|
keydown: "_keydown"
|
|
});
|
|
|
|
this.refresh();
|
|
|
|
// Clicks outside of a menu collapse any open menus
|
|
this._on(this.document, {
|
|
click: function (event) {
|
|
if (this._closeOnDocumentClick(event)) {
|
|
this.collapseAll(event);
|
|
}
|
|
|
|
// Reset the mouseHandled flag
|
|
this.mouseHandled = false;
|
|
}
|
|
});
|
|
},
|
|
|
|
_destroy: function () {
|
|
var items = this.element.find(".ui-menu-item")
|
|
.removeAttr("role aria-disabled"),
|
|
submenus = items.children(".ui-menu-item-wrapper")
|
|
.removeUniqueId()
|
|
.removeAttr("tabIndex role aria-haspopup");
|
|
|
|
// Destroy (sub)menus
|
|
this.element
|
|
.removeAttr("aria-activedescendant")
|
|
.find(".ui-menu").addBack()
|
|
.removeAttr("role aria-labelledby aria-expanded aria-hidden aria-disabled " +
|
|
"tabIndex")
|
|
.removeUniqueId()
|
|
.show();
|
|
|
|
submenus.children().each(function () {
|
|
var elem = $(this);
|
|
if (elem.data("ui-menu-submenu-caret")) {
|
|
elem.remove();
|
|
}
|
|
});
|
|
},
|
|
|
|
_keydown: function (event) {
|
|
var match, prev, character, skip,
|
|
preventDefault = true;
|
|
|
|
switch (event.keyCode) {
|
|
case $.ui.keyCode.PAGE_UP:
|
|
this.previousPage(event);
|
|
break;
|
|
case $.ui.keyCode.PAGE_DOWN:
|
|
this.nextPage(event);
|
|
break;
|
|
case $.ui.keyCode.HOME:
|
|
this._move("first", "first", event);
|
|
break;
|
|
case $.ui.keyCode.END:
|
|
this._move("last", "last", event);
|
|
break;
|
|
case $.ui.keyCode.UP:
|
|
this.previous(event);
|
|
break;
|
|
case $.ui.keyCode.DOWN:
|
|
this.next(event);
|
|
break;
|
|
case $.ui.keyCode.LEFT:
|
|
this.collapse(event);
|
|
break;
|
|
case $.ui.keyCode.RIGHT:
|
|
if (this.active && !this.active.is(".ui-state-disabled")) {
|
|
this.expand(event);
|
|
}
|
|
break;
|
|
case $.ui.keyCode.ENTER:
|
|
case $.ui.keyCode.SPACE:
|
|
this._activate(event);
|
|
break;
|
|
case $.ui.keyCode.ESCAPE:
|
|
this.collapse(event);
|
|
break;
|
|
default:
|
|
preventDefault = false;
|
|
prev = this.previousFilter || "";
|
|
skip = false;
|
|
|
|
// Support number pad values
|
|
character = event.keyCode >= 96 && event.keyCode <= 105 ?
|
|
(event.keyCode - 96).toString() : String.fromCharCode(event.keyCode);
|
|
|
|
clearTimeout(this.filterTimer);
|
|
|
|
if (character === prev) {
|
|
skip = true;
|
|
} else {
|
|
character = prev + character;
|
|
}
|
|
|
|
match = this._filterMenuItems(character);
|
|
match = skip && match.index(this.active.next()) !== -1 ?
|
|
this.active.nextAll(".ui-menu-item") :
|
|
match;
|
|
|
|
// If no matches on the current filter, reset to the last character pressed
|
|
// to move down the menu to the first item that starts with that character
|
|
if (!match.length) {
|
|
character = String.fromCharCode(event.keyCode);
|
|
match = this._filterMenuItems(character);
|
|
}
|
|
|
|
if (match.length) {
|
|
this.focus(event, match);
|
|
this.previousFilter = character;
|
|
this.filterTimer = this._delay(function () {
|
|
delete this.previousFilter;
|
|
}, 1000);
|
|
} else {
|
|
delete this.previousFilter;
|
|
}
|
|
}
|
|
|
|
if (preventDefault) {
|
|
event.preventDefault();
|
|
}
|
|
},
|
|
|
|
_activate: function (event) {
|
|
if (this.active && !this.active.is(".ui-state-disabled")) {
|
|
if (this.active.children("[aria-haspopup='true']").length) {
|
|
this.expand(event);
|
|
} else {
|
|
this.select(event);
|
|
}
|
|
}
|
|
},
|
|
|
|
refresh: function () {
|
|
var menus, items, newSubmenus, newItems, newWrappers,
|
|
that = this,
|
|
icon = this.options.icons.submenu,
|
|
submenus = this.element.find(this.options.menus);
|
|
|
|
this._toggleClass("ui-menu-icons", null, !!this.element.find(".ui-icon").length);
|
|
|
|
// Initialize nested menus
|
|
newSubmenus = submenus.filter(":not(.ui-menu)")
|
|
.hide()
|
|
.attr({
|
|
role: this.options.role,
|
|
"aria-hidden": "true",
|
|
"aria-expanded": "false"
|
|
})
|
|
.each(function () {
|
|
var menu = $(this),
|
|
item = menu.prev(),
|
|
submenuCaret = $("<span>").data("ui-menu-submenu-caret", true);
|
|
|
|
that._addClass(submenuCaret, "ui-menu-icon", "ui-icon " + icon);
|
|
item
|
|
.attr("aria-haspopup", "true")
|
|
.prepend(submenuCaret);
|
|
menu.attr("aria-labelledby", item.attr("id"));
|
|
});
|
|
|
|
this._addClass(newSubmenus, "ui-menu", "ui-widget ui-widget-content ui-front");
|
|
|
|
menus = submenus.add(this.element);
|
|
items = menus.find(this.options.items);
|
|
|
|
// Initialize menu-items containing spaces and/or dashes only as dividers
|
|
items.not(".ui-menu-item").each(function () {
|
|
var item = $(this);
|
|
if (that._isDivider(item)) {
|
|
that._addClass(item, "ui-menu-divider", "ui-widget-content");
|
|
}
|
|
});
|
|
|
|
// Don't refresh list items that are already adapted
|
|
newItems = items.not(".ui-menu-item, .ui-menu-divider");
|
|
newWrappers = newItems.children()
|
|
.not(".ui-menu")
|
|
.uniqueId()
|
|
.attr({
|
|
tabIndex: -1,
|
|
role: this._itemRole()
|
|
});
|
|
this._addClass(newItems, "ui-menu-item")
|
|
._addClass(newWrappers, "ui-menu-item-wrapper");
|
|
|
|
// Add aria-disabled attribute to any disabled menu item
|
|
items.filter(".ui-state-disabled").attr("aria-disabled", "true");
|
|
|
|
// If the active item has been removed, blur the menu
|
|
if (this.active && !$.contains(this.element[0], this.active[0])) {
|
|
this.blur();
|
|
}
|
|
},
|
|
|
|
_itemRole: function () {
|
|
return {
|
|
menu: "menuitem",
|
|
listbox: "option"
|
|
}[this.options.role];
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "icons") {
|
|
var icons = this.element.find(".ui-menu-icon");
|
|
this._removeClass(icons, null, this.options.icons.submenu)
|
|
._addClass(icons, null, value.submenu);
|
|
}
|
|
this._super(key, value);
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this._super(value);
|
|
|
|
this.element.attr("aria-disabled", String(value));
|
|
this._toggleClass(null, "ui-state-disabled", !!value);
|
|
},
|
|
|
|
focus: function (event, item) {
|
|
var nested, focused, activeParent;
|
|
this.blur(event, event && event.type === "focus");
|
|
|
|
this._scrollIntoView(item);
|
|
|
|
this.active = item.first();
|
|
|
|
focused = this.active.children(".ui-menu-item-wrapper");
|
|
this._addClass(focused, null, "ui-state-active");
|
|
|
|
// Only update aria-activedescendant if there's a role
|
|
// otherwise we assume focus is managed elsewhere
|
|
if (this.options.role) {
|
|
this.element.attr("aria-activedescendant", focused.attr("id"));
|
|
}
|
|
|
|
// Highlight active parent menu item, if any
|
|
activeParent = this.active
|
|
.parent()
|
|
.closest(".ui-menu-item")
|
|
.children(".ui-menu-item-wrapper");
|
|
this._addClass(activeParent, null, "ui-state-active");
|
|
|
|
if (event && event.type === "keydown") {
|
|
this._close();
|
|
} else {
|
|
this.timer = this._delay(function () {
|
|
this._close();
|
|
}, this.delay);
|
|
}
|
|
|
|
nested = item.children(".ui-menu");
|
|
if (nested.length && event && (/^mouse/.test(event.type))) {
|
|
this._startOpening(nested);
|
|
}
|
|
this.activeMenu = item.parent();
|
|
|
|
this._trigger("focus", event, { item: item });
|
|
},
|
|
|
|
_scrollIntoView: function (item) {
|
|
var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
|
|
if (this._hasScroll()) {
|
|
borderTop = parseFloat($.css(this.activeMenu[0], "borderTopWidth")) || 0;
|
|
paddingTop = parseFloat($.css(this.activeMenu[0], "paddingTop")) || 0;
|
|
offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
|
|
scroll = this.activeMenu.scrollTop();
|
|
elementHeight = this.activeMenu.height();
|
|
itemHeight = item.outerHeight();
|
|
|
|
if (offset < 0) {
|
|
this.activeMenu.scrollTop(scroll + offset);
|
|
} else if (offset + itemHeight > elementHeight) {
|
|
this.activeMenu.scrollTop(scroll + offset - elementHeight + itemHeight);
|
|
}
|
|
}
|
|
},
|
|
|
|
blur: function (event, fromFocus) {
|
|
if (!fromFocus) {
|
|
clearTimeout(this.timer);
|
|
}
|
|
|
|
if (!this.active) {
|
|
return;
|
|
}
|
|
|
|
this._removeClass(this.active.children(".ui-menu-item-wrapper"),
|
|
null, "ui-state-active");
|
|
|
|
this._trigger("blur", event, { item: this.active });
|
|
this.active = null;
|
|
},
|
|
|
|
_startOpening: function (submenu) {
|
|
clearTimeout(this.timer);
|
|
|
|
// Don't open if already open fixes a Firefox bug that caused a .5 pixel
|
|
// shift in the submenu position when mousing over the caret icon
|
|
if (submenu.attr("aria-hidden") !== "true") {
|
|
return;
|
|
}
|
|
|
|
this.timer = this._delay(function () {
|
|
this._close();
|
|
this._open(submenu);
|
|
}, this.delay);
|
|
},
|
|
|
|
_open: function (submenu) {
|
|
var position = $.extend({
|
|
of: this.active
|
|
}, this.options.position);
|
|
|
|
clearTimeout(this.timer);
|
|
this.element.find(".ui-menu").not(submenu.parents(".ui-menu"))
|
|
.hide()
|
|
.attr("aria-hidden", "true");
|
|
|
|
submenu
|
|
.show()
|
|
.removeAttr("aria-hidden")
|
|
.attr("aria-expanded", "true")
|
|
.position(position);
|
|
},
|
|
|
|
collapseAll: function (event, all) {
|
|
clearTimeout(this.timer);
|
|
this.timer = this._delay(function () {
|
|
// If we were passed an event, look for the submenu that contains the event
|
|
var currentMenu = all ? this.element :
|
|
$(event && event.target).closest(this.element.find(".ui-menu"));
|
|
|
|
// If we found no valid submenu ancestor, use the main menu to close all
|
|
// sub menus anyway
|
|
if (!currentMenu.length) {
|
|
currentMenu = this.element;
|
|
}
|
|
|
|
this._close(currentMenu);
|
|
|
|
this.blur(event);
|
|
|
|
// Work around active item staying active after menu is blurred
|
|
this._removeClass(currentMenu.find(".ui-state-active"), null, "ui-state-active");
|
|
|
|
this.activeMenu = currentMenu;
|
|
}, this.delay);
|
|
},
|
|
|
|
// With no arguments, closes the currently active menu - if nothing is active
|
|
// it closes all menus. If passed an argument, it will search for menus BELOW
|
|
_close: function (startMenu) {
|
|
if (!startMenu) {
|
|
startMenu = this.active ? this.active.parent() : this.element;
|
|
}
|
|
|
|
startMenu.find(".ui-menu")
|
|
.hide()
|
|
.attr("aria-hidden", "true")
|
|
.attr("aria-expanded", "false");
|
|
},
|
|
|
|
_closeOnDocumentClick: function (event) {
|
|
return !$(event.target).closest(".ui-menu").length;
|
|
},
|
|
|
|
_isDivider: function (item) {
|
|
// Match hyphen, em dash, en dash
|
|
return !/[^\-\u2014\u2013\s]/.test(item.text());
|
|
},
|
|
|
|
collapse: function (event) {
|
|
var newItem = this.active &&
|
|
this.active.parent().closest(".ui-menu-item", this.element);
|
|
if (newItem && newItem.length) {
|
|
this._close();
|
|
this.focus(event, newItem);
|
|
}
|
|
},
|
|
|
|
expand: function (event) {
|
|
var newItem = this.active &&
|
|
this.active
|
|
.children(".ui-menu ")
|
|
.find(this.options.items)
|
|
.first();
|
|
|
|
if (newItem && newItem.length) {
|
|
this._open(newItem.parent());
|
|
|
|
// Delay so Firefox will not hide activedescendant change in expanding submenu from AT
|
|
this._delay(function () {
|
|
this.focus(event, newItem);
|
|
});
|
|
}
|
|
},
|
|
|
|
next: function (event) {
|
|
this._move("next", "first", event);
|
|
},
|
|
|
|
previous: function (event) {
|
|
this._move("prev", "last", event);
|
|
},
|
|
|
|
isFirstItem: function () {
|
|
return this.active && !this.active.prevAll(".ui-menu-item").length;
|
|
},
|
|
|
|
isLastItem: function () {
|
|
return this.active && !this.active.nextAll(".ui-menu-item").length;
|
|
},
|
|
|
|
_move: function (direction, filter, event) {
|
|
var next;
|
|
if (this.active) {
|
|
if (direction === "first" || direction === "last") {
|
|
next = this.active
|
|
[direction === "first" ? "prevAll" : "nextAll"](".ui-menu-item")
|
|
.eq(-1);
|
|
} else {
|
|
next = this.active
|
|
[direction + "All"](".ui-menu-item")
|
|
.eq(0);
|
|
}
|
|
}
|
|
if (!next || !next.length || !this.active) {
|
|
next = this.activeMenu.find(this.options.items)[filter]();
|
|
}
|
|
|
|
this.focus(event, next);
|
|
},
|
|
|
|
nextPage: function (event) {
|
|
var item, base, height;
|
|
|
|
if (!this.active) {
|
|
this.next(event);
|
|
return;
|
|
}
|
|
if (this.isLastItem()) {
|
|
return;
|
|
}
|
|
if (this._hasScroll()) {
|
|
base = this.active.offset().top;
|
|
height = this.element.height();
|
|
this.active.nextAll(".ui-menu-item").each(function () {
|
|
item = $(this);
|
|
return item.offset().top - base - height < 0;
|
|
});
|
|
|
|
this.focus(event, item);
|
|
} else {
|
|
this.focus(event, this.activeMenu.find(this.options.items)
|
|
[!this.active ? "first" : "last"]());
|
|
}
|
|
},
|
|
|
|
previousPage: function (event) {
|
|
var item, base, height;
|
|
if (!this.active) {
|
|
this.next(event);
|
|
return;
|
|
}
|
|
if (this.isFirstItem()) {
|
|
return;
|
|
}
|
|
if (this._hasScroll()) {
|
|
base = this.active.offset().top;
|
|
height = this.element.height();
|
|
this.active.prevAll(".ui-menu-item").each(function () {
|
|
item = $(this);
|
|
return item.offset().top - base + height > 0;
|
|
});
|
|
|
|
this.focus(event, item);
|
|
} else {
|
|
this.focus(event, this.activeMenu.find(this.options.items).first());
|
|
}
|
|
},
|
|
|
|
_hasScroll: function () {
|
|
return this.element.outerHeight() < this.element.prop("scrollHeight");
|
|
},
|
|
|
|
select: function (event) {
|
|
// TODO: It should never be possible to not have an active item at this
|
|
// point, but the tests don't trigger mouseenter before click.
|
|
this.active = this.active || $(event.target).closest(".ui-menu-item");
|
|
var ui = { item: this.active };
|
|
if (!this.active.has(".ui-menu").length) {
|
|
this.collapseAll(event, true);
|
|
}
|
|
this._trigger("select", event, ui);
|
|
},
|
|
|
|
_filterMenuItems: function (character) {
|
|
var escapedCharacter = character.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"),
|
|
regex = new RegExp("^" + escapedCharacter, "i");
|
|
|
|
return this.activeMenu
|
|
.find(this.options.items)
|
|
|
|
// Only match on items, not dividers or other content (#10571)
|
|
.filter(".ui-menu-item")
|
|
.filter(function () {
|
|
return regex.test(
|
|
$.trim($(this).children(".ui-menu-item-wrapper").text()));
|
|
});
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Autocomplete 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Autocomplete
|
|
//>>group: Widgets
|
|
//>>description: Lists suggested words as the user is typing.
|
|
//>>docs: http://api.jqueryui.com/autocomplete/
|
|
//>>demos: http://jqueryui.com/autocomplete/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/autocomplete.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.widget("ui.autocomplete", {
|
|
version: "1.12.1",
|
|
defaultElement: "<input>",
|
|
options: {
|
|
appendTo: null,
|
|
autoFocus: false,
|
|
delay: 300,
|
|
minLength: 1,
|
|
position: {
|
|
my: "left top",
|
|
at: "left bottom",
|
|
collision: "none"
|
|
},
|
|
source: null,
|
|
|
|
// Callbacks
|
|
change: null,
|
|
close: null,
|
|
focus: null,
|
|
open: null,
|
|
response: null,
|
|
search: null,
|
|
select: null
|
|
},
|
|
|
|
requestIndex: 0,
|
|
pending: 0,
|
|
|
|
_create: function () {
|
|
// Some browsers only repeat keydown events, not keypress events,
|
|
// so we use the suppressKeyPress flag to determine if we've already
|
|
// handled the keydown event. #7269
|
|
// Unfortunately the code for & in keypress is the same as the up arrow,
|
|
// so we use the suppressKeyPressRepeat flag to avoid handling keypress
|
|
// events when we know the keydown event was used to modify the
|
|
// search term. #7799
|
|
var suppressKeyPress, suppressKeyPressRepeat, suppressInput,
|
|
nodeName = this.element[0].nodeName.toLowerCase(),
|
|
isTextarea = nodeName === "textarea",
|
|
isInput = nodeName === "input";
|
|
|
|
// Textareas are always multi-line
|
|
// Inputs are always single-line, even if inside a contentEditable element
|
|
// IE also treats inputs as contentEditable
|
|
// All other element types are determined by whether or not they're contentEditable
|
|
this.isMultiLine = isTextarea || !isInput && this._isContentEditable(this.element);
|
|
|
|
this.valueMethod = this.element[isTextarea || isInput ? "val" : "text"];
|
|
this.isNewMenu = true;
|
|
|
|
this._addClass("ui-autocomplete-input");
|
|
this.element.attr("autocomplete", "off");
|
|
|
|
this._on(this.element, {
|
|
keydown: function (event) {
|
|
if (this.element.prop("readOnly")) {
|
|
suppressKeyPress = true;
|
|
suppressInput = true;
|
|
suppressKeyPressRepeat = true;
|
|
return;
|
|
}
|
|
|
|
suppressKeyPress = false;
|
|
suppressInput = false;
|
|
suppressKeyPressRepeat = false;
|
|
var keyCode = $.ui.keyCode;
|
|
switch (event.keyCode) {
|
|
case keyCode.PAGE_UP:
|
|
suppressKeyPress = true;
|
|
this._move("previousPage", event);
|
|
break;
|
|
case keyCode.PAGE_DOWN:
|
|
suppressKeyPress = true;
|
|
this._move("nextPage", event);
|
|
break;
|
|
case keyCode.UP:
|
|
suppressKeyPress = true;
|
|
this._keyEvent("previous", event);
|
|
break;
|
|
case keyCode.DOWN:
|
|
suppressKeyPress = true;
|
|
this._keyEvent("next", event);
|
|
break;
|
|
case keyCode.ENTER:
|
|
|
|
// when menu is open and has focus
|
|
if (this.menu.active) {
|
|
// #6055 - Opera still allows the keypress to occur
|
|
// which causes forms to submit
|
|
suppressKeyPress = true;
|
|
event.preventDefault();
|
|
this.menu.select(event);
|
|
}
|
|
break;
|
|
case keyCode.TAB:
|
|
if (this.menu.active) {
|
|
this.menu.select(event);
|
|
}
|
|
break;
|
|
case keyCode.ESCAPE:
|
|
if (this.menu.element.is(":visible")) {
|
|
if (!this.isMultiLine) {
|
|
this._value(this.term);
|
|
}
|
|
this.close(event);
|
|
|
|
// Different browsers have different default behavior for escape
|
|
// Single press can mean undo or clear
|
|
// Double press in IE means clear the whole form
|
|
event.preventDefault();
|
|
}
|
|
break;
|
|
default:
|
|
suppressKeyPressRepeat = true;
|
|
|
|
// search timeout should be triggered before the input value is changed
|
|
this._searchTimeout(event);
|
|
break;
|
|
}
|
|
},
|
|
keypress: function (event) {
|
|
if (suppressKeyPress) {
|
|
suppressKeyPress = false;
|
|
if (!this.isMultiLine || this.menu.element.is(":visible")) {
|
|
event.preventDefault();
|
|
}
|
|
return;
|
|
}
|
|
if (suppressKeyPressRepeat) {
|
|
return;
|
|
}
|
|
|
|
// Replicate some key handlers to allow them to repeat in Firefox and Opera
|
|
var keyCode = $.ui.keyCode;
|
|
switch (event.keyCode) {
|
|
case keyCode.PAGE_UP:
|
|
this._move("previousPage", event);
|
|
break;
|
|
case keyCode.PAGE_DOWN:
|
|
this._move("nextPage", event);
|
|
break;
|
|
case keyCode.UP:
|
|
this._keyEvent("previous", event);
|
|
break;
|
|
case keyCode.DOWN:
|
|
this._keyEvent("next", event);
|
|
break;
|
|
}
|
|
},
|
|
input: function (event) {
|
|
if (suppressInput) {
|
|
suppressInput = false;
|
|
event.preventDefault();
|
|
return;
|
|
}
|
|
this._searchTimeout(event);
|
|
},
|
|
focus: function () {
|
|
this.selectedItem = null;
|
|
this.previous = this._value();
|
|
},
|
|
blur: function (event) {
|
|
if (this.cancelBlur) {
|
|
delete this.cancelBlur;
|
|
return;
|
|
}
|
|
|
|
clearTimeout(this.searching);
|
|
this.close(event);
|
|
this._change(event);
|
|
}
|
|
});
|
|
|
|
this._initSource();
|
|
this.menu = $("<ul>")
|
|
.appendTo(this._appendTo())
|
|
.menu({
|
|
// disable ARIA support, the live region takes care of that
|
|
role: null
|
|
})
|
|
.hide()
|
|
.menu("instance");
|
|
|
|
this._addClass(this.menu.element, "ui-autocomplete", "ui-front");
|
|
this._on(this.menu.element, {
|
|
mousedown: function (event) {
|
|
// prevent moving focus out of the text field
|
|
event.preventDefault();
|
|
|
|
// IE doesn't prevent moving focus even with event.preventDefault()
|
|
// so we set a flag to know when we should ignore the blur event
|
|
this.cancelBlur = true;
|
|
this._delay(function () {
|
|
delete this.cancelBlur;
|
|
|
|
// Support: IE 8 only
|
|
// Right clicking a menu item or selecting text from the menu items will
|
|
// result in focus moving out of the input. However, we've already received
|
|
// and ignored the blur event because of the cancelBlur flag set above. So
|
|
// we restore focus to ensure that the menu closes properly based on the user's
|
|
// next actions.
|
|
if (this.element[0] !== $.ui.safeActiveElement(this.document[0])) {
|
|
this.element.trigger("focus");
|
|
}
|
|
});
|
|
},
|
|
menufocus: function (event, ui) {
|
|
var label, item;
|
|
|
|
// support: Firefox
|
|
// Prevent accidental activation of menu items in Firefox (#7024 #9118)
|
|
if (this.isNewMenu) {
|
|
this.isNewMenu = false;
|
|
if (event.originalEvent && /^mouse/.test(event.originalEvent.type)) {
|
|
this.menu.blur();
|
|
|
|
this.document.one("mousemove", function () {
|
|
$(event.target).trigger(event.originalEvent);
|
|
});
|
|
|
|
return;
|
|
}
|
|
}
|
|
|
|
item = ui.item.data("ui-autocomplete-item");
|
|
if (false !== this._trigger("focus", event, { item: item })) {
|
|
// use value to match what will end up in the input, if it was a key event
|
|
if (event.originalEvent && /^key/.test(event.originalEvent.type)) {
|
|
this._value(item.value);
|
|
}
|
|
}
|
|
|
|
// Announce the value in the liveRegion
|
|
label = ui.item.attr("aria-label") || item.value;
|
|
if (label && $.trim(label).length) {
|
|
this.liveRegion.children().hide();
|
|
$("<div>").text(label).appendTo(this.liveRegion);
|
|
}
|
|
},
|
|
menuselect: function (event, ui) {
|
|
var item = ui.item.data("ui-autocomplete-item"),
|
|
previous = this.previous;
|
|
|
|
// Only trigger when focus was lost (click on menu)
|
|
if (this.element[0] !== $.ui.safeActiveElement(this.document[0])) {
|
|
this.element.trigger("focus");
|
|
this.previous = previous;
|
|
|
|
// #6109 - IE triggers two focus events and the second
|
|
// is asynchronous, so we need to reset the previous
|
|
// term synchronously and asynchronously :-(
|
|
this._delay(function () {
|
|
this.previous = previous;
|
|
this.selectedItem = item;
|
|
});
|
|
}
|
|
|
|
if (false !== this._trigger("select", event, { item: item })) {
|
|
this._value(item.value);
|
|
}
|
|
|
|
// reset the term after the select event
|
|
// this allows custom select handling to work properly
|
|
this.term = this._value();
|
|
|
|
this.close(event);
|
|
this.selectedItem = item;
|
|
}
|
|
});
|
|
|
|
this.liveRegion = $("<div>", {
|
|
role: "status",
|
|
"aria-live": "assertive",
|
|
"aria-relevant": "additions"
|
|
})
|
|
.appendTo(this.document[0].body);
|
|
|
|
this._addClass(this.liveRegion, null, "ui-helper-hidden-accessible");
|
|
|
|
// Turning off autocomplete prevents the browser from remembering the
|
|
// value when navigating through history, so we re-enable autocomplete
|
|
// if the page is unloaded before the widget is destroyed. #7790
|
|
this._on(this.window, {
|
|
beforeunload: function () {
|
|
this.element.removeAttr("autocomplete");
|
|
}
|
|
});
|
|
},
|
|
|
|
_destroy: function () {
|
|
clearTimeout(this.searching);
|
|
this.element.removeAttr("autocomplete");
|
|
this.menu.element.remove();
|
|
this.liveRegion.remove();
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
this._super(key, value);
|
|
if (key === "source") {
|
|
this._initSource();
|
|
}
|
|
if (key === "appendTo") {
|
|
this.menu.element.appendTo(this._appendTo());
|
|
}
|
|
if (key === "disabled" && value && this.xhr) {
|
|
this.xhr.abort();
|
|
}
|
|
},
|
|
|
|
_isEventTargetInWidget: function (event) {
|
|
var menuElement = this.menu.element[0];
|
|
|
|
return event.target === this.element[0] ||
|
|
event.target === menuElement ||
|
|
$.contains(menuElement, event.target);
|
|
},
|
|
|
|
_closeOnClickOutside: function (event) {
|
|
if (!this._isEventTargetInWidget(event)) {
|
|
this.close();
|
|
}
|
|
},
|
|
|
|
_appendTo: function () {
|
|
var element = this.options.appendTo;
|
|
|
|
if (element) {
|
|
element = element.jquery || element.nodeType ?
|
|
$(element) :
|
|
this.document.find(element).eq(0);
|
|
}
|
|
|
|
if (!element || !element[0]) {
|
|
element = this.element.closest(".ui-front, dialog");
|
|
}
|
|
|
|
if (!element.length) {
|
|
element = this.document[0].body;
|
|
}
|
|
|
|
return element;
|
|
},
|
|
|
|
_initSource: function () {
|
|
var array, url,
|
|
that = this;
|
|
if ($.isArray(this.options.source)) {
|
|
array = this.options.source;
|
|
this.source = function (request, response) {
|
|
response($.ui.autocomplete.filter(array, request.term));
|
|
};
|
|
} else if (typeof this.options.source === "string") {
|
|
url = this.options.source;
|
|
this.source = function (request, response) {
|
|
if (that.xhr) {
|
|
that.xhr.abort();
|
|
}
|
|
that.xhr = $.ajax({
|
|
url: url,
|
|
data: request,
|
|
dataType: "json",
|
|
success: function (data) {
|
|
response(data);
|
|
},
|
|
error: function () {
|
|
response([]);
|
|
}
|
|
});
|
|
};
|
|
} else {
|
|
this.source = this.options.source;
|
|
}
|
|
},
|
|
|
|
_searchTimeout: function (event) {
|
|
clearTimeout(this.searching);
|
|
this.searching = this._delay(function () {
|
|
// Search if the value has changed, or if the user retypes the same value (see #7434)
|
|
var equalValues = this.term === this._value(),
|
|
menuVisible = this.menu.element.is(":visible"),
|
|
modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey;
|
|
|
|
if (!equalValues || (equalValues && !menuVisible && !modifierKey)) {
|
|
this.selectedItem = null;
|
|
this.search(null, event);
|
|
}
|
|
}, this.options.delay);
|
|
},
|
|
|
|
search: function (value, event) {
|
|
value = value != null ? value : this._value();
|
|
|
|
// Always save the actual value, not the one passed as an argument
|
|
this.term = this._value();
|
|
|
|
if (value.length < this.options.minLength) {
|
|
return this.close(event);
|
|
}
|
|
|
|
if (this._trigger("search", event) === false) {
|
|
return;
|
|
}
|
|
|
|
return this._search(value);
|
|
},
|
|
|
|
_search: function (value) {
|
|
this.pending++;
|
|
this._addClass("ui-autocomplete-loading");
|
|
this.cancelSearch = false;
|
|
|
|
this.source({ term: value }, this._response());
|
|
},
|
|
|
|
_response: function () {
|
|
var index = ++this.requestIndex;
|
|
|
|
return $.proxy(function (content) {
|
|
if (index === this.requestIndex) {
|
|
this.__response(content);
|
|
}
|
|
|
|
this.pending--;
|
|
if (!this.pending) {
|
|
this._removeClass("ui-autocomplete-loading");
|
|
}
|
|
}, this);
|
|
},
|
|
|
|
__response: function (content) {
|
|
if (content) {
|
|
content = this._normalize(content);
|
|
}
|
|
this._trigger("response", null, { content: content });
|
|
if (!this.options.disabled && content && content.length && !this.cancelSearch) {
|
|
this._suggest(content);
|
|
this._trigger("open");
|
|
} else {
|
|
// use ._close() instead of .close() so we don't cancel future searches
|
|
this._close();
|
|
}
|
|
},
|
|
|
|
close: function (event) {
|
|
this.cancelSearch = true;
|
|
this._close(event);
|
|
},
|
|
|
|
_close: function (event) {
|
|
// Remove the handler that closes the menu on outside clicks
|
|
this._off(this.document, "mousedown");
|
|
|
|
if (this.menu.element.is(":visible")) {
|
|
this.menu.element.hide();
|
|
this.menu.blur();
|
|
this.isNewMenu = true;
|
|
this._trigger("close", event);
|
|
}
|
|
},
|
|
|
|
_change: function (event) {
|
|
if (this.previous !== this._value()) {
|
|
this._trigger("change", event, { item: this.selectedItem });
|
|
}
|
|
},
|
|
|
|
_normalize: function (items) {
|
|
// assume all items have the right format when the first item is complete
|
|
if (items.length && items[0].label && items[0].value) {
|
|
return items;
|
|
}
|
|
return $.map(items, function (item) {
|
|
if (typeof item === "string") {
|
|
return {
|
|
label: item,
|
|
value: item
|
|
};
|
|
}
|
|
return $.extend({}, item, {
|
|
label: item.label || item.value,
|
|
value: item.value || item.label
|
|
});
|
|
});
|
|
},
|
|
|
|
_suggest: function (items) {
|
|
var ul = this.menu.element.empty();
|
|
this._renderMenu(ul, items);
|
|
this.isNewMenu = true;
|
|
this.menu.refresh();
|
|
|
|
// Size and position menu
|
|
ul.show();
|
|
this._resizeMenu();
|
|
ul.position($.extend({
|
|
of: this.element
|
|
}, this.options.position));
|
|
|
|
if (this.options.autoFocus) {
|
|
this.menu.next();
|
|
}
|
|
|
|
// Listen for interactions outside of the widget (#6642)
|
|
this._on(this.document, {
|
|
mousedown: "_closeOnClickOutside"
|
|
});
|
|
},
|
|
|
|
_resizeMenu: function () {
|
|
var ul = this.menu.element;
|
|
ul.outerWidth(Math.max(
|
|
|
|
// Firefox wraps long text (possibly a rounding bug)
|
|
// so we add 1px to avoid the wrapping (#7513)
|
|
ul.width("").outerWidth() + 1,
|
|
this.element.outerWidth()
|
|
));
|
|
},
|
|
|
|
_renderMenu: function (ul, items) {
|
|
var that = this;
|
|
$.each(items, function (index, item) {
|
|
that._renderItemData(ul, item);
|
|
});
|
|
},
|
|
|
|
_renderItemData: function (ul, item) {
|
|
return this._renderItem(ul, item).data("ui-autocomplete-item", item);
|
|
},
|
|
|
|
_renderItem: function (ul, item) {
|
|
return $("<li>")
|
|
.append($("<div>").text(item.label))
|
|
.appendTo(ul);
|
|
},
|
|
|
|
_move: function (direction, event) {
|
|
if (!this.menu.element.is(":visible")) {
|
|
this.search(null, event);
|
|
return;
|
|
}
|
|
if (this.menu.isFirstItem() && /^previous/.test(direction) ||
|
|
this.menu.isLastItem() && /^next/.test(direction)) {
|
|
if (!this.isMultiLine) {
|
|
this._value(this.term);
|
|
}
|
|
|
|
this.menu.blur();
|
|
return;
|
|
}
|
|
this.menu[direction](event);
|
|
},
|
|
|
|
widget: function () {
|
|
return this.menu.element;
|
|
},
|
|
|
|
_value: function () {
|
|
return this.valueMethod.apply(this.element, arguments);
|
|
},
|
|
|
|
_keyEvent: function (keyEvent, event) {
|
|
if (!this.isMultiLine || this.menu.element.is(":visible")) {
|
|
this._move(keyEvent, event);
|
|
|
|
// Prevents moving cursor to beginning/end of the text field in some browsers
|
|
event.preventDefault();
|
|
}
|
|
},
|
|
|
|
// Support: Chrome <=50
|
|
// We should be able to just use this.element.prop( "isContentEditable" )
|
|
// but hidden elements always report false in Chrome.
|
|
// https://code.google.com/p/chromium/issues/detail?id=313082
|
|
_isContentEditable: function (element) {
|
|
if (!element.length) {
|
|
return false;
|
|
}
|
|
|
|
var editable = element.prop("contentEditable");
|
|
|
|
if (editable === "inherit") {
|
|
return this._isContentEditable(element.parent());
|
|
}
|
|
|
|
return editable === "true";
|
|
}
|
|
});
|
|
|
|
$.extend($.ui.autocomplete, {
|
|
escapeRegex: function (value) {
|
|
return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&");
|
|
},
|
|
filter: function (array, term) {
|
|
var matcher = new RegExp($.ui.autocomplete.escapeRegex(term), "i");
|
|
return $.grep(array, function (value) {
|
|
return matcher.test(value.label || value.value || value);
|
|
});
|
|
}
|
|
});
|
|
|
|
// Live region extension, adding a `messages` option
|
|
// NOTE: This is an experimental API. We are still investigating
|
|
// a full solution for string manipulation and internationalization.
|
|
$.widget("ui.autocomplete", $.ui.autocomplete, {
|
|
options: {
|
|
messages: {
|
|
noResults: "No search results.",
|
|
results: function (amount) {
|
|
return amount + (amount > 1 ? " results are" : " result is") +
|
|
" available, use up and down arrow keys to navigate.";
|
|
}
|
|
}
|
|
},
|
|
|
|
__response: function (content) {
|
|
var message;
|
|
this._superApply(arguments);
|
|
if (this.options.disabled || this.cancelSearch) {
|
|
return;
|
|
}
|
|
if (content && content.length) {
|
|
message = this.options.messages.results(content.length);
|
|
} else {
|
|
message = this.options.messages.noResults;
|
|
}
|
|
this.liveRegion.children().hide();
|
|
$("<div>").text(message).appendTo(this.liveRegion);
|
|
}
|
|
});
|
|
|
|
var widgetsAutocomplete = $.ui.autocomplete;
|
|
|
|
/*!
|
|
* jQuery UI Controlgroup 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Controlgroup
|
|
//>>group: Widgets
|
|
//>>description: Visually groups form control widgets
|
|
//>>docs: http://api.jqueryui.com/controlgroup/
|
|
//>>demos: http://jqueryui.com/controlgroup/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/controlgroup.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g;
|
|
|
|
var widgetsControlgroup = $.widget("ui.controlgroup", {
|
|
version: "1.12.1",
|
|
defaultElement: "<div>",
|
|
options: {
|
|
direction: "horizontal",
|
|
disabled: null,
|
|
onlyVisible: true,
|
|
items: {
|
|
"button": "input[type=button], input[type=submit], input[type=reset], button, a",
|
|
"controlgroupLabel": ".ui-controlgroup-label",
|
|
"checkboxradio": "input[type='checkbox'], input[type='radio']",
|
|
"selectmenu": "select",
|
|
"spinner": ".ui-spinner-input"
|
|
}
|
|
},
|
|
|
|
_create: function () {
|
|
this._enhance();
|
|
},
|
|
|
|
// To support the enhanced option in jQuery Mobile, we isolate DOM manipulation
|
|
_enhance: function () {
|
|
this.element.attr("role", "toolbar");
|
|
this.refresh();
|
|
},
|
|
|
|
_destroy: function () {
|
|
this._callChildMethod("destroy");
|
|
this.childWidgets.removeData("ui-controlgroup-data");
|
|
this.element.removeAttr("role");
|
|
if (this.options.items.controlgroupLabel) {
|
|
this.element
|
|
.find(this.options.items.controlgroupLabel)
|
|
.find(".ui-controlgroup-label-contents")
|
|
.contents().unwrap();
|
|
}
|
|
},
|
|
|
|
_initWidgets: function () {
|
|
var that = this,
|
|
childWidgets = [];
|
|
|
|
// First we iterate over each of the items options
|
|
$.each(this.options.items, function (widget, selector) {
|
|
var labels;
|
|
var options = {};
|
|
|
|
// Make sure the widget has a selector set
|
|
if (!selector) {
|
|
return;
|
|
}
|
|
|
|
if (widget === "controlgroupLabel") {
|
|
labels = that.element.find(selector);
|
|
labels.each(function () {
|
|
var element = $(this);
|
|
|
|
if (element.children(".ui-controlgroup-label-contents").length) {
|
|
return;
|
|
}
|
|
element.contents()
|
|
.wrapAll("<span class='ui-controlgroup-label-contents'></span>");
|
|
});
|
|
that._addClass(labels, null, "ui-widget ui-widget-content ui-state-default");
|
|
childWidgets = childWidgets.concat(labels.get());
|
|
return;
|
|
}
|
|
|
|
// Make sure the widget actually exists
|
|
if (!$.fn[widget]) {
|
|
return;
|
|
}
|
|
|
|
// We assume everything is in the middle to start because we can't determine
|
|
// first / last elements until all enhancments are done.
|
|
if (that["_" + widget + "Options"]) {
|
|
options = that["_" + widget + "Options"]("middle");
|
|
} else {
|
|
options = { classes: {} };
|
|
}
|
|
|
|
// Find instances of this widget inside controlgroup and init them
|
|
that.element
|
|
.find(selector)
|
|
.each(function () {
|
|
var element = $(this);
|
|
var instance = element[widget]("instance");
|
|
|
|
// We need to clone the default options for this type of widget to avoid
|
|
// polluting the variable options which has a wider scope than a single widget.
|
|
var instanceOptions = $.widget.extend({}, options);
|
|
|
|
// If the button is the child of a spinner ignore it
|
|
// TODO: Find a more generic solution
|
|
if (widget === "button" && element.parent(".ui-spinner").length) {
|
|
return;
|
|
}
|
|
|
|
// Create the widget if it doesn't exist
|
|
if (!instance) {
|
|
instance = element[widget]()[widget]("instance");
|
|
}
|
|
if (instance) {
|
|
instanceOptions.classes =
|
|
that._resolveClassesValues(instanceOptions.classes, instance);
|
|
}
|
|
element[widget](instanceOptions);
|
|
|
|
// Store an instance of the controlgroup to be able to reference
|
|
// from the outermost element for changing options and refresh
|
|
var widgetElement = element[widget]("widget");
|
|
$.data(widgetElement[0], "ui-controlgroup-data",
|
|
instance ? instance : element[widget]("instance"));
|
|
|
|
childWidgets.push(widgetElement[0]);
|
|
});
|
|
});
|
|
|
|
this.childWidgets = $($.unique(childWidgets));
|
|
this._addClass(this.childWidgets, "ui-controlgroup-item");
|
|
},
|
|
|
|
_callChildMethod: function (method) {
|
|
this.childWidgets.each(function () {
|
|
var element = $(this),
|
|
data = element.data("ui-controlgroup-data");
|
|
if (data && data[method]) {
|
|
data[method]();
|
|
}
|
|
});
|
|
},
|
|
|
|
_updateCornerClass: function (element, position) {
|
|
var remove = "ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all";
|
|
var add = this._buildSimpleOptions(position, "label").classes.label;
|
|
|
|
this._removeClass(element, null, remove);
|
|
this._addClass(element, null, add);
|
|
},
|
|
|
|
_buildSimpleOptions: function (position, key) {
|
|
var direction = this.options.direction === "vertical";
|
|
var result = {
|
|
classes: {}
|
|
};
|
|
result.classes[key] = {
|
|
"middle": "",
|
|
"first": "ui-corner-" + (direction ? "top" : "left"),
|
|
"last": "ui-corner-" + (direction ? "bottom" : "right"),
|
|
"only": "ui-corner-all"
|
|
}[position];
|
|
|
|
return result;
|
|
},
|
|
|
|
_spinnerOptions: function (position) {
|
|
var options = this._buildSimpleOptions(position, "ui-spinner");
|
|
|
|
options.classes["ui-spinner-up"] = "";
|
|
options.classes["ui-spinner-down"] = "";
|
|
|
|
return options;
|
|
},
|
|
|
|
_buttonOptions: function (position) {
|
|
return this._buildSimpleOptions(position, "ui-button");
|
|
},
|
|
|
|
_checkboxradioOptions: function (position) {
|
|
return this._buildSimpleOptions(position, "ui-checkboxradio-label");
|
|
},
|
|
|
|
_selectmenuOptions: function (position) {
|
|
var direction = this.options.direction === "vertical";
|
|
return {
|
|
width: direction ? "auto" : false,
|
|
classes: {
|
|
middle: {
|
|
"ui-selectmenu-button-open": "",
|
|
"ui-selectmenu-button-closed": ""
|
|
},
|
|
first: {
|
|
"ui-selectmenu-button-open": "ui-corner-" + (direction ? "top" : "tl"),
|
|
"ui-selectmenu-button-closed": "ui-corner-" + (direction ? "top" : "left")
|
|
},
|
|
last: {
|
|
"ui-selectmenu-button-open": direction ? "" : "ui-corner-tr",
|
|
"ui-selectmenu-button-closed": "ui-corner-" + (direction ? "bottom" : "right")
|
|
},
|
|
only: {
|
|
"ui-selectmenu-button-open": "ui-corner-top",
|
|
"ui-selectmenu-button-closed": "ui-corner-all"
|
|
}
|
|
}[position]
|
|
};
|
|
},
|
|
|
|
_resolveClassesValues: function (classes, instance) {
|
|
var result = {};
|
|
$.each(classes, function (key) {
|
|
var current = instance.options.classes[key] || "";
|
|
current = $.trim(current.replace(controlgroupCornerRegex, ""));
|
|
result[key] = (current + " " + classes[key]).replace(/\s+/g, " ");
|
|
});
|
|
return result;
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "direction") {
|
|
this._removeClass("ui-controlgroup-" + this.options.direction);
|
|
}
|
|
|
|
this._super(key, value);
|
|
if (key === "disabled") {
|
|
this._callChildMethod(value ? "disable" : "enable");
|
|
return;
|
|
}
|
|
|
|
this.refresh();
|
|
},
|
|
|
|
refresh: function () {
|
|
var children,
|
|
that = this;
|
|
|
|
this._addClass("ui-controlgroup ui-controlgroup-" + this.options.direction);
|
|
|
|
if (this.options.direction === "horizontal") {
|
|
this._addClass(null, "ui-helper-clearfix");
|
|
}
|
|
this._initWidgets();
|
|
|
|
children = this.childWidgets;
|
|
|
|
// We filter here because we need to track all childWidgets not just the visible ones
|
|
if (this.options.onlyVisible) {
|
|
children = children.filter(":visible");
|
|
}
|
|
|
|
if (children.length) {
|
|
// We do this last because we need to make sure all enhancment is done
|
|
// before determining first and last
|
|
$.each(["first", "last"], function (index, value) {
|
|
var instance = children[value]().data("ui-controlgroup-data");
|
|
|
|
if (instance && that["_" + instance.widgetName + "Options"]) {
|
|
var options = that["_" + instance.widgetName + "Options"](
|
|
children.length === 1 ? "only" : value
|
|
);
|
|
options.classes = that._resolveClassesValues(options.classes, instance);
|
|
instance.element[instance.widgetName](options);
|
|
} else {
|
|
that._updateCornerClass(children[value](), value);
|
|
}
|
|
});
|
|
|
|
// Finally call the refresh method on each of the child widgets.
|
|
this._callChildMethod("refresh");
|
|
}
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Checkboxradio 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Checkboxradio
|
|
//>>group: Widgets
|
|
//>>description: Enhances a form with multiple themeable checkboxes or radio buttons.
|
|
//>>docs: http://api.jqueryui.com/checkboxradio/
|
|
//>>demos: http://jqueryui.com/checkboxradio/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/button.css
|
|
//>>css.structure: ../../themes/base/checkboxradio.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.widget("ui.checkboxradio", [$.ui.formResetMixin, {
|
|
version: "1.12.1",
|
|
options: {
|
|
disabled: null,
|
|
label: null,
|
|
icon: true,
|
|
classes: {
|
|
"ui-checkboxradio-label": "ui-corner-all",
|
|
"ui-checkboxradio-icon": "ui-corner-all"
|
|
}
|
|
},
|
|
|
|
_getCreateOptions: function () {
|
|
var disabled, labels;
|
|
var that = this;
|
|
var options = this._super() || {};
|
|
|
|
// We read the type here, because it makes more sense to throw a element type error first,
|
|
// rather then the error for lack of a label. Often if its the wrong type, it
|
|
// won't have a label (e.g. calling on a div, btn, etc)
|
|
this._readType();
|
|
|
|
labels = this.element.labels();
|
|
|
|
// If there are multiple labels, use the last one
|
|
this.label = $(labels[labels.length - 1]);
|
|
if (!this.label.length) {
|
|
$.error("No label found for checkboxradio widget");
|
|
}
|
|
|
|
this.originalLabel = "";
|
|
|
|
// We need to get the label text but this may also need to make sure it does not contain the
|
|
// input itself.
|
|
this.label.contents().not(this.element[0]).each(function () {
|
|
// The label contents could be text, html, or a mix. We concat each element to get a
|
|
// string representation of the label, without the input as part of it.
|
|
that.originalLabel += this.nodeType === 3 ? $(this).text() : this.outerHTML;
|
|
});
|
|
|
|
// Set the label option if we found label text
|
|
if (this.originalLabel) {
|
|
options.label = this.originalLabel;
|
|
}
|
|
|
|
disabled = this.element[0].disabled;
|
|
if (disabled != null) {
|
|
options.disabled = disabled;
|
|
}
|
|
return options;
|
|
},
|
|
|
|
_create: function () {
|
|
var checked = this.element[0].checked;
|
|
|
|
this._bindFormResetHandler();
|
|
|
|
if (this.options.disabled == null) {
|
|
this.options.disabled = this.element[0].disabled;
|
|
}
|
|
|
|
this._setOption("disabled", this.options.disabled);
|
|
this._addClass("ui-checkboxradio", "ui-helper-hidden-accessible");
|
|
this._addClass(this.label, "ui-checkboxradio-label", "ui-button ui-widget");
|
|
|
|
if (this.type === "radio") {
|
|
this._addClass(this.label, "ui-checkboxradio-radio-label");
|
|
}
|
|
|
|
if (this.options.label && this.options.label !== this.originalLabel) {
|
|
this._updateLabel();
|
|
} else if (this.originalLabel) {
|
|
this.options.label = this.originalLabel;
|
|
}
|
|
|
|
this._enhance();
|
|
|
|
if (checked) {
|
|
this._addClass(this.label, "ui-checkboxradio-checked", "ui-state-active");
|
|
if (this.icon) {
|
|
this._addClass(this.icon, null, "ui-state-hover");
|
|
}
|
|
}
|
|
|
|
this._on({
|
|
change: "_toggleClasses",
|
|
focus: function () {
|
|
this._addClass(this.label, null, "ui-state-focus ui-visual-focus");
|
|
},
|
|
blur: function () {
|
|
this._removeClass(this.label, null, "ui-state-focus ui-visual-focus");
|
|
}
|
|
});
|
|
},
|
|
|
|
_readType: function () {
|
|
var nodeName = this.element[0].nodeName.toLowerCase();
|
|
this.type = this.element[0].type;
|
|
if (nodeName !== "input" || !/radio|checkbox/.test(this.type)) {
|
|
$.error("Can't create checkboxradio on element.nodeName=" + nodeName +
|
|
" and element.type=" + this.type);
|
|
}
|
|
},
|
|
|
|
// Support jQuery Mobile enhanced option
|
|
_enhance: function () {
|
|
this._updateIcon(this.element[0].checked);
|
|
},
|
|
|
|
widget: function () {
|
|
return this.label;
|
|
},
|
|
|
|
_getRadioGroup: function () {
|
|
var group;
|
|
var name = this.element[0].name;
|
|
var nameSelector = "input[name='" + $.ui.escapeSelector(name) + "']";
|
|
|
|
if (!name) {
|
|
return $([]);
|
|
}
|
|
|
|
if (this.form.length) {
|
|
group = $(this.form[0].elements).filter(nameSelector);
|
|
} else {
|
|
// Not inside a form, check all inputs that also are not inside a form
|
|
group = $(nameSelector).filter(function () {
|
|
return $(this).form().length === 0;
|
|
});
|
|
}
|
|
|
|
return group.not(this.element);
|
|
},
|
|
|
|
_toggleClasses: function () {
|
|
var checked = this.element[0].checked;
|
|
this._toggleClass(this.label, "ui-checkboxradio-checked", "ui-state-active", checked);
|
|
|
|
if (this.options.icon && this.type === "checkbox") {
|
|
this._toggleClass(this.icon, null, "ui-icon-check ui-state-checked", checked)
|
|
._toggleClass(this.icon, null, "ui-icon-blank", !checked);
|
|
}
|
|
|
|
if (this.type === "radio") {
|
|
this._getRadioGroup()
|
|
.each(function () {
|
|
var instance = $(this).checkboxradio("instance");
|
|
|
|
if (instance) {
|
|
instance._removeClass(instance.label,
|
|
"ui-checkboxradio-checked", "ui-state-active");
|
|
}
|
|
});
|
|
}
|
|
},
|
|
|
|
_destroy: function () {
|
|
this._unbindFormResetHandler();
|
|
|
|
if (this.icon) {
|
|
this.icon.remove();
|
|
this.iconSpace.remove();
|
|
}
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
// We don't allow the value to be set to nothing
|
|
if (key === "label" && !value) {
|
|
return;
|
|
}
|
|
|
|
this._super(key, value);
|
|
|
|
if (key === "disabled") {
|
|
this._toggleClass(this.label, null, "ui-state-disabled", value);
|
|
this.element[0].disabled = value;
|
|
|
|
// Don't refresh when setting disabled
|
|
return;
|
|
}
|
|
this.refresh();
|
|
},
|
|
|
|
_updateIcon: function (checked) {
|
|
var toAdd = "ui-icon ui-icon-background ";
|
|
|
|
if (this.options.icon) {
|
|
if (!this.icon) {
|
|
this.icon = $("<span>");
|
|
this.iconSpace = $("<span> </span>");
|
|
this._addClass(this.iconSpace, "ui-checkboxradio-icon-space");
|
|
}
|
|
|
|
if (this.type === "checkbox") {
|
|
toAdd += checked ? "ui-icon-check ui-state-checked" : "ui-icon-blank";
|
|
this._removeClass(this.icon, null, checked ? "ui-icon-blank" : "ui-icon-check");
|
|
} else {
|
|
toAdd += "ui-icon-blank";
|
|
}
|
|
this._addClass(this.icon, "ui-checkboxradio-icon", toAdd);
|
|
if (!checked) {
|
|
this._removeClass(this.icon, null, "ui-icon-check ui-state-checked");
|
|
}
|
|
this.icon.prependTo(this.label).after(this.iconSpace);
|
|
} else if (this.icon !== undefined) {
|
|
this.icon.remove();
|
|
this.iconSpace.remove();
|
|
delete this.icon;
|
|
}
|
|
},
|
|
|
|
_updateLabel: function () {
|
|
// Remove the contents of the label ( minus the icon, icon space, and input )
|
|
var contents = this.label.contents().not(this.element[0]);
|
|
if (this.icon) {
|
|
contents = contents.not(this.icon[0]);
|
|
}
|
|
if (this.iconSpace) {
|
|
contents = contents.not(this.iconSpace[0]);
|
|
}
|
|
contents.remove();
|
|
|
|
this.label.append(this.options.label);
|
|
},
|
|
|
|
refresh: function () {
|
|
var checked = this.element[0].checked,
|
|
isDisabled = this.element[0].disabled;
|
|
|
|
this._updateIcon(checked);
|
|
this._toggleClass(this.label, "ui-checkboxradio-checked", "ui-state-active", checked);
|
|
if (this.options.label !== null) {
|
|
this._updateLabel();
|
|
}
|
|
|
|
if (isDisabled !== this.options.disabled) {
|
|
this._setOptions({ "disabled": isDisabled });
|
|
}
|
|
}
|
|
}]);
|
|
|
|
var widgetsCheckboxradio = $.ui.checkboxradio;
|
|
|
|
/*!
|
|
* jQuery UI Button 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Button
|
|
//>>group: Widgets
|
|
//>>description: Enhances a form with themeable buttons.
|
|
//>>docs: http://api.jqueryui.com/button/
|
|
//>>demos: http://jqueryui.com/button/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/button.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.widget("ui.button", {
|
|
version: "1.12.1",
|
|
defaultElement: "<button>",
|
|
options: {
|
|
classes: {
|
|
"ui-button": "ui-corner-all"
|
|
},
|
|
disabled: null,
|
|
icon: null,
|
|
iconPosition: "beginning",
|
|
label: null,
|
|
showLabel: true
|
|
},
|
|
|
|
_getCreateOptions: function () {
|
|
var disabled,
|
|
|
|
// This is to support cases like in jQuery Mobile where the base widget does have
|
|
// an implementation of _getCreateOptions
|
|
options = this._super() || {};
|
|
|
|
this.isInput = this.element.is("input");
|
|
|
|
disabled = this.element[0].disabled;
|
|
if (disabled != null) {
|
|
options.disabled = disabled;
|
|
}
|
|
|
|
this.originalLabel = this.isInput ? this.element.val() : this.element.html();
|
|
if (this.originalLabel) {
|
|
options.label = this.originalLabel;
|
|
}
|
|
|
|
return options;
|
|
},
|
|
|
|
_create: function () {
|
|
if (!this.option.showLabel & !this.options.icon) {
|
|
this.options.showLabel = true;
|
|
}
|
|
|
|
// We have to check the option again here even though we did in _getCreateOptions,
|
|
// because null may have been passed on init which would override what was set in
|
|
// _getCreateOptions
|
|
if (this.options.disabled == null) {
|
|
this.options.disabled = this.element[0].disabled || false;
|
|
}
|
|
|
|
this.hasTitle = !!this.element.attr("title");
|
|
|
|
// Check to see if the label needs to be set or if its already correct
|
|
if (this.options.label && this.options.label !== this.originalLabel) {
|
|
if (this.isInput) {
|
|
this.element.val(this.options.label);
|
|
} else {
|
|
this.element.html(this.options.label);
|
|
}
|
|
}
|
|
this._addClass("ui-button", "ui-widget");
|
|
this._setOption("disabled", this.options.disabled);
|
|
this._enhance();
|
|
|
|
if (this.element.is("a")) {
|
|
this._on({
|
|
"keyup": function (event) {
|
|
if (event.keyCode === $.ui.keyCode.SPACE) {
|
|
event.preventDefault();
|
|
|
|
// Support: PhantomJS <= 1.9, IE 8 Only
|
|
// If a native click is available use it so we actually cause navigation
|
|
// otherwise just trigger a click event
|
|
if (this.element[0].click) {
|
|
this.element[0].click();
|
|
} else {
|
|
this.element.trigger("click");
|
|
}
|
|
}
|
|
}
|
|
});
|
|
}
|
|
},
|
|
|
|
_enhance: function () {
|
|
if (!this.element.is("button")) {
|
|
this.element.attr("role", "button");
|
|
}
|
|
|
|
if (this.options.icon) {
|
|
this._updateIcon("icon", this.options.icon);
|
|
this._updateTooltip();
|
|
}
|
|
},
|
|
|
|
_updateTooltip: function () {
|
|
this.title = this.element.attr("title");
|
|
|
|
if (!this.options.showLabel && !this.title) {
|
|
this.element.attr("title", this.options.label);
|
|
}
|
|
},
|
|
|
|
_updateIcon: function (option, value) {
|
|
var icon = option !== "iconPosition",
|
|
position = icon ? this.options.iconPosition : value,
|
|
displayBlock = position === "top" || position === "bottom";
|
|
|
|
// Create icon
|
|
if (!this.icon) {
|
|
this.icon = $("<span>");
|
|
|
|
this._addClass(this.icon, "ui-button-icon", "ui-icon");
|
|
|
|
if (!this.options.showLabel) {
|
|
this._addClass("ui-button-icon-only");
|
|
}
|
|
} else if (icon) {
|
|
// If we are updating the icon remove the old icon class
|
|
this._removeClass(this.icon, null, this.options.icon);
|
|
}
|
|
|
|
// If we are updating the icon add the new icon class
|
|
if (icon) {
|
|
this._addClass(this.icon, null, value);
|
|
}
|
|
|
|
this._attachIcon(position);
|
|
|
|
// If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove
|
|
// the iconSpace if there is one.
|
|
if (displayBlock) {
|
|
this._addClass(this.icon, null, "ui-widget-icon-block");
|
|
if (this.iconSpace) {
|
|
this.iconSpace.remove();
|
|
}
|
|
} else {
|
|
// Position is beginning or end so remove the ui-widget-icon-block class and add the
|
|
// space if it does not exist
|
|
if (!this.iconSpace) {
|
|
this.iconSpace = $("<span> </span>");
|
|
this._addClass(this.iconSpace, "ui-button-icon-space");
|
|
}
|
|
this._removeClass(this.icon, null, "ui-wiget-icon-block");
|
|
this._attachIconSpace(position);
|
|
}
|
|
},
|
|
|
|
_destroy: function () {
|
|
this.element.removeAttr("role");
|
|
|
|
if (this.icon) {
|
|
this.icon.remove();
|
|
}
|
|
if (this.iconSpace) {
|
|
this.iconSpace.remove();
|
|
}
|
|
if (!this.hasTitle) {
|
|
this.element.removeAttr("title");
|
|
}
|
|
},
|
|
|
|
_attachIconSpace: function (iconPosition) {
|
|
this.icon[/^(?:end|bottom)/.test(iconPosition) ? "before" : "after"](this.iconSpace);
|
|
},
|
|
|
|
_attachIcon: function (iconPosition) {
|
|
this.element[/^(?:end|bottom)/.test(iconPosition) ? "append" : "prepend"](this.icon);
|
|
},
|
|
|
|
_setOptions: function (options) {
|
|
var newShowLabel = options.showLabel === undefined ?
|
|
this.options.showLabel :
|
|
options.showLabel,
|
|
newIcon = options.icon === undefined ? this.options.icon : options.icon;
|
|
|
|
if (!newShowLabel && !newIcon) {
|
|
options.showLabel = true;
|
|
}
|
|
this._super(options);
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "icon") {
|
|
if (value) {
|
|
this._updateIcon(key, value);
|
|
} else if (this.icon) {
|
|
this.icon.remove();
|
|
if (this.iconSpace) {
|
|
this.iconSpace.remove();
|
|
}
|
|
}
|
|
}
|
|
|
|
if (key === "iconPosition") {
|
|
this._updateIcon(key, value);
|
|
}
|
|
|
|
// Make sure we can't end up with a button that has neither text nor icon
|
|
if (key === "showLabel") {
|
|
this._toggleClass("ui-button-icon-only", null, !value);
|
|
this._updateTooltip();
|
|
}
|
|
|
|
if (key === "label") {
|
|
if (this.isInput) {
|
|
this.element.val(value);
|
|
} else {
|
|
// If there is an icon, append it, else nothing then append the value
|
|
// this avoids removal of the icon when setting label text
|
|
this.element.html(value);
|
|
if (this.icon) {
|
|
this._attachIcon(this.options.iconPosition);
|
|
this._attachIconSpace(this.options.iconPosition);
|
|
}
|
|
}
|
|
}
|
|
|
|
this._super(key, value);
|
|
|
|
if (key === "disabled") {
|
|
this._toggleClass(null, "ui-state-disabled", value);
|
|
this.element[0].disabled = value;
|
|
if (value) {
|
|
this.element.blur();
|
|
}
|
|
}
|
|
},
|
|
|
|
refresh: function () {
|
|
// Make sure to only check disabled if its an element that supports this otherwise
|
|
// check for the disabled class to determine state
|
|
var isDisabled = this.element.is("input, button") ?
|
|
this.element[0].disabled : this.element.hasClass("ui-button-disabled");
|
|
|
|
if (isDisabled !== this.options.disabled) {
|
|
this._setOptions({ disabled: isDisabled });
|
|
}
|
|
|
|
this._updateTooltip();
|
|
}
|
|
});
|
|
|
|
// DEPRECATED
|
|
if ($.uiBackCompat !== false) {
|
|
// Text and Icons options
|
|
$.widget("ui.button", $.ui.button, {
|
|
options: {
|
|
text: true,
|
|
icons: {
|
|
primary: null,
|
|
secondary: null
|
|
}
|
|
},
|
|
|
|
_create: function () {
|
|
if (this.options.showLabel && !this.options.text) {
|
|
this.options.showLabel = this.options.text;
|
|
}
|
|
if (!this.options.showLabel && this.options.text) {
|
|
this.options.text = this.options.showLabel;
|
|
}
|
|
if (!this.options.icon && (this.options.icons.primary ||
|
|
this.options.icons.secondary)) {
|
|
if (this.options.icons.primary) {
|
|
this.options.icon = this.options.icons.primary;
|
|
} else {
|
|
this.options.icon = this.options.icons.secondary;
|
|
this.options.iconPosition = "end";
|
|
}
|
|
} else if (this.options.icon) {
|
|
this.options.icons.primary = this.options.icon;
|
|
}
|
|
this._super();
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "text") {
|
|
this._super("showLabel", value);
|
|
return;
|
|
}
|
|
if (key === "showLabel") {
|
|
this.options.text = value;
|
|
}
|
|
if (key === "icon") {
|
|
this.options.icons.primary = value;
|
|
}
|
|
if (key === "icons") {
|
|
if (value.primary) {
|
|
this._super("icon", value.primary);
|
|
this._super("iconPosition", "beginning");
|
|
} else if (value.secondary) {
|
|
this._super("icon", value.secondary);
|
|
this._super("iconPosition", "end");
|
|
}
|
|
}
|
|
this._superApply(arguments);
|
|
}
|
|
});
|
|
|
|
$.fn.button = (function (orig) {
|
|
return function () {
|
|
if (!this.length || (this.length && this[0].tagName !== "INPUT") ||
|
|
(this.length && this[0].tagName === "INPUT" && (
|
|
this.attr("type") !== "checkbox" && this.attr("type") !== "radio"
|
|
))) {
|
|
return orig.apply(this, arguments);
|
|
}
|
|
if (!$.ui.checkboxradio) {
|
|
$.error("Checkboxradio widget missing");
|
|
}
|
|
if (arguments.length === 0) {
|
|
return this.checkboxradio({
|
|
"icon": false
|
|
});
|
|
}
|
|
return this.checkboxradio.apply(this, arguments);
|
|
};
|
|
})($.fn.button);
|
|
|
|
$.fn.buttonset = function () {
|
|
if (!$.ui.controlgroup) {
|
|
$.error("Controlgroup widget missing");
|
|
}
|
|
if (arguments[0] === "option" && arguments[1] === "items" && arguments[2]) {
|
|
return this.controlgroup.apply(this,
|
|
[arguments[0], "items.button", arguments[2]]);
|
|
}
|
|
if (arguments[0] === "option" && arguments[1] === "items") {
|
|
return this.controlgroup.apply(this, [arguments[0], "items.button"]);
|
|
}
|
|
if (typeof arguments[0] === "object" && arguments[0].items) {
|
|
arguments[0].items = {
|
|
button: arguments[0].items
|
|
};
|
|
}
|
|
return this.controlgroup.apply(this, arguments);
|
|
};
|
|
}
|
|
|
|
var widgetsButton = $.ui.button;
|
|
|
|
// jscs:disable maximumLineLength
|
|
/* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */
|
|
/*!
|
|
* jQuery UI Datepicker 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Datepicker
|
|
//>>group: Widgets
|
|
//>>description: Displays a calendar from an input or inline for selecting dates.
|
|
//>>docs: http://api.jqueryui.com/datepicker/
|
|
//>>demos: http://jqueryui.com/datepicker/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/datepicker.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.extend($.ui, { datepicker: { version: "1.12.1" } });
|
|
|
|
var datepicker_instActive;
|
|
|
|
function datepicker_getZindex(elem) {
|
|
var position, value;
|
|
while (elem.length && elem[0] !== document) {
|
|
// Ignore z-index if position is set to a value where z-index is ignored by the browser
|
|
// This makes behavior of this function consistent across browsers
|
|
// WebKit always returns auto if the element is positioned
|
|
position = elem.css("position");
|
|
if (position === "absolute" || position === "relative" || position === "fixed") {
|
|
// IE returns 0 when zIndex is not specified
|
|
// other browsers return a string
|
|
// we ignore the case of nested elements with an explicit value of 0
|
|
// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
|
|
value = parseInt(elem.css("zIndex"), 10);
|
|
if (!isNaN(value) && value !== 0) {
|
|
return value;
|
|
}
|
|
}
|
|
elem = elem.parent();
|
|
}
|
|
|
|
return 0;
|
|
}
|
|
/* Date picker manager.
|
|
Use the singleton instance of this class, $.datepicker, to interact with the date picker.
|
|
Settings for (groups of) date pickers are maintained in an instance object,
|
|
allowing multiple different settings on the same page. */
|
|
|
|
function Datepicker() {
|
|
this._curInst = null; // The current instance in use
|
|
this._keyEvent = false; // If the last event was a key event
|
|
this._disabledInputs = []; // List of date picker inputs that have been disabled
|
|
this._datepickerShowing = false; // True if the popup picker is showing , false if not
|
|
this._inDialog = false; // True if showing within a "dialog", false if not
|
|
this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
|
|
this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
|
|
this._appendClass = "ui-datepicker-append"; // The name of the append marker class
|
|
this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
|
|
this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
|
|
this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
|
|
this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
|
|
this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
|
|
this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
|
|
this.regional = []; // Available regional settings, indexed by language code
|
|
this.regional[""] = { // Default regional settings
|
|
closeText: "Done", // Display text for close link
|
|
prevText: "Prev", // Display text for previous month link
|
|
nextText: "Next", // Display text for next month link
|
|
currentText: "Today", // Display text for current month link
|
|
monthNames: ["January", "February", "March", "April", "May", "June",
|
|
"July", "August", "September", "October", "November", "December"], // Names of months for drop-down and formatting
|
|
monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"], // For formatting
|
|
dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], // For formatting
|
|
dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], // For formatting
|
|
dayNamesMin: ["Su", "Mo", "Tu", "We", "Th", "Fr", "Sa"], // Column headings for days starting at Sunday
|
|
weekHeader: "Wk", // Column header for week of the year
|
|
dateFormat: "mm/dd/yy", // See format options on parseDate
|
|
firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
|
|
isRTL: false, // True if right-to-left language, false if left-to-right
|
|
showMonthAfterYear: false, // True if the year select precedes month, false for month then year
|
|
yearSuffix: "" // Additional text to append to the year in the month headers
|
|
};
|
|
this._defaults = { // Global defaults for all the date picker instances
|
|
showOn: "focus", // "focus" for popup on focus,
|
|
// "button" for trigger button, or "both" for either
|
|
showAnim: "fadeIn", // Name of jQuery animation for popup
|
|
showOptions: {}, // Options for enhanced animations
|
|
defaultDate: null, // Used when field is blank: actual date,
|
|
// +/-number for offset from today, null for today
|
|
appendText: "", // Display text following the input box, e.g. showing the format
|
|
buttonText: "...", // Text for trigger button
|
|
buttonImage: "", // URL for trigger button image
|
|
buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
|
|
hideIfNoPrevNext: false, // True to hide next/previous month links
|
|
// if not applicable, false to just disable them
|
|
navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
|
|
gotoCurrent: false, // True if today link goes back to current selection instead
|
|
changeMonth: false, // True if month can be selected directly, false if only prev/next
|
|
changeYear: false, // True if year can be selected directly, false if only prev/next
|
|
yearRange: "c-10:c+10", // Range of years to display in drop-down,
|
|
// either relative to today's year (-nn:+nn), relative to currently displayed year
|
|
// (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
|
|
showOtherMonths: false, // True to show dates in other months, false to leave blank
|
|
selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
|
|
showWeek: false, // True to show week of the year, false to not show it
|
|
calculateWeek: this.iso8601Week, // How to calculate the week of the year,
|
|
// takes a Date and returns the number of the week for it
|
|
shortYearCutoff: "+10", // Short year values < this are in the current century,
|
|
// > this are in the previous century,
|
|
// string value starting with "+" for current year + value
|
|
minDate: null, // The earliest selectable date, or null for no limit
|
|
maxDate: null, // The latest selectable date, or null for no limit
|
|
duration: "fast", // Duration of display/closure
|
|
beforeShowDay: null, // Function that takes a date and returns an array with
|
|
// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
|
|
// [2] = cell title (optional), e.g. $.datepicker.noWeekends
|
|
beforeShow: null, // Function that takes an input field and
|
|
// returns a set of custom settings for the date picker
|
|
onSelect: null, // Define a callback function when a date is selected
|
|
onChangeMonthYear: null, // Define a callback function when the month or year is changed
|
|
onClose: null, // Define a callback function when the datepicker is closed
|
|
numberOfMonths: 1, // Number of months to show at a time
|
|
showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
|
|
stepMonths: 1, // Number of months to step back/forward
|
|
stepBigMonths: 12, // Number of months to step back/forward for the big links
|
|
altField: "", // Selector for an alternate field to store selected dates into
|
|
altFormat: "", // The date format to use for the alternate field
|
|
constrainInput: true, // The input is constrained by the current date format
|
|
showButtonPanel: false, // True to show button panel, false to not show it
|
|
autoSize: false, // True to size the input for the date format, false to leave as is
|
|
disabled: false // The initial disabled state
|
|
};
|
|
$.extend(this._defaults, this.regional[""]);
|
|
this.regional.en = $.extend(true, {}, this.regional[""]);
|
|
this.regional["en-US"] = $.extend(true, {}, this.regional.en);
|
|
this.dpDiv = datepicker_bindHover($("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"));
|
|
}
|
|
|
|
$.extend(Datepicker.prototype, {
|
|
/* Class name added to elements to indicate already configured with a date picker. */
|
|
markerClassName: "hasDatepicker",
|
|
|
|
//Keep track of the maximum number of rows displayed (see #7043)
|
|
maxRows: 4,
|
|
|
|
// TODO rename to "widget" when switching to widget factory
|
|
_widgetDatepicker: function () {
|
|
return this.dpDiv;
|
|
},
|
|
|
|
/* Override the default settings for all instances of the date picker.
|
|
* @param settings object - the new settings to use as defaults (anonymous object)
|
|
* @return the manager object
|
|
*/
|
|
setDefaults: function (settings) {
|
|
datepicker_extendRemove(this._defaults, settings || {});
|
|
return this;
|
|
},
|
|
|
|
/* Attach the date picker to a jQuery selection.
|
|
* @param target element - the target input field or division or span
|
|
* @param settings object - the new settings to use for this date picker instance (anonymous)
|
|
*/
|
|
_attachDatepicker: function (target, settings) {
|
|
var nodeName, inline, inst;
|
|
nodeName = target.nodeName.toLowerCase();
|
|
inline = (nodeName === "div" || nodeName === "span");
|
|
if (!target.id) {
|
|
this.uuid += 1;
|
|
target.id = "dp" + this.uuid;
|
|
}
|
|
inst = this._newInst($(target), inline);
|
|
inst.settings = $.extend({}, settings || {});
|
|
if (nodeName === "input") {
|
|
this._connectDatepicker(target, inst);
|
|
} else if (inline) {
|
|
this._inlineDatepicker(target, inst);
|
|
}
|
|
},
|
|
|
|
/* Create a new instance object. */
|
|
_newInst: function (target, inline) {
|
|
var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1"); // escape jQuery meta chars
|
|
return {
|
|
id: id, input: target, // associated target
|
|
selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
|
|
drawMonth: 0, drawYear: 0, // month being drawn
|
|
inline: inline, // is datepicker inline or not
|
|
dpDiv: (!inline ? this.dpDiv : // presentation div
|
|
datepicker_bindHover($("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")))
|
|
};
|
|
},
|
|
|
|
/* Attach the date picker to an input field. */
|
|
_connectDatepicker: function (target, inst) {
|
|
var input = $(target);
|
|
inst.append = $([]);
|
|
inst.trigger = $([]);
|
|
if (input.hasClass(this.markerClassName)) {
|
|
return;
|
|
}
|
|
this._attachments(input, inst);
|
|
input.addClass(this.markerClassName).on("keydown", this._doKeyDown).
|
|
on("keypress", this._doKeyPress).on("keyup", this._doKeyUp);
|
|
this._autoSize(inst);
|
|
$.data(target, "datepicker", inst);
|
|
|
|
//If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
|
|
if (inst.settings.disabled) {
|
|
this._disableDatepicker(target);
|
|
}
|
|
},
|
|
|
|
/* Make attachments based on settings. */
|
|
_attachments: function (input, inst) {
|
|
var showOn, buttonText, buttonImage,
|
|
appendText = this._get(inst, "appendText"),
|
|
isRTL = this._get(inst, "isRTL");
|
|
|
|
if (inst.append) {
|
|
inst.append.remove();
|
|
}
|
|
if (appendText) {
|
|
inst.append = $("<span class='" + this._appendClass + "'>" + appendText + "</span>");
|
|
input[isRTL ? "before" : "after"](inst.append);
|
|
}
|
|
|
|
input.off("focus", this._showDatepicker);
|
|
|
|
if (inst.trigger) {
|
|
inst.trigger.remove();
|
|
}
|
|
|
|
showOn = this._get(inst, "showOn");
|
|
if (showOn === "focus" || showOn === "both") { // pop-up date picker when in the marked field
|
|
input.on("focus", this._showDatepicker);
|
|
}
|
|
if (showOn === "button" || showOn === "both") { // pop-up date picker when button clicked
|
|
buttonText = this._get(inst, "buttonText");
|
|
buttonImage = this._get(inst, "buttonImage");
|
|
inst.trigger = $(this._get(inst, "buttonImageOnly") ?
|
|
$("<img/>").addClass(this._triggerClass).
|
|
attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
|
|
$("<button type='button'></button>").addClass(this._triggerClass).
|
|
html(!buttonImage ? buttonText : $("<img/>").attr(
|
|
{ src: buttonImage, alt: buttonText, title: buttonText })));
|
|
input[isRTL ? "before" : "after"](inst.trigger);
|
|
inst.trigger.on("click", function () {
|
|
if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) {
|
|
$.datepicker._hideDatepicker();
|
|
} else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) {
|
|
$.datepicker._hideDatepicker();
|
|
$.datepicker._showDatepicker(input[0]);
|
|
} else {
|
|
$.datepicker._showDatepicker(input[0]);
|
|
}
|
|
return false;
|
|
});
|
|
}
|
|
},
|
|
|
|
/* Apply the maximum length for the date format. */
|
|
_autoSize: function (inst) {
|
|
if (this._get(inst, "autoSize") && !inst.inline) {
|
|
var findMax, max, maxI, i,
|
|
date = new Date(2009, 12 - 1, 20), // Ensure double digits
|
|
dateFormat = this._get(inst, "dateFormat");
|
|
|
|
if (dateFormat.match(/[DM]/)) {
|
|
findMax = function (names) {
|
|
max = 0;
|
|
maxI = 0;
|
|
for (i = 0; i < names.length; i++) {
|
|
if (names[i].length > max) {
|
|
max = names[i].length;
|
|
maxI = i;
|
|
}
|
|
}
|
|
return maxI;
|
|
};
|
|
date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
|
|
"monthNames" : "monthNamesShort"))));
|
|
date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
|
|
"dayNames" : "dayNamesShort"))) + 20 - date.getDay());
|
|
}
|
|
inst.input.attr("size", this._formatDate(inst, date).length);
|
|
}
|
|
},
|
|
|
|
/* Attach an inline date picker to a div. */
|
|
_inlineDatepicker: function (target, inst) {
|
|
var divSpan = $(target);
|
|
if (divSpan.hasClass(this.markerClassName)) {
|
|
return;
|
|
}
|
|
divSpan.addClass(this.markerClassName).append(inst.dpDiv);
|
|
$.data(target, "datepicker", inst);
|
|
this._setDate(inst, this._getDefaultDate(inst), true);
|
|
this._updateDatepicker(inst);
|
|
this._updateAlternate(inst);
|
|
|
|
//If disabled option is true, disable the datepicker before showing it (see ticket #5665)
|
|
if (inst.settings.disabled) {
|
|
this._disableDatepicker(target);
|
|
}
|
|
|
|
// Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
|
|
// http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
|
|
inst.dpDiv.css("display", "block");
|
|
},
|
|
|
|
/* Pop-up the date picker in a "dialog" box.
|
|
* @param input element - ignored
|
|
* @param date string or Date - the initial date to display
|
|
* @param onSelect function - the function to call when a date is selected
|
|
* @param settings object - update the dialog date picker instance's settings (anonymous object)
|
|
* @param pos int[2] - coordinates for the dialog's position within the screen or
|
|
* event - with x/y coordinates or
|
|
* leave empty for default (screen centre)
|
|
* @return the manager object
|
|
*/
|
|
_dialogDatepicker: function (input, date, onSelect, settings, pos) {
|
|
var id, browserWidth, browserHeight, scrollX, scrollY,
|
|
inst = this._dialogInst; // internal instance
|
|
|
|
if (!inst) {
|
|
this.uuid += 1;
|
|
id = "dp" + this.uuid;
|
|
this._dialogInput = $("<input type='text' id='" + id +
|
|
"' style='position: absolute; top: -100px; width: 0px;'/>");
|
|
this._dialogInput.on("keydown", this._doKeyDown);
|
|
$("body").append(this._dialogInput);
|
|
inst = this._dialogInst = this._newInst(this._dialogInput, false);
|
|
inst.settings = {};
|
|
$.data(this._dialogInput[0], "datepicker", inst);
|
|
}
|
|
datepicker_extendRemove(inst.settings, settings || {});
|
|
date = (date && date.constructor === Date ? this._formatDate(inst, date) : date);
|
|
this._dialogInput.val(date);
|
|
|
|
this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
|
|
if (!this._pos) {
|
|
browserWidth = document.documentElement.clientWidth;
|
|
browserHeight = document.documentElement.clientHeight;
|
|
scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
|
|
scrollY = document.documentElement.scrollTop || document.body.scrollTop;
|
|
this._pos = // should use actual width/height below
|
|
[(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
|
|
}
|
|
|
|
// Move input on screen for focus, but hidden behind dialog
|
|
this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px");
|
|
inst.settings.onSelect = onSelect;
|
|
this._inDialog = true;
|
|
this.dpDiv.addClass(this._dialogClass);
|
|
this._showDatepicker(this._dialogInput[0]);
|
|
if ($.blockUI) {
|
|
$.blockUI(this.dpDiv);
|
|
}
|
|
$.data(this._dialogInput[0], "datepicker", inst);
|
|
return this;
|
|
},
|
|
|
|
/* Detach a datepicker from its control.
|
|
* @param target element - the target input field or division or span
|
|
*/
|
|
_destroyDatepicker: function (target) {
|
|
var nodeName,
|
|
$target = $(target),
|
|
inst = $.data(target, "datepicker");
|
|
|
|
if (!$target.hasClass(this.markerClassName)) {
|
|
return;
|
|
}
|
|
|
|
nodeName = target.nodeName.toLowerCase();
|
|
$.removeData(target, "datepicker");
|
|
if (nodeName === "input") {
|
|
inst.append.remove();
|
|
inst.trigger.remove();
|
|
$target.removeClass(this.markerClassName).
|
|
off("focus", this._showDatepicker).
|
|
off("keydown", this._doKeyDown).
|
|
off("keypress", this._doKeyPress).
|
|
off("keyup", this._doKeyUp);
|
|
} else if (nodeName === "div" || nodeName === "span") {
|
|
$target.removeClass(this.markerClassName).empty();
|
|
}
|
|
|
|
if (datepicker_instActive === inst) {
|
|
datepicker_instActive = null;
|
|
}
|
|
},
|
|
|
|
/* Enable the date picker to a jQuery selection.
|
|
* @param target element - the target input field or division or span
|
|
*/
|
|
_enableDatepicker: function (target) {
|
|
var nodeName, inline,
|
|
$target = $(target),
|
|
inst = $.data(target, "datepicker");
|
|
|
|
if (!$target.hasClass(this.markerClassName)) {
|
|
return;
|
|
}
|
|
|
|
nodeName = target.nodeName.toLowerCase();
|
|
if (nodeName === "input") {
|
|
target.disabled = false;
|
|
inst.trigger.filter("button").
|
|
each(function () { this.disabled = false; }).end().
|
|
filter("img").css({ opacity: "1.0", cursor: "" });
|
|
} else if (nodeName === "div" || nodeName === "span") {
|
|
inline = $target.children("." + this._inlineClass);
|
|
inline.children().removeClass("ui-state-disabled");
|
|
inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
|
|
prop("disabled", false);
|
|
}
|
|
this._disabledInputs = $.map(this._disabledInputs,
|
|
function (value) { return (value === target ? null : value); }); // delete entry
|
|
},
|
|
|
|
/* Disable the date picker to a jQuery selection.
|
|
* @param target element - the target input field or division or span
|
|
*/
|
|
_disableDatepicker: function (target) {
|
|
var nodeName, inline,
|
|
$target = $(target),
|
|
inst = $.data(target, "datepicker");
|
|
|
|
if (!$target.hasClass(this.markerClassName)) {
|
|
return;
|
|
}
|
|
|
|
nodeName = target.nodeName.toLowerCase();
|
|
if (nodeName === "input") {
|
|
target.disabled = true;
|
|
inst.trigger.filter("button").
|
|
each(function () { this.disabled = true; }).end().
|
|
filter("img").css({ opacity: "0.5", cursor: "default" });
|
|
} else if (nodeName === "div" || nodeName === "span") {
|
|
inline = $target.children("." + this._inlineClass);
|
|
inline.children().addClass("ui-state-disabled");
|
|
inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
|
|
prop("disabled", true);
|
|
}
|
|
this._disabledInputs = $.map(this._disabledInputs,
|
|
function (value) { return (value === target ? null : value); }); // delete entry
|
|
this._disabledInputs[this._disabledInputs.length] = target;
|
|
},
|
|
|
|
/* Is the first field in a jQuery collection disabled as a datepicker?
|
|
* @param target element - the target input field or division or span
|
|
* @return boolean - true if disabled, false if enabled
|
|
*/
|
|
_isDisabledDatepicker: function (target) {
|
|
if (!target) {
|
|
return false;
|
|
}
|
|
for (var i = 0; i < this._disabledInputs.length; i++) {
|
|
if (this._disabledInputs[i] === target) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/* Retrieve the instance data for the target control.
|
|
* @param target element - the target input field or division or span
|
|
* @return object - the associated instance data
|
|
* @throws error if a jQuery problem getting data
|
|
*/
|
|
_getInst: function (target) {
|
|
try {
|
|
return $.data(target, "datepicker");
|
|
}
|
|
catch (err) {
|
|
throw "Missing instance data for this datepicker";
|
|
}
|
|
},
|
|
|
|
/* Update or retrieve the settings for a date picker attached to an input field or division.
|
|
* @param target element - the target input field or division or span
|
|
* @param name object - the new settings to update or
|
|
* string - the name of the setting to change or retrieve,
|
|
* when retrieving also "all" for all instance settings or
|
|
* "defaults" for all global defaults
|
|
* @param value any - the new value for the setting
|
|
* (omit if above is an object or to retrieve a value)
|
|
*/
|
|
_optionDatepicker: function (target, name, value) {
|
|
var settings, date, minDate, maxDate,
|
|
inst = this._getInst(target);
|
|
|
|
if (arguments.length === 2 && typeof name === "string") {
|
|
return (name === "defaults" ? $.extend({}, $.datepicker._defaults) :
|
|
(inst ? (name === "all" ? $.extend({}, inst.settings) :
|
|
this._get(inst, name)) : null));
|
|
}
|
|
|
|
settings = name || {};
|
|
if (typeof name === "string") {
|
|
settings = {};
|
|
settings[name] = value;
|
|
}
|
|
|
|
if (inst) {
|
|
if (this._curInst === inst) {
|
|
this._hideDatepicker();
|
|
}
|
|
|
|
date = this._getDateDatepicker(target, true);
|
|
minDate = this._getMinMaxDate(inst, "min");
|
|
maxDate = this._getMinMaxDate(inst, "max");
|
|
datepicker_extendRemove(inst.settings, settings);
|
|
|
|
// reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
|
|
if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) {
|
|
inst.settings.minDate = this._formatDate(inst, minDate);
|
|
}
|
|
if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) {
|
|
inst.settings.maxDate = this._formatDate(inst, maxDate);
|
|
}
|
|
if ("disabled" in settings) {
|
|
if (settings.disabled) {
|
|
this._disableDatepicker(target);
|
|
} else {
|
|
this._enableDatepicker(target);
|
|
}
|
|
}
|
|
this._attachments($(target), inst);
|
|
this._autoSize(inst);
|
|
this._setDate(inst, date);
|
|
this._updateAlternate(inst);
|
|
this._updateDatepicker(inst);
|
|
}
|
|
},
|
|
|
|
// Change method deprecated
|
|
_changeDatepicker: function (target, name, value) {
|
|
this._optionDatepicker(target, name, value);
|
|
},
|
|
|
|
/* Redraw the date picker attached to an input field or division.
|
|
* @param target element - the target input field or division or span
|
|
*/
|
|
_refreshDatepicker: function (target) {
|
|
var inst = this._getInst(target);
|
|
if (inst) {
|
|
this._updateDatepicker(inst);
|
|
}
|
|
},
|
|
|
|
/* Set the dates for a jQuery selection.
|
|
* @param target element - the target input field or division or span
|
|
* @param date Date - the new date
|
|
*/
|
|
_setDateDatepicker: function (target, date) {
|
|
var inst = this._getInst(target);
|
|
if (inst) {
|
|
this._setDate(inst, date);
|
|
this._updateDatepicker(inst);
|
|
this._updateAlternate(inst);
|
|
}
|
|
},
|
|
|
|
/* Get the date(s) for the first entry in a jQuery selection.
|
|
* @param target element - the target input field or division or span
|
|
* @param noDefault boolean - true if no default date is to be used
|
|
* @return Date - the current date
|
|
*/
|
|
_getDateDatepicker: function (target, noDefault) {
|
|
var inst = this._getInst(target);
|
|
if (inst && !inst.inline) {
|
|
this._setDateFromField(inst, noDefault);
|
|
}
|
|
return (inst ? this._getDate(inst) : null);
|
|
},
|
|
|
|
/* Handle keystrokes. */
|
|
_doKeyDown: function (event) {
|
|
var onSelect, dateStr, sel,
|
|
inst = $.datepicker._getInst(event.target),
|
|
handled = true,
|
|
isRTL = inst.dpDiv.is(".ui-datepicker-rtl");
|
|
|
|
inst._keyEvent = true;
|
|
if ($.datepicker._datepickerShowing) {
|
|
switch (event.keyCode) {
|
|
case 9: $.datepicker._hideDatepicker();
|
|
handled = false;
|
|
break; // hide on tab out
|
|
case 13: sel = $("td." + $.datepicker._dayOverClass + ":not(." +
|
|
$.datepicker._currentClass + ")", inst.dpDiv);
|
|
if (sel[0]) {
|
|
$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
|
|
}
|
|
|
|
onSelect = $.datepicker._get(inst, "onSelect");
|
|
if (onSelect) {
|
|
dateStr = $.datepicker._formatDate(inst);
|
|
|
|
// Trigger custom callback
|
|
onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
|
|
} else {
|
|
$.datepicker._hideDatepicker();
|
|
}
|
|
|
|
return false; // don't submit the form
|
|
case 27: $.datepicker._hideDatepicker();
|
|
break; // hide on escape
|
|
case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
|
-$.datepicker._get(inst, "stepBigMonths") :
|
|
-$.datepicker._get(inst, "stepMonths")), "M");
|
|
break; // previous month/year on page up/+ ctrl
|
|
case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
|
+$.datepicker._get(inst, "stepBigMonths") :
|
|
+$.datepicker._get(inst, "stepMonths")), "M");
|
|
break; // next month/year on page down/+ ctrl
|
|
case 35: if (event.ctrlKey || event.metaKey) {
|
|
$.datepicker._clearDate(event.target);
|
|
}
|
|
handled = event.ctrlKey || event.metaKey;
|
|
break; // clear on ctrl or command +end
|
|
case 36: if (event.ctrlKey || event.metaKey) {
|
|
$.datepicker._gotoToday(event.target);
|
|
}
|
|
handled = event.ctrlKey || event.metaKey;
|
|
break; // current on ctrl or command +home
|
|
case 37: if (event.ctrlKey || event.metaKey) {
|
|
$.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D");
|
|
}
|
|
handled = event.ctrlKey || event.metaKey;
|
|
|
|
// -1 day on ctrl or command +left
|
|
if (event.originalEvent.altKey) {
|
|
$.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
|
-$.datepicker._get(inst, "stepBigMonths") :
|
|
-$.datepicker._get(inst, "stepMonths")), "M");
|
|
}
|
|
|
|
// next month/year on alt +left on Mac
|
|
break;
|
|
case 38: if (event.ctrlKey || event.metaKey) {
|
|
$.datepicker._adjustDate(event.target, -7, "D");
|
|
}
|
|
handled = event.ctrlKey || event.metaKey;
|
|
break; // -1 week on ctrl or command +up
|
|
case 39: if (event.ctrlKey || event.metaKey) {
|
|
$.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D");
|
|
}
|
|
handled = event.ctrlKey || event.metaKey;
|
|
|
|
// +1 day on ctrl or command +right
|
|
if (event.originalEvent.altKey) {
|
|
$.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
|
+$.datepicker._get(inst, "stepBigMonths") :
|
|
+$.datepicker._get(inst, "stepMonths")), "M");
|
|
}
|
|
|
|
// next month/year on alt +right
|
|
break;
|
|
case 40: if (event.ctrlKey || event.metaKey) {
|
|
$.datepicker._adjustDate(event.target, +7, "D");
|
|
}
|
|
handled = event.ctrlKey || event.metaKey;
|
|
break; // +1 week on ctrl or command +down
|
|
default: handled = false;
|
|
}
|
|
} else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home
|
|
$.datepicker._showDatepicker(this);
|
|
} else {
|
|
handled = false;
|
|
}
|
|
|
|
if (handled) {
|
|
event.preventDefault();
|
|
event.stopPropagation();
|
|
}
|
|
},
|
|
|
|
/* Filter entered characters - based on date format. */
|
|
_doKeyPress: function (event) {
|
|
var chars, chr,
|
|
inst = $.datepicker._getInst(event.target);
|
|
|
|
if ($.datepicker._get(inst, "constrainInput")) {
|
|
chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat"));
|
|
chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode);
|
|
return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1);
|
|
}
|
|
},
|
|
|
|
/* Synchronise manual entry and field/alternate field. */
|
|
_doKeyUp: function (event) {
|
|
var date,
|
|
inst = $.datepicker._getInst(event.target);
|
|
|
|
if (inst.input.val() !== inst.lastVal) {
|
|
try {
|
|
date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
|
|
(inst.input ? inst.input.val() : null),
|
|
$.datepicker._getFormatConfig(inst));
|
|
|
|
if (date) { // only if valid
|
|
$.datepicker._setDateFromField(inst);
|
|
$.datepicker._updateAlternate(inst);
|
|
$.datepicker._updateDatepicker(inst);
|
|
}
|
|
}
|
|
catch (err) {
|
|
}
|
|
}
|
|
return true;
|
|
},
|
|
|
|
/* Pop-up the date picker for a given input field.
|
|
* If false returned from beforeShow event handler do not show.
|
|
* @param input element - the input field attached to the date picker or
|
|
* event - if triggered by focus
|
|
*/
|
|
_showDatepicker: function (input) {
|
|
input = input.target || input;
|
|
if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger
|
|
input = $("input", input.parentNode)[0];
|
|
}
|
|
|
|
if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here
|
|
return;
|
|
}
|
|
|
|
var inst, beforeShow, beforeShowSettings, isFixed,
|
|
offset, showAnim, duration;
|
|
|
|
inst = $.datepicker._getInst(input);
|
|
if ($.datepicker._curInst && $.datepicker._curInst !== inst) {
|
|
$.datepicker._curInst.dpDiv.stop(true, true);
|
|
if (inst && $.datepicker._datepickerShowing) {
|
|
$.datepicker._hideDatepicker($.datepicker._curInst.input[0]);
|
|
}
|
|
}
|
|
|
|
beforeShow = $.datepicker._get(inst, "beforeShow");
|
|
beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
|
|
if (beforeShowSettings === false) {
|
|
return;
|
|
}
|
|
datepicker_extendRemove(inst.settings, beforeShowSettings);
|
|
|
|
inst.lastVal = null;
|
|
$.datepicker._lastInput = input;
|
|
$.datepicker._setDateFromField(inst);
|
|
|
|
if ($.datepicker._inDialog) { // hide cursor
|
|
input.value = "";
|
|
}
|
|
if (!$.datepicker._pos) { // position below input
|
|
$.datepicker._pos = $.datepicker._findPos(input);
|
|
$.datepicker._pos[1] += input.offsetHeight; // add the height
|
|
}
|
|
|
|
isFixed = false;
|
|
$(input).parents().each(function () {
|
|
isFixed |= $(this).css("position") === "fixed";
|
|
return !isFixed;
|
|
});
|
|
|
|
offset = { left: $.datepicker._pos[0], top: $.datepicker._pos[1] };
|
|
$.datepicker._pos = null;
|
|
|
|
//to avoid flashes on Firefox
|
|
inst.dpDiv.empty();
|
|
|
|
// determine sizing offscreen
|
|
inst.dpDiv.css({ position: "absolute", display: "block", top: "-1000px" });
|
|
$.datepicker._updateDatepicker(inst);
|
|
|
|
// fix width for dynamic number of date pickers
|
|
// and adjust position before showing
|
|
offset = $.datepicker._checkOffset(inst, offset, isFixed);
|
|
inst.dpDiv.css({
|
|
position: ($.datepicker._inDialog && $.blockUI ?
|
|
"static" : (isFixed ? "fixed" : "absolute")), display: "none",
|
|
left: offset.left + "px", top: offset.top + "px"
|
|
});
|
|
|
|
if (!inst.inline) {
|
|
showAnim = $.datepicker._get(inst, "showAnim");
|
|
duration = $.datepicker._get(inst, "duration");
|
|
inst.dpDiv.css("z-index", datepicker_getZindex($(input)) + 1);
|
|
$.datepicker._datepickerShowing = true;
|
|
|
|
if ($.effects && $.effects.effect[showAnim]) {
|
|
inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration);
|
|
} else {
|
|
inst.dpDiv[showAnim || "show"](showAnim ? duration : null);
|
|
}
|
|
|
|
if ($.datepicker._shouldFocusInput(inst)) {
|
|
inst.input.trigger("focus");
|
|
}
|
|
|
|
$.datepicker._curInst = inst;
|
|
}
|
|
},
|
|
|
|
/* Generate the date picker content. */
|
|
_updateDatepicker: function (inst) {
|
|
this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
|
|
datepicker_instActive = inst; // for delegate hover events
|
|
inst.dpDiv.empty().append(this._generateHTML(inst));
|
|
this._attachHandlers(inst);
|
|
|
|
var origyearshtml,
|
|
numMonths = this._getNumberOfMonths(inst),
|
|
cols = numMonths[1],
|
|
width = 17,
|
|
activeCell = inst.dpDiv.find("." + this._dayOverClass + " a");
|
|
|
|
if (activeCell.length > 0) {
|
|
datepicker_handleMouseover.apply(activeCell.get(0));
|
|
}
|
|
|
|
inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");
|
|
if (cols > 1) {
|
|
inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em");
|
|
}
|
|
inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") +
|
|
"Class"]("ui-datepicker-multi");
|
|
inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") +
|
|
"Class"]("ui-datepicker-rtl");
|
|
|
|
if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput(inst)) {
|
|
inst.input.trigger("focus");
|
|
}
|
|
|
|
// Deffered render of the years select (to avoid flashes on Firefox)
|
|
if (inst.yearshtml) {
|
|
origyearshtml = inst.yearshtml;
|
|
setTimeout(function () {
|
|
//assure that inst.yearshtml didn't change.
|
|
if (origyearshtml === inst.yearshtml && inst.yearshtml) {
|
|
inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml);
|
|
}
|
|
origyearshtml = inst.yearshtml = null;
|
|
}, 0);
|
|
}
|
|
},
|
|
|
|
// #6694 - don't focus the input if it's already focused
|
|
// this breaks the change event in IE
|
|
// Support: IE and jQuery <1.9
|
|
_shouldFocusInput: function (inst) {
|
|
return inst.input && inst.input.is(":visible") && !inst.input.is(":disabled") && !inst.input.is(":focus");
|
|
},
|
|
|
|
/* Check positioning to remain on screen. */
|
|
_checkOffset: function (inst, offset, isFixed) {
|
|
var dpWidth = inst.dpDiv.outerWidth(),
|
|
dpHeight = inst.dpDiv.outerHeight(),
|
|
inputWidth = inst.input ? inst.input.outerWidth() : 0,
|
|
inputHeight = inst.input ? inst.input.outerHeight() : 0,
|
|
viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()),
|
|
viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop());
|
|
|
|
offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0);
|
|
offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0;
|
|
offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
|
|
|
|
// Now check if datepicker is showing outside window viewport - move to a better place if so.
|
|
offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
|
|
Math.abs(offset.left + dpWidth - viewWidth) : 0);
|
|
offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
|
|
Math.abs(dpHeight + inputHeight) : 0);
|
|
|
|
return offset;
|
|
},
|
|
|
|
/* Find an object's position on the screen. */
|
|
_findPos: function (obj) {
|
|
var position,
|
|
inst = this._getInst(obj),
|
|
isRTL = this._get(inst, "isRTL");
|
|
|
|
while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) {
|
|
obj = obj[isRTL ? "previousSibling" : "nextSibling"];
|
|
}
|
|
|
|
position = $(obj).offset();
|
|
return [position.left, position.top];
|
|
},
|
|
|
|
/* Hide the date picker from view.
|
|
* @param input element - the input field attached to the date picker
|
|
*/
|
|
_hideDatepicker: function (input) {
|
|
var showAnim, duration, postProcess, onClose,
|
|
inst = this._curInst;
|
|
|
|
if (!inst || (input && inst !== $.data(input, "datepicker"))) {
|
|
return;
|
|
}
|
|
|
|
if (this._datepickerShowing) {
|
|
showAnim = this._get(inst, "showAnim");
|
|
duration = this._get(inst, "duration");
|
|
postProcess = function () {
|
|
$.datepicker._tidyDialog(inst);
|
|
};
|
|
|
|
// DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
|
|
if ($.effects && ($.effects.effect[showAnim] || $.effects[showAnim])) {
|
|
inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess);
|
|
} else {
|
|
inst.dpDiv[(showAnim === "slideDown" ? "slideUp" :
|
|
(showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess);
|
|
}
|
|
|
|
if (!showAnim) {
|
|
postProcess();
|
|
}
|
|
this._datepickerShowing = false;
|
|
|
|
onClose = this._get(inst, "onClose");
|
|
if (onClose) {
|
|
onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]);
|
|
}
|
|
|
|
this._lastInput = null;
|
|
if (this._inDialog) {
|
|
this._dialogInput.css({ position: "absolute", left: "0", top: "-100px" });
|
|
if ($.blockUI) {
|
|
$.unblockUI();
|
|
$("body").append(this.dpDiv);
|
|
}
|
|
}
|
|
this._inDialog = false;
|
|
}
|
|
},
|
|
|
|
/* Tidy up after a dialog display. */
|
|
_tidyDialog: function (inst) {
|
|
inst.dpDiv.removeClass(this._dialogClass).off(".ui-datepicker-calendar");
|
|
},
|
|
|
|
/* Close date picker if clicked elsewhere. */
|
|
_checkExternalClick: function (event) {
|
|
if (!$.datepicker._curInst) {
|
|
return;
|
|
}
|
|
|
|
var $target = $(event.target),
|
|
inst = $.datepicker._getInst($target[0]);
|
|
|
|
if ((($target[0].id !== $.datepicker._mainDivId &&
|
|
$target.parents("#" + $.datepicker._mainDivId).length === 0 &&
|
|
!$target.hasClass($.datepicker.markerClassName) &&
|
|
!$target.closest("." + $.datepicker._triggerClass).length &&
|
|
$.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))) ||
|
|
($target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst)) {
|
|
$.datepicker._hideDatepicker();
|
|
}
|
|
},
|
|
|
|
/* Adjust one of the date sub-fields. */
|
|
_adjustDate: function (id, offset, period) {
|
|
var target = $(id),
|
|
inst = this._getInst(target[0]);
|
|
|
|
if (this._isDisabledDatepicker(target[0])) {
|
|
return;
|
|
}
|
|
this._adjustInstDate(inst, offset +
|
|
(period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning
|
|
period);
|
|
this._updateDatepicker(inst);
|
|
},
|
|
|
|
/* Action for current link. */
|
|
_gotoToday: function (id) {
|
|
var date,
|
|
target = $(id),
|
|
inst = this._getInst(target[0]);
|
|
|
|
if (this._get(inst, "gotoCurrent") && inst.currentDay) {
|
|
inst.selectedDay = inst.currentDay;
|
|
inst.drawMonth = inst.selectedMonth = inst.currentMonth;
|
|
inst.drawYear = inst.selectedYear = inst.currentYear;
|
|
} else {
|
|
date = new Date();
|
|
inst.selectedDay = date.getDate();
|
|
inst.drawMonth = inst.selectedMonth = date.getMonth();
|
|
inst.drawYear = inst.selectedYear = date.getFullYear();
|
|
}
|
|
this._notifyChange(inst);
|
|
this._adjustDate(target);
|
|
},
|
|
|
|
/* Action for selecting a new month/year. */
|
|
_selectMonthYear: function (id, select, period) {
|
|
var target = $(id),
|
|
inst = this._getInst(target[0]);
|
|
|
|
inst["selected" + (period === "M" ? "Month" : "Year")] =
|
|
inst["draw" + (period === "M" ? "Month" : "Year")] =
|
|
parseInt(select.options[select.selectedIndex].value, 10);
|
|
|
|
this._notifyChange(inst);
|
|
this._adjustDate(target);
|
|
},
|
|
|
|
/* Action for selecting a day. */
|
|
_selectDay: function (id, month, year, td) {
|
|
var inst,
|
|
target = $(id);
|
|
|
|
if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
|
|
return;
|
|
}
|
|
|
|
inst = this._getInst(target[0]);
|
|
inst.selectedDay = inst.currentDay = $("a", td).html();
|
|
inst.selectedMonth = inst.currentMonth = month;
|
|
inst.selectedYear = inst.currentYear = year;
|
|
this._selectDate(id, this._formatDate(inst,
|
|
inst.currentDay, inst.currentMonth, inst.currentYear));
|
|
},
|
|
|
|
/* Erase the input field and hide the date picker. */
|
|
_clearDate: function (id) {
|
|
var target = $(id);
|
|
this._selectDate(target, "");
|
|
},
|
|
|
|
/* Update the input field with the selected date. */
|
|
_selectDate: function (id, dateStr) {
|
|
var onSelect,
|
|
target = $(id),
|
|
inst = this._getInst(target[0]);
|
|
|
|
dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
|
|
if (inst.input) {
|
|
inst.input.val(dateStr);
|
|
}
|
|
this._updateAlternate(inst);
|
|
|
|
onSelect = this._get(inst, "onSelect");
|
|
if (onSelect) {
|
|
onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
|
|
} else if (inst.input) {
|
|
inst.input.trigger("change"); // fire the change event
|
|
}
|
|
|
|
if (inst.inline) {
|
|
this._updateDatepicker(inst);
|
|
} else {
|
|
this._hideDatepicker();
|
|
this._lastInput = inst.input[0];
|
|
if (typeof (inst.input[0]) !== "object") {
|
|
inst.input.trigger("focus"); // restore focus
|
|
}
|
|
this._lastInput = null;
|
|
}
|
|
},
|
|
|
|
/* Update any alternate field to synchronise with the main field. */
|
|
_updateAlternate: function (inst) {
|
|
var altFormat, date, dateStr,
|
|
altField = this._get(inst, "altField");
|
|
|
|
if (altField) { // update alternate field too
|
|
altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat");
|
|
date = this._getDate(inst);
|
|
dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
|
|
$(altField).val(dateStr);
|
|
}
|
|
},
|
|
|
|
/* Set as beforeShowDay function to prevent selection of weekends.
|
|
* @param date Date - the date to customise
|
|
* @return [boolean, string] - is this date selectable?, what is its CSS class?
|
|
*/
|
|
noWeekends: function (date) {
|
|
var day = date.getDay();
|
|
return [(day > 0 && day < 6), ""];
|
|
},
|
|
|
|
/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
|
|
* @param date Date - the date to get the week for
|
|
* @return number - the number of the week within the year that contains this date
|
|
*/
|
|
iso8601Week: function (date) {
|
|
var time,
|
|
checkDate = new Date(date.getTime());
|
|
|
|
// Find Thursday of this week starting on Monday
|
|
checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
|
|
|
|
time = checkDate.getTime();
|
|
checkDate.setMonth(0); // Compare with Jan 1
|
|
checkDate.setDate(1);
|
|
return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
|
|
},
|
|
|
|
/* Parse a string value into a date object.
|
|
* See formatDate below for the possible formats.
|
|
*
|
|
* @param format string - the expected format of the date
|
|
* @param value string - the date in the above format
|
|
* @param settings Object - attributes include:
|
|
* shortYearCutoff number - the cutoff year for determining the century (optional)
|
|
* dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
|
|
* dayNames string[7] - names of the days from Sunday (optional)
|
|
* monthNamesShort string[12] - abbreviated names of the months (optional)
|
|
* monthNames string[12] - names of the months (optional)
|
|
* @return Date - the extracted date value or null if value is blank
|
|
*/
|
|
parseDate: function (format, value, settings) {
|
|
if (format == null || value == null) {
|
|
throw "Invalid arguments";
|
|
}
|
|
|
|
value = (typeof value === "object" ? value.toString() : value + "");
|
|
if (value === "") {
|
|
return null;
|
|
}
|
|
|
|
var iFormat, dim, extra,
|
|
iValue = 0,
|
|
shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff,
|
|
shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
|
|
new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)),
|
|
dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
|
|
dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
|
|
monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
|
|
monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
|
|
year = -1,
|
|
month = -1,
|
|
day = -1,
|
|
doy = -1,
|
|
literal = false,
|
|
date,
|
|
|
|
// Check whether a format character is doubled
|
|
lookAhead = function (match) {
|
|
var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
|
|
if (matches) {
|
|
iFormat++;
|
|
}
|
|
return matches;
|
|
},
|
|
|
|
// Extract a number from the string value
|
|
getNumber = function (match) {
|
|
var isDoubled = lookAhead(match),
|
|
size = (match === "@" ? 14 : (match === "!" ? 20 :
|
|
(match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))),
|
|
minSize = (match === "y" ? size : 1),
|
|
digits = new RegExp("^\\d{" + minSize + "," + size + "}"),
|
|
num = value.substring(iValue).match(digits);
|
|
if (!num) {
|
|
throw "Missing number at position " + iValue;
|
|
}
|
|
iValue += num[0].length;
|
|
return parseInt(num[0], 10);
|
|
},
|
|
|
|
// Extract a name from the string value and convert to an index
|
|
getName = function (match, shortNames, longNames) {
|
|
var index = -1,
|
|
names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
|
|
return [[k, v]];
|
|
}).sort(function (a, b) {
|
|
return -(a[1].length - b[1].length);
|
|
});
|
|
|
|
$.each(names, function (i, pair) {
|
|
var name = pair[1];
|
|
if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) {
|
|
index = pair[0];
|
|
iValue += name.length;
|
|
return false;
|
|
}
|
|
});
|
|
if (index !== -1) {
|
|
return index + 1;
|
|
} else {
|
|
throw "Unknown name at position " + iValue;
|
|
}
|
|
},
|
|
|
|
// Confirm that a literal character matches the string value
|
|
checkLiteral = function () {
|
|
if (value.charAt(iValue) !== format.charAt(iFormat)) {
|
|
throw "Unexpected literal at position " + iValue;
|
|
}
|
|
iValue++;
|
|
};
|
|
|
|
for (iFormat = 0; iFormat < format.length; iFormat++) {
|
|
if (literal) {
|
|
if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
|
|
literal = false;
|
|
} else {
|
|
checkLiteral();
|
|
}
|
|
} else {
|
|
switch (format.charAt(iFormat)) {
|
|
case "d":
|
|
day = getNumber("d");
|
|
break;
|
|
case "D":
|
|
getName("D", dayNamesShort, dayNames);
|
|
break;
|
|
case "o":
|
|
doy = getNumber("o");
|
|
break;
|
|
case "m":
|
|
month = getNumber("m");
|
|
break;
|
|
case "M":
|
|
month = getName("M", monthNamesShort, monthNames);
|
|
break;
|
|
case "y":
|
|
year = getNumber("y");
|
|
break;
|
|
case "@":
|
|
date = new Date(getNumber("@"));
|
|
year = date.getFullYear();
|
|
month = date.getMonth() + 1;
|
|
day = date.getDate();
|
|
break;
|
|
case "!":
|
|
date = new Date((getNumber("!") - this._ticksTo1970) / 10000);
|
|
year = date.getFullYear();
|
|
month = date.getMonth() + 1;
|
|
day = date.getDate();
|
|
break;
|
|
case "'":
|
|
if (lookAhead("'")) {
|
|
checkLiteral();
|
|
} else {
|
|
literal = true;
|
|
}
|
|
break;
|
|
default:
|
|
checkLiteral();
|
|
}
|
|
}
|
|
}
|
|
|
|
if (iValue < value.length) {
|
|
extra = value.substr(iValue);
|
|
if (!/^\s+/.test(extra)) {
|
|
throw "Extra/unparsed characters found in date: " + extra;
|
|
}
|
|
}
|
|
|
|
if (year === -1) {
|
|
year = new Date().getFullYear();
|
|
} else if (year < 100) {
|
|
year += new Date().getFullYear() - new Date().getFullYear() % 100 +
|
|
(year <= shortYearCutoff ? 0 : -100);
|
|
}
|
|
|
|
if (doy > -1) {
|
|
month = 1;
|
|
day = doy;
|
|
do {
|
|
dim = this._getDaysInMonth(year, month - 1);
|
|
if (day <= dim) {
|
|
break;
|
|
}
|
|
month++;
|
|
day -= dim;
|
|
} while (true);
|
|
}
|
|
|
|
date = this._daylightSavingAdjust(new Date(year, month - 1, day));
|
|
if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) {
|
|
throw "Invalid date"; // E.g. 31/02/00
|
|
}
|
|
return date;
|
|
},
|
|
|
|
/* Standard date formats. */
|
|
ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
|
|
COOKIE: "D, dd M yy",
|
|
ISO_8601: "yy-mm-dd",
|
|
RFC_822: "D, d M y",
|
|
RFC_850: "DD, dd-M-y",
|
|
RFC_1036: "D, d M y",
|
|
RFC_1123: "D, d M yy",
|
|
RFC_2822: "D, d M yy",
|
|
RSS: "D, d M y", // RFC 822
|
|
TICKS: "!",
|
|
TIMESTAMP: "@",
|
|
W3C: "yy-mm-dd", // ISO 8601
|
|
|
|
_ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
|
|
Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
|
|
|
|
/* Format a date object into a string value.
|
|
* The format can be combinations of the following:
|
|
* d - day of month (no leading zero)
|
|
* dd - day of month (two digit)
|
|
* o - day of year (no leading zeros)
|
|
* oo - day of year (three digit)
|
|
* D - day name short
|
|
* DD - day name long
|
|
* m - month of year (no leading zero)
|
|
* mm - month of year (two digit)
|
|
* M - month name short
|
|
* MM - month name long
|
|
* y - year (two digit)
|
|
* yy - year (four digit)
|
|
* @ - Unix timestamp (ms since 01/01/1970)
|
|
* ! - Windows ticks (100ns since 01/01/0001)
|
|
* "..." - literal text
|
|
* '' - single quote
|
|
*
|
|
* @param format string - the desired format of the date
|
|
* @param date Date - the date value to format
|
|
* @param settings Object - attributes include:
|
|
* dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
|
|
* dayNames string[7] - names of the days from Sunday (optional)
|
|
* monthNamesShort string[12] - abbreviated names of the months (optional)
|
|
* monthNames string[12] - names of the months (optional)
|
|
* @return string - the date in the above format
|
|
*/
|
|
formatDate: function (format, date, settings) {
|
|
if (!date) {
|
|
return "";
|
|
}
|
|
|
|
var iFormat,
|
|
dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
|
|
dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
|
|
monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
|
|
monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
|
|
|
|
// Check whether a format character is doubled
|
|
lookAhead = function (match) {
|
|
var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
|
|
if (matches) {
|
|
iFormat++;
|
|
}
|
|
return matches;
|
|
},
|
|
|
|
// Format a number, with leading zero if necessary
|
|
formatNumber = function (match, value, len) {
|
|
var num = "" + value;
|
|
if (lookAhead(match)) {
|
|
while (num.length < len) {
|
|
num = "0" + num;
|
|
}
|
|
}
|
|
return num;
|
|
},
|
|
|
|
// Format a name, short or long as requested
|
|
formatName = function (match, value, shortNames, longNames) {
|
|
return (lookAhead(match) ? longNames[value] : shortNames[value]);
|
|
},
|
|
output = "",
|
|
literal = false;
|
|
|
|
if (date) {
|
|
for (iFormat = 0; iFormat < format.length; iFormat++) {
|
|
if (literal) {
|
|
if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
|
|
literal = false;
|
|
} else {
|
|
output += format.charAt(iFormat);
|
|
}
|
|
} else {
|
|
switch (format.charAt(iFormat)) {
|
|
case "d":
|
|
output += formatNumber("d", date.getDate(), 2);
|
|
break;
|
|
case "D":
|
|
output += formatName("D", date.getDay(), dayNamesShort, dayNames);
|
|
break;
|
|
case "o":
|
|
output += formatNumber("o",
|
|
Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
|
|
break;
|
|
case "m":
|
|
output += formatNumber("m", date.getMonth() + 1, 2);
|
|
break;
|
|
case "M":
|
|
output += formatName("M", date.getMonth(), monthNamesShort, monthNames);
|
|
break;
|
|
case "y":
|
|
output += (lookAhead("y") ? date.getFullYear() :
|
|
(date.getFullYear() % 100 < 10 ? "0" : "") + date.getFullYear() % 100);
|
|
break;
|
|
case "@":
|
|
output += date.getTime();
|
|
break;
|
|
case "!":
|
|
output += date.getTime() * 10000 + this._ticksTo1970;
|
|
break;
|
|
case "'":
|
|
if (lookAhead("'")) {
|
|
output += "'";
|
|
} else {
|
|
literal = true;
|
|
}
|
|
break;
|
|
default:
|
|
output += format.charAt(iFormat);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return output;
|
|
},
|
|
|
|
/* Extract all possible characters from the date format. */
|
|
_possibleChars: function (format) {
|
|
var iFormat,
|
|
chars = "",
|
|
literal = false,
|
|
|
|
// Check whether a format character is doubled
|
|
lookAhead = function (match) {
|
|
var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
|
|
if (matches) {
|
|
iFormat++;
|
|
}
|
|
return matches;
|
|
};
|
|
|
|
for (iFormat = 0; iFormat < format.length; iFormat++) {
|
|
if (literal) {
|
|
if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
|
|
literal = false;
|
|
} else {
|
|
chars += format.charAt(iFormat);
|
|
}
|
|
} else {
|
|
switch (format.charAt(iFormat)) {
|
|
case "d": case "m": case "y": case "@":
|
|
chars += "0123456789";
|
|
break;
|
|
case "D": case "M":
|
|
return null; // Accept anything
|
|
case "'":
|
|
if (lookAhead("'")) {
|
|
chars += "'";
|
|
} else {
|
|
literal = true;
|
|
}
|
|
break;
|
|
default:
|
|
chars += format.charAt(iFormat);
|
|
}
|
|
}
|
|
}
|
|
return chars;
|
|
},
|
|
|
|
/* Get a setting value, defaulting if necessary. */
|
|
_get: function (inst, name) {
|
|
return inst.settings[name] !== undefined ?
|
|
inst.settings[name] : this._defaults[name];
|
|
},
|
|
|
|
/* Parse existing date and initialise date picker. */
|
|
_setDateFromField: function (inst, noDefault) {
|
|
if (inst.input.val() === inst.lastVal) {
|
|
return;
|
|
}
|
|
|
|
var dateFormat = this._get(inst, "dateFormat"),
|
|
dates = inst.lastVal = inst.input ? inst.input.val() : null,
|
|
defaultDate = this._getDefaultDate(inst),
|
|
date = defaultDate,
|
|
settings = this._getFormatConfig(inst);
|
|
|
|
try {
|
|
date = this.parseDate(dateFormat, dates, settings) || defaultDate;
|
|
} catch (event) {
|
|
dates = (noDefault ? "" : dates);
|
|
}
|
|
inst.selectedDay = date.getDate();
|
|
inst.drawMonth = inst.selectedMonth = date.getMonth();
|
|
inst.drawYear = inst.selectedYear = date.getFullYear();
|
|
inst.currentDay = (dates ? date.getDate() : 0);
|
|
inst.currentMonth = (dates ? date.getMonth() : 0);
|
|
inst.currentYear = (dates ? date.getFullYear() : 0);
|
|
this._adjustInstDate(inst);
|
|
},
|
|
|
|
/* Retrieve the default date shown on opening. */
|
|
_getDefaultDate: function (inst) {
|
|
return this._restrictMinMax(inst,
|
|
this._determineDate(inst, this._get(inst, "defaultDate"), new Date()));
|
|
},
|
|
|
|
/* A date may be specified as an exact value or a relative one. */
|
|
_determineDate: function (inst, date, defaultDate) {
|
|
var offsetNumeric = function (offset) {
|
|
var date = new Date();
|
|
date.setDate(date.getDate() + offset);
|
|
return date;
|
|
},
|
|
offsetString = function (offset) {
|
|
try {
|
|
return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
|
|
offset, $.datepicker._getFormatConfig(inst));
|
|
}
|
|
catch (e) {
|
|
// Ignore
|
|
}
|
|
|
|
var date = (offset.toLowerCase().match(/^c/) ?
|
|
$.datepicker._getDate(inst) : null) || new Date(),
|
|
year = date.getFullYear(),
|
|
month = date.getMonth(),
|
|
day = date.getDate(),
|
|
pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
|
|
matches = pattern.exec(offset);
|
|
|
|
while (matches) {
|
|
switch (matches[2] || "d") {
|
|
case "d": case "D":
|
|
day += parseInt(matches[1], 10); break;
|
|
case "w": case "W":
|
|
day += parseInt(matches[1], 10) * 7; break;
|
|
case "m": case "M":
|
|
month += parseInt(matches[1], 10);
|
|
day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
|
|
break;
|
|
case "y": case "Y":
|
|
year += parseInt(matches[1], 10);
|
|
day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
|
|
break;
|
|
}
|
|
matches = pattern.exec(offset);
|
|
}
|
|
return new Date(year, month, day);
|
|
},
|
|
newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) :
|
|
(typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
|
|
|
|
newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate);
|
|
if (newDate) {
|
|
newDate.setHours(0);
|
|
newDate.setMinutes(0);
|
|
newDate.setSeconds(0);
|
|
newDate.setMilliseconds(0);
|
|
}
|
|
return this._daylightSavingAdjust(newDate);
|
|
},
|
|
|
|
/* Handle switch to/from daylight saving.
|
|
* Hours may be non-zero on daylight saving cut-over:
|
|
* > 12 when midnight changeover, but then cannot generate
|
|
* midnight datetime, so jump to 1AM, otherwise reset.
|
|
* @param date (Date) the date to check
|
|
* @return (Date) the corrected date
|
|
*/
|
|
_daylightSavingAdjust: function (date) {
|
|
if (!date) {
|
|
return null;
|
|
}
|
|
date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
|
|
return date;
|
|
},
|
|
|
|
/* Set the date(s) directly. */
|
|
_setDate: function (inst, date, noChange) {
|
|
var clear = !date,
|
|
origMonth = inst.selectedMonth,
|
|
origYear = inst.selectedYear,
|
|
newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
|
|
|
|
inst.selectedDay = inst.currentDay = newDate.getDate();
|
|
inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
|
|
inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
|
|
if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) {
|
|
this._notifyChange(inst);
|
|
}
|
|
this._adjustInstDate(inst);
|
|
if (inst.input) {
|
|
inst.input.val(clear ? "" : this._formatDate(inst));
|
|
}
|
|
},
|
|
|
|
/* Retrieve the date(s) directly. */
|
|
_getDate: function (inst) {
|
|
var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null :
|
|
this._daylightSavingAdjust(new Date(
|
|
inst.currentYear, inst.currentMonth, inst.currentDay)));
|
|
return startDate;
|
|
},
|
|
|
|
/* Attach the onxxx handlers. These are declared statically so
|
|
* they work with static code transformers like Caja.
|
|
*/
|
|
_attachHandlers: function (inst) {
|
|
var stepMonths = this._get(inst, "stepMonths"),
|
|
id = "#" + inst.id.replace(/\\\\/g, "\\");
|
|
inst.dpDiv.find("[data-handler]").map(function () {
|
|
var handler = {
|
|
prev: function () {
|
|
$.datepicker._adjustDate(id, -stepMonths, "M");
|
|
},
|
|
next: function () {
|
|
$.datepicker._adjustDate(id, +stepMonths, "M");
|
|
},
|
|
hide: function () {
|
|
$.datepicker._hideDatepicker();
|
|
},
|
|
today: function () {
|
|
$.datepicker._gotoToday(id);
|
|
},
|
|
selectDay: function () {
|
|
$.datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this);
|
|
return false;
|
|
},
|
|
selectMonth: function () {
|
|
$.datepicker._selectMonthYear(id, this, "M");
|
|
return false;
|
|
},
|
|
selectYear: function () {
|
|
$.datepicker._selectMonthYear(id, this, "Y");
|
|
return false;
|
|
}
|
|
};
|
|
$(this).on(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]);
|
|
});
|
|
},
|
|
|
|
/* Generate the HTML for the current state of the date picker. */
|
|
_generateHTML: function (inst) {
|
|
var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
|
|
controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
|
|
monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
|
|
selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
|
|
cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
|
|
printDate, dRow, tbody, daySettings, otherMonth, unselectable,
|
|
tempDate = new Date(),
|
|
today = this._daylightSavingAdjust(
|
|
new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time
|
|
isRTL = this._get(inst, "isRTL"),
|
|
showButtonPanel = this._get(inst, "showButtonPanel"),
|
|
hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"),
|
|
navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"),
|
|
numMonths = this._getNumberOfMonths(inst),
|
|
showCurrentAtPos = this._get(inst, "showCurrentAtPos"),
|
|
stepMonths = this._get(inst, "stepMonths"),
|
|
isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1),
|
|
currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
|
|
new Date(inst.currentYear, inst.currentMonth, inst.currentDay))),
|
|
minDate = this._getMinMaxDate(inst, "min"),
|
|
maxDate = this._getMinMaxDate(inst, "max"),
|
|
drawMonth = inst.drawMonth - showCurrentAtPos,
|
|
drawYear = inst.drawYear;
|
|
|
|
if (drawMonth < 0) {
|
|
drawMonth += 12;
|
|
drawYear--;
|
|
}
|
|
if (maxDate) {
|
|
maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
|
|
maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
|
|
maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
|
|
while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
|
|
drawMonth--;
|
|
if (drawMonth < 0) {
|
|
drawMonth = 11;
|
|
drawYear--;
|
|
}
|
|
}
|
|
}
|
|
inst.drawMonth = drawMonth;
|
|
inst.drawYear = drawYear;
|
|
|
|
prevText = this._get(inst, "prevText");
|
|
prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
|
|
this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
|
|
this._getFormatConfig(inst)));
|
|
|
|
prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
|
|
"<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
|
|
" title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "e" : "w") + "'>" + prevText + "</span></a>" :
|
|
(hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "e" : "w") + "'>" + prevText + "</span></a>"));
|
|
|
|
nextText = this._get(inst, "nextText");
|
|
nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
|
|
this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
|
|
this._getFormatConfig(inst)));
|
|
|
|
next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
|
|
"<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
|
|
" title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "w" : "e") + "'>" + nextText + "</span></a>" :
|
|
(hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "w" : "e") + "'>" + nextText + "</span></a>"));
|
|
|
|
currentText = this._get(inst, "currentText");
|
|
gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today);
|
|
currentText = (!navigationAsDateFormat ? currentText :
|
|
this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
|
|
|
|
controls = (!inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
|
|
this._get(inst, "closeText") + "</button>" : "");
|
|
|
|
buttonPanel = (showButtonPanel) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + (isRTL ? controls : "") +
|
|
(this._isInRange(inst, gotoDate) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
|
|
">" + currentText + "</button>" : "") + (isRTL ? "" : controls) + "</div>" : "";
|
|
|
|
firstDay = parseInt(this._get(inst, "firstDay"), 10);
|
|
firstDay = (isNaN(firstDay) ? 0 : firstDay);
|
|
|
|
showWeek = this._get(inst, "showWeek");
|
|
dayNames = this._get(inst, "dayNames");
|
|
dayNamesMin = this._get(inst, "dayNamesMin");
|
|
monthNames = this._get(inst, "monthNames");
|
|
monthNamesShort = this._get(inst, "monthNamesShort");
|
|
beforeShowDay = this._get(inst, "beforeShowDay");
|
|
showOtherMonths = this._get(inst, "showOtherMonths");
|
|
selectOtherMonths = this._get(inst, "selectOtherMonths");
|
|
defaultDate = this._getDefaultDate(inst);
|
|
html = "";
|
|
|
|
for (row = 0; row < numMonths[0]; row++) {
|
|
group = "";
|
|
this.maxRows = 4;
|
|
for (col = 0; col < numMonths[1]; col++) {
|
|
selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
|
|
cornerClass = " ui-corner-all";
|
|
calender = "";
|
|
if (isMultiMonth) {
|
|
calender += "<div class='ui-datepicker-group";
|
|
if (numMonths[1] > 1) {
|
|
switch (col) {
|
|
case 0: calender += " ui-datepicker-group-first";
|
|
cornerClass = " ui-corner-" + (isRTL ? "right" : "left"); break;
|
|
case numMonths[1] - 1: calender += " ui-datepicker-group-last";
|
|
cornerClass = " ui-corner-" + (isRTL ? "left" : "right"); break;
|
|
default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break;
|
|
}
|
|
}
|
|
calender += "'>";
|
|
}
|
|
calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" +
|
|
(/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") +
|
|
(/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") +
|
|
this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
|
|
row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
|
|
"</div><table class='ui-datepicker-calendar'><thead>" +
|
|
"<tr>";
|
|
thead = (showWeek ? "<th class='ui-datepicker-week-col'>" + this._get(inst, "weekHeader") + "</th>" : "");
|
|
for (dow = 0; dow < 7; dow++) { // days of the week
|
|
day = (dow + firstDay) % 7;
|
|
thead += "<th scope='col'" + ((dow + firstDay + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "") + ">" +
|
|
"<span title='" + dayNames[day] + "'>" + dayNamesMin[day] + "</span></th>";
|
|
}
|
|
calender += thead + "</tr></thead><tbody>";
|
|
daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
|
|
if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) {
|
|
inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
|
|
}
|
|
leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
|
|
curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
|
|
numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
|
|
this.maxRows = numRows;
|
|
printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
|
|
for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows
|
|
calender += "<tr>";
|
|
tbody = (!showWeek ? "" : "<td class='ui-datepicker-week-col'>" +
|
|
this._get(inst, "calculateWeek")(printDate) + "</td>");
|
|
for (dow = 0; dow < 7; dow++) { // create date picker days
|
|
daySettings = (beforeShowDay ?
|
|
beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]);
|
|
otherMonth = (printDate.getMonth() !== drawMonth);
|
|
unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
|
|
(minDate && printDate < minDate) || (maxDate && printDate > maxDate);
|
|
tbody += "<td class='" +
|
|
((dow + firstDay + 6) % 7 >= 5 ? " ui-datepicker-week-end" : "") + // highlight weekends
|
|
(otherMonth ? " ui-datepicker-other-month" : "") + // highlight days from other months
|
|
((printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent) || // user pressed key
|
|
(defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime()) ?
|
|
|
|
// or defaultDate is current printedDate and defaultDate is selectedDate
|
|
" " + this._dayOverClass : "") + // highlight selected day
|
|
(unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "") + // highlight unselectable days
|
|
(otherMonth && !showOtherMonths ? "" : " " + daySettings[1] + // highlight custom dates
|
|
(printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "") + // highlight selected day
|
|
(printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "")) + "'" + // highlight today (if different)
|
|
((!otherMonth || showOtherMonths) && daySettings[2] ? " title='" + daySettings[2].replace(/'/g, "'") + "'" : "") + // cell title
|
|
(unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'") + ">" + // actions
|
|
(otherMonth && !showOtherMonths ? " " : // display for other months
|
|
(unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" +
|
|
(printDate.getTime() === today.getTime() ? " ui-state-highlight" : "") +
|
|
(printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "") + // highlight selected day
|
|
(otherMonth ? " ui-priority-secondary" : "") + // distinguish dates from other months
|
|
"' href='#'>" + printDate.getDate() + "</a>")) + "</td>"; // display selectable date
|
|
printDate.setDate(printDate.getDate() + 1);
|
|
printDate = this._daylightSavingAdjust(printDate);
|
|
}
|
|
calender += tbody + "</tr>";
|
|
}
|
|
drawMonth++;
|
|
if (drawMonth > 11) {
|
|
drawMonth = 0;
|
|
drawYear++;
|
|
}
|
|
calender += "</tbody></table>" + (isMultiMonth ? "</div>" +
|
|
((numMonths[0] > 0 && col === numMonths[1] - 1) ? "<div class='ui-datepicker-row-break'></div>" : "") : "");
|
|
group += calender;
|
|
}
|
|
html += group;
|
|
}
|
|
html += buttonPanel;
|
|
inst._keyEvent = false;
|
|
return html;
|
|
},
|
|
|
|
/* Generate the month and year header. */
|
|
_generateMonthYearHeader: function (inst, drawMonth, drawYear, minDate, maxDate,
|
|
secondary, monthNames, monthNamesShort) {
|
|
var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
|
|
changeMonth = this._get(inst, "changeMonth"),
|
|
changeYear = this._get(inst, "changeYear"),
|
|
showMonthAfterYear = this._get(inst, "showMonthAfterYear"),
|
|
html = "<div class='ui-datepicker-title'>",
|
|
monthHtml = "";
|
|
|
|
// Month selection
|
|
if (secondary || !changeMonth) {
|
|
monthHtml += "<span class='ui-datepicker-month'>" + monthNames[drawMonth] + "</span>";
|
|
} else {
|
|
inMinYear = (minDate && minDate.getFullYear() === drawYear);
|
|
inMaxYear = (maxDate && maxDate.getFullYear() === drawYear);
|
|
monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
|
|
for (month = 0; month < 12; month++) {
|
|
if ((!inMinYear || month >= minDate.getMonth()) && (!inMaxYear || month <= maxDate.getMonth())) {
|
|
monthHtml += "<option value='" + month + "'" +
|
|
(month === drawMonth ? " selected='selected'" : "") +
|
|
">" + monthNamesShort[month] + "</option>";
|
|
}
|
|
}
|
|
monthHtml += "</select>";
|
|
}
|
|
|
|
if (!showMonthAfterYear) {
|
|
html += monthHtml + (secondary || !(changeMonth && changeYear) ? " " : "");
|
|
}
|
|
|
|
// Year selection
|
|
if (!inst.yearshtml) {
|
|
inst.yearshtml = "";
|
|
if (secondary || !changeYear) {
|
|
html += "<span class='ui-datepicker-year'>" + drawYear + "</span>";
|
|
} else {
|
|
// determine range of years to display
|
|
years = this._get(inst, "yearRange").split(":");
|
|
thisYear = new Date().getFullYear();
|
|
determineYear = function (value) {
|
|
var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) :
|
|
(value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) :
|
|
parseInt(value, 10)));
|
|
return (isNaN(year) ? thisYear : year);
|
|
};
|
|
year = determineYear(years[0]);
|
|
endYear = Math.max(year, determineYear(years[1] || ""));
|
|
year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
|
|
endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
|
|
inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
|
|
for (; year <= endYear; year++) {
|
|
inst.yearshtml += "<option value='" + year + "'" +
|
|
(year === drawYear ? " selected='selected'" : "") +
|
|
">" + year + "</option>";
|
|
}
|
|
inst.yearshtml += "</select>";
|
|
|
|
html += inst.yearshtml;
|
|
inst.yearshtml = null;
|
|
}
|
|
}
|
|
|
|
html += this._get(inst, "yearSuffix");
|
|
if (showMonthAfterYear) {
|
|
html += (secondary || !(changeMonth && changeYear) ? " " : "") + monthHtml;
|
|
}
|
|
html += "</div>"; // Close datepicker_header
|
|
return html;
|
|
},
|
|
|
|
/* Adjust one of the date sub-fields. */
|
|
_adjustInstDate: function (inst, offset, period) {
|
|
var year = inst.selectedYear + (period === "Y" ? offset : 0),
|
|
month = inst.selectedMonth + (period === "M" ? offset : 0),
|
|
day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0),
|
|
date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day)));
|
|
|
|
inst.selectedDay = date.getDate();
|
|
inst.drawMonth = inst.selectedMonth = date.getMonth();
|
|
inst.drawYear = inst.selectedYear = date.getFullYear();
|
|
if (period === "M" || period === "Y") {
|
|
this._notifyChange(inst);
|
|
}
|
|
},
|
|
|
|
/* Ensure a date is within any min/max bounds. */
|
|
_restrictMinMax: function (inst, date) {
|
|
var minDate = this._getMinMaxDate(inst, "min"),
|
|
maxDate = this._getMinMaxDate(inst, "max"),
|
|
newDate = (minDate && date < minDate ? minDate : date);
|
|
return (maxDate && newDate > maxDate ? maxDate : newDate);
|
|
},
|
|
|
|
/* Notify change of month/year. */
|
|
_notifyChange: function (inst) {
|
|
var onChange = this._get(inst, "onChangeMonthYear");
|
|
if (onChange) {
|
|
onChange.apply((inst.input ? inst.input[0] : null),
|
|
[inst.selectedYear, inst.selectedMonth + 1, inst]);
|
|
}
|
|
},
|
|
|
|
/* Determine the number of months to show. */
|
|
_getNumberOfMonths: function (inst) {
|
|
var numMonths = this._get(inst, "numberOfMonths");
|
|
return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths));
|
|
},
|
|
|
|
/* Determine the current maximum date - ensure no time components are set. */
|
|
_getMinMaxDate: function (inst, minMax) {
|
|
return this._determineDate(inst, this._get(inst, minMax + "Date"), null);
|
|
},
|
|
|
|
/* Find the number of days in a given month. */
|
|
_getDaysInMonth: function (year, month) {
|
|
return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
|
|
},
|
|
|
|
/* Find the day of the week of the first of a month. */
|
|
_getFirstDayOfMonth: function (year, month) {
|
|
return new Date(year, month, 1).getDay();
|
|
},
|
|
|
|
/* Determines if we should allow a "next/prev" month display change. */
|
|
_canAdjustMonth: function (inst, offset, curYear, curMonth) {
|
|
var numMonths = this._getNumberOfMonths(inst),
|
|
date = this._daylightSavingAdjust(new Date(curYear,
|
|
curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
|
|
|
|
if (offset < 0) {
|
|
date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
|
|
}
|
|
return this._isInRange(inst, date);
|
|
},
|
|
|
|
/* Is the given date in the accepted range? */
|
|
_isInRange: function (inst, date) {
|
|
var yearSplit, currentYear,
|
|
minDate = this._getMinMaxDate(inst, "min"),
|
|
maxDate = this._getMinMaxDate(inst, "max"),
|
|
minYear = null,
|
|
maxYear = null,
|
|
years = this._get(inst, "yearRange");
|
|
if (years) {
|
|
yearSplit = years.split(":");
|
|
currentYear = new Date().getFullYear();
|
|
minYear = parseInt(yearSplit[0], 10);
|
|
maxYear = parseInt(yearSplit[1], 10);
|
|
if (yearSplit[0].match(/[+\-].*/)) {
|
|
minYear += currentYear;
|
|
}
|
|
if (yearSplit[1].match(/[+\-].*/)) {
|
|
maxYear += currentYear;
|
|
}
|
|
}
|
|
|
|
return ((!minDate || date.getTime() >= minDate.getTime()) &&
|
|
(!maxDate || date.getTime() <= maxDate.getTime()) &&
|
|
(!minYear || date.getFullYear() >= minYear) &&
|
|
(!maxYear || date.getFullYear() <= maxYear));
|
|
},
|
|
|
|
/* Provide the configuration settings for formatting/parsing. */
|
|
_getFormatConfig: function (inst) {
|
|
var shortYearCutoff = this._get(inst, "shortYearCutoff");
|
|
shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff :
|
|
new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
|
|
return {
|
|
shortYearCutoff: shortYearCutoff,
|
|
dayNamesShort: this._get(inst, "dayNamesShort"), dayNames: this._get(inst, "dayNames"),
|
|
monthNamesShort: this._get(inst, "monthNamesShort"), monthNames: this._get(inst, "monthNames")
|
|
};
|
|
},
|
|
|
|
/* Format the given date for display. */
|
|
_formatDate: function (inst, day, month, year) {
|
|
if (!day) {
|
|
inst.currentDay = inst.selectedDay;
|
|
inst.currentMonth = inst.selectedMonth;
|
|
inst.currentYear = inst.selectedYear;
|
|
}
|
|
var date = (day ? (typeof day === "object" ? day :
|
|
this._daylightSavingAdjust(new Date(year, month, day))) :
|
|
this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
|
|
return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst));
|
|
}
|
|
});
|
|
|
|
/*
|
|
* Bind hover events for datepicker elements.
|
|
* Done via delegate so the binding only occurs once in the lifetime of the parent div.
|
|
* Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
|
|
*/
|
|
function datepicker_bindHover(dpDiv) {
|
|
var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
|
|
return dpDiv.on("mouseout", selector, function () {
|
|
$(this).removeClass("ui-state-hover");
|
|
if (this.className.indexOf("ui-datepicker-prev") !== -1) {
|
|
$(this).removeClass("ui-datepicker-prev-hover");
|
|
}
|
|
if (this.className.indexOf("ui-datepicker-next") !== -1) {
|
|
$(this).removeClass("ui-datepicker-next-hover");
|
|
}
|
|
})
|
|
.on("mouseover", selector, datepicker_handleMouseover);
|
|
}
|
|
|
|
function datepicker_handleMouseover() {
|
|
if (!$.datepicker._isDisabledDatepicker(datepicker_instActive.inline ? datepicker_instActive.dpDiv.parent()[0] : datepicker_instActive.input[0])) {
|
|
$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
|
|
$(this).addClass("ui-state-hover");
|
|
if (this.className.indexOf("ui-datepicker-prev") !== -1) {
|
|
$(this).addClass("ui-datepicker-prev-hover");
|
|
}
|
|
if (this.className.indexOf("ui-datepicker-next") !== -1) {
|
|
$(this).addClass("ui-datepicker-next-hover");
|
|
}
|
|
}
|
|
}
|
|
|
|
/* jQuery extend now ignores nulls! */
|
|
function datepicker_extendRemove(target, props) {
|
|
$.extend(target, props);
|
|
for (var name in props) {
|
|
if (props[name] == null) {
|
|
target[name] = props[name];
|
|
}
|
|
}
|
|
return target;
|
|
}
|
|
|
|
/* Invoke the datepicker functionality.
|
|
@param options string - a command, optionally followed by additional parameters or
|
|
Object - settings for attaching new datepicker functionality
|
|
@return jQuery object */
|
|
$.fn.datepicker = function (options) {
|
|
/* Verify an empty collection wasn't passed - Fixes #6976 */
|
|
if (!this.length) {
|
|
return this;
|
|
}
|
|
|
|
/* Initialise the date picker. */
|
|
if (!$.datepicker.initialized) {
|
|
$(document).on("mousedown", $.datepicker._checkExternalClick);
|
|
$.datepicker.initialized = true;
|
|
}
|
|
|
|
/* Append datepicker main container to body if not exist. */
|
|
if ($("#" + $.datepicker._mainDivId).length === 0) {
|
|
$("body").append($.datepicker.dpDiv);
|
|
}
|
|
|
|
var otherArgs = Array.prototype.slice.call(arguments, 1);
|
|
if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) {
|
|
return $.datepicker["_" + options + "Datepicker"].
|
|
apply($.datepicker, [this[0]].concat(otherArgs));
|
|
}
|
|
if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") {
|
|
return $.datepicker["_" + options + "Datepicker"].
|
|
apply($.datepicker, [this[0]].concat(otherArgs));
|
|
}
|
|
return this.each(function () {
|
|
typeof options === "string" ?
|
|
$.datepicker["_" + options + "Datepicker"].
|
|
apply($.datepicker, [this].concat(otherArgs)) :
|
|
$.datepicker._attachDatepicker(this, options);
|
|
});
|
|
};
|
|
|
|
$.datepicker = new Datepicker(); // singleton instance
|
|
$.datepicker.initialized = false;
|
|
$.datepicker.uuid = new Date().getTime();
|
|
$.datepicker.version = "1.12.1";
|
|
|
|
var widgetsDatepicker = $.datepicker;
|
|
|
|
// This file is deprecated
|
|
var ie = $.ui.ie = !!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase());
|
|
|
|
/*!
|
|
* jQuery UI Mouse 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Mouse
|
|
//>>group: Widgets
|
|
//>>description: Abstracts mouse-based interactions to assist in creating certain widgets.
|
|
//>>docs: http://api.jqueryui.com/mouse/
|
|
|
|
var mouseHandled = false;
|
|
$(document).on("mouseup", function () {
|
|
mouseHandled = false;
|
|
});
|
|
|
|
var widgetsMouse = $.widget("ui.mouse", {
|
|
version: "1.12.1",
|
|
options: {
|
|
cancel: "input, textarea, button, select, option",
|
|
distance: 1,
|
|
delay: 0
|
|
},
|
|
_mouseInit: function () {
|
|
var that = this;
|
|
|
|
this.element
|
|
.on("mousedown." + this.widgetName, function (event) {
|
|
return that._mouseDown(event);
|
|
})
|
|
.on("click." + this.widgetName, function (event) {
|
|
if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) {
|
|
$.removeData(event.target, that.widgetName + ".preventClickEvent");
|
|
event.stopImmediatePropagation();
|
|
return false;
|
|
}
|
|
});
|
|
|
|
this.started = false;
|
|
},
|
|
|
|
// TODO: make sure destroying one instance of mouse doesn't mess with
|
|
// other instances of mouse
|
|
_mouseDestroy: function () {
|
|
this.element.off("." + this.widgetName);
|
|
if (this._mouseMoveDelegate) {
|
|
this.document
|
|
.off("mousemove." + this.widgetName, this._mouseMoveDelegate)
|
|
.off("mouseup." + this.widgetName, this._mouseUpDelegate);
|
|
}
|
|
},
|
|
|
|
_mouseDown: function (event) {
|
|
// don't let more than one widget handle mouseStart
|
|
if (mouseHandled) {
|
|
return;
|
|
}
|
|
|
|
this._mouseMoved = false;
|
|
|
|
// We may have missed mouseup (out of window)
|
|
(this._mouseStarted && this._mouseUp(event));
|
|
|
|
this._mouseDownEvent = event;
|
|
|
|
var that = this,
|
|
btnIsLeft = (event.which === 1),
|
|
|
|
// event.target.nodeName works around a bug in IE 8 with
|
|
// disabled inputs (#7620)
|
|
elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ?
|
|
$(event.target).closest(this.options.cancel).length : false);
|
|
if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
|
|
return true;
|
|
}
|
|
|
|
this.mouseDelayMet = !this.options.delay;
|
|
if (!this.mouseDelayMet) {
|
|
this._mouseDelayTimer = setTimeout(function () {
|
|
that.mouseDelayMet = true;
|
|
}, this.options.delay);
|
|
}
|
|
|
|
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
|
this._mouseStarted = (this._mouseStart(event) !== false);
|
|
if (!this._mouseStarted) {
|
|
event.preventDefault();
|
|
return true;
|
|
}
|
|
}
|
|
|
|
// Click event may never have fired (Gecko & Opera)
|
|
if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) {
|
|
$.removeData(event.target, this.widgetName + ".preventClickEvent");
|
|
}
|
|
|
|
// These delegates are required to keep context
|
|
this._mouseMoveDelegate = function (event) {
|
|
return that._mouseMove(event);
|
|
};
|
|
this._mouseUpDelegate = function (event) {
|
|
return that._mouseUp(event);
|
|
};
|
|
|
|
this.document
|
|
.on("mousemove." + this.widgetName, this._mouseMoveDelegate)
|
|
.on("mouseup." + this.widgetName, this._mouseUpDelegate);
|
|
|
|
event.preventDefault();
|
|
|
|
mouseHandled = true;
|
|
return true;
|
|
},
|
|
|
|
_mouseMove: function (event) {
|
|
// Only check for mouseups outside the document if you've moved inside the document
|
|
// at least once. This prevents the firing of mouseup in the case of IE<9, which will
|
|
// fire a mousemove event if content is placed under the cursor. See #7778
|
|
// Support: IE <9
|
|
if (this._mouseMoved) {
|
|
// IE mouseup check - mouseup happened when mouse was out of window
|
|
if ($.ui.ie && (!document.documentMode || document.documentMode < 9) &&
|
|
!event.button) {
|
|
return this._mouseUp(event);
|
|
|
|
// Iframe mouseup check - mouseup occurred in another document
|
|
} else if (!event.which) {
|
|
// Support: Safari <=8 - 9
|
|
// Safari sets which to 0 if you press any of the following keys
|
|
// during a drag (#14461)
|
|
if (event.originalEvent.altKey || event.originalEvent.ctrlKey ||
|
|
event.originalEvent.metaKey || event.originalEvent.shiftKey) {
|
|
this.ignoreMissingWhich = true;
|
|
} else if (!this.ignoreMissingWhich) {
|
|
return this._mouseUp(event);
|
|
}
|
|
}
|
|
}
|
|
|
|
if (event.which || event.button) {
|
|
this._mouseMoved = true;
|
|
}
|
|
|
|
if (this._mouseStarted) {
|
|
this._mouseDrag(event);
|
|
return event.preventDefault();
|
|
}
|
|
|
|
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
|
this._mouseStarted =
|
|
(this._mouseStart(this._mouseDownEvent, event) !== false);
|
|
(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
|
|
}
|
|
|
|
return !this._mouseStarted;
|
|
},
|
|
|
|
_mouseUp: function (event) {
|
|
this.document
|
|
.off("mousemove." + this.widgetName, this._mouseMoveDelegate)
|
|
.off("mouseup." + this.widgetName, this._mouseUpDelegate);
|
|
|
|
if (this._mouseStarted) {
|
|
this._mouseStarted = false;
|
|
|
|
if (event.target === this._mouseDownEvent.target) {
|
|
$.data(event.target, this.widgetName + ".preventClickEvent", true);
|
|
}
|
|
|
|
this._mouseStop(event);
|
|
}
|
|
|
|
if (this._mouseDelayTimer) {
|
|
clearTimeout(this._mouseDelayTimer);
|
|
delete this._mouseDelayTimer;
|
|
}
|
|
|
|
this.ignoreMissingWhich = false;
|
|
mouseHandled = false;
|
|
event.preventDefault();
|
|
},
|
|
|
|
_mouseDistanceMet: function (event) {
|
|
return (Math.max(
|
|
Math.abs(this._mouseDownEvent.pageX - event.pageX),
|
|
Math.abs(this._mouseDownEvent.pageY - event.pageY)
|
|
) >= this.options.distance
|
|
);
|
|
},
|
|
|
|
_mouseDelayMet: function ( /* event */) {
|
|
return this.mouseDelayMet;
|
|
},
|
|
|
|
// These are placeholder methods, to be overriden by extending plugin
|
|
_mouseStart: function ( /* event */) { },
|
|
_mouseDrag: function ( /* event */) { },
|
|
_mouseStop: function ( /* event */) { },
|
|
_mouseCapture: function ( /* event */) { return true; }
|
|
});
|
|
|
|
// $.ui.plugin is deprecated. Use $.widget() extensions instead.
|
|
var plugin = $.ui.plugin = {
|
|
add: function (module, option, set) {
|
|
var i,
|
|
proto = $.ui[module].prototype;
|
|
for (i in set) {
|
|
proto.plugins[i] = proto.plugins[i] || [];
|
|
proto.plugins[i].push([option, set[i]]);
|
|
}
|
|
},
|
|
call: function (instance, name, args, allowDisconnected) {
|
|
var i,
|
|
set = instance.plugins[name];
|
|
|
|
if (!set) {
|
|
return;
|
|
}
|
|
|
|
if (!allowDisconnected && (!instance.element[0].parentNode ||
|
|
instance.element[0].parentNode.nodeType === 11)) {
|
|
return;
|
|
}
|
|
|
|
for (i = 0; i < set.length; i++) {
|
|
if (instance.options[set[i][0]]) {
|
|
set[i][1].apply(instance.element, args);
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
var safeBlur = $.ui.safeBlur = function (element) {
|
|
// Support: IE9 - 10 only
|
|
// If the <body> is blurred, IE will switch windows, see #9420
|
|
if (element && element.nodeName.toLowerCase() !== "body") {
|
|
$(element).trigger("blur");
|
|
}
|
|
};
|
|
|
|
/*!
|
|
* jQuery UI Draggable 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Draggable
|
|
//>>group: Interactions
|
|
//>>description: Enables dragging functionality for any element.
|
|
//>>docs: http://api.jqueryui.com/draggable/
|
|
//>>demos: http://jqueryui.com/draggable/
|
|
//>>css.structure: ../../themes/base/draggable.css
|
|
|
|
$.widget("ui.draggable", $.ui.mouse, {
|
|
version: "1.12.1",
|
|
widgetEventPrefix: "drag",
|
|
options: {
|
|
addClasses: true,
|
|
appendTo: "parent",
|
|
axis: false,
|
|
connectToSortable: false,
|
|
containment: false,
|
|
cursor: "auto",
|
|
cursorAt: false,
|
|
grid: false,
|
|
handle: false,
|
|
helper: "original",
|
|
iframeFix: false,
|
|
opacity: false,
|
|
refreshPositions: false,
|
|
revert: false,
|
|
revertDuration: 500,
|
|
scope: "default",
|
|
scroll: true,
|
|
scrollSensitivity: 20,
|
|
scrollSpeed: 20,
|
|
snap: false,
|
|
snapMode: "both",
|
|
snapTolerance: 20,
|
|
stack: false,
|
|
zIndex: false,
|
|
|
|
// Callbacks
|
|
drag: null,
|
|
start: null,
|
|
stop: null
|
|
},
|
|
_create: function () {
|
|
if (this.options.helper === "original") {
|
|
this._setPositionRelative();
|
|
}
|
|
if (this.options.addClasses) {
|
|
this._addClass("ui-draggable");
|
|
}
|
|
this._setHandleClassName();
|
|
|
|
this._mouseInit();
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
this._super(key, value);
|
|
if (key === "handle") {
|
|
this._removeHandleClassName();
|
|
this._setHandleClassName();
|
|
}
|
|
},
|
|
|
|
_destroy: function () {
|
|
if ((this.helper || this.element).is(".ui-draggable-dragging")) {
|
|
this.destroyOnClear = true;
|
|
return;
|
|
}
|
|
this._removeHandleClassName();
|
|
this._mouseDestroy();
|
|
},
|
|
|
|
_mouseCapture: function (event) {
|
|
var o = this.options;
|
|
|
|
// Among others, prevent a drag on a resizable-handle
|
|
if (this.helper || o.disabled ||
|
|
$(event.target).closest(".ui-resizable-handle").length > 0) {
|
|
return false;
|
|
}
|
|
|
|
//Quit if we're not on a valid handle
|
|
this.handle = this._getHandle(event);
|
|
if (!this.handle) {
|
|
return false;
|
|
}
|
|
|
|
this._blurActiveElement(event);
|
|
|
|
this._blockFrames(o.iframeFix === true ? "iframe" : o.iframeFix);
|
|
|
|
return true;
|
|
},
|
|
|
|
_blockFrames: function (selector) {
|
|
this.iframeBlocks = this.document.find(selector).map(function () {
|
|
var iframe = $(this);
|
|
|
|
return $("<div>")
|
|
.css("position", "absolute")
|
|
.appendTo(iframe.parent())
|
|
.outerWidth(iframe.outerWidth())
|
|
.outerHeight(iframe.outerHeight())
|
|
.offset(iframe.offset())[0];
|
|
});
|
|
},
|
|
|
|
_unblockFrames: function () {
|
|
if (this.iframeBlocks) {
|
|
this.iframeBlocks.remove();
|
|
delete this.iframeBlocks;
|
|
}
|
|
},
|
|
|
|
_blurActiveElement: function (event) {
|
|
var activeElement = $.ui.safeActiveElement(this.document[0]),
|
|
target = $(event.target);
|
|
|
|
// Don't blur if the event occurred on an element that is within
|
|
// the currently focused element
|
|
// See #10527, #12472
|
|
if (target.closest(activeElement).length) {
|
|
return;
|
|
}
|
|
|
|
// Blur any element that currently has focus, see #4261
|
|
$.ui.safeBlur(activeElement);
|
|
},
|
|
|
|
_mouseStart: function (event) {
|
|
var o = this.options;
|
|
|
|
//Create and append the visible helper
|
|
this.helper = this._createHelper(event);
|
|
|
|
this._addClass(this.helper, "ui-draggable-dragging");
|
|
|
|
//Cache the helper size
|
|
this._cacheHelperProportions();
|
|
|
|
//If ddmanager is used for droppables, set the global draggable
|
|
if ($.ui.ddmanager) {
|
|
$.ui.ddmanager.current = this;
|
|
}
|
|
|
|
/*
|
|
* - Position generation -
|
|
* This block generates everything position related - it's the core of draggables.
|
|
*/
|
|
|
|
//Cache the margins of the original element
|
|
this._cacheMargins();
|
|
|
|
//Store the helper's css position
|
|
this.cssPosition = this.helper.css("position");
|
|
this.scrollParent = this.helper.scrollParent(true);
|
|
this.offsetParent = this.helper.offsetParent();
|
|
this.hasFixedAncestor = this.helper.parents().filter(function () {
|
|
return $(this).css("position") === "fixed";
|
|
}).length > 0;
|
|
|
|
//The element's absolute position on the page minus margins
|
|
this.positionAbs = this.element.offset();
|
|
this._refreshOffsets(event);
|
|
|
|
//Generate the original position
|
|
this.originalPosition = this.position = this._generatePosition(event, false);
|
|
this.originalPageX = event.pageX;
|
|
this.originalPageY = event.pageY;
|
|
|
|
//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
|
|
(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
|
|
|
|
//Set a containment if given in the options
|
|
this._setContainment();
|
|
|
|
//Trigger event + callbacks
|
|
if (this._trigger("start", event) === false) {
|
|
this._clear();
|
|
return false;
|
|
}
|
|
|
|
//Recache the helper size
|
|
this._cacheHelperProportions();
|
|
|
|
//Prepare the droppable offsets
|
|
if ($.ui.ddmanager && !o.dropBehaviour) {
|
|
$.ui.ddmanager.prepareOffsets(this, event);
|
|
}
|
|
|
|
// Execute the drag once - this causes the helper not to be visible before getting its
|
|
// correct position
|
|
this._mouseDrag(event, true);
|
|
|
|
// If the ddmanager is used for droppables, inform the manager that dragging has started
|
|
// (see #5003)
|
|
if ($.ui.ddmanager) {
|
|
$.ui.ddmanager.dragStart(this, event);
|
|
}
|
|
|
|
return true;
|
|
},
|
|
|
|
_refreshOffsets: function (event) {
|
|
this.offset = {
|
|
top: this.positionAbs.top - this.margins.top,
|
|
left: this.positionAbs.left - this.margins.left,
|
|
scroll: false,
|
|
parent: this._getParentOffset(),
|
|
relative: this._getRelativeOffset()
|
|
};
|
|
|
|
this.offset.click = {
|
|
left: event.pageX - this.offset.left,
|
|
top: event.pageY - this.offset.top
|
|
};
|
|
},
|
|
|
|
_mouseDrag: function (event, noPropagation) {
|
|
// reset any necessary cached properties (see #5009)
|
|
if (this.hasFixedAncestor) {
|
|
this.offset.parent = this._getParentOffset();
|
|
}
|
|
|
|
//Compute the helpers position
|
|
this.position = this._generatePosition(event, true);
|
|
this.positionAbs = this._convertPositionTo("absolute");
|
|
|
|
//Call plugins and callbacks and use the resulting position if something is returned
|
|
if (!noPropagation) {
|
|
var ui = this._uiHash();
|
|
if (this._trigger("drag", event, ui) === false) {
|
|
this._mouseUp(new $.Event("mouseup", event));
|
|
return false;
|
|
}
|
|
this.position = ui.position;
|
|
}
|
|
|
|
this.helper[0].style.left = this.position.left + "px";
|
|
this.helper[0].style.top = this.position.top + "px";
|
|
|
|
if ($.ui.ddmanager) {
|
|
$.ui.ddmanager.drag(this, event);
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
_mouseStop: function (event) {
|
|
//If we are using droppables, inform the manager about the drop
|
|
var that = this,
|
|
dropped = false;
|
|
if ($.ui.ddmanager && !this.options.dropBehaviour) {
|
|
dropped = $.ui.ddmanager.drop(this, event);
|
|
}
|
|
|
|
//if a drop comes from outside (a sortable)
|
|
if (this.dropped) {
|
|
dropped = this.dropped;
|
|
this.dropped = false;
|
|
}
|
|
|
|
if ((this.options.revert === "invalid" && !dropped) ||
|
|
(this.options.revert === "valid" && dropped) ||
|
|
this.options.revert === true || ($.isFunction(this.options.revert) &&
|
|
this.options.revert.call(this.element, dropped))
|
|
) {
|
|
$(this.helper).animate(
|
|
this.originalPosition,
|
|
parseInt(this.options.revertDuration, 10),
|
|
function () {
|
|
if (that._trigger("stop", event) !== false) {
|
|
that._clear();
|
|
}
|
|
}
|
|
);
|
|
} else {
|
|
if (this._trigger("stop", event) !== false) {
|
|
this._clear();
|
|
}
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
_mouseUp: function (event) {
|
|
this._unblockFrames();
|
|
|
|
// If the ddmanager is used for droppables, inform the manager that dragging has stopped
|
|
// (see #5003)
|
|
if ($.ui.ddmanager) {
|
|
$.ui.ddmanager.dragStop(this, event);
|
|
}
|
|
|
|
// Only need to focus if the event occurred on the draggable itself, see #10527
|
|
if (this.handleElement.is(event.target)) {
|
|
// The interaction is over; whether or not the click resulted in a drag,
|
|
// focus the element
|
|
this.element.trigger("focus");
|
|
}
|
|
|
|
return $.ui.mouse.prototype._mouseUp.call(this, event);
|
|
},
|
|
|
|
cancel: function () {
|
|
if (this.helper.is(".ui-draggable-dragging")) {
|
|
this._mouseUp(new $.Event("mouseup", { target: this.element[0] }));
|
|
} else {
|
|
this._clear();
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
_getHandle: function (event) {
|
|
return this.options.handle ?
|
|
!!$(event.target).closest(this.element.find(this.options.handle)).length :
|
|
true;
|
|
},
|
|
|
|
_setHandleClassName: function () {
|
|
this.handleElement = this.options.handle ?
|
|
this.element.find(this.options.handle) : this.element;
|
|
this._addClass(this.handleElement, "ui-draggable-handle");
|
|
},
|
|
|
|
_removeHandleClassName: function () {
|
|
this._removeClass(this.handleElement, "ui-draggable-handle");
|
|
},
|
|
|
|
_createHelper: function (event) {
|
|
var o = this.options,
|
|
helperIsFunction = $.isFunction(o.helper),
|
|
helper = helperIsFunction ?
|
|
$(o.helper.apply(this.element[0], [event])) :
|
|
(o.helper === "clone" ?
|
|
this.element.clone().removeAttr("id") :
|
|
this.element);
|
|
|
|
if (!helper.parents("body").length) {
|
|
helper.appendTo((o.appendTo === "parent" ?
|
|
this.element[0].parentNode :
|
|
o.appendTo));
|
|
}
|
|
|
|
// Http://bugs.jqueryui.com/ticket/9446
|
|
// a helper function can return the original element
|
|
// which wouldn't have been set to relative in _create
|
|
if (helperIsFunction && helper[0] === this.element[0]) {
|
|
this._setPositionRelative();
|
|
}
|
|
|
|
if (helper[0] !== this.element[0] &&
|
|
!(/(fixed|absolute)/).test(helper.css("position"))) {
|
|
helper.css("position", "absolute");
|
|
}
|
|
|
|
return helper;
|
|
},
|
|
|
|
_setPositionRelative: function () {
|
|
if (!(/^(?:r|a|f)/).test(this.element.css("position"))) {
|
|
this.element[0].style.position = "relative";
|
|
}
|
|
},
|
|
|
|
_adjustOffsetFromHelper: function (obj) {
|
|
if (typeof obj === "string") {
|
|
obj = obj.split(" ");
|
|
}
|
|
if ($.isArray(obj)) {
|
|
obj = { left: +obj[0], top: +obj[1] || 0 };
|
|
}
|
|
if ("left" in obj) {
|
|
this.offset.click.left = obj.left + this.margins.left;
|
|
}
|
|
if ("right" in obj) {
|
|
this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
|
|
}
|
|
if ("top" in obj) {
|
|
this.offset.click.top = obj.top + this.margins.top;
|
|
}
|
|
if ("bottom" in obj) {
|
|
this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
|
|
}
|
|
},
|
|
|
|
_isRootNode: function (element) {
|
|
return (/(html|body)/i).test(element.tagName) || element === this.document[0];
|
|
},
|
|
|
|
_getParentOffset: function () {
|
|
//Get the offsetParent and cache its position
|
|
var po = this.offsetParent.offset(),
|
|
document = this.document[0];
|
|
|
|
// This is a special case where we need to modify a offset calculated on start, since the
|
|
// following happened:
|
|
// 1. The position of the helper is absolute, so it's position is calculated based on the
|
|
// next positioned parent
|
|
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
|
|
// the document, which means that the scroll is included in the initial calculation of the
|
|
// offset of the parent, and never recalculated upon drag
|
|
if (this.cssPosition === "absolute" && this.scrollParent[0] !== document &&
|
|
$.contains(this.scrollParent[0], this.offsetParent[0])) {
|
|
po.left += this.scrollParent.scrollLeft();
|
|
po.top += this.scrollParent.scrollTop();
|
|
}
|
|
|
|
if (this._isRootNode(this.offsetParent[0])) {
|
|
po = { top: 0, left: 0 };
|
|
}
|
|
|
|
return {
|
|
top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
|
|
left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
|
|
};
|
|
},
|
|
|
|
_getRelativeOffset: function () {
|
|
if (this.cssPosition !== "relative") {
|
|
return { top: 0, left: 0 };
|
|
}
|
|
|
|
var p = this.element.position(),
|
|
scrollIsRootNode = this._isRootNode(this.scrollParent[0]);
|
|
|
|
return {
|
|
top: p.top - (parseInt(this.helper.css("top"), 10) || 0) +
|
|
(!scrollIsRootNode ? this.scrollParent.scrollTop() : 0),
|
|
left: p.left - (parseInt(this.helper.css("left"), 10) || 0) +
|
|
(!scrollIsRootNode ? this.scrollParent.scrollLeft() : 0)
|
|
};
|
|
},
|
|
|
|
_cacheMargins: function () {
|
|
this.margins = {
|
|
left: (parseInt(this.element.css("marginLeft"), 10) || 0),
|
|
top: (parseInt(this.element.css("marginTop"), 10) || 0),
|
|
right: (parseInt(this.element.css("marginRight"), 10) || 0),
|
|
bottom: (parseInt(this.element.css("marginBottom"), 10) || 0)
|
|
};
|
|
},
|
|
|
|
_cacheHelperProportions: function () {
|
|
this.helperProportions = {
|
|
width: this.helper.outerWidth(),
|
|
height: this.helper.outerHeight()
|
|
};
|
|
},
|
|
|
|
_setContainment: function () {
|
|
var isUserScrollable, c, ce,
|
|
o = this.options,
|
|
document = this.document[0];
|
|
|
|
this.relativeContainer = null;
|
|
|
|
if (!o.containment) {
|
|
this.containment = null;
|
|
return;
|
|
}
|
|
|
|
if (o.containment === "window") {
|
|
this.containment = [
|
|
$(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
|
|
$(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
|
|
$(window).scrollLeft() + $(window).width() -
|
|
this.helperProportions.width - this.margins.left,
|
|
$(window).scrollTop() +
|
|
($(window).height() || document.body.parentNode.scrollHeight) -
|
|
this.helperProportions.height - this.margins.top
|
|
];
|
|
return;
|
|
}
|
|
|
|
if (o.containment === "document") {
|
|
this.containment = [
|
|
0,
|
|
0,
|
|
$(document).width() - this.helperProportions.width - this.margins.left,
|
|
($(document).height() || document.body.parentNode.scrollHeight) -
|
|
this.helperProportions.height - this.margins.top
|
|
];
|
|
return;
|
|
}
|
|
|
|
if (o.containment.constructor === Array) {
|
|
this.containment = o.containment;
|
|
return;
|
|
}
|
|
|
|
if (o.containment === "parent") {
|
|
o.containment = this.helper[0].parentNode;
|
|
}
|
|
|
|
c = $(o.containment);
|
|
ce = c[0];
|
|
|
|
if (!ce) {
|
|
return;
|
|
}
|
|
|
|
isUserScrollable = /(scroll|auto)/.test(c.css("overflow"));
|
|
|
|
this.containment = [
|
|
(parseInt(c.css("borderLeftWidth"), 10) || 0) +
|
|
(parseInt(c.css("paddingLeft"), 10) || 0),
|
|
(parseInt(c.css("borderTopWidth"), 10) || 0) +
|
|
(parseInt(c.css("paddingTop"), 10) || 0),
|
|
(isUserScrollable ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) -
|
|
(parseInt(c.css("borderRightWidth"), 10) || 0) -
|
|
(parseInt(c.css("paddingRight"), 10) || 0) -
|
|
this.helperProportions.width -
|
|
this.margins.left -
|
|
this.margins.right,
|
|
(isUserScrollable ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) -
|
|
(parseInt(c.css("borderBottomWidth"), 10) || 0) -
|
|
(parseInt(c.css("paddingBottom"), 10) || 0) -
|
|
this.helperProportions.height -
|
|
this.margins.top -
|
|
this.margins.bottom
|
|
];
|
|
this.relativeContainer = c;
|
|
},
|
|
|
|
_convertPositionTo: function (d, pos) {
|
|
if (!pos) {
|
|
pos = this.position;
|
|
}
|
|
|
|
var mod = d === "absolute" ? 1 : -1,
|
|
scrollIsRootNode = this._isRootNode(this.scrollParent[0]);
|
|
|
|
return {
|
|
top: (
|
|
|
|
// The absolute mouse position
|
|
pos.top +
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.top * mod +
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.top * mod -
|
|
((this.cssPosition === "fixed" ?
|
|
-this.offset.scroll.top :
|
|
(scrollIsRootNode ? 0 : this.offset.scroll.top)) * mod)
|
|
),
|
|
left: (
|
|
|
|
// The absolute mouse position
|
|
pos.left +
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.left * mod +
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.left * mod -
|
|
((this.cssPosition === "fixed" ?
|
|
-this.offset.scroll.left :
|
|
(scrollIsRootNode ? 0 : this.offset.scroll.left)) * mod)
|
|
)
|
|
};
|
|
},
|
|
|
|
_generatePosition: function (event, constrainPosition) {
|
|
var containment, co, top, left,
|
|
o = this.options,
|
|
scrollIsRootNode = this._isRootNode(this.scrollParent[0]),
|
|
pageX = event.pageX,
|
|
pageY = event.pageY;
|
|
|
|
// Cache the scroll
|
|
if (!scrollIsRootNode || !this.offset.scroll) {
|
|
this.offset.scroll = {
|
|
top: this.scrollParent.scrollTop(),
|
|
left: this.scrollParent.scrollLeft()
|
|
};
|
|
}
|
|
|
|
/*
|
|
* - Position constraining -
|
|
* Constrain the position to a mix of grid, containment.
|
|
*/
|
|
|
|
// If we are not dragging yet, we won't check for options
|
|
if (constrainPosition) {
|
|
if (this.containment) {
|
|
if (this.relativeContainer) {
|
|
co = this.relativeContainer.offset();
|
|
containment = [
|
|
this.containment[0] + co.left,
|
|
this.containment[1] + co.top,
|
|
this.containment[2] + co.left,
|
|
this.containment[3] + co.top
|
|
];
|
|
} else {
|
|
containment = this.containment;
|
|
}
|
|
|
|
if (event.pageX - this.offset.click.left < containment[0]) {
|
|
pageX = containment[0] + this.offset.click.left;
|
|
}
|
|
if (event.pageY - this.offset.click.top < containment[1]) {
|
|
pageY = containment[1] + this.offset.click.top;
|
|
}
|
|
if (event.pageX - this.offset.click.left > containment[2]) {
|
|
pageX = containment[2] + this.offset.click.left;
|
|
}
|
|
if (event.pageY - this.offset.click.top > containment[3]) {
|
|
pageY = containment[3] + this.offset.click.top;
|
|
}
|
|
}
|
|
|
|
if (o.grid) {
|
|
//Check for grid elements set to 0 to prevent divide by 0 error causing invalid
|
|
// argument errors in IE (see ticket #6950)
|
|
top = o.grid[1] ? this.originalPageY + Math.round((pageY -
|
|
this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
|
|
pageY = containment ? ((top - this.offset.click.top >= containment[1] ||
|
|
top - this.offset.click.top > containment[3]) ?
|
|
top :
|
|
((top - this.offset.click.top >= containment[1]) ?
|
|
top - o.grid[1] : top + o.grid[1])) : top;
|
|
|
|
left = o.grid[0] ? this.originalPageX +
|
|
Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] :
|
|
this.originalPageX;
|
|
pageX = containment ? ((left - this.offset.click.left >= containment[0] ||
|
|
left - this.offset.click.left > containment[2]) ?
|
|
left :
|
|
((left - this.offset.click.left >= containment[0]) ?
|
|
left - o.grid[0] : left + o.grid[0])) : left;
|
|
}
|
|
|
|
if (o.axis === "y") {
|
|
pageX = this.originalPageX;
|
|
}
|
|
|
|
if (o.axis === "x") {
|
|
pageY = this.originalPageY;
|
|
}
|
|
}
|
|
|
|
return {
|
|
top: (
|
|
|
|
// The absolute mouse position
|
|
pageY -
|
|
|
|
// Click offset (relative to the element)
|
|
this.offset.click.top -
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.top -
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.top +
|
|
(this.cssPosition === "fixed" ?
|
|
-this.offset.scroll.top :
|
|
(scrollIsRootNode ? 0 : this.offset.scroll.top))
|
|
),
|
|
left: (
|
|
|
|
// The absolute mouse position
|
|
pageX -
|
|
|
|
// Click offset (relative to the element)
|
|
this.offset.click.left -
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.left -
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.left +
|
|
(this.cssPosition === "fixed" ?
|
|
-this.offset.scroll.left :
|
|
(scrollIsRootNode ? 0 : this.offset.scroll.left))
|
|
)
|
|
};
|
|
},
|
|
|
|
_clear: function () {
|
|
this._removeClass(this.helper, "ui-draggable-dragging");
|
|
if (this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) {
|
|
this.helper.remove();
|
|
}
|
|
this.helper = null;
|
|
this.cancelHelperRemoval = false;
|
|
if (this.destroyOnClear) {
|
|
this.destroy();
|
|
}
|
|
},
|
|
|
|
// From now on bulk stuff - mainly helpers
|
|
|
|
_trigger: function (type, event, ui) {
|
|
ui = ui || this._uiHash();
|
|
$.ui.plugin.call(this, type, [event, ui, this], true);
|
|
|
|
// Absolute position and offset (see #6884 ) have to be recalculated after plugins
|
|
if (/^(drag|start|stop)/.test(type)) {
|
|
this.positionAbs = this._convertPositionTo("absolute");
|
|
ui.offset = this.positionAbs;
|
|
}
|
|
return $.Widget.prototype._trigger.call(this, type, event, ui);
|
|
},
|
|
|
|
plugins: {},
|
|
|
|
_uiHash: function () {
|
|
return {
|
|
helper: this.helper,
|
|
position: this.position,
|
|
originalPosition: this.originalPosition,
|
|
offset: this.positionAbs
|
|
};
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("draggable", "connectToSortable", {
|
|
start: function (event, ui, draggable) {
|
|
var uiSortable = $.extend({}, ui, {
|
|
item: draggable.element
|
|
});
|
|
|
|
draggable.sortables = [];
|
|
$(draggable.options.connectToSortable).each(function () {
|
|
var sortable = $(this).sortable("instance");
|
|
|
|
if (sortable && !sortable.options.disabled) {
|
|
draggable.sortables.push(sortable);
|
|
|
|
// RefreshPositions is called at drag start to refresh the containerCache
|
|
// which is used in drag. This ensures it's initialized and synchronized
|
|
// with any changes that might have happened on the page since initialization.
|
|
sortable.refreshPositions();
|
|
sortable._trigger("activate", event, uiSortable);
|
|
}
|
|
});
|
|
},
|
|
stop: function (event, ui, draggable) {
|
|
var uiSortable = $.extend({}, ui, {
|
|
item: draggable.element
|
|
});
|
|
|
|
draggable.cancelHelperRemoval = false;
|
|
|
|
$.each(draggable.sortables, function () {
|
|
var sortable = this;
|
|
|
|
if (sortable.isOver) {
|
|
sortable.isOver = 0;
|
|
|
|
// Allow this sortable to handle removing the helper
|
|
draggable.cancelHelperRemoval = true;
|
|
sortable.cancelHelperRemoval = false;
|
|
|
|
// Use _storedCSS To restore properties in the sortable,
|
|
// as this also handles revert (#9675) since the draggable
|
|
// may have modified them in unexpected ways (#8809)
|
|
sortable._storedCSS = {
|
|
position: sortable.placeholder.css("position"),
|
|
top: sortable.placeholder.css("top"),
|
|
left: sortable.placeholder.css("left")
|
|
};
|
|
|
|
sortable._mouseStop(event);
|
|
|
|
// Once drag has ended, the sortable should return to using
|
|
// its original helper, not the shared helper from draggable
|
|
sortable.options.helper = sortable.options._helper;
|
|
} else {
|
|
// Prevent this Sortable from removing the helper.
|
|
// However, don't set the draggable to remove the helper
|
|
// either as another connected Sortable may yet handle the removal.
|
|
sortable.cancelHelperRemoval = true;
|
|
|
|
sortable._trigger("deactivate", event, uiSortable);
|
|
}
|
|
});
|
|
},
|
|
drag: function (event, ui, draggable) {
|
|
$.each(draggable.sortables, function () {
|
|
var innermostIntersecting = false,
|
|
sortable = this;
|
|
|
|
// Copy over variables that sortable's _intersectsWith uses
|
|
sortable.positionAbs = draggable.positionAbs;
|
|
sortable.helperProportions = draggable.helperProportions;
|
|
sortable.offset.click = draggable.offset.click;
|
|
|
|
if (sortable._intersectsWith(sortable.containerCache)) {
|
|
innermostIntersecting = true;
|
|
|
|
$.each(draggable.sortables, function () {
|
|
// Copy over variables that sortable's _intersectsWith uses
|
|
this.positionAbs = draggable.positionAbs;
|
|
this.helperProportions = draggable.helperProportions;
|
|
this.offset.click = draggable.offset.click;
|
|
|
|
if (this !== sortable &&
|
|
this._intersectsWith(this.containerCache) &&
|
|
$.contains(sortable.element[0], this.element[0])) {
|
|
innermostIntersecting = false;
|
|
}
|
|
|
|
return innermostIntersecting;
|
|
});
|
|
}
|
|
|
|
if (innermostIntersecting) {
|
|
// If it intersects, we use a little isOver variable and set it once,
|
|
// so that the move-in stuff gets fired only once.
|
|
if (!sortable.isOver) {
|
|
sortable.isOver = 1;
|
|
|
|
// Store draggable's parent in case we need to reappend to it later.
|
|
draggable._parent = ui.helper.parent();
|
|
|
|
sortable.currentItem = ui.helper
|
|
.appendTo(sortable.element)
|
|
.data("ui-sortable-item", true);
|
|
|
|
// Store helper option to later restore it
|
|
sortable.options._helper = sortable.options.helper;
|
|
|
|
sortable.options.helper = function () {
|
|
return ui.helper[0];
|
|
};
|
|
|
|
// Fire the start events of the sortable with our passed browser event,
|
|
// and our own helper (so it doesn't create a new one)
|
|
event.target = sortable.currentItem[0];
|
|
sortable._mouseCapture(event, true);
|
|
sortable._mouseStart(event, true, true);
|
|
|
|
// Because the browser event is way off the new appended portlet,
|
|
// modify necessary variables to reflect the changes
|
|
sortable.offset.click.top = draggable.offset.click.top;
|
|
sortable.offset.click.left = draggable.offset.click.left;
|
|
sortable.offset.parent.left -= draggable.offset.parent.left -
|
|
sortable.offset.parent.left;
|
|
sortable.offset.parent.top -= draggable.offset.parent.top -
|
|
sortable.offset.parent.top;
|
|
|
|
draggable._trigger("toSortable", event);
|
|
|
|
// Inform draggable that the helper is in a valid drop zone,
|
|
// used solely in the revert option to handle "valid/invalid".
|
|
draggable.dropped = sortable.element;
|
|
|
|
// Need to refreshPositions of all sortables in the case that
|
|
// adding to one sortable changes the location of the other sortables (#9675)
|
|
$.each(draggable.sortables, function () {
|
|
this.refreshPositions();
|
|
});
|
|
|
|
// Hack so receive/update callbacks work (mostly)
|
|
draggable.currentItem = draggable.element;
|
|
sortable.fromOutside = draggable;
|
|
}
|
|
|
|
if (sortable.currentItem) {
|
|
sortable._mouseDrag(event);
|
|
|
|
// Copy the sortable's position because the draggable's can potentially reflect
|
|
// a relative position, while sortable is always absolute, which the dragged
|
|
// element has now become. (#8809)
|
|
ui.position = sortable.position;
|
|
}
|
|
} else {
|
|
// If it doesn't intersect with the sortable, and it intersected before,
|
|
// we fake the drag stop of the sortable, but make sure it doesn't remove
|
|
// the helper by using cancelHelperRemoval.
|
|
if (sortable.isOver) {
|
|
sortable.isOver = 0;
|
|
sortable.cancelHelperRemoval = true;
|
|
|
|
// Calling sortable's mouseStop would trigger a revert,
|
|
// so revert must be temporarily false until after mouseStop is called.
|
|
sortable.options._revert = sortable.options.revert;
|
|
sortable.options.revert = false;
|
|
|
|
sortable._trigger("out", event, sortable._uiHash(sortable));
|
|
sortable._mouseStop(event, true);
|
|
|
|
// Restore sortable behaviors that were modfied
|
|
// when the draggable entered the sortable area (#9481)
|
|
sortable.options.revert = sortable.options._revert;
|
|
sortable.options.helper = sortable.options._helper;
|
|
|
|
if (sortable.placeholder) {
|
|
sortable.placeholder.remove();
|
|
}
|
|
|
|
// Restore and recalculate the draggable's offset considering the sortable
|
|
// may have modified them in unexpected ways. (#8809, #10669)
|
|
ui.helper.appendTo(draggable._parent);
|
|
draggable._refreshOffsets(event);
|
|
ui.position = draggable._generatePosition(event, true);
|
|
|
|
draggable._trigger("fromSortable", event);
|
|
|
|
// Inform draggable that the helper is no longer in a valid drop zone
|
|
draggable.dropped = false;
|
|
|
|
// Need to refreshPositions of all sortables just in case removing
|
|
// from one sortable changes the location of other sortables (#9675)
|
|
$.each(draggable.sortables, function () {
|
|
this.refreshPositions();
|
|
});
|
|
}
|
|
}
|
|
});
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("draggable", "cursor", {
|
|
start: function (event, ui, instance) {
|
|
var t = $("body"),
|
|
o = instance.options;
|
|
|
|
if (t.css("cursor")) {
|
|
o._cursor = t.css("cursor");
|
|
}
|
|
t.css("cursor", o.cursor);
|
|
},
|
|
stop: function (event, ui, instance) {
|
|
var o = instance.options;
|
|
if (o._cursor) {
|
|
$("body").css("cursor", o._cursor);
|
|
}
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("draggable", "opacity", {
|
|
start: function (event, ui, instance) {
|
|
var t = $(ui.helper),
|
|
o = instance.options;
|
|
if (t.css("opacity")) {
|
|
o._opacity = t.css("opacity");
|
|
}
|
|
t.css("opacity", o.opacity);
|
|
},
|
|
stop: function (event, ui, instance) {
|
|
var o = instance.options;
|
|
if (o._opacity) {
|
|
$(ui.helper).css("opacity", o._opacity);
|
|
}
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("draggable", "scroll", {
|
|
start: function (event, ui, i) {
|
|
if (!i.scrollParentNotHidden) {
|
|
i.scrollParentNotHidden = i.helper.scrollParent(false);
|
|
}
|
|
|
|
if (i.scrollParentNotHidden[0] !== i.document[0] &&
|
|
i.scrollParentNotHidden[0].tagName !== "HTML") {
|
|
i.overflowOffset = i.scrollParentNotHidden.offset();
|
|
}
|
|
},
|
|
drag: function (event, ui, i) {
|
|
var o = i.options,
|
|
scrolled = false,
|
|
scrollParent = i.scrollParentNotHidden[0],
|
|
document = i.document[0];
|
|
|
|
if (scrollParent !== document && scrollParent.tagName !== "HTML") {
|
|
if (!o.axis || o.axis !== "x") {
|
|
if ((i.overflowOffset.top + scrollParent.offsetHeight) - event.pageY <
|
|
o.scrollSensitivity) {
|
|
scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed;
|
|
} else if (event.pageY - i.overflowOffset.top < o.scrollSensitivity) {
|
|
scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed;
|
|
}
|
|
}
|
|
|
|
if (!o.axis || o.axis !== "y") {
|
|
if ((i.overflowOffset.left + scrollParent.offsetWidth) - event.pageX <
|
|
o.scrollSensitivity) {
|
|
scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed;
|
|
} else if (event.pageX - i.overflowOffset.left < o.scrollSensitivity) {
|
|
scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed;
|
|
}
|
|
}
|
|
} else {
|
|
if (!o.axis || o.axis !== "x") {
|
|
if (event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
|
|
scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
|
|
} else if ($(window).height() - (event.pageY - $(document).scrollTop()) <
|
|
o.scrollSensitivity) {
|
|
scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
|
|
}
|
|
}
|
|
|
|
if (!o.axis || o.axis !== "y") {
|
|
if (event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
|
|
scrolled = $(document).scrollLeft(
|
|
$(document).scrollLeft() - o.scrollSpeed
|
|
);
|
|
} else if ($(window).width() - (event.pageX - $(document).scrollLeft()) <
|
|
o.scrollSensitivity) {
|
|
scrolled = $(document).scrollLeft(
|
|
$(document).scrollLeft() + o.scrollSpeed
|
|
);
|
|
}
|
|
}
|
|
}
|
|
|
|
if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
|
|
$.ui.ddmanager.prepareOffsets(i, event);
|
|
}
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("draggable", "snap", {
|
|
start: function (event, ui, i) {
|
|
var o = i.options;
|
|
|
|
i.snapElements = [];
|
|
|
|
$(o.snap.constructor !== String ? (o.snap.items || ":data(ui-draggable)") : o.snap)
|
|
.each(function () {
|
|
var $t = $(this),
|
|
$o = $t.offset();
|
|
if (this !== i.element[0]) {
|
|
i.snapElements.push({
|
|
item: this,
|
|
width: $t.outerWidth(), height: $t.outerHeight(),
|
|
top: $o.top, left: $o.left
|
|
});
|
|
}
|
|
});
|
|
},
|
|
drag: function (event, ui, inst) {
|
|
var ts, bs, ls, rs, l, r, t, b, i, first,
|
|
o = inst.options,
|
|
d = o.snapTolerance,
|
|
x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
|
|
y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
|
|
|
|
for (i = inst.snapElements.length - 1; i >= 0; i--) {
|
|
l = inst.snapElements[i].left - inst.margins.left;
|
|
r = l + inst.snapElements[i].width;
|
|
t = inst.snapElements[i].top - inst.margins.top;
|
|
b = t + inst.snapElements[i].height;
|
|
|
|
if (x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d ||
|
|
!$.contains(inst.snapElements[i].item.ownerDocument,
|
|
inst.snapElements[i].item)) {
|
|
if (inst.snapElements[i].snapping) {
|
|
(inst.options.snap.release &&
|
|
inst.options.snap.release.call(
|
|
inst.element,
|
|
event,
|
|
$.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })
|
|
));
|
|
}
|
|
inst.snapElements[i].snapping = false;
|
|
continue;
|
|
}
|
|
|
|
if (o.snapMode !== "inner") {
|
|
ts = Math.abs(t - y2) <= d;
|
|
bs = Math.abs(b - y1) <= d;
|
|
ls = Math.abs(l - x2) <= d;
|
|
rs = Math.abs(r - x1) <= d;
|
|
if (ts) {
|
|
ui.position.top = inst._convertPositionTo("relative", {
|
|
top: t - inst.helperProportions.height,
|
|
left: 0
|
|
}).top;
|
|
}
|
|
if (bs) {
|
|
ui.position.top = inst._convertPositionTo("relative", {
|
|
top: b,
|
|
left: 0
|
|
}).top;
|
|
}
|
|
if (ls) {
|
|
ui.position.left = inst._convertPositionTo("relative", {
|
|
top: 0,
|
|
left: l - inst.helperProportions.width
|
|
}).left;
|
|
}
|
|
if (rs) {
|
|
ui.position.left = inst._convertPositionTo("relative", {
|
|
top: 0,
|
|
left: r
|
|
}).left;
|
|
}
|
|
}
|
|
|
|
first = (ts || bs || ls || rs);
|
|
|
|
if (o.snapMode !== "outer") {
|
|
ts = Math.abs(t - y1) <= d;
|
|
bs = Math.abs(b - y2) <= d;
|
|
ls = Math.abs(l - x1) <= d;
|
|
rs = Math.abs(r - x2) <= d;
|
|
if (ts) {
|
|
ui.position.top = inst._convertPositionTo("relative", {
|
|
top: t,
|
|
left: 0
|
|
}).top;
|
|
}
|
|
if (bs) {
|
|
ui.position.top = inst._convertPositionTo("relative", {
|
|
top: b - inst.helperProportions.height,
|
|
left: 0
|
|
}).top;
|
|
}
|
|
if (ls) {
|
|
ui.position.left = inst._convertPositionTo("relative", {
|
|
top: 0,
|
|
left: l
|
|
}).left;
|
|
}
|
|
if (rs) {
|
|
ui.position.left = inst._convertPositionTo("relative", {
|
|
top: 0,
|
|
left: r - inst.helperProportions.width
|
|
}).left;
|
|
}
|
|
}
|
|
|
|
if (!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) {
|
|
(inst.options.snap.snap &&
|
|
inst.options.snap.snap.call(
|
|
inst.element,
|
|
event,
|
|
$.extend(inst._uiHash(), {
|
|
snapItem: inst.snapElements[i].item
|
|
})));
|
|
}
|
|
inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
|
|
}
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("draggable", "stack", {
|
|
start: function (event, ui, instance) {
|
|
var min,
|
|
o = instance.options,
|
|
group = $.makeArray($(o.stack)).sort(function (a, b) {
|
|
return (parseInt($(a).css("zIndex"), 10) || 0) -
|
|
(parseInt($(b).css("zIndex"), 10) || 0);
|
|
});
|
|
|
|
if (!group.length) { return; }
|
|
|
|
min = parseInt($(group[0]).css("zIndex"), 10) || 0;
|
|
$(group).each(function (i) {
|
|
$(this).css("zIndex", min + i);
|
|
});
|
|
this.css("zIndex", (min + group.length));
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("draggable", "zIndex", {
|
|
start: function (event, ui, instance) {
|
|
var t = $(ui.helper),
|
|
o = instance.options;
|
|
|
|
if (t.css("zIndex")) {
|
|
o._zIndex = t.css("zIndex");
|
|
}
|
|
t.css("zIndex", o.zIndex);
|
|
},
|
|
stop: function (event, ui, instance) {
|
|
var o = instance.options;
|
|
|
|
if (o._zIndex) {
|
|
$(ui.helper).css("zIndex", o._zIndex);
|
|
}
|
|
}
|
|
});
|
|
|
|
var widgetsDraggable = $.ui.draggable;
|
|
|
|
/*!
|
|
* jQuery UI Resizable 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Resizable
|
|
//>>group: Interactions
|
|
//>>description: Enables resize functionality for any element.
|
|
//>>docs: http://api.jqueryui.com/resizable/
|
|
//>>demos: http://jqueryui.com/resizable/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/resizable.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.widget("ui.resizable", $.ui.mouse, {
|
|
version: "1.12.1",
|
|
widgetEventPrefix: "resize",
|
|
options: {
|
|
alsoResize: false,
|
|
animate: false,
|
|
animateDuration: "slow",
|
|
animateEasing: "swing",
|
|
aspectRatio: false,
|
|
autoHide: false,
|
|
classes: {
|
|
"ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se"
|
|
},
|
|
containment: false,
|
|
ghost: false,
|
|
grid: false,
|
|
handles: "e,s,se",
|
|
helper: false,
|
|
maxHeight: null,
|
|
maxWidth: null,
|
|
minHeight: 10,
|
|
minWidth: 10,
|
|
|
|
// See #7960
|
|
zIndex: 90,
|
|
|
|
// Callbacks
|
|
resize: null,
|
|
start: null,
|
|
stop: null
|
|
},
|
|
|
|
_num: function (value) {
|
|
return parseFloat(value) || 0;
|
|
},
|
|
|
|
_isNumber: function (value) {
|
|
return !isNaN(parseFloat(value));
|
|
},
|
|
|
|
_hasScroll: function (el, a) {
|
|
if ($(el).css("overflow") === "hidden") {
|
|
return false;
|
|
}
|
|
|
|
var scroll = (a && a === "left") ? "scrollLeft" : "scrollTop",
|
|
has = false;
|
|
|
|
if (el[scroll] > 0) {
|
|
return true;
|
|
}
|
|
|
|
// TODO: determine which cases actually cause this to happen
|
|
// if the element doesn't have the scroll set, see if it's possible to
|
|
// set the scroll
|
|
el[scroll] = 1;
|
|
has = (el[scroll] > 0);
|
|
el[scroll] = 0;
|
|
return has;
|
|
},
|
|
|
|
_create: function () {
|
|
var margins,
|
|
o = this.options,
|
|
that = this;
|
|
this._addClass("ui-resizable");
|
|
|
|
$.extend(this, {
|
|
_aspectRatio: !!(o.aspectRatio),
|
|
aspectRatio: o.aspectRatio,
|
|
originalElement: this.element,
|
|
_proportionallyResizeElements: [],
|
|
_helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null
|
|
});
|
|
|
|
// Wrap the element if it cannot hold child nodes
|
|
if (this.element[0].nodeName.match(/^(canvas|textarea|input|select|button|img)$/i)) {
|
|
this.element.wrap(
|
|
$("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({
|
|
position: this.element.css("position"),
|
|
width: this.element.outerWidth(),
|
|
height: this.element.outerHeight(),
|
|
top: this.element.css("top"),
|
|
left: this.element.css("left")
|
|
})
|
|
);
|
|
|
|
this.element = this.element.parent().data(
|
|
"ui-resizable", this.element.resizable("instance")
|
|
);
|
|
|
|
this.elementIsWrapper = true;
|
|
|
|
margins = {
|
|
marginTop: this.originalElement.css("marginTop"),
|
|
marginRight: this.originalElement.css("marginRight"),
|
|
marginBottom: this.originalElement.css("marginBottom"),
|
|
marginLeft: this.originalElement.css("marginLeft")
|
|
};
|
|
|
|
this.element.css(margins);
|
|
this.originalElement.css("margin", 0);
|
|
|
|
// support: Safari
|
|
// Prevent Safari textarea resize
|
|
this.originalResizeStyle = this.originalElement.css("resize");
|
|
this.originalElement.css("resize", "none");
|
|
|
|
this._proportionallyResizeElements.push(this.originalElement.css({
|
|
position: "static",
|
|
zoom: 1,
|
|
display: "block"
|
|
}));
|
|
|
|
// Support: IE9
|
|
// avoid IE jump (hard set the margin)
|
|
this.originalElement.css(margins);
|
|
|
|
this._proportionallyResize();
|
|
}
|
|
|
|
this._setupHandles();
|
|
|
|
if (o.autoHide) {
|
|
$(this.element)
|
|
.on("mouseenter", function () {
|
|
if (o.disabled) {
|
|
return;
|
|
}
|
|
that._removeClass("ui-resizable-autohide");
|
|
that._handles.show();
|
|
})
|
|
.on("mouseleave", function () {
|
|
if (o.disabled) {
|
|
return;
|
|
}
|
|
if (!that.resizing) {
|
|
that._addClass("ui-resizable-autohide");
|
|
that._handles.hide();
|
|
}
|
|
});
|
|
}
|
|
|
|
this._mouseInit();
|
|
},
|
|
|
|
_destroy: function () {
|
|
this._mouseDestroy();
|
|
|
|
var wrapper,
|
|
_destroy = function (exp) {
|
|
$(exp)
|
|
.removeData("resizable")
|
|
.removeData("ui-resizable")
|
|
.off(".resizable")
|
|
.find(".ui-resizable-handle")
|
|
.remove();
|
|
};
|
|
|
|
// TODO: Unwrap at same DOM position
|
|
if (this.elementIsWrapper) {
|
|
_destroy(this.element);
|
|
wrapper = this.element;
|
|
this.originalElement.css({
|
|
position: wrapper.css("position"),
|
|
width: wrapper.outerWidth(),
|
|
height: wrapper.outerHeight(),
|
|
top: wrapper.css("top"),
|
|
left: wrapper.css("left")
|
|
}).insertAfter(wrapper);
|
|
wrapper.remove();
|
|
}
|
|
|
|
this.originalElement.css("resize", this.originalResizeStyle);
|
|
_destroy(this.originalElement);
|
|
|
|
return this;
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
this._super(key, value);
|
|
|
|
switch (key) {
|
|
case "handles":
|
|
this._removeHandles();
|
|
this._setupHandles();
|
|
break;
|
|
default:
|
|
break;
|
|
}
|
|
},
|
|
|
|
_setupHandles: function () {
|
|
var o = this.options, handle, i, n, hname, axis, that = this;
|
|
this.handles = o.handles ||
|
|
(!$(".ui-resizable-handle", this.element).length ?
|
|
"e,s,se" : {
|
|
n: ".ui-resizable-n",
|
|
e: ".ui-resizable-e",
|
|
s: ".ui-resizable-s",
|
|
w: ".ui-resizable-w",
|
|
se: ".ui-resizable-se",
|
|
sw: ".ui-resizable-sw",
|
|
ne: ".ui-resizable-ne",
|
|
nw: ".ui-resizable-nw"
|
|
});
|
|
|
|
this._handles = $();
|
|
if (this.handles.constructor === String) {
|
|
if (this.handles === "all") {
|
|
this.handles = "n,e,s,w,se,sw,ne,nw";
|
|
}
|
|
|
|
n = this.handles.split(",");
|
|
this.handles = {};
|
|
|
|
for (i = 0; i < n.length; i++) {
|
|
handle = $.trim(n[i]);
|
|
hname = "ui-resizable-" + handle;
|
|
axis = $("<div>");
|
|
this._addClass(axis, "ui-resizable-handle " + hname);
|
|
|
|
axis.css({ zIndex: o.zIndex });
|
|
|
|
this.handles[handle] = ".ui-resizable-" + handle;
|
|
this.element.append(axis);
|
|
}
|
|
}
|
|
|
|
this._renderAxis = function (target) {
|
|
var i, axis, padPos, padWrapper;
|
|
|
|
target = target || this.element;
|
|
|
|
for (i in this.handles) {
|
|
if (this.handles[i].constructor === String) {
|
|
this.handles[i] = this.element.children(this.handles[i]).first().show();
|
|
} else if (this.handles[i].jquery || this.handles[i].nodeType) {
|
|
this.handles[i] = $(this.handles[i]);
|
|
this._on(this.handles[i], { "mousedown": that._mouseDown });
|
|
}
|
|
|
|
if (this.elementIsWrapper &&
|
|
this.originalElement[0]
|
|
.nodeName
|
|
.match(/^(textarea|input|select|button)$/i)) {
|
|
axis = $(this.handles[i], this.element);
|
|
|
|
padWrapper = /sw|ne|nw|se|n|s/.test(i) ?
|
|
axis.outerHeight() :
|
|
axis.outerWidth();
|
|
|
|
padPos = ["padding",
|
|
/ne|nw|n/.test(i) ? "Top" :
|
|
/se|sw|s/.test(i) ? "Bottom" :
|
|
/^e$/.test(i) ? "Right" : "Left"].join("");
|
|
|
|
target.css(padPos, padWrapper);
|
|
|
|
this._proportionallyResize();
|
|
}
|
|
|
|
this._handles = this._handles.add(this.handles[i]);
|
|
}
|
|
};
|
|
|
|
// TODO: make renderAxis a prototype function
|
|
this._renderAxis(this.element);
|
|
|
|
this._handles = this._handles.add(this.element.find(".ui-resizable-handle"));
|
|
this._handles.disableSelection();
|
|
|
|
this._handles.on("mouseover", function () {
|
|
if (!that.resizing) {
|
|
if (this.className) {
|
|
axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
|
|
}
|
|
that.axis = axis && axis[1] ? axis[1] : "se";
|
|
}
|
|
});
|
|
|
|
if (o.autoHide) {
|
|
this._handles.hide();
|
|
this._addClass("ui-resizable-autohide");
|
|
}
|
|
},
|
|
|
|
_removeHandles: function () {
|
|
this._handles.remove();
|
|
},
|
|
|
|
_mouseCapture: function (event) {
|
|
var i, handle,
|
|
capture = false;
|
|
|
|
for (i in this.handles) {
|
|
handle = $(this.handles[i])[0];
|
|
if (handle === event.target || $.contains(handle, event.target)) {
|
|
capture = true;
|
|
}
|
|
}
|
|
|
|
return !this.options.disabled && capture;
|
|
},
|
|
|
|
_mouseStart: function (event) {
|
|
var curleft, curtop, cursor,
|
|
o = this.options,
|
|
el = this.element;
|
|
|
|
this.resizing = true;
|
|
|
|
this._renderProxy();
|
|
|
|
curleft = this._num(this.helper.css("left"));
|
|
curtop = this._num(this.helper.css("top"));
|
|
|
|
if (o.containment) {
|
|
curleft += $(o.containment).scrollLeft() || 0;
|
|
curtop += $(o.containment).scrollTop() || 0;
|
|
}
|
|
|
|
this.offset = this.helper.offset();
|
|
this.position = { left: curleft, top: curtop };
|
|
|
|
this.size = this._helper ? {
|
|
width: this.helper.width(),
|
|
height: this.helper.height()
|
|
} : {
|
|
width: el.width(),
|
|
height: el.height()
|
|
};
|
|
|
|
this.originalSize = this._helper ? {
|
|
width: el.outerWidth(),
|
|
height: el.outerHeight()
|
|
} : {
|
|
width: el.width(),
|
|
height: el.height()
|
|
};
|
|
|
|
this.sizeDiff = {
|
|
width: el.outerWidth() - el.width(),
|
|
height: el.outerHeight() - el.height()
|
|
};
|
|
|
|
this.originalPosition = { left: curleft, top: curtop };
|
|
this.originalMousePosition = { left: event.pageX, top: event.pageY };
|
|
|
|
this.aspectRatio = (typeof o.aspectRatio === "number") ?
|
|
o.aspectRatio :
|
|
((this.originalSize.width / this.originalSize.height) || 1);
|
|
|
|
cursor = $(".ui-resizable-" + this.axis).css("cursor");
|
|
$("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor);
|
|
|
|
this._addClass("ui-resizable-resizing");
|
|
this._propagate("start", event);
|
|
return true;
|
|
},
|
|
|
|
_mouseDrag: function (event) {
|
|
var data, props,
|
|
smp = this.originalMousePosition,
|
|
a = this.axis,
|
|
dx = (event.pageX - smp.left) || 0,
|
|
dy = (event.pageY - smp.top) || 0,
|
|
trigger = this._change[a];
|
|
|
|
this._updatePrevProperties();
|
|
|
|
if (!trigger) {
|
|
return false;
|
|
}
|
|
|
|
data = trigger.apply(this, [event, dx, dy]);
|
|
|
|
this._updateVirtualBoundaries(event.shiftKey);
|
|
if (this._aspectRatio || event.shiftKey) {
|
|
data = this._updateRatio(data, event);
|
|
}
|
|
|
|
data = this._respectSize(data, event);
|
|
|
|
this._updateCache(data);
|
|
|
|
this._propagate("resize", event);
|
|
|
|
props = this._applyChanges();
|
|
|
|
if (!this._helper && this._proportionallyResizeElements.length) {
|
|
this._proportionallyResize();
|
|
}
|
|
|
|
if (!$.isEmptyObject(props)) {
|
|
this._updatePrevProperties();
|
|
this._trigger("resize", event, this.ui());
|
|
this._applyChanges();
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
_mouseStop: function (event) {
|
|
this.resizing = false;
|
|
var pr, ista, soffseth, soffsetw, s, left, top,
|
|
o = this.options, that = this;
|
|
|
|
if (this._helper) {
|
|
pr = this._proportionallyResizeElements;
|
|
ista = pr.length && (/textarea/i).test(pr[0].nodeName);
|
|
soffseth = ista && this._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height;
|
|
soffsetw = ista ? 0 : that.sizeDiff.width;
|
|
|
|
s = {
|
|
width: (that.helper.width() - soffsetw),
|
|
height: (that.helper.height() - soffseth)
|
|
};
|
|
left = (parseFloat(that.element.css("left")) +
|
|
(that.position.left - that.originalPosition.left)) || null;
|
|
top = (parseFloat(that.element.css("top")) +
|
|
(that.position.top - that.originalPosition.top)) || null;
|
|
|
|
if (!o.animate) {
|
|
this.element.css($.extend(s, { top: top, left: left }));
|
|
}
|
|
|
|
that.helper.height(that.size.height);
|
|
that.helper.width(that.size.width);
|
|
|
|
if (this._helper && !o.animate) {
|
|
this._proportionallyResize();
|
|
}
|
|
}
|
|
|
|
$("body").css("cursor", "auto");
|
|
|
|
this._removeClass("ui-resizable-resizing");
|
|
|
|
this._propagate("stop", event);
|
|
|
|
if (this._helper) {
|
|
this.helper.remove();
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
_updatePrevProperties: function () {
|
|
this.prevPosition = {
|
|
top: this.position.top,
|
|
left: this.position.left
|
|
};
|
|
this.prevSize = {
|
|
width: this.size.width,
|
|
height: this.size.height
|
|
};
|
|
},
|
|
|
|
_applyChanges: function () {
|
|
var props = {};
|
|
|
|
if (this.position.top !== this.prevPosition.top) {
|
|
props.top = this.position.top + "px";
|
|
}
|
|
if (this.position.left !== this.prevPosition.left) {
|
|
props.left = this.position.left + "px";
|
|
}
|
|
if (this.size.width !== this.prevSize.width) {
|
|
props.width = this.size.width + "px";
|
|
}
|
|
if (this.size.height !== this.prevSize.height) {
|
|
props.height = this.size.height + "px";
|
|
}
|
|
|
|
this.helper.css(props);
|
|
|
|
return props;
|
|
},
|
|
|
|
_updateVirtualBoundaries: function (forceAspectRatio) {
|
|
var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
|
|
o = this.options;
|
|
|
|
b = {
|
|
minWidth: this._isNumber(o.minWidth) ? o.minWidth : 0,
|
|
maxWidth: this._isNumber(o.maxWidth) ? o.maxWidth : Infinity,
|
|
minHeight: this._isNumber(o.minHeight) ? o.minHeight : 0,
|
|
maxHeight: this._isNumber(o.maxHeight) ? o.maxHeight : Infinity
|
|
};
|
|
|
|
if (this._aspectRatio || forceAspectRatio) {
|
|
pMinWidth = b.minHeight * this.aspectRatio;
|
|
pMinHeight = b.minWidth / this.aspectRatio;
|
|
pMaxWidth = b.maxHeight * this.aspectRatio;
|
|
pMaxHeight = b.maxWidth / this.aspectRatio;
|
|
|
|
if (pMinWidth > b.minWidth) {
|
|
b.minWidth = pMinWidth;
|
|
}
|
|
if (pMinHeight > b.minHeight) {
|
|
b.minHeight = pMinHeight;
|
|
}
|
|
if (pMaxWidth < b.maxWidth) {
|
|
b.maxWidth = pMaxWidth;
|
|
}
|
|
if (pMaxHeight < b.maxHeight) {
|
|
b.maxHeight = pMaxHeight;
|
|
}
|
|
}
|
|
this._vBoundaries = b;
|
|
},
|
|
|
|
_updateCache: function (data) {
|
|
this.offset = this.helper.offset();
|
|
if (this._isNumber(data.left)) {
|
|
this.position.left = data.left;
|
|
}
|
|
if (this._isNumber(data.top)) {
|
|
this.position.top = data.top;
|
|
}
|
|
if (this._isNumber(data.height)) {
|
|
this.size.height = data.height;
|
|
}
|
|
if (this._isNumber(data.width)) {
|
|
this.size.width = data.width;
|
|
}
|
|
},
|
|
|
|
_updateRatio: function (data) {
|
|
var cpos = this.position,
|
|
csize = this.size,
|
|
a = this.axis;
|
|
|
|
if (this._isNumber(data.height)) {
|
|
data.width = (data.height * this.aspectRatio);
|
|
} else if (this._isNumber(data.width)) {
|
|
data.height = (data.width / this.aspectRatio);
|
|
}
|
|
|
|
if (a === "sw") {
|
|
data.left = cpos.left + (csize.width - data.width);
|
|
data.top = null;
|
|
}
|
|
if (a === "nw") {
|
|
data.top = cpos.top + (csize.height - data.height);
|
|
data.left = cpos.left + (csize.width - data.width);
|
|
}
|
|
|
|
return data;
|
|
},
|
|
|
|
_respectSize: function (data) {
|
|
var o = this._vBoundaries,
|
|
a = this.axis,
|
|
ismaxw = this._isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width),
|
|
ismaxh = this._isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
|
|
isminw = this._isNumber(data.width) && o.minWidth && (o.minWidth > data.width),
|
|
isminh = this._isNumber(data.height) && o.minHeight && (o.minHeight > data.height),
|
|
dw = this.originalPosition.left + this.originalSize.width,
|
|
dh = this.originalPosition.top + this.originalSize.height,
|
|
cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
|
|
if (isminw) {
|
|
data.width = o.minWidth;
|
|
}
|
|
if (isminh) {
|
|
data.height = o.minHeight;
|
|
}
|
|
if (ismaxw) {
|
|
data.width = o.maxWidth;
|
|
}
|
|
if (ismaxh) {
|
|
data.height = o.maxHeight;
|
|
}
|
|
|
|
if (isminw && cw) {
|
|
data.left = dw - o.minWidth;
|
|
}
|
|
if (ismaxw && cw) {
|
|
data.left = dw - o.maxWidth;
|
|
}
|
|
if (isminh && ch) {
|
|
data.top = dh - o.minHeight;
|
|
}
|
|
if (ismaxh && ch) {
|
|
data.top = dh - o.maxHeight;
|
|
}
|
|
|
|
// Fixing jump error on top/left - bug #2330
|
|
if (!data.width && !data.height && !data.left && data.top) {
|
|
data.top = null;
|
|
} else if (!data.width && !data.height && !data.top && data.left) {
|
|
data.left = null;
|
|
}
|
|
|
|
return data;
|
|
},
|
|
|
|
_getPaddingPlusBorderDimensions: function (element) {
|
|
var i = 0,
|
|
widths = [],
|
|
borders = [
|
|
element.css("borderTopWidth"),
|
|
element.css("borderRightWidth"),
|
|
element.css("borderBottomWidth"),
|
|
element.css("borderLeftWidth")
|
|
],
|
|
paddings = [
|
|
element.css("paddingTop"),
|
|
element.css("paddingRight"),
|
|
element.css("paddingBottom"),
|
|
element.css("paddingLeft")
|
|
];
|
|
|
|
for (; i < 4; i++) {
|
|
widths[i] = (parseFloat(borders[i]) || 0);
|
|
widths[i] += (parseFloat(paddings[i]) || 0);
|
|
}
|
|
|
|
return {
|
|
height: widths[0] + widths[2],
|
|
width: widths[1] + widths[3]
|
|
};
|
|
},
|
|
|
|
_proportionallyResize: function () {
|
|
if (!this._proportionallyResizeElements.length) {
|
|
return;
|
|
}
|
|
|
|
var prel,
|
|
i = 0,
|
|
element = this.helper || this.element;
|
|
|
|
for (; i < this._proportionallyResizeElements.length; i++) {
|
|
prel = this._proportionallyResizeElements[i];
|
|
|
|
// TODO: Seems like a bug to cache this.outerDimensions
|
|
// considering that we are in a loop.
|
|
if (!this.outerDimensions) {
|
|
this.outerDimensions = this._getPaddingPlusBorderDimensions(prel);
|
|
}
|
|
|
|
prel.css({
|
|
height: (element.height() - this.outerDimensions.height) || 0,
|
|
width: (element.width() - this.outerDimensions.width) || 0
|
|
});
|
|
}
|
|
},
|
|
|
|
_renderProxy: function () {
|
|
var el = this.element, o = this.options;
|
|
this.elementOffset = el.offset();
|
|
|
|
if (this._helper) {
|
|
this.helper = this.helper || $("<div style='overflow:hidden;'></div>");
|
|
|
|
this._addClass(this.helper, this._helper);
|
|
this.helper.css({
|
|
width: this.element.outerWidth(),
|
|
height: this.element.outerHeight(),
|
|
position: "absolute",
|
|
left: this.elementOffset.left + "px",
|
|
top: this.elementOffset.top + "px",
|
|
zIndex: ++o.zIndex //TODO: Don't modify option
|
|
});
|
|
|
|
this.helper
|
|
.appendTo("body")
|
|
.disableSelection();
|
|
} else {
|
|
this.helper = this.element;
|
|
}
|
|
},
|
|
|
|
_change: {
|
|
e: function (event, dx) {
|
|
return { width: this.originalSize.width + dx };
|
|
},
|
|
w: function (event, dx) {
|
|
var cs = this.originalSize, sp = this.originalPosition;
|
|
return { left: sp.left + dx, width: cs.width - dx };
|
|
},
|
|
n: function (event, dx, dy) {
|
|
var cs = this.originalSize, sp = this.originalPosition;
|
|
return { top: sp.top + dy, height: cs.height - dy };
|
|
},
|
|
s: function (event, dx, dy) {
|
|
return { height: this.originalSize.height + dy };
|
|
},
|
|
se: function (event, dx, dy) {
|
|
return $.extend(this._change.s.apply(this, arguments),
|
|
this._change.e.apply(this, [event, dx, dy]));
|
|
},
|
|
sw: function (event, dx, dy) {
|
|
return $.extend(this._change.s.apply(this, arguments),
|
|
this._change.w.apply(this, [event, dx, dy]));
|
|
},
|
|
ne: function (event, dx, dy) {
|
|
return $.extend(this._change.n.apply(this, arguments),
|
|
this._change.e.apply(this, [event, dx, dy]));
|
|
},
|
|
nw: function (event, dx, dy) {
|
|
return $.extend(this._change.n.apply(this, arguments),
|
|
this._change.w.apply(this, [event, dx, dy]));
|
|
}
|
|
},
|
|
|
|
_propagate: function (n, event) {
|
|
$.ui.plugin.call(this, n, [event, this.ui()]);
|
|
(n !== "resize" && this._trigger(n, event, this.ui()));
|
|
},
|
|
|
|
plugins: {},
|
|
|
|
ui: function () {
|
|
return {
|
|
originalElement: this.originalElement,
|
|
element: this.element,
|
|
helper: this.helper,
|
|
position: this.position,
|
|
size: this.size,
|
|
originalSize: this.originalSize,
|
|
originalPosition: this.originalPosition
|
|
};
|
|
}
|
|
});
|
|
|
|
/*
|
|
* Resizable Extensions
|
|
*/
|
|
|
|
$.ui.plugin.add("resizable", "animate", {
|
|
stop: function (event) {
|
|
var that = $(this).resizable("instance"),
|
|
o = that.options,
|
|
pr = that._proportionallyResizeElements,
|
|
ista = pr.length && (/textarea/i).test(pr[0].nodeName),
|
|
soffseth = ista && that._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height,
|
|
soffsetw = ista ? 0 : that.sizeDiff.width,
|
|
style = {
|
|
width: (that.size.width - soffsetw),
|
|
height: (that.size.height - soffseth)
|
|
},
|
|
left = (parseFloat(that.element.css("left")) +
|
|
(that.position.left - that.originalPosition.left)) || null,
|
|
top = (parseFloat(that.element.css("top")) +
|
|
(that.position.top - that.originalPosition.top)) || null;
|
|
|
|
that.element.animate(
|
|
$.extend(style, top && left ? { top: top, left: left } : {}), {
|
|
duration: o.animateDuration,
|
|
easing: o.animateEasing,
|
|
step: function () {
|
|
var data = {
|
|
width: parseFloat(that.element.css("width")),
|
|
height: parseFloat(that.element.css("height")),
|
|
top: parseFloat(that.element.css("top")),
|
|
left: parseFloat(that.element.css("left"))
|
|
};
|
|
|
|
if (pr && pr.length) {
|
|
$(pr[0]).css({ width: data.width, height: data.height });
|
|
}
|
|
|
|
// Propagating resize, and updating values for each animation step
|
|
that._updateCache(data);
|
|
that._propagate("resize", event);
|
|
}
|
|
}
|
|
);
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("resizable", "containment", {
|
|
start: function () {
|
|
var element, p, co, ch, cw, width, height,
|
|
that = $(this).resizable("instance"),
|
|
o = that.options,
|
|
el = that.element,
|
|
oc = o.containment,
|
|
ce = (oc instanceof $) ?
|
|
oc.get(0) :
|
|
(/parent/.test(oc)) ? el.parent().get(0) : oc;
|
|
|
|
if (!ce) {
|
|
return;
|
|
}
|
|
|
|
that.containerElement = $(ce);
|
|
|
|
if (/document/.test(oc) || oc === document) {
|
|
that.containerOffset = {
|
|
left: 0,
|
|
top: 0
|
|
};
|
|
that.containerPosition = {
|
|
left: 0,
|
|
top: 0
|
|
};
|
|
|
|
that.parentData = {
|
|
element: $(document),
|
|
left: 0,
|
|
top: 0,
|
|
width: $(document).width(),
|
|
height: $(document).height() || document.body.parentNode.scrollHeight
|
|
};
|
|
} else {
|
|
element = $(ce);
|
|
p = [];
|
|
$(["Top", "Right", "Left", "Bottom"]).each(function (i, name) {
|
|
p[i] = that._num(element.css("padding" + name));
|
|
});
|
|
|
|
that.containerOffset = element.offset();
|
|
that.containerPosition = element.position();
|
|
that.containerSize = {
|
|
height: (element.innerHeight() - p[3]),
|
|
width: (element.innerWidth() - p[1])
|
|
};
|
|
|
|
co = that.containerOffset;
|
|
ch = that.containerSize.height;
|
|
cw = that.containerSize.width;
|
|
width = (that._hasScroll(ce, "left") ? ce.scrollWidth : cw);
|
|
height = (that._hasScroll(ce) ? ce.scrollHeight : ch);
|
|
|
|
that.parentData = {
|
|
element: ce,
|
|
left: co.left,
|
|
top: co.top,
|
|
width: width,
|
|
height: height
|
|
};
|
|
}
|
|
},
|
|
|
|
resize: function (event) {
|
|
var woset, hoset, isParent, isOffsetRelative,
|
|
that = $(this).resizable("instance"),
|
|
o = that.options,
|
|
co = that.containerOffset,
|
|
cp = that.position,
|
|
pRatio = that._aspectRatio || event.shiftKey,
|
|
cop = {
|
|
top: 0,
|
|
left: 0
|
|
},
|
|
ce = that.containerElement,
|
|
continueResize = true;
|
|
|
|
if (ce[0] !== document && (/static/).test(ce.css("position"))) {
|
|
cop = co;
|
|
}
|
|
|
|
if (cp.left < (that._helper ? co.left : 0)) {
|
|
that.size.width = that.size.width +
|
|
(that._helper ?
|
|
(that.position.left - co.left) :
|
|
(that.position.left - cop.left));
|
|
|
|
if (pRatio) {
|
|
that.size.height = that.size.width / that.aspectRatio;
|
|
continueResize = false;
|
|
}
|
|
that.position.left = o.helper ? co.left : 0;
|
|
}
|
|
|
|
if (cp.top < (that._helper ? co.top : 0)) {
|
|
that.size.height = that.size.height +
|
|
(that._helper ?
|
|
(that.position.top - co.top) :
|
|
that.position.top);
|
|
|
|
if (pRatio) {
|
|
that.size.width = that.size.height * that.aspectRatio;
|
|
continueResize = false;
|
|
}
|
|
that.position.top = that._helper ? co.top : 0;
|
|
}
|
|
|
|
isParent = that.containerElement.get(0) === that.element.parent().get(0);
|
|
isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position"));
|
|
|
|
if (isParent && isOffsetRelative) {
|
|
that.offset.left = that.parentData.left + that.position.left;
|
|
that.offset.top = that.parentData.top + that.position.top;
|
|
} else {
|
|
that.offset.left = that.element.offset().left;
|
|
that.offset.top = that.element.offset().top;
|
|
}
|
|
|
|
woset = Math.abs(that.sizeDiff.width +
|
|
(that._helper ?
|
|
that.offset.left - cop.left :
|
|
(that.offset.left - co.left)));
|
|
|
|
hoset = Math.abs(that.sizeDiff.height +
|
|
(that._helper ?
|
|
that.offset.top - cop.top :
|
|
(that.offset.top - co.top)));
|
|
|
|
if (woset + that.size.width >= that.parentData.width) {
|
|
that.size.width = that.parentData.width - woset;
|
|
if (pRatio) {
|
|
that.size.height = that.size.width / that.aspectRatio;
|
|
continueResize = false;
|
|
}
|
|
}
|
|
|
|
if (hoset + that.size.height >= that.parentData.height) {
|
|
that.size.height = that.parentData.height - hoset;
|
|
if (pRatio) {
|
|
that.size.width = that.size.height * that.aspectRatio;
|
|
continueResize = false;
|
|
}
|
|
}
|
|
|
|
if (!continueResize) {
|
|
that.position.left = that.prevPosition.left;
|
|
that.position.top = that.prevPosition.top;
|
|
that.size.width = that.prevSize.width;
|
|
that.size.height = that.prevSize.height;
|
|
}
|
|
},
|
|
|
|
stop: function () {
|
|
var that = $(this).resizable("instance"),
|
|
o = that.options,
|
|
co = that.containerOffset,
|
|
cop = that.containerPosition,
|
|
ce = that.containerElement,
|
|
helper = $(that.helper),
|
|
ho = helper.offset(),
|
|
w = helper.outerWidth() - that.sizeDiff.width,
|
|
h = helper.outerHeight() - that.sizeDiff.height;
|
|
|
|
if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) {
|
|
$(this).css({
|
|
left: ho.left - cop.left - co.left,
|
|
width: w,
|
|
height: h
|
|
});
|
|
}
|
|
|
|
if (that._helper && !o.animate && (/static/).test(ce.css("position"))) {
|
|
$(this).css({
|
|
left: ho.left - cop.left - co.left,
|
|
width: w,
|
|
height: h
|
|
});
|
|
}
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("resizable", "alsoResize", {
|
|
start: function () {
|
|
var that = $(this).resizable("instance"),
|
|
o = that.options;
|
|
|
|
$(o.alsoResize).each(function () {
|
|
var el = $(this);
|
|
el.data("ui-resizable-alsoresize", {
|
|
width: parseFloat(el.width()), height: parseFloat(el.height()),
|
|
left: parseFloat(el.css("left")), top: parseFloat(el.css("top"))
|
|
});
|
|
});
|
|
},
|
|
|
|
resize: function (event, ui) {
|
|
var that = $(this).resizable("instance"),
|
|
o = that.options,
|
|
os = that.originalSize,
|
|
op = that.originalPosition,
|
|
delta = {
|
|
height: (that.size.height - os.height) || 0,
|
|
width: (that.size.width - os.width) || 0,
|
|
top: (that.position.top - op.top) || 0,
|
|
left: (that.position.left - op.left) || 0
|
|
};
|
|
|
|
$(o.alsoResize).each(function () {
|
|
var el = $(this), start = $(this).data("ui-resizable-alsoresize"), style = {},
|
|
css = el.parents(ui.originalElement[0]).length ?
|
|
["width", "height"] :
|
|
["width", "height", "top", "left"];
|
|
|
|
$.each(css, function (i, prop) {
|
|
var sum = (start[prop] || 0) + (delta[prop] || 0);
|
|
if (sum && sum >= 0) {
|
|
style[prop] = sum || null;
|
|
}
|
|
});
|
|
|
|
el.css(style);
|
|
});
|
|
},
|
|
|
|
stop: function () {
|
|
$(this).removeData("ui-resizable-alsoresize");
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("resizable", "ghost", {
|
|
start: function () {
|
|
var that = $(this).resizable("instance"), cs = that.size;
|
|
|
|
that.ghost = that.originalElement.clone();
|
|
that.ghost.css({
|
|
opacity: 0.25,
|
|
display: "block",
|
|
position: "relative",
|
|
height: cs.height,
|
|
width: cs.width,
|
|
margin: 0,
|
|
left: 0,
|
|
top: 0
|
|
});
|
|
|
|
that._addClass(that.ghost, "ui-resizable-ghost");
|
|
|
|
// DEPRECATED
|
|
// TODO: remove after 1.12
|
|
if ($.uiBackCompat !== false && typeof that.options.ghost === "string") {
|
|
// Ghost option
|
|
that.ghost.addClass(this.options.ghost);
|
|
}
|
|
|
|
that.ghost.appendTo(that.helper);
|
|
},
|
|
|
|
resize: function () {
|
|
var that = $(this).resizable("instance");
|
|
if (that.ghost) {
|
|
that.ghost.css({
|
|
position: "relative",
|
|
height: that.size.height,
|
|
width: that.size.width
|
|
});
|
|
}
|
|
},
|
|
|
|
stop: function () {
|
|
var that = $(this).resizable("instance");
|
|
if (that.ghost && that.helper) {
|
|
that.helper.get(0).removeChild(that.ghost.get(0));
|
|
}
|
|
}
|
|
});
|
|
|
|
$.ui.plugin.add("resizable", "grid", {
|
|
resize: function () {
|
|
var outerDimensions,
|
|
that = $(this).resizable("instance"),
|
|
o = that.options,
|
|
cs = that.size,
|
|
os = that.originalSize,
|
|
op = that.originalPosition,
|
|
a = that.axis,
|
|
grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid,
|
|
gridX = (grid[0] || 1),
|
|
gridY = (grid[1] || 1),
|
|
ox = Math.round((cs.width - os.width) / gridX) * gridX,
|
|
oy = Math.round((cs.height - os.height) / gridY) * gridY,
|
|
newWidth = os.width + ox,
|
|
newHeight = os.height + oy,
|
|
isMaxWidth = o.maxWidth && (o.maxWidth < newWidth),
|
|
isMaxHeight = o.maxHeight && (o.maxHeight < newHeight),
|
|
isMinWidth = o.minWidth && (o.minWidth > newWidth),
|
|
isMinHeight = o.minHeight && (o.minHeight > newHeight);
|
|
|
|
o.grid = grid;
|
|
|
|
if (isMinWidth) {
|
|
newWidth += gridX;
|
|
}
|
|
if (isMinHeight) {
|
|
newHeight += gridY;
|
|
}
|
|
if (isMaxWidth) {
|
|
newWidth -= gridX;
|
|
}
|
|
if (isMaxHeight) {
|
|
newHeight -= gridY;
|
|
}
|
|
|
|
if (/^(se|s|e)$/.test(a)) {
|
|
that.size.width = newWidth;
|
|
that.size.height = newHeight;
|
|
} else if (/^(ne)$/.test(a)) {
|
|
that.size.width = newWidth;
|
|
that.size.height = newHeight;
|
|
that.position.top = op.top - oy;
|
|
} else if (/^(sw)$/.test(a)) {
|
|
that.size.width = newWidth;
|
|
that.size.height = newHeight;
|
|
that.position.left = op.left - ox;
|
|
} else {
|
|
if (newHeight - gridY <= 0 || newWidth - gridX <= 0) {
|
|
outerDimensions = that._getPaddingPlusBorderDimensions(this);
|
|
}
|
|
|
|
if (newHeight - gridY > 0) {
|
|
that.size.height = newHeight;
|
|
that.position.top = op.top - oy;
|
|
} else {
|
|
newHeight = gridY - outerDimensions.height;
|
|
that.size.height = newHeight;
|
|
that.position.top = op.top + os.height - newHeight;
|
|
}
|
|
if (newWidth - gridX > 0) {
|
|
that.size.width = newWidth;
|
|
that.position.left = op.left - ox;
|
|
} else {
|
|
newWidth = gridX - outerDimensions.width;
|
|
that.size.width = newWidth;
|
|
that.position.left = op.left + os.width - newWidth;
|
|
}
|
|
}
|
|
}
|
|
});
|
|
|
|
var widgetsResizable = $.ui.resizable;
|
|
|
|
/*!
|
|
* jQuery UI Dialog 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Dialog
|
|
//>>group: Widgets
|
|
//>>description: Displays customizable dialog windows.
|
|
//>>docs: http://api.jqueryui.com/dialog/
|
|
//>>demos: http://jqueryui.com/dialog/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/dialog.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.widget("ui.dialog", {
|
|
version: "1.12.1",
|
|
options: {
|
|
appendTo: "body",
|
|
autoOpen: true,
|
|
buttons: [],
|
|
classes: {
|
|
"ui-dialog": "ui-corner-all",
|
|
"ui-dialog-titlebar": "ui-corner-all"
|
|
},
|
|
closeOnEscape: true,
|
|
closeText: "Close",
|
|
draggable: true,
|
|
hide: null,
|
|
height: "auto",
|
|
maxHeight: null,
|
|
maxWidth: null,
|
|
minHeight: 150,
|
|
minWidth: 150,
|
|
modal: false,
|
|
position: {
|
|
my: "center",
|
|
at: "center",
|
|
of: window,
|
|
collision: "fit",
|
|
|
|
// Ensure the titlebar is always visible
|
|
using: function (pos) {
|
|
var topOffset = $(this).css(pos).offset().top;
|
|
if (topOffset < 0) {
|
|
$(this).css("top", pos.top - topOffset);
|
|
}
|
|
}
|
|
},
|
|
resizable: true,
|
|
show: null,
|
|
title: null,
|
|
width: 300,
|
|
|
|
// Callbacks
|
|
beforeClose: null,
|
|
close: null,
|
|
drag: null,
|
|
dragStart: null,
|
|
dragStop: null,
|
|
focus: null,
|
|
open: null,
|
|
resize: null,
|
|
resizeStart: null,
|
|
resizeStop: null
|
|
},
|
|
|
|
sizeRelatedOptions: {
|
|
buttons: true,
|
|
height: true,
|
|
maxHeight: true,
|
|
maxWidth: true,
|
|
minHeight: true,
|
|
minWidth: true,
|
|
width: true
|
|
},
|
|
|
|
resizableRelatedOptions: {
|
|
maxHeight: true,
|
|
maxWidth: true,
|
|
minHeight: true,
|
|
minWidth: true
|
|
},
|
|
|
|
_create: function () {
|
|
this.originalCss = {
|
|
display: this.element[0].style.display,
|
|
width: this.element[0].style.width,
|
|
minHeight: this.element[0].style.minHeight,
|
|
maxHeight: this.element[0].style.maxHeight,
|
|
height: this.element[0].style.height
|
|
};
|
|
this.originalPosition = {
|
|
parent: this.element.parent(),
|
|
index: this.element.parent().children().index(this.element)
|
|
};
|
|
this.originalTitle = this.element.attr("title");
|
|
if (this.options.title == null && this.originalTitle != null) {
|
|
this.options.title = this.originalTitle;
|
|
}
|
|
|
|
// Dialogs can't be disabled
|
|
if (this.options.disabled) {
|
|
this.options.disabled = false;
|
|
}
|
|
|
|
this._createWrapper();
|
|
|
|
this.element
|
|
.show()
|
|
.removeAttr("title")
|
|
.appendTo(this.uiDialog);
|
|
|
|
this._addClass("ui-dialog-content", "ui-widget-content");
|
|
|
|
this._createTitlebar();
|
|
this._createButtonPane();
|
|
|
|
if (this.options.draggable && $.fn.draggable) {
|
|
this._makeDraggable();
|
|
}
|
|
if (this.options.resizable && $.fn.resizable) {
|
|
this._makeResizable();
|
|
}
|
|
|
|
this._isOpen = false;
|
|
|
|
this._trackFocus();
|
|
},
|
|
|
|
_init: function () {
|
|
if (this.options.autoOpen) {
|
|
this.open();
|
|
}
|
|
},
|
|
|
|
_appendTo: function () {
|
|
var element = this.options.appendTo;
|
|
if (element && (element.jquery || element.nodeType)) {
|
|
return $(element);
|
|
}
|
|
return this.document.find(element || "body").eq(0);
|
|
},
|
|
|
|
_destroy: function () {
|
|
var next,
|
|
originalPosition = this.originalPosition;
|
|
|
|
this._untrackInstance();
|
|
this._destroyOverlay();
|
|
|
|
this.element
|
|
.removeUniqueId()
|
|
.css(this.originalCss)
|
|
|
|
// Without detaching first, the following becomes really slow
|
|
.detach();
|
|
|
|
this.uiDialog.remove();
|
|
|
|
if (this.originalTitle) {
|
|
this.element.attr("title", this.originalTitle);
|
|
}
|
|
|
|
next = originalPosition.parent.children().eq(originalPosition.index);
|
|
|
|
// Don't try to place the dialog next to itself (#8613)
|
|
if (next.length && next[0] !== this.element[0]) {
|
|
next.before(this.element);
|
|
} else {
|
|
originalPosition.parent.append(this.element);
|
|
}
|
|
},
|
|
|
|
widget: function () {
|
|
return this.uiDialog;
|
|
},
|
|
|
|
disable: $.noop,
|
|
enable: $.noop,
|
|
|
|
close: function (event) {
|
|
var that = this;
|
|
|
|
if (!this._isOpen || this._trigger("beforeClose", event) === false) {
|
|
return;
|
|
}
|
|
|
|
this._isOpen = false;
|
|
this._focusedElement = null;
|
|
this._destroyOverlay();
|
|
this._untrackInstance();
|
|
|
|
if (!this.opener.filter(":focusable").trigger("focus").length) {
|
|
// Hiding a focused element doesn't trigger blur in WebKit
|
|
// so in case we have nothing to focus on, explicitly blur the active element
|
|
// https://bugs.webkit.org/show_bug.cgi?id=47182
|
|
$.ui.safeBlur($.ui.safeActiveElement(this.document[0]));
|
|
}
|
|
|
|
this._hide(this.uiDialog, this.options.hide, function () {
|
|
that._trigger("close", event);
|
|
});
|
|
},
|
|
|
|
isOpen: function () {
|
|
return this._isOpen;
|
|
},
|
|
|
|
moveToTop: function () {
|
|
this._moveToTop();
|
|
},
|
|
|
|
_moveToTop: function (event, silent) {
|
|
var moved = false,
|
|
zIndices = this.uiDialog.siblings(".ui-front:visible").map(function () {
|
|
return +$(this).css("z-index");
|
|
}).get(),
|
|
zIndexMax = Math.max.apply(null, zIndices);
|
|
|
|
if (zIndexMax >= +this.uiDialog.css("z-index")) {
|
|
this.uiDialog.css("z-index", zIndexMax + 1);
|
|
moved = true;
|
|
}
|
|
|
|
if (moved && !silent) {
|
|
this._trigger("focus", event);
|
|
}
|
|
return moved;
|
|
},
|
|
|
|
open: function () {
|
|
var that = this;
|
|
if (this._isOpen) {
|
|
if (this._moveToTop()) {
|
|
this._focusTabbable();
|
|
}
|
|
return;
|
|
}
|
|
|
|
this._isOpen = true;
|
|
this.opener = $($.ui.safeActiveElement(this.document[0]));
|
|
|
|
this._size();
|
|
this._position();
|
|
this._createOverlay();
|
|
this._moveToTop(null, true);
|
|
|
|
// Ensure the overlay is moved to the top with the dialog, but only when
|
|
// opening. The overlay shouldn't move after the dialog is open so that
|
|
// modeless dialogs opened after the modal dialog stack properly.
|
|
if (this.overlay) {
|
|
this.overlay.css("z-index", this.uiDialog.css("z-index") - 1);
|
|
}
|
|
|
|
this._show(this.uiDialog, this.options.show, function () {
|
|
that._focusTabbable();
|
|
that._trigger("focus");
|
|
});
|
|
|
|
// Track the dialog immediately upon openening in case a focus event
|
|
// somehow occurs outside of the dialog before an element inside the
|
|
// dialog is focused (#10152)
|
|
this._makeFocusTarget();
|
|
|
|
this._trigger("open");
|
|
},
|
|
|
|
_focusTabbable: function () {
|
|
// Set focus to the first match:
|
|
// 1. An element that was focused previously
|
|
// 2. First element inside the dialog matching [autofocus]
|
|
// 3. Tabbable element inside the content element
|
|
// 4. Tabbable element inside the buttonpane
|
|
// 5. The close button
|
|
// 6. The dialog itself
|
|
var hasFocus = this._focusedElement;
|
|
if (!hasFocus) {
|
|
hasFocus = this.element.find("[autofocus]");
|
|
}
|
|
if (!hasFocus.length) {
|
|
hasFocus = this.element.find(":tabbable");
|
|
}
|
|
if (!hasFocus.length) {
|
|
hasFocus = this.uiDialogButtonPane.find(":tabbable");
|
|
}
|
|
if (!hasFocus.length) {
|
|
hasFocus = this.uiDialogTitlebarClose.filter(":tabbable");
|
|
}
|
|
if (!hasFocus.length) {
|
|
hasFocus = this.uiDialog;
|
|
}
|
|
hasFocus.eq(0).trigger("focus");
|
|
},
|
|
|
|
_keepFocus: function (event) {
|
|
function checkFocus() {
|
|
var activeElement = $.ui.safeActiveElement(this.document[0]),
|
|
isActive = this.uiDialog[0] === activeElement ||
|
|
$.contains(this.uiDialog[0], activeElement);
|
|
if (!isActive) {
|
|
this._focusTabbable();
|
|
}
|
|
}
|
|
event.preventDefault();
|
|
checkFocus.call(this);
|
|
|
|
// support: IE
|
|
// IE <= 8 doesn't prevent moving focus even with event.preventDefault()
|
|
// so we check again later
|
|
this._delay(checkFocus);
|
|
},
|
|
|
|
_createWrapper: function () {
|
|
this.uiDialog = $("<div>")
|
|
.hide()
|
|
.attr({
|
|
// Setting tabIndex makes the div focusable
|
|
tabIndex: -1,
|
|
role: "dialog"
|
|
})
|
|
.appendTo(this._appendTo());
|
|
|
|
this._addClass(this.uiDialog, "ui-dialog", "ui-widget ui-widget-content ui-front");
|
|
this._on(this.uiDialog, {
|
|
keydown: function (event) {
|
|
if (this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
|
|
event.keyCode === $.ui.keyCode.ESCAPE) {
|
|
event.preventDefault();
|
|
this.close(event);
|
|
return;
|
|
}
|
|
|
|
// Prevent tabbing out of dialogs
|
|
if (event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented()) {
|
|
return;
|
|
}
|
|
var tabbables = this.uiDialog.find(":tabbable"),
|
|
first = tabbables.filter(":first"),
|
|
last = tabbables.filter(":last");
|
|
|
|
if ((event.target === last[0] || event.target === this.uiDialog[0]) &&
|
|
!event.shiftKey) {
|
|
this._delay(function () {
|
|
first.trigger("focus");
|
|
});
|
|
event.preventDefault();
|
|
} else if ((event.target === first[0] ||
|
|
event.target === this.uiDialog[0]) && event.shiftKey) {
|
|
this._delay(function () {
|
|
last.trigger("focus");
|
|
});
|
|
event.preventDefault();
|
|
}
|
|
},
|
|
mousedown: function (event) {
|
|
if (this._moveToTop(event)) {
|
|
this._focusTabbable();
|
|
}
|
|
}
|
|
});
|
|
|
|
// We assume that any existing aria-describedby attribute means
|
|
// that the dialog content is marked up properly
|
|
// otherwise we brute force the content as the description
|
|
if (!this.element.find("[aria-describedby]").length) {
|
|
this.uiDialog.attr({
|
|
"aria-describedby": this.element.uniqueId().attr("id")
|
|
});
|
|
}
|
|
},
|
|
|
|
_createTitlebar: function () {
|
|
var uiDialogTitle;
|
|
|
|
this.uiDialogTitlebar = $("<div>");
|
|
this._addClass(this.uiDialogTitlebar,
|
|
"ui-dialog-titlebar", "ui-widget-header ui-helper-clearfix");
|
|
this._on(this.uiDialogTitlebar, {
|
|
mousedown: function (event) {
|
|
// Don't prevent click on close button (#8838)
|
|
// Focusing a dialog that is partially scrolled out of view
|
|
// causes the browser to scroll it into view, preventing the click event
|
|
if (!$(event.target).closest(".ui-dialog-titlebar-close")) {
|
|
// Dialog isn't getting focus when dragging (#8063)
|
|
this.uiDialog.trigger("focus");
|
|
}
|
|
}
|
|
});
|
|
|
|
// Support: IE
|
|
// Use type="button" to prevent enter keypresses in textboxes from closing the
|
|
// dialog in IE (#9312)
|
|
this.uiDialogTitlebarClose = $("<button type='button'></button>")
|
|
.button({
|
|
label: $("<a>").text(this.options.closeText).html(),
|
|
icon: "ui-icon-closethick",
|
|
showLabel: false
|
|
})
|
|
.appendTo(this.uiDialogTitlebar);
|
|
|
|
this._addClass(this.uiDialogTitlebarClose, "ui-dialog-titlebar-close");
|
|
this._on(this.uiDialogTitlebarClose, {
|
|
click: function (event) {
|
|
event.preventDefault();
|
|
this.close(event);
|
|
}
|
|
});
|
|
|
|
uiDialogTitle = $("<span>").uniqueId().prependTo(this.uiDialogTitlebar);
|
|
this._addClass(uiDialogTitle, "ui-dialog-title");
|
|
this._title(uiDialogTitle);
|
|
|
|
this.uiDialogTitlebar.prependTo(this.uiDialog);
|
|
|
|
this.uiDialog.attr({
|
|
"aria-labelledby": uiDialogTitle.attr("id")
|
|
});
|
|
},
|
|
|
|
_title: function (title) {
|
|
if (this.options.title) {
|
|
title.text(this.options.title);
|
|
} else {
|
|
title.html(" ");
|
|
}
|
|
},
|
|
|
|
_createButtonPane: function () {
|
|
this.uiDialogButtonPane = $("<div>");
|
|
this._addClass(this.uiDialogButtonPane, "ui-dialog-buttonpane",
|
|
"ui-widget-content ui-helper-clearfix");
|
|
|
|
this.uiButtonSet = $("<div>")
|
|
.appendTo(this.uiDialogButtonPane);
|
|
this._addClass(this.uiButtonSet, "ui-dialog-buttonset");
|
|
|
|
this._createButtons();
|
|
},
|
|
|
|
_createButtons: function () {
|
|
var that = this,
|
|
buttons = this.options.buttons;
|
|
|
|
// If we already have a button pane, remove it
|
|
this.uiDialogButtonPane.remove();
|
|
this.uiButtonSet.empty();
|
|
|
|
if ($.isEmptyObject(buttons) || ($.isArray(buttons) && !buttons.length)) {
|
|
this._removeClass(this.uiDialog, "ui-dialog-buttons");
|
|
return;
|
|
}
|
|
|
|
$.each(buttons, function (name, props) {
|
|
var click, buttonOptions;
|
|
props = $.isFunction(props) ?
|
|
{ click: props, text: name } :
|
|
props;
|
|
|
|
// Default to a non-submitting button
|
|
props = $.extend({ type: "button" }, props);
|
|
|
|
// Change the context for the click callback to be the main element
|
|
click = props.click;
|
|
buttonOptions = {
|
|
icon: props.icon,
|
|
iconPosition: props.iconPosition,
|
|
showLabel: props.showLabel,
|
|
|
|
// Deprecated options
|
|
icons: props.icons,
|
|
text: props.text
|
|
};
|
|
|
|
delete props.click;
|
|
delete props.icon;
|
|
delete props.iconPosition;
|
|
delete props.showLabel;
|
|
|
|
// Deprecated options
|
|
delete props.icons;
|
|
if (typeof props.text === "boolean") {
|
|
delete props.text;
|
|
}
|
|
|
|
$("<button></button>", props)
|
|
.button(buttonOptions)
|
|
.appendTo(that.uiButtonSet)
|
|
.on("click", function () {
|
|
click.apply(that.element[0], arguments);
|
|
});
|
|
});
|
|
this._addClass(this.uiDialog, "ui-dialog-buttons");
|
|
this.uiDialogButtonPane.appendTo(this.uiDialog);
|
|
},
|
|
|
|
_makeDraggable: function () {
|
|
var that = this,
|
|
options = this.options;
|
|
|
|
function filteredUi(ui) {
|
|
return {
|
|
position: ui.position,
|
|
offset: ui.offset
|
|
};
|
|
}
|
|
|
|
this.uiDialog.draggable({
|
|
cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
|
|
handle: ".ui-dialog-titlebar",
|
|
containment: "document",
|
|
start: function (event, ui) {
|
|
that._addClass($(this), "ui-dialog-dragging");
|
|
that._blockFrames();
|
|
that._trigger("dragStart", event, filteredUi(ui));
|
|
},
|
|
drag: function (event, ui) {
|
|
that._trigger("drag", event, filteredUi(ui));
|
|
},
|
|
stop: function (event, ui) {
|
|
var left = ui.offset.left - that.document.scrollLeft(),
|
|
top = ui.offset.top - that.document.scrollTop();
|
|
|
|
options.position = {
|
|
my: "left top",
|
|
at: "left" + (left >= 0 ? "+" : "") + left + " " +
|
|
"top" + (top >= 0 ? "+" : "") + top,
|
|
of: that.window
|
|
};
|
|
that._removeClass($(this), "ui-dialog-dragging");
|
|
that._unblockFrames();
|
|
that._trigger("dragStop", event, filteredUi(ui));
|
|
}
|
|
});
|
|
},
|
|
|
|
_makeResizable: function () {
|
|
var that = this,
|
|
options = this.options,
|
|
handles = options.resizable,
|
|
|
|
// .ui-resizable has position: relative defined in the stylesheet
|
|
// but dialogs have to use absolute or fixed positioning
|
|
position = this.uiDialog.css("position"),
|
|
resizeHandles = typeof handles === "string" ?
|
|
handles :
|
|
"n,e,s,w,se,sw,ne,nw";
|
|
|
|
function filteredUi(ui) {
|
|
return {
|
|
originalPosition: ui.originalPosition,
|
|
originalSize: ui.originalSize,
|
|
position: ui.position,
|
|
size: ui.size
|
|
};
|
|
}
|
|
|
|
this.uiDialog.resizable({
|
|
cancel: ".ui-dialog-content",
|
|
containment: "document",
|
|
alsoResize: this.element,
|
|
maxWidth: options.maxWidth,
|
|
maxHeight: options.maxHeight,
|
|
minWidth: options.minWidth,
|
|
minHeight: this._minHeight(),
|
|
handles: resizeHandles,
|
|
start: function (event, ui) {
|
|
that._addClass($(this), "ui-dialog-resizing");
|
|
that._blockFrames();
|
|
that._trigger("resizeStart", event, filteredUi(ui));
|
|
},
|
|
resize: function (event, ui) {
|
|
that._trigger("resize", event, filteredUi(ui));
|
|
},
|
|
stop: function (event, ui) {
|
|
var offset = that.uiDialog.offset(),
|
|
left = offset.left - that.document.scrollLeft(),
|
|
top = offset.top - that.document.scrollTop();
|
|
|
|
options.height = that.uiDialog.height();
|
|
options.width = that.uiDialog.width();
|
|
options.position = {
|
|
my: "left top",
|
|
at: "left" + (left >= 0 ? "+" : "") + left + " " +
|
|
"top" + (top >= 0 ? "+" : "") + top,
|
|
of: that.window
|
|
};
|
|
that._removeClass($(this), "ui-dialog-resizing");
|
|
that._unblockFrames();
|
|
that._trigger("resizeStop", event, filteredUi(ui));
|
|
}
|
|
})
|
|
.css("position", position);
|
|
},
|
|
|
|
_trackFocus: function () {
|
|
this._on(this.widget(), {
|
|
focusin: function (event) {
|
|
this._makeFocusTarget();
|
|
this._focusedElement = $(event.target);
|
|
}
|
|
});
|
|
},
|
|
|
|
_makeFocusTarget: function () {
|
|
this._untrackInstance();
|
|
this._trackingInstances().unshift(this);
|
|
},
|
|
|
|
_untrackInstance: function () {
|
|
var instances = this._trackingInstances(),
|
|
exists = $.inArray(this, instances);
|
|
if (exists !== -1) {
|
|
instances.splice(exists, 1);
|
|
}
|
|
},
|
|
|
|
_trackingInstances: function () {
|
|
var instances = this.document.data("ui-dialog-instances");
|
|
if (!instances) {
|
|
instances = [];
|
|
this.document.data("ui-dialog-instances", instances);
|
|
}
|
|
return instances;
|
|
},
|
|
|
|
_minHeight: function () {
|
|
var options = this.options;
|
|
|
|
return options.height === "auto" ?
|
|
options.minHeight :
|
|
Math.min(options.minHeight, options.height);
|
|
},
|
|
|
|
_position: function () {
|
|
// Need to show the dialog to get the actual offset in the position plugin
|
|
var isVisible = this.uiDialog.is(":visible");
|
|
if (!isVisible) {
|
|
this.uiDialog.show();
|
|
}
|
|
this.uiDialog.position(this.options.position);
|
|
if (!isVisible) {
|
|
this.uiDialog.hide();
|
|
}
|
|
},
|
|
|
|
_setOptions: function (options) {
|
|
var that = this,
|
|
resize = false,
|
|
resizableOptions = {};
|
|
|
|
$.each(options, function (key, value) {
|
|
that._setOption(key, value);
|
|
|
|
if (key in that.sizeRelatedOptions) {
|
|
resize = true;
|
|
}
|
|
if (key in that.resizableRelatedOptions) {
|
|
resizableOptions[key] = value;
|
|
}
|
|
});
|
|
|
|
if (resize) {
|
|
this._size();
|
|
this._position();
|
|
}
|
|
if (this.uiDialog.is(":data(ui-resizable)")) {
|
|
this.uiDialog.resizable("option", resizableOptions);
|
|
}
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
var isDraggable, isResizable,
|
|
uiDialog = this.uiDialog;
|
|
|
|
if (key === "disabled") {
|
|
return;
|
|
}
|
|
|
|
this._super(key, value);
|
|
|
|
if (key === "appendTo") {
|
|
this.uiDialog.appendTo(this._appendTo());
|
|
}
|
|
|
|
if (key === "buttons") {
|
|
this._createButtons();
|
|
}
|
|
|
|
if (key === "closeText") {
|
|
this.uiDialogTitlebarClose.button({
|
|
// Ensure that we always pass a string
|
|
label: $("<a>").text("" + this.options.closeText).html()
|
|
});
|
|
}
|
|
|
|
if (key === "draggable") {
|
|
isDraggable = uiDialog.is(":data(ui-draggable)");
|
|
if (isDraggable && !value) {
|
|
uiDialog.draggable("destroy");
|
|
}
|
|
|
|
if (!isDraggable && value) {
|
|
this._makeDraggable();
|
|
}
|
|
}
|
|
|
|
if (key === "position") {
|
|
this._position();
|
|
}
|
|
|
|
if (key === "resizable") {
|
|
// currently resizable, becoming non-resizable
|
|
isResizable = uiDialog.is(":data(ui-resizable)");
|
|
if (isResizable && !value) {
|
|
uiDialog.resizable("destroy");
|
|
}
|
|
|
|
// Currently resizable, changing handles
|
|
if (isResizable && typeof value === "string") {
|
|
uiDialog.resizable("option", "handles", value);
|
|
}
|
|
|
|
// Currently non-resizable, becoming resizable
|
|
if (!isResizable && value !== false) {
|
|
this._makeResizable();
|
|
}
|
|
}
|
|
|
|
if (key === "title") {
|
|
this._title(this.uiDialogTitlebar.find(".ui-dialog-title"));
|
|
}
|
|
},
|
|
|
|
_size: function () {
|
|
// If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
|
|
// divs will both have width and height set, so we need to reset them
|
|
var nonContentHeight, minContentHeight, maxContentHeight,
|
|
options = this.options;
|
|
|
|
// Reset content sizing
|
|
this.element.show().css({
|
|
width: "auto",
|
|
minHeight: 0,
|
|
maxHeight: "none",
|
|
height: 0
|
|
});
|
|
|
|
if (options.minWidth > options.width) {
|
|
options.width = options.minWidth;
|
|
}
|
|
|
|
// Reset wrapper sizing
|
|
// determine the height of all the non-content elements
|
|
nonContentHeight = this.uiDialog.css({
|
|
height: "auto",
|
|
width: options.width
|
|
})
|
|
.outerHeight();
|
|
minContentHeight = Math.max(0, options.minHeight - nonContentHeight);
|
|
maxContentHeight = typeof options.maxHeight === "number" ?
|
|
Math.max(0, options.maxHeight - nonContentHeight) :
|
|
"none";
|
|
|
|
if (options.height === "auto") {
|
|
this.element.css({
|
|
minHeight: minContentHeight,
|
|
maxHeight: maxContentHeight,
|
|
height: "auto"
|
|
});
|
|
} else {
|
|
this.element.height(Math.max(0, options.height - nonContentHeight));
|
|
}
|
|
|
|
if (this.uiDialog.is(":data(ui-resizable)")) {
|
|
this.uiDialog.resizable("option", "minHeight", this._minHeight());
|
|
}
|
|
},
|
|
|
|
_blockFrames: function () {
|
|
this.iframeBlocks = this.document.find("iframe").map(function () {
|
|
var iframe = $(this);
|
|
|
|
return $("<div>")
|
|
.css({
|
|
position: "absolute",
|
|
width: iframe.outerWidth(),
|
|
height: iframe.outerHeight()
|
|
})
|
|
.appendTo(iframe.parent())
|
|
.offset(iframe.offset())[0];
|
|
});
|
|
},
|
|
|
|
_unblockFrames: function () {
|
|
if (this.iframeBlocks) {
|
|
this.iframeBlocks.remove();
|
|
delete this.iframeBlocks;
|
|
}
|
|
},
|
|
|
|
_allowInteraction: function (event) {
|
|
if ($(event.target).closest(".ui-dialog").length) {
|
|
return true;
|
|
}
|
|
|
|
// TODO: Remove hack when datepicker implements
|
|
// the .ui-front logic (#8989)
|
|
return !!$(event.target).closest(".ui-datepicker").length;
|
|
},
|
|
|
|
_createOverlay: function () {
|
|
if (!this.options.modal) {
|
|
return;
|
|
}
|
|
|
|
// We use a delay in case the overlay is created from an
|
|
// event that we're going to be cancelling (#2804)
|
|
var isOpening = true;
|
|
this._delay(function () {
|
|
isOpening = false;
|
|
});
|
|
|
|
if (!this.document.data("ui-dialog-overlays")) {
|
|
// Prevent use of anchors and inputs
|
|
// Using _on() for an event handler shared across many instances is
|
|
// safe because the dialogs stack and must be closed in reverse order
|
|
this._on(this.document, {
|
|
focusin: function (event) {
|
|
if (isOpening) {
|
|
return;
|
|
}
|
|
|
|
if (!this._allowInteraction(event)) {
|
|
event.preventDefault();
|
|
this._trackingInstances()[0]._focusTabbable();
|
|
}
|
|
}
|
|
});
|
|
}
|
|
|
|
this.overlay = $("<div>")
|
|
.appendTo(this._appendTo());
|
|
|
|
this._addClass(this.overlay, null, "ui-widget-overlay ui-front");
|
|
this._on(this.overlay, {
|
|
mousedown: "_keepFocus"
|
|
});
|
|
this.document.data("ui-dialog-overlays",
|
|
(this.document.data("ui-dialog-overlays") || 0) + 1);
|
|
},
|
|
|
|
_destroyOverlay: function () {
|
|
if (!this.options.modal) {
|
|
return;
|
|
}
|
|
|
|
if (this.overlay) {
|
|
var overlays = this.document.data("ui-dialog-overlays") - 1;
|
|
|
|
if (!overlays) {
|
|
this._off(this.document, "focusin");
|
|
this.document.removeData("ui-dialog-overlays");
|
|
} else {
|
|
this.document.data("ui-dialog-overlays", overlays);
|
|
}
|
|
|
|
this.overlay.remove();
|
|
this.overlay = null;
|
|
}
|
|
}
|
|
});
|
|
|
|
// DEPRECATED
|
|
// TODO: switch return back to widget declaration at top of file when this is removed
|
|
if ($.uiBackCompat !== false) {
|
|
// Backcompat for dialogClass option
|
|
$.widget("ui.dialog", $.ui.dialog, {
|
|
options: {
|
|
dialogClass: ""
|
|
},
|
|
_createWrapper: function () {
|
|
this._super();
|
|
this.uiDialog.addClass(this.options.dialogClass);
|
|
},
|
|
_setOption: function (key, value) {
|
|
if (key === "dialogClass") {
|
|
this.uiDialog
|
|
.removeClass(this.options.dialogClass)
|
|
.addClass(value);
|
|
}
|
|
this._superApply(arguments);
|
|
}
|
|
});
|
|
}
|
|
|
|
var widgetsDialog = $.ui.dialog;
|
|
|
|
/*!
|
|
* jQuery UI Droppable 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Droppable
|
|
//>>group: Interactions
|
|
//>>description: Enables drop targets for draggable elements.
|
|
//>>docs: http://api.jqueryui.com/droppable/
|
|
//>>demos: http://jqueryui.com/droppable/
|
|
|
|
$.widget("ui.droppable", {
|
|
version: "1.12.1",
|
|
widgetEventPrefix: "drop",
|
|
options: {
|
|
accept: "*",
|
|
addClasses: true,
|
|
greedy: false,
|
|
scope: "default",
|
|
tolerance: "intersect",
|
|
|
|
// Callbacks
|
|
activate: null,
|
|
deactivate: null,
|
|
drop: null,
|
|
out: null,
|
|
over: null
|
|
},
|
|
_create: function () {
|
|
var proportions,
|
|
o = this.options,
|
|
accept = o.accept;
|
|
|
|
this.isover = false;
|
|
this.isout = true;
|
|
|
|
this.accept = $.isFunction(accept) ? accept : function (d) {
|
|
return d.is(accept);
|
|
};
|
|
|
|
this.proportions = function ( /* valueToWrite */) {
|
|
if (arguments.length) {
|
|
// Store the droppable's proportions
|
|
proportions = arguments[0];
|
|
} else {
|
|
// Retrieve or derive the droppable's proportions
|
|
return proportions ?
|
|
proportions :
|
|
proportions = {
|
|
width: this.element[0].offsetWidth,
|
|
height: this.element[0].offsetHeight
|
|
};
|
|
}
|
|
};
|
|
|
|
this._addToManager(o.scope);
|
|
|
|
o.addClasses && this._addClass("ui-droppable");
|
|
},
|
|
|
|
_addToManager: function (scope) {
|
|
// Add the reference and positions to the manager
|
|
$.ui.ddmanager.droppables[scope] = $.ui.ddmanager.droppables[scope] || [];
|
|
$.ui.ddmanager.droppables[scope].push(this);
|
|
},
|
|
|
|
_splice: function (drop) {
|
|
var i = 0;
|
|
for (; i < drop.length; i++) {
|
|
if (drop[i] === this) {
|
|
drop.splice(i, 1);
|
|
}
|
|
}
|
|
},
|
|
|
|
_destroy: function () {
|
|
var drop = $.ui.ddmanager.droppables[this.options.scope];
|
|
|
|
this._splice(drop);
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "accept") {
|
|
this.accept = $.isFunction(value) ? value : function (d) {
|
|
return d.is(value);
|
|
};
|
|
} else if (key === "scope") {
|
|
var drop = $.ui.ddmanager.droppables[this.options.scope];
|
|
|
|
this._splice(drop);
|
|
this._addToManager(value);
|
|
}
|
|
|
|
this._super(key, value);
|
|
},
|
|
|
|
_activate: function (event) {
|
|
var draggable = $.ui.ddmanager.current;
|
|
|
|
this._addActiveClass();
|
|
if (draggable) {
|
|
this._trigger("activate", event, this.ui(draggable));
|
|
}
|
|
},
|
|
|
|
_deactivate: function (event) {
|
|
var draggable = $.ui.ddmanager.current;
|
|
|
|
this._removeActiveClass();
|
|
if (draggable) {
|
|
this._trigger("deactivate", event, this.ui(draggable));
|
|
}
|
|
},
|
|
|
|
_over: function (event) {
|
|
var draggable = $.ui.ddmanager.current;
|
|
|
|
// Bail if draggable and droppable are same element
|
|
if (!draggable || (draggable.currentItem ||
|
|
draggable.element)[0] === this.element[0]) {
|
|
return;
|
|
}
|
|
|
|
if (this.accept.call(this.element[0], (draggable.currentItem ||
|
|
draggable.element))) {
|
|
this._addHoverClass();
|
|
this._trigger("over", event, this.ui(draggable));
|
|
}
|
|
},
|
|
|
|
_out: function (event) {
|
|
var draggable = $.ui.ddmanager.current;
|
|
|
|
// Bail if draggable and droppable are same element
|
|
if (!draggable || (draggable.currentItem ||
|
|
draggable.element)[0] === this.element[0]) {
|
|
return;
|
|
}
|
|
|
|
if (this.accept.call(this.element[0], (draggable.currentItem ||
|
|
draggable.element))) {
|
|
this._removeHoverClass();
|
|
this._trigger("out", event, this.ui(draggable));
|
|
}
|
|
},
|
|
|
|
_drop: function (event, custom) {
|
|
var draggable = custom || $.ui.ddmanager.current,
|
|
childrenIntersection = false;
|
|
|
|
// Bail if draggable and droppable are same element
|
|
if (!draggable || (draggable.currentItem ||
|
|
draggable.element)[0] === this.element[0]) {
|
|
return false;
|
|
}
|
|
|
|
this.element
|
|
.find(":data(ui-droppable)")
|
|
.not(".ui-draggable-dragging")
|
|
.each(function () {
|
|
var inst = $(this).droppable("instance");
|
|
if (
|
|
inst.options.greedy &&
|
|
!inst.options.disabled &&
|
|
inst.options.scope === draggable.options.scope &&
|
|
inst.accept.call(
|
|
inst.element[0], (draggable.currentItem || draggable.element)
|
|
) &&
|
|
intersect(
|
|
draggable,
|
|
$.extend(inst, { offset: inst.element.offset() }),
|
|
inst.options.tolerance, event
|
|
)
|
|
) {
|
|
childrenIntersection = true;
|
|
return false;
|
|
}
|
|
});
|
|
if (childrenIntersection) {
|
|
return false;
|
|
}
|
|
|
|
if (this.accept.call(this.element[0],
|
|
(draggable.currentItem || draggable.element))) {
|
|
this._removeActiveClass();
|
|
this._removeHoverClass();
|
|
|
|
this._trigger("drop", event, this.ui(draggable));
|
|
return this.element;
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
ui: function (c) {
|
|
return {
|
|
draggable: (c.currentItem || c.element),
|
|
helper: c.helper,
|
|
position: c.position,
|
|
offset: c.positionAbs
|
|
};
|
|
},
|
|
|
|
// Extension points just to make backcompat sane and avoid duplicating logic
|
|
// TODO: Remove in 1.13 along with call to it below
|
|
_addHoverClass: function () {
|
|
this._addClass("ui-droppable-hover");
|
|
},
|
|
|
|
_removeHoverClass: function () {
|
|
this._removeClass("ui-droppable-hover");
|
|
},
|
|
|
|
_addActiveClass: function () {
|
|
this._addClass("ui-droppable-active");
|
|
},
|
|
|
|
_removeActiveClass: function () {
|
|
this._removeClass("ui-droppable-active");
|
|
}
|
|
});
|
|
|
|
var intersect = $.ui.intersect = (function () {
|
|
function isOverAxis(x, reference, size) {
|
|
return (x >= reference) && (x < (reference + size));
|
|
}
|
|
|
|
return function (draggable, droppable, toleranceMode, event) {
|
|
if (!droppable.offset) {
|
|
return false;
|
|
}
|
|
|
|
var x1 = (draggable.positionAbs ||
|
|
draggable.position.absolute).left + draggable.margins.left,
|
|
y1 = (draggable.positionAbs ||
|
|
draggable.position.absolute).top + draggable.margins.top,
|
|
x2 = x1 + draggable.helperProportions.width,
|
|
y2 = y1 + draggable.helperProportions.height,
|
|
l = droppable.offset.left,
|
|
t = droppable.offset.top,
|
|
r = l + droppable.proportions().width,
|
|
b = t + droppable.proportions().height;
|
|
|
|
switch (toleranceMode) {
|
|
case "fit":
|
|
return (l <= x1 && x2 <= r && t <= y1 && y2 <= b);
|
|
case "intersect":
|
|
return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half
|
|
x2 - (draggable.helperProportions.width / 2) < r && // Left Half
|
|
t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half
|
|
y2 - (draggable.helperProportions.height / 2) < b); // Top Half
|
|
case "pointer":
|
|
return isOverAxis(event.pageY, t, droppable.proportions().height) &&
|
|
isOverAxis(event.pageX, l, droppable.proportions().width);
|
|
case "touch":
|
|
return (
|
|
(y1 >= t && y1 <= b) || // Top edge touching
|
|
(y2 >= t && y2 <= b) || // Bottom edge touching
|
|
(y1 < t && y2 > b) // Surrounded vertically
|
|
) && (
|
|
(x1 >= l && x1 <= r) || // Left edge touching
|
|
(x2 >= l && x2 <= r) || // Right edge touching
|
|
(x1 < l && x2 > r) // Surrounded horizontally
|
|
);
|
|
default:
|
|
return false;
|
|
}
|
|
};
|
|
})();
|
|
|
|
/*
|
|
This manager tracks offsets of draggables and droppables
|
|
*/
|
|
$.ui.ddmanager = {
|
|
current: null,
|
|
droppables: { "default": [] },
|
|
prepareOffsets: function (t, event) {
|
|
var i, j,
|
|
m = $.ui.ddmanager.droppables[t.options.scope] || [],
|
|
type = event ? event.type : null, // workaround for #2317
|
|
list = (t.currentItem || t.element).find(":data(ui-droppable)").addBack();
|
|
|
|
droppablesLoop: for (i = 0; i < m.length; i++) {
|
|
// No disabled and non-accepted
|
|
if (m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],
|
|
(t.currentItem || t.element)))) {
|
|
continue;
|
|
}
|
|
|
|
// Filter out elements in the current dragged item
|
|
for (j = 0; j < list.length; j++) {
|
|
if (list[j] === m[i].element[0]) {
|
|
m[i].proportions().height = 0;
|
|
continue droppablesLoop;
|
|
}
|
|
}
|
|
|
|
m[i].visible = m[i].element.css("display") !== "none";
|
|
if (!m[i].visible) {
|
|
continue;
|
|
}
|
|
|
|
// Activate the droppable if used directly from draggables
|
|
if (type === "mousedown") {
|
|
m[i]._activate.call(m[i], event);
|
|
}
|
|
|
|
m[i].offset = m[i].element.offset();
|
|
m[i].proportions({
|
|
width: m[i].element[0].offsetWidth,
|
|
height: m[i].element[0].offsetHeight
|
|
});
|
|
}
|
|
},
|
|
drop: function (draggable, event) {
|
|
var dropped = false;
|
|
|
|
// Create a copy of the droppables in case the list changes during the drop (#9116)
|
|
$.each(($.ui.ddmanager.droppables[draggable.options.scope] || []).slice(), function () {
|
|
if (!this.options) {
|
|
return;
|
|
}
|
|
if (!this.options.disabled && this.visible &&
|
|
intersect(draggable, this, this.options.tolerance, event)) {
|
|
dropped = this._drop.call(this, event) || dropped;
|
|
}
|
|
|
|
if (!this.options.disabled && this.visible && this.accept.call(this.element[0],
|
|
(draggable.currentItem || draggable.element))) {
|
|
this.isout = true;
|
|
this.isover = false;
|
|
this._deactivate.call(this, event);
|
|
}
|
|
});
|
|
return dropped;
|
|
},
|
|
dragStart: function (draggable, event) {
|
|
// Listen for scrolling so that if the dragging causes scrolling the position of the
|
|
// droppables can be recalculated (see #5003)
|
|
draggable.element.parentsUntil("body").on("scroll.droppable", function () {
|
|
if (!draggable.options.refreshPositions) {
|
|
$.ui.ddmanager.prepareOffsets(draggable, event);
|
|
}
|
|
});
|
|
},
|
|
drag: function (draggable, event) {
|
|
// If you have a highly dynamic page, you might try this option. It renders positions
|
|
// every time you move the mouse.
|
|
if (draggable.options.refreshPositions) {
|
|
$.ui.ddmanager.prepareOffsets(draggable, event);
|
|
}
|
|
|
|
// Run through all droppables and check their positions based on specific tolerance options
|
|
$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function () {
|
|
if (this.options.disabled || this.greedyChild || !this.visible) {
|
|
return;
|
|
}
|
|
|
|
var parentInstance, scope, parent,
|
|
intersects = intersect(draggable, this, this.options.tolerance, event),
|
|
c = !intersects && this.isover ?
|
|
"isout" :
|
|
(intersects && !this.isover ? "isover" : null);
|
|
if (!c) {
|
|
return;
|
|
}
|
|
|
|
if (this.options.greedy) {
|
|
// find droppable parents with same scope
|
|
scope = this.options.scope;
|
|
parent = this.element.parents(":data(ui-droppable)").filter(function () {
|
|
return $(this).droppable("instance").options.scope === scope;
|
|
});
|
|
|
|
if (parent.length) {
|
|
parentInstance = $(parent[0]).droppable("instance");
|
|
parentInstance.greedyChild = (c === "isover");
|
|
}
|
|
}
|
|
|
|
// We just moved into a greedy child
|
|
if (parentInstance && c === "isover") {
|
|
parentInstance.isover = false;
|
|
parentInstance.isout = true;
|
|
parentInstance._out.call(parentInstance, event);
|
|
}
|
|
|
|
this[c] = true;
|
|
this[c === "isout" ? "isover" : "isout"] = false;
|
|
this[c === "isover" ? "_over" : "_out"].call(this, event);
|
|
|
|
// We just moved out of a greedy child
|
|
if (parentInstance && c === "isout") {
|
|
parentInstance.isout = false;
|
|
parentInstance.isover = true;
|
|
parentInstance._over.call(parentInstance, event);
|
|
}
|
|
});
|
|
},
|
|
dragStop: function (draggable, event) {
|
|
draggable.element.parentsUntil("body").off("scroll.droppable");
|
|
|
|
// Call prepareOffsets one final time since IE does not fire return scroll events when
|
|
// overflow was caused by drag (see #5003)
|
|
if (!draggable.options.refreshPositions) {
|
|
$.ui.ddmanager.prepareOffsets(draggable, event);
|
|
}
|
|
}
|
|
};
|
|
|
|
// DEPRECATED
|
|
// TODO: switch return back to widget declaration at top of file when this is removed
|
|
if ($.uiBackCompat !== false) {
|
|
// Backcompat for activeClass and hoverClass options
|
|
$.widget("ui.droppable", $.ui.droppable, {
|
|
options: {
|
|
hoverClass: false,
|
|
activeClass: false
|
|
},
|
|
_addActiveClass: function () {
|
|
this._super();
|
|
if (this.options.activeClass) {
|
|
this.element.addClass(this.options.activeClass);
|
|
}
|
|
},
|
|
_removeActiveClass: function () {
|
|
this._super();
|
|
if (this.options.activeClass) {
|
|
this.element.removeClass(this.options.activeClass);
|
|
}
|
|
},
|
|
_addHoverClass: function () {
|
|
this._super();
|
|
if (this.options.hoverClass) {
|
|
this.element.addClass(this.options.hoverClass);
|
|
}
|
|
},
|
|
_removeHoverClass: function () {
|
|
this._super();
|
|
if (this.options.hoverClass) {
|
|
this.element.removeClass(this.options.hoverClass);
|
|
}
|
|
}
|
|
});
|
|
}
|
|
|
|
var widgetsDroppable = $.ui.droppable;
|
|
|
|
/*!
|
|
* jQuery UI Progressbar 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Progressbar
|
|
//>>group: Widgets
|
|
// jscs:disable maximumLineLength
|
|
//>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators.
|
|
// jscs:enable maximumLineLength
|
|
//>>docs: http://api.jqueryui.com/progressbar/
|
|
//>>demos: http://jqueryui.com/progressbar/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/progressbar.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
var widgetsProgressbar = $.widget("ui.progressbar", {
|
|
version: "1.12.1",
|
|
options: {
|
|
classes: {
|
|
"ui-progressbar": "ui-corner-all",
|
|
"ui-progressbar-value": "ui-corner-left",
|
|
"ui-progressbar-complete": "ui-corner-right"
|
|
},
|
|
max: 100,
|
|
value: 0,
|
|
|
|
change: null,
|
|
complete: null
|
|
},
|
|
|
|
min: 0,
|
|
|
|
_create: function () {
|
|
// Constrain initial value
|
|
this.oldValue = this.options.value = this._constrainedValue();
|
|
|
|
this.element.attr({
|
|
// Only set static values; aria-valuenow and aria-valuemax are
|
|
// set inside _refreshValue()
|
|
role: "progressbar",
|
|
"aria-valuemin": this.min
|
|
});
|
|
this._addClass("ui-progressbar", "ui-widget ui-widget-content");
|
|
|
|
this.valueDiv = $("<div>").appendTo(this.element);
|
|
this._addClass(this.valueDiv, "ui-progressbar-value", "ui-widget-header");
|
|
this._refreshValue();
|
|
},
|
|
|
|
_destroy: function () {
|
|
this.element.removeAttr("role aria-valuemin aria-valuemax aria-valuenow");
|
|
|
|
this.valueDiv.remove();
|
|
},
|
|
|
|
value: function (newValue) {
|
|
if (newValue === undefined) {
|
|
return this.options.value;
|
|
}
|
|
|
|
this.options.value = this._constrainedValue(newValue);
|
|
this._refreshValue();
|
|
},
|
|
|
|
_constrainedValue: function (newValue) {
|
|
if (newValue === undefined) {
|
|
newValue = this.options.value;
|
|
}
|
|
|
|
this.indeterminate = newValue === false;
|
|
|
|
// Sanitize value
|
|
if (typeof newValue !== "number") {
|
|
newValue = 0;
|
|
}
|
|
|
|
return this.indeterminate ? false :
|
|
Math.min(this.options.max, Math.max(this.min, newValue));
|
|
},
|
|
|
|
_setOptions: function (options) {
|
|
// Ensure "value" option is set after other values (like max)
|
|
var value = options.value;
|
|
delete options.value;
|
|
|
|
this._super(options);
|
|
|
|
this.options.value = this._constrainedValue(value);
|
|
this._refreshValue();
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "max") {
|
|
// Don't allow a max less than min
|
|
value = Math.max(this.min, value);
|
|
}
|
|
this._super(key, value);
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this._super(value);
|
|
|
|
this.element.attr("aria-disabled", value);
|
|
this._toggleClass(null, "ui-state-disabled", !!value);
|
|
},
|
|
|
|
_percentage: function () {
|
|
return this.indeterminate ?
|
|
100 :
|
|
100 * (this.options.value - this.min) / (this.options.max - this.min);
|
|
},
|
|
|
|
_refreshValue: function () {
|
|
var value = this.options.value,
|
|
percentage = this._percentage();
|
|
|
|
this.valueDiv
|
|
.toggle(this.indeterminate || value > this.min)
|
|
.width(percentage.toFixed(0) + "%");
|
|
|
|
this
|
|
._toggleClass(this.valueDiv, "ui-progressbar-complete", null,
|
|
value === this.options.max)
|
|
._toggleClass("ui-progressbar-indeterminate", null, this.indeterminate);
|
|
|
|
if (this.indeterminate) {
|
|
this.element.removeAttr("aria-valuenow");
|
|
if (!this.overlayDiv) {
|
|
this.overlayDiv = $("<div>").appendTo(this.valueDiv);
|
|
this._addClass(this.overlayDiv, "ui-progressbar-overlay");
|
|
}
|
|
} else {
|
|
this.element.attr({
|
|
"aria-valuemax": this.options.max,
|
|
"aria-valuenow": value
|
|
});
|
|
if (this.overlayDiv) {
|
|
this.overlayDiv.remove();
|
|
this.overlayDiv = null;
|
|
}
|
|
}
|
|
|
|
if (this.oldValue !== value) {
|
|
this.oldValue = value;
|
|
this._trigger("change");
|
|
}
|
|
if (value === this.options.max) {
|
|
this._trigger("complete");
|
|
}
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Selectable 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Selectable
|
|
//>>group: Interactions
|
|
//>>description: Allows groups of elements to be selected with the mouse.
|
|
//>>docs: http://api.jqueryui.com/selectable/
|
|
//>>demos: http://jqueryui.com/selectable/
|
|
//>>css.structure: ../../themes/base/selectable.css
|
|
|
|
var widgetsSelectable = $.widget("ui.selectable", $.ui.mouse, {
|
|
version: "1.12.1",
|
|
options: {
|
|
appendTo: "body",
|
|
autoRefresh: true,
|
|
distance: 0,
|
|
filter: "*",
|
|
tolerance: "touch",
|
|
|
|
// Callbacks
|
|
selected: null,
|
|
selecting: null,
|
|
start: null,
|
|
stop: null,
|
|
unselected: null,
|
|
unselecting: null
|
|
},
|
|
_create: function () {
|
|
var that = this;
|
|
|
|
this._addClass("ui-selectable");
|
|
|
|
this.dragged = false;
|
|
|
|
// Cache selectee children based on filter
|
|
this.refresh = function () {
|
|
that.elementPos = $(that.element[0]).offset();
|
|
that.selectees = $(that.options.filter, that.element[0]);
|
|
that._addClass(that.selectees, "ui-selectee");
|
|
that.selectees.each(function () {
|
|
var $this = $(this),
|
|
selecteeOffset = $this.offset(),
|
|
pos = {
|
|
left: selecteeOffset.left - that.elementPos.left,
|
|
top: selecteeOffset.top - that.elementPos.top
|
|
};
|
|
$.data(this, "selectable-item", {
|
|
element: this,
|
|
$element: $this,
|
|
left: pos.left,
|
|
top: pos.top,
|
|
right: pos.left + $this.outerWidth(),
|
|
bottom: pos.top + $this.outerHeight(),
|
|
startselected: false,
|
|
selected: $this.hasClass("ui-selected"),
|
|
selecting: $this.hasClass("ui-selecting"),
|
|
unselecting: $this.hasClass("ui-unselecting")
|
|
});
|
|
});
|
|
};
|
|
this.refresh();
|
|
|
|
this._mouseInit();
|
|
|
|
this.helper = $("<div>");
|
|
this._addClass(this.helper, "ui-selectable-helper");
|
|
},
|
|
|
|
_destroy: function () {
|
|
this.selectees.removeData("selectable-item");
|
|
this._mouseDestroy();
|
|
},
|
|
|
|
_mouseStart: function (event) {
|
|
var that = this,
|
|
options = this.options;
|
|
|
|
this.opos = [event.pageX, event.pageY];
|
|
this.elementPos = $(this.element[0]).offset();
|
|
|
|
if (this.options.disabled) {
|
|
return;
|
|
}
|
|
|
|
this.selectees = $(options.filter, this.element[0]);
|
|
|
|
this._trigger("start", event);
|
|
|
|
$(options.appendTo).append(this.helper);
|
|
|
|
// position helper (lasso)
|
|
this.helper.css({
|
|
"left": event.pageX,
|
|
"top": event.pageY,
|
|
"width": 0,
|
|
"height": 0
|
|
});
|
|
|
|
if (options.autoRefresh) {
|
|
this.refresh();
|
|
}
|
|
|
|
this.selectees.filter(".ui-selected").each(function () {
|
|
var selectee = $.data(this, "selectable-item");
|
|
selectee.startselected = true;
|
|
if (!event.metaKey && !event.ctrlKey) {
|
|
that._removeClass(selectee.$element, "ui-selected");
|
|
selectee.selected = false;
|
|
that._addClass(selectee.$element, "ui-unselecting");
|
|
selectee.unselecting = true;
|
|
|
|
// selectable UNSELECTING callback
|
|
that._trigger("unselecting", event, {
|
|
unselecting: selectee.element
|
|
});
|
|
}
|
|
});
|
|
|
|
$(event.target).parents().addBack().each(function () {
|
|
var doSelect,
|
|
selectee = $.data(this, "selectable-item");
|
|
if (selectee) {
|
|
doSelect = (!event.metaKey && !event.ctrlKey) ||
|
|
!selectee.$element.hasClass("ui-selected");
|
|
that._removeClass(selectee.$element, doSelect ? "ui-unselecting" : "ui-selected")
|
|
._addClass(selectee.$element, doSelect ? "ui-selecting" : "ui-unselecting");
|
|
selectee.unselecting = !doSelect;
|
|
selectee.selecting = doSelect;
|
|
selectee.selected = doSelect;
|
|
|
|
// selectable (UN)SELECTING callback
|
|
if (doSelect) {
|
|
that._trigger("selecting", event, {
|
|
selecting: selectee.element
|
|
});
|
|
} else {
|
|
that._trigger("unselecting", event, {
|
|
unselecting: selectee.element
|
|
});
|
|
}
|
|
return false;
|
|
}
|
|
});
|
|
},
|
|
|
|
_mouseDrag: function (event) {
|
|
this.dragged = true;
|
|
|
|
if (this.options.disabled) {
|
|
return;
|
|
}
|
|
|
|
var tmp,
|
|
that = this,
|
|
options = this.options,
|
|
x1 = this.opos[0],
|
|
y1 = this.opos[1],
|
|
x2 = event.pageX,
|
|
y2 = event.pageY;
|
|
|
|
if (x1 > x2) { tmp = x2; x2 = x1; x1 = tmp; }
|
|
if (y1 > y2) { tmp = y2; y2 = y1; y1 = tmp; }
|
|
this.helper.css({ left: x1, top: y1, width: x2 - x1, height: y2 - y1 });
|
|
|
|
this.selectees.each(function () {
|
|
var selectee = $.data(this, "selectable-item"),
|
|
hit = false,
|
|
offset = {};
|
|
|
|
//prevent helper from being selected if appendTo: selectable
|
|
if (!selectee || selectee.element === that.element[0]) {
|
|
return;
|
|
}
|
|
|
|
offset.left = selectee.left + that.elementPos.left;
|
|
offset.right = selectee.right + that.elementPos.left;
|
|
offset.top = selectee.top + that.elementPos.top;
|
|
offset.bottom = selectee.bottom + that.elementPos.top;
|
|
|
|
if (options.tolerance === "touch") {
|
|
hit = (!(offset.left > x2 || offset.right < x1 || offset.top > y2 ||
|
|
offset.bottom < y1));
|
|
} else if (options.tolerance === "fit") {
|
|
hit = (offset.left > x1 && offset.right < x2 && offset.top > y1 &&
|
|
offset.bottom < y2);
|
|
}
|
|
|
|
if (hit) {
|
|
// SELECT
|
|
if (selectee.selected) {
|
|
that._removeClass(selectee.$element, "ui-selected");
|
|
selectee.selected = false;
|
|
}
|
|
if (selectee.unselecting) {
|
|
that._removeClass(selectee.$element, "ui-unselecting");
|
|
selectee.unselecting = false;
|
|
}
|
|
if (!selectee.selecting) {
|
|
that._addClass(selectee.$element, "ui-selecting");
|
|
selectee.selecting = true;
|
|
|
|
// selectable SELECTING callback
|
|
that._trigger("selecting", event, {
|
|
selecting: selectee.element
|
|
});
|
|
}
|
|
} else {
|
|
// UNSELECT
|
|
if (selectee.selecting) {
|
|
if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
|
|
that._removeClass(selectee.$element, "ui-selecting");
|
|
selectee.selecting = false;
|
|
that._addClass(selectee.$element, "ui-selected");
|
|
selectee.selected = true;
|
|
} else {
|
|
that._removeClass(selectee.$element, "ui-selecting");
|
|
selectee.selecting = false;
|
|
if (selectee.startselected) {
|
|
that._addClass(selectee.$element, "ui-unselecting");
|
|
selectee.unselecting = true;
|
|
}
|
|
|
|
// selectable UNSELECTING callback
|
|
that._trigger("unselecting", event, {
|
|
unselecting: selectee.element
|
|
});
|
|
}
|
|
}
|
|
if (selectee.selected) {
|
|
if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
|
|
that._removeClass(selectee.$element, "ui-selected");
|
|
selectee.selected = false;
|
|
|
|
that._addClass(selectee.$element, "ui-unselecting");
|
|
selectee.unselecting = true;
|
|
|
|
// selectable UNSELECTING callback
|
|
that._trigger("unselecting", event, {
|
|
unselecting: selectee.element
|
|
});
|
|
}
|
|
}
|
|
}
|
|
});
|
|
|
|
return false;
|
|
},
|
|
|
|
_mouseStop: function (event) {
|
|
var that = this;
|
|
|
|
this.dragged = false;
|
|
|
|
$(".ui-unselecting", this.element[0]).each(function () {
|
|
var selectee = $.data(this, "selectable-item");
|
|
that._removeClass(selectee.$element, "ui-unselecting");
|
|
selectee.unselecting = false;
|
|
selectee.startselected = false;
|
|
that._trigger("unselected", event, {
|
|
unselected: selectee.element
|
|
});
|
|
});
|
|
$(".ui-selecting", this.element[0]).each(function () {
|
|
var selectee = $.data(this, "selectable-item");
|
|
that._removeClass(selectee.$element, "ui-selecting")
|
|
._addClass(selectee.$element, "ui-selected");
|
|
selectee.selecting = false;
|
|
selectee.selected = true;
|
|
selectee.startselected = true;
|
|
that._trigger("selected", event, {
|
|
selected: selectee.element
|
|
});
|
|
});
|
|
this._trigger("stop", event);
|
|
|
|
this.helper.remove();
|
|
|
|
return false;
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Selectmenu 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Selectmenu
|
|
//>>group: Widgets
|
|
// jscs:disable maximumLineLength
|
|
//>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select.
|
|
// jscs:enable maximumLineLength
|
|
//>>docs: http://api.jqueryui.com/selectmenu/
|
|
//>>demos: http://jqueryui.com/selectmenu/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
var widgetsSelectmenu = $.widget("ui.selectmenu", [$.ui.formResetMixin, {
|
|
version: "1.12.1",
|
|
defaultElement: "<select>",
|
|
options: {
|
|
appendTo: null,
|
|
classes: {
|
|
"ui-selectmenu-button-open": "ui-corner-top",
|
|
"ui-selectmenu-button-closed": "ui-corner-all"
|
|
},
|
|
disabled: null,
|
|
icons: {
|
|
button: "ui-icon-triangle-1-s"
|
|
},
|
|
position: {
|
|
my: "left top",
|
|
at: "left bottom",
|
|
collision: "none"
|
|
},
|
|
width: false,
|
|
|
|
// Callbacks
|
|
change: null,
|
|
close: null,
|
|
focus: null,
|
|
open: null,
|
|
select: null
|
|
},
|
|
|
|
_create: function () {
|
|
var selectmenuId = this.element.uniqueId().attr("id");
|
|
this.ids = {
|
|
element: selectmenuId,
|
|
button: selectmenuId + "-button",
|
|
menu: selectmenuId + "-menu"
|
|
};
|
|
|
|
this._drawButton();
|
|
this._drawMenu();
|
|
this._bindFormResetHandler();
|
|
|
|
this._rendered = false;
|
|
this.menuItems = $();
|
|
},
|
|
|
|
_drawButton: function () {
|
|
var icon,
|
|
that = this,
|
|
item = this._parseOption(
|
|
this.element.find("option:selected"),
|
|
this.element[0].selectedIndex
|
|
);
|
|
|
|
// Associate existing label with the new button
|
|
this.labels = this.element.labels().attr("for", this.ids.button);
|
|
this._on(this.labels, {
|
|
click: function (event) {
|
|
this.button.focus();
|
|
event.preventDefault();
|
|
}
|
|
});
|
|
|
|
// Hide original select element
|
|
this.element.hide();
|
|
|
|
// Create button
|
|
this.button = $("<span>", {
|
|
tabindex: this.options.disabled ? -1 : 0,
|
|
id: this.ids.button,
|
|
role: "combobox",
|
|
"aria-expanded": "false",
|
|
"aria-autocomplete": "list",
|
|
"aria-owns": this.ids.menu,
|
|
"aria-haspopup": "true",
|
|
title: this.element.attr("title")
|
|
})
|
|
.insertAfter(this.element);
|
|
|
|
this._addClass(this.button, "ui-selectmenu-button ui-selectmenu-button-closed",
|
|
"ui-button ui-widget");
|
|
|
|
icon = $("<span>").appendTo(this.button);
|
|
this._addClass(icon, "ui-selectmenu-icon", "ui-icon " + this.options.icons.button);
|
|
this.buttonItem = this._renderButtonItem(item)
|
|
.appendTo(this.button);
|
|
|
|
if (this.options.width !== false) {
|
|
this._resizeButton();
|
|
}
|
|
|
|
this._on(this.button, this._buttonEvents);
|
|
this.button.one("focusin", function () {
|
|
// Delay rendering the menu items until the button receives focus.
|
|
// The menu may have already been rendered via a programmatic open.
|
|
if (!that._rendered) {
|
|
that._refreshMenu();
|
|
}
|
|
});
|
|
},
|
|
|
|
_drawMenu: function () {
|
|
var that = this;
|
|
|
|
// Create menu
|
|
this.menu = $("<ul>", {
|
|
"aria-hidden": "true",
|
|
"aria-labelledby": this.ids.button,
|
|
id: this.ids.menu
|
|
});
|
|
|
|
// Wrap menu
|
|
this.menuWrap = $("<div>").append(this.menu);
|
|
this._addClass(this.menuWrap, "ui-selectmenu-menu", "ui-front");
|
|
this.menuWrap.appendTo(this._appendTo());
|
|
|
|
// Initialize menu widget
|
|
this.menuInstance = this.menu
|
|
.menu({
|
|
classes: {
|
|
"ui-menu": "ui-corner-bottom"
|
|
},
|
|
role: "listbox",
|
|
select: function (event, ui) {
|
|
event.preventDefault();
|
|
|
|
// Support: IE8
|
|
// If the item was selected via a click, the text selection
|
|
// will be destroyed in IE
|
|
that._setSelection();
|
|
|
|
that._select(ui.item.data("ui-selectmenu-item"), event);
|
|
},
|
|
focus: function (event, ui) {
|
|
var item = ui.item.data("ui-selectmenu-item");
|
|
|
|
// Prevent inital focus from firing and check if its a newly focused item
|
|
if (that.focusIndex != null && item.index !== that.focusIndex) {
|
|
that._trigger("focus", event, { item: item });
|
|
if (!that.isOpen) {
|
|
that._select(item, event);
|
|
}
|
|
}
|
|
that.focusIndex = item.index;
|
|
|
|
that.button.attr("aria-activedescendant",
|
|
that.menuItems.eq(item.index).attr("id"));
|
|
}
|
|
})
|
|
.menu("instance");
|
|
|
|
// Don't close the menu on mouseleave
|
|
this.menuInstance._off(this.menu, "mouseleave");
|
|
|
|
// Cancel the menu's collapseAll on document click
|
|
this.menuInstance._closeOnDocumentClick = function () {
|
|
return false;
|
|
};
|
|
|
|
// Selects often contain empty items, but never contain dividers
|
|
this.menuInstance._isDivider = function () {
|
|
return false;
|
|
};
|
|
},
|
|
|
|
refresh: function () {
|
|
this._refreshMenu();
|
|
this.buttonItem.replaceWith(
|
|
this.buttonItem = this._renderButtonItem(
|
|
|
|
// Fall back to an empty object in case there are no options
|
|
this._getSelectedItem().data("ui-selectmenu-item") || {}
|
|
)
|
|
);
|
|
if (this.options.width === null) {
|
|
this._resizeButton();
|
|
}
|
|
},
|
|
|
|
_refreshMenu: function () {
|
|
var item,
|
|
options = this.element.find("option");
|
|
|
|
this.menu.empty();
|
|
|
|
this._parseOptions(options);
|
|
this._renderMenu(this.menu, this.items);
|
|
|
|
this.menuInstance.refresh();
|
|
this.menuItems = this.menu.find("li")
|
|
.not(".ui-selectmenu-optgroup")
|
|
.find(".ui-menu-item-wrapper");
|
|
|
|
this._rendered = true;
|
|
|
|
if (!options.length) {
|
|
return;
|
|
}
|
|
|
|
item = this._getSelectedItem();
|
|
|
|
// Update the menu to have the correct item focused
|
|
this.menuInstance.focus(null, item);
|
|
this._setAria(item.data("ui-selectmenu-item"));
|
|
|
|
// Set disabled state
|
|
this._setOption("disabled", this.element.prop("disabled"));
|
|
},
|
|
|
|
open: function (event) {
|
|
if (this.options.disabled) {
|
|
return;
|
|
}
|
|
|
|
// If this is the first time the menu is being opened, render the items
|
|
if (!this._rendered) {
|
|
this._refreshMenu();
|
|
} else {
|
|
// Menu clears focus on close, reset focus to selected item
|
|
this._removeClass(this.menu.find(".ui-state-active"), null, "ui-state-active");
|
|
this.menuInstance.focus(null, this._getSelectedItem());
|
|
}
|
|
|
|
// If there are no options, don't open the menu
|
|
if (!this.menuItems.length) {
|
|
return;
|
|
}
|
|
|
|
this.isOpen = true;
|
|
this._toggleAttr();
|
|
this._resizeMenu();
|
|
this._position();
|
|
|
|
this._on(this.document, this._documentClick);
|
|
|
|
this._trigger("open", event);
|
|
},
|
|
|
|
_position: function () {
|
|
this.menuWrap.position($.extend({ of: this.button }, this.options.position));
|
|
},
|
|
|
|
close: function (event) {
|
|
if (!this.isOpen) {
|
|
return;
|
|
}
|
|
|
|
this.isOpen = false;
|
|
this._toggleAttr();
|
|
|
|
this.range = null;
|
|
this._off(this.document);
|
|
|
|
this._trigger("close", event);
|
|
},
|
|
|
|
widget: function () {
|
|
return this.button;
|
|
},
|
|
|
|
menuWidget: function () {
|
|
return this.menu;
|
|
},
|
|
|
|
_renderButtonItem: function (item) {
|
|
var buttonItem = $("<span>");
|
|
|
|
this._setText(buttonItem, item.label);
|
|
this._addClass(buttonItem, "ui-selectmenu-text");
|
|
|
|
return buttonItem;
|
|
},
|
|
|
|
_renderMenu: function (ul, items) {
|
|
var that = this,
|
|
currentOptgroup = "";
|
|
|
|
$.each(items, function (index, item) {
|
|
var li;
|
|
|
|
if (item.optgroup !== currentOptgroup) {
|
|
li = $("<li>", {
|
|
text: item.optgroup
|
|
});
|
|
that._addClass(li, "ui-selectmenu-optgroup", "ui-menu-divider" +
|
|
(item.element.parent("optgroup").prop("disabled") ?
|
|
" ui-state-disabled" :
|
|
""));
|
|
|
|
li.appendTo(ul);
|
|
|
|
currentOptgroup = item.optgroup;
|
|
}
|
|
|
|
that._renderItemData(ul, item);
|
|
});
|
|
},
|
|
|
|
_renderItemData: function (ul, item) {
|
|
return this._renderItem(ul, item).data("ui-selectmenu-item", item);
|
|
},
|
|
|
|
_renderItem: function (ul, item) {
|
|
var li = $("<li>"),
|
|
wrapper = $("<div>", {
|
|
title: item.element.attr("title")
|
|
});
|
|
|
|
if (item.disabled) {
|
|
this._addClass(li, null, "ui-state-disabled");
|
|
}
|
|
this._setText(wrapper, item.label);
|
|
|
|
return li.append(wrapper).appendTo(ul);
|
|
},
|
|
|
|
_setText: function (element, value) {
|
|
if (value) {
|
|
element.text(value);
|
|
} else {
|
|
element.html(" ");
|
|
}
|
|
},
|
|
|
|
_move: function (direction, event) {
|
|
var item, next,
|
|
filter = ".ui-menu-item";
|
|
|
|
if (this.isOpen) {
|
|
item = this.menuItems.eq(this.focusIndex).parent("li");
|
|
} else {
|
|
item = this.menuItems.eq(this.element[0].selectedIndex).parent("li");
|
|
filter += ":not(.ui-state-disabled)";
|
|
}
|
|
|
|
if (direction === "first" || direction === "last") {
|
|
next = item[direction === "first" ? "prevAll" : "nextAll"](filter).eq(-1);
|
|
} else {
|
|
next = item[direction + "All"](filter).eq(0);
|
|
}
|
|
|
|
if (next.length) {
|
|
this.menuInstance.focus(event, next);
|
|
}
|
|
},
|
|
|
|
_getSelectedItem: function () {
|
|
return this.menuItems.eq(this.element[0].selectedIndex).parent("li");
|
|
},
|
|
|
|
_toggle: function (event) {
|
|
this[this.isOpen ? "close" : "open"](event);
|
|
},
|
|
|
|
_setSelection: function () {
|
|
var selection;
|
|
|
|
if (!this.range) {
|
|
return;
|
|
}
|
|
|
|
if (window.getSelection) {
|
|
selection = window.getSelection();
|
|
selection.removeAllRanges();
|
|
selection.addRange(this.range);
|
|
|
|
// Support: IE8
|
|
} else {
|
|
this.range.select();
|
|
}
|
|
|
|
// Support: IE
|
|
// Setting the text selection kills the button focus in IE, but
|
|
// restoring the focus doesn't kill the selection.
|
|
this.button.focus();
|
|
},
|
|
|
|
_documentClick: {
|
|
mousedown: function (event) {
|
|
if (!this.isOpen) {
|
|
return;
|
|
}
|
|
|
|
if (!$(event.target).closest(".ui-selectmenu-menu, #" +
|
|
$.ui.escapeSelector(this.ids.button)).length) {
|
|
this.close(event);
|
|
}
|
|
}
|
|
},
|
|
|
|
_buttonEvents: {
|
|
// Prevent text selection from being reset when interacting with the selectmenu (#10144)
|
|
mousedown: function () {
|
|
var selection;
|
|
|
|
if (window.getSelection) {
|
|
selection = window.getSelection();
|
|
if (selection.rangeCount) {
|
|
this.range = selection.getRangeAt(0);
|
|
}
|
|
|
|
// Support: IE8
|
|
} else {
|
|
this.range = document.selection.createRange();
|
|
}
|
|
},
|
|
|
|
click: function (event) {
|
|
this._setSelection();
|
|
this._toggle(event);
|
|
},
|
|
|
|
keydown: function (event) {
|
|
var preventDefault = true;
|
|
switch (event.keyCode) {
|
|
case $.ui.keyCode.TAB:
|
|
case $.ui.keyCode.ESCAPE:
|
|
this.close(event);
|
|
preventDefault = false;
|
|
break;
|
|
case $.ui.keyCode.ENTER:
|
|
if (this.isOpen) {
|
|
this._selectFocusedItem(event);
|
|
}
|
|
break;
|
|
case $.ui.keyCode.UP:
|
|
if (event.altKey) {
|
|
this._toggle(event);
|
|
} else {
|
|
this._move("prev", event);
|
|
}
|
|
break;
|
|
case $.ui.keyCode.DOWN:
|
|
if (event.altKey) {
|
|
this._toggle(event);
|
|
} else {
|
|
this._move("next", event);
|
|
}
|
|
break;
|
|
case $.ui.keyCode.SPACE:
|
|
if (this.isOpen) {
|
|
this._selectFocusedItem(event);
|
|
} else {
|
|
this._toggle(event);
|
|
}
|
|
break;
|
|
case $.ui.keyCode.LEFT:
|
|
this._move("prev", event);
|
|
break;
|
|
case $.ui.keyCode.RIGHT:
|
|
this._move("next", event);
|
|
break;
|
|
case $.ui.keyCode.HOME:
|
|
case $.ui.keyCode.PAGE_UP:
|
|
this._move("first", event);
|
|
break;
|
|
case $.ui.keyCode.END:
|
|
case $.ui.keyCode.PAGE_DOWN:
|
|
this._move("last", event);
|
|
break;
|
|
default:
|
|
this.menu.trigger(event);
|
|
preventDefault = false;
|
|
}
|
|
|
|
if (preventDefault) {
|
|
event.preventDefault();
|
|
}
|
|
}
|
|
},
|
|
|
|
_selectFocusedItem: function (event) {
|
|
var item = this.menuItems.eq(this.focusIndex).parent("li");
|
|
if (!item.hasClass("ui-state-disabled")) {
|
|
this._select(item.data("ui-selectmenu-item"), event);
|
|
}
|
|
},
|
|
|
|
_select: function (item, event) {
|
|
var oldIndex = this.element[0].selectedIndex;
|
|
|
|
// Change native select element
|
|
this.element[0].selectedIndex = item.index;
|
|
this.buttonItem.replaceWith(this.buttonItem = this._renderButtonItem(item));
|
|
this._setAria(item);
|
|
this._trigger("select", event, { item: item });
|
|
|
|
if (item.index !== oldIndex) {
|
|
this._trigger("change", event, { item: item });
|
|
}
|
|
|
|
this.close(event);
|
|
},
|
|
|
|
_setAria: function (item) {
|
|
var id = this.menuItems.eq(item.index).attr("id");
|
|
|
|
this.button.attr({
|
|
"aria-labelledby": id,
|
|
"aria-activedescendant": id
|
|
});
|
|
this.menu.attr("aria-activedescendant", id);
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "icons") {
|
|
var icon = this.button.find("span.ui-icon");
|
|
this._removeClass(icon, null, this.options.icons.button)
|
|
._addClass(icon, null, value.button);
|
|
}
|
|
|
|
this._super(key, value);
|
|
|
|
if (key === "appendTo") {
|
|
this.menuWrap.appendTo(this._appendTo());
|
|
}
|
|
|
|
if (key === "width") {
|
|
this._resizeButton();
|
|
}
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this._super(value);
|
|
|
|
this.menuInstance.option("disabled", value);
|
|
this.button.attr("aria-disabled", value);
|
|
this._toggleClass(this.button, null, "ui-state-disabled", value);
|
|
|
|
this.element.prop("disabled", value);
|
|
if (value) {
|
|
this.button.attr("tabindex", -1);
|
|
this.close();
|
|
} else {
|
|
this.button.attr("tabindex", 0);
|
|
}
|
|
},
|
|
|
|
_appendTo: function () {
|
|
var element = this.options.appendTo;
|
|
|
|
if (element) {
|
|
element = element.jquery || element.nodeType ?
|
|
$(element) :
|
|
this.document.find(element).eq(0);
|
|
}
|
|
|
|
if (!element || !element[0]) {
|
|
element = this.element.closest(".ui-front, dialog");
|
|
}
|
|
|
|
if (!element.length) {
|
|
element = this.document[0].body;
|
|
}
|
|
|
|
return element;
|
|
},
|
|
|
|
_toggleAttr: function () {
|
|
this.button.attr("aria-expanded", this.isOpen);
|
|
|
|
// We can't use two _toggleClass() calls here, because we need to make sure
|
|
// we always remove classes first and add them second, otherwise if both classes have the
|
|
// same theme class, it will be removed after we add it.
|
|
this._removeClass(this.button, "ui-selectmenu-button-" +
|
|
(this.isOpen ? "closed" : "open"))
|
|
._addClass(this.button, "ui-selectmenu-button-" +
|
|
(this.isOpen ? "open" : "closed"))
|
|
._toggleClass(this.menuWrap, "ui-selectmenu-open", null, this.isOpen);
|
|
|
|
this.menu.attr("aria-hidden", !this.isOpen);
|
|
},
|
|
|
|
_resizeButton: function () {
|
|
var width = this.options.width;
|
|
|
|
// For `width: false`, just remove inline style and stop
|
|
if (width === false) {
|
|
this.button.css("width", "");
|
|
return;
|
|
}
|
|
|
|
// For `width: null`, match the width of the original element
|
|
if (width === null) {
|
|
width = this.element.show().outerWidth();
|
|
this.element.hide();
|
|
}
|
|
|
|
this.button.outerWidth(width);
|
|
},
|
|
|
|
_resizeMenu: function () {
|
|
this.menu.outerWidth(Math.max(
|
|
this.button.outerWidth(),
|
|
|
|
// Support: IE10
|
|
// IE10 wraps long text (possibly a rounding bug)
|
|
// so we add 1px to avoid the wrapping
|
|
this.menu.width("").outerWidth() + 1
|
|
));
|
|
},
|
|
|
|
_getCreateOptions: function () {
|
|
var options = this._super();
|
|
|
|
options.disabled = this.element.prop("disabled");
|
|
|
|
return options;
|
|
},
|
|
|
|
_parseOptions: function (options) {
|
|
var that = this,
|
|
data = [];
|
|
options.each(function (index, item) {
|
|
data.push(that._parseOption($(item), index));
|
|
});
|
|
this.items = data;
|
|
},
|
|
|
|
_parseOption: function (option, index) {
|
|
var optgroup = option.parent("optgroup");
|
|
|
|
return {
|
|
element: option,
|
|
index: index,
|
|
value: option.val(),
|
|
label: option.text(),
|
|
optgroup: optgroup.attr("label") || "",
|
|
disabled: optgroup.prop("disabled") || option.prop("disabled")
|
|
};
|
|
},
|
|
|
|
_destroy: function () {
|
|
this._unbindFormResetHandler();
|
|
this.menuWrap.remove();
|
|
this.button.remove();
|
|
this.element.show();
|
|
this.element.removeUniqueId();
|
|
this.labels.attr("for", this.ids.element);
|
|
}
|
|
}]);
|
|
|
|
/*!
|
|
* jQuery UI Slider 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Slider
|
|
//>>group: Widgets
|
|
//>>description: Displays a flexible slider with ranges and accessibility via keyboard.
|
|
//>>docs: http://api.jqueryui.com/slider/
|
|
//>>demos: http://jqueryui.com/slider/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/slider.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
var widgetsSlider = $.widget("ui.slider", $.ui.mouse, {
|
|
version: "1.12.1",
|
|
widgetEventPrefix: "slide",
|
|
|
|
options: {
|
|
animate: false,
|
|
classes: {
|
|
"ui-slider": "ui-corner-all",
|
|
"ui-slider-handle": "ui-corner-all",
|
|
|
|
// Note: ui-widget-header isn't the most fittingly semantic framework class for this
|
|
// element, but worked best visually with a variety of themes
|
|
"ui-slider-range": "ui-corner-all ui-widget-header"
|
|
},
|
|
distance: 0,
|
|
max: 100,
|
|
min: 0,
|
|
orientation: "horizontal",
|
|
range: false,
|
|
step: 1,
|
|
value: 0,
|
|
values: null,
|
|
|
|
// Callbacks
|
|
change: null,
|
|
slide: null,
|
|
start: null,
|
|
stop: null
|
|
},
|
|
|
|
// Number of pages in a slider
|
|
// (how many times can you page up/down to go through the whole range)
|
|
numPages: 5,
|
|
|
|
_create: function () {
|
|
this._keySliding = false;
|
|
this._mouseSliding = false;
|
|
this._animateOff = true;
|
|
this._handleIndex = null;
|
|
this._detectOrientation();
|
|
this._mouseInit();
|
|
this._calculateNewMax();
|
|
|
|
this._addClass("ui-slider ui-slider-" + this.orientation,
|
|
"ui-widget ui-widget-content");
|
|
|
|
this._refresh();
|
|
|
|
this._animateOff = false;
|
|
},
|
|
|
|
_refresh: function () {
|
|
this._createRange();
|
|
this._createHandles();
|
|
this._setupEvents();
|
|
this._refreshValue();
|
|
},
|
|
|
|
_createHandles: function () {
|
|
var i, handleCount,
|
|
options = this.options,
|
|
existingHandles = this.element.find(".ui-slider-handle"),
|
|
handle = "<span tabindex='0'></span>",
|
|
handles = [];
|
|
|
|
handleCount = (options.values && options.values.length) || 1;
|
|
|
|
if (existingHandles.length > handleCount) {
|
|
existingHandles.slice(handleCount).remove();
|
|
existingHandles = existingHandles.slice(0, handleCount);
|
|
}
|
|
|
|
for (i = existingHandles.length; i < handleCount; i++) {
|
|
handles.push(handle);
|
|
}
|
|
|
|
this.handles = existingHandles.add($(handles.join("")).appendTo(this.element));
|
|
|
|
this._addClass(this.handles, "ui-slider-handle", "ui-state-default");
|
|
|
|
this.handle = this.handles.eq(0);
|
|
|
|
this.handles.each(function (i) {
|
|
$(this)
|
|
.data("ui-slider-handle-index", i)
|
|
.attr("tabIndex", 0);
|
|
});
|
|
},
|
|
|
|
_createRange: function () {
|
|
var options = this.options;
|
|
|
|
if (options.range) {
|
|
if (options.range === true) {
|
|
if (!options.values) {
|
|
options.values = [this._valueMin(), this._valueMin()];
|
|
} else if (options.values.length && options.values.length !== 2) {
|
|
options.values = [options.values[0], options.values[0]];
|
|
} else if ($.isArray(options.values)) {
|
|
options.values = options.values.slice(0);
|
|
}
|
|
}
|
|
|
|
if (!this.range || !this.range.length) {
|
|
this.range = $("<div>")
|
|
.appendTo(this.element);
|
|
|
|
this._addClass(this.range, "ui-slider-range");
|
|
} else {
|
|
this._removeClass(this.range, "ui-slider-range-min ui-slider-range-max");
|
|
|
|
// Handle range switching from true to min/max
|
|
this.range.css({
|
|
"left": "",
|
|
"bottom": ""
|
|
});
|
|
}
|
|
if (options.range === "min" || options.range === "max") {
|
|
this._addClass(this.range, "ui-slider-range-" + options.range);
|
|
}
|
|
} else {
|
|
if (this.range) {
|
|
this.range.remove();
|
|
}
|
|
this.range = null;
|
|
}
|
|
},
|
|
|
|
_setupEvents: function () {
|
|
this._off(this.handles);
|
|
this._on(this.handles, this._handleEvents);
|
|
this._hoverable(this.handles);
|
|
this._focusable(this.handles);
|
|
},
|
|
|
|
_destroy: function () {
|
|
this.handles.remove();
|
|
if (this.range) {
|
|
this.range.remove();
|
|
}
|
|
|
|
this._mouseDestroy();
|
|
},
|
|
|
|
_mouseCapture: function (event) {
|
|
var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
|
|
that = this,
|
|
o = this.options;
|
|
|
|
if (o.disabled) {
|
|
return false;
|
|
}
|
|
|
|
this.elementSize = {
|
|
width: this.element.outerWidth(),
|
|
height: this.element.outerHeight()
|
|
};
|
|
this.elementOffset = this.element.offset();
|
|
|
|
position = { x: event.pageX, y: event.pageY };
|
|
normValue = this._normValueFromMouse(position);
|
|
distance = this._valueMax() - this._valueMin() + 1;
|
|
this.handles.each(function (i) {
|
|
var thisDistance = Math.abs(normValue - that.values(i));
|
|
if ((distance > thisDistance) ||
|
|
(distance === thisDistance &&
|
|
(i === that._lastChangedValue || that.values(i) === o.min))) {
|
|
distance = thisDistance;
|
|
closestHandle = $(this);
|
|
index = i;
|
|
}
|
|
});
|
|
|
|
allowed = this._start(event, index);
|
|
if (allowed === false) {
|
|
return false;
|
|
}
|
|
this._mouseSliding = true;
|
|
|
|
this._handleIndex = index;
|
|
|
|
this._addClass(closestHandle, null, "ui-state-active");
|
|
closestHandle.trigger("focus");
|
|
|
|
offset = closestHandle.offset();
|
|
mouseOverHandle = !$(event.target).parents().addBack().is(".ui-slider-handle");
|
|
this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
|
|
left: event.pageX - offset.left - (closestHandle.width() / 2),
|
|
top: event.pageY - offset.top -
|
|
(closestHandle.height() / 2) -
|
|
(parseInt(closestHandle.css("borderTopWidth"), 10) || 0) -
|
|
(parseInt(closestHandle.css("borderBottomWidth"), 10) || 0) +
|
|
(parseInt(closestHandle.css("marginTop"), 10) || 0)
|
|
};
|
|
|
|
if (!this.handles.hasClass("ui-state-hover")) {
|
|
this._slide(event, index, normValue);
|
|
}
|
|
this._animateOff = true;
|
|
return true;
|
|
},
|
|
|
|
_mouseStart: function () {
|
|
return true;
|
|
},
|
|
|
|
_mouseDrag: function (event) {
|
|
var position = { x: event.pageX, y: event.pageY },
|
|
normValue = this._normValueFromMouse(position);
|
|
|
|
this._slide(event, this._handleIndex, normValue);
|
|
|
|
return false;
|
|
},
|
|
|
|
_mouseStop: function (event) {
|
|
this._removeClass(this.handles, null, "ui-state-active");
|
|
this._mouseSliding = false;
|
|
|
|
this._stop(event, this._handleIndex);
|
|
this._change(event, this._handleIndex);
|
|
|
|
this._handleIndex = null;
|
|
this._clickOffset = null;
|
|
this._animateOff = false;
|
|
|
|
return false;
|
|
},
|
|
|
|
_detectOrientation: function () {
|
|
this.orientation = (this.options.orientation === "vertical") ? "vertical" : "horizontal";
|
|
},
|
|
|
|
_normValueFromMouse: function (position) {
|
|
var pixelTotal,
|
|
pixelMouse,
|
|
percentMouse,
|
|
valueTotal,
|
|
valueMouse;
|
|
|
|
if (this.orientation === "horizontal") {
|
|
pixelTotal = this.elementSize.width;
|
|
pixelMouse = position.x - this.elementOffset.left -
|
|
(this._clickOffset ? this._clickOffset.left : 0);
|
|
} else {
|
|
pixelTotal = this.elementSize.height;
|
|
pixelMouse = position.y - this.elementOffset.top -
|
|
(this._clickOffset ? this._clickOffset.top : 0);
|
|
}
|
|
|
|
percentMouse = (pixelMouse / pixelTotal);
|
|
if (percentMouse > 1) {
|
|
percentMouse = 1;
|
|
}
|
|
if (percentMouse < 0) {
|
|
percentMouse = 0;
|
|
}
|
|
if (this.orientation === "vertical") {
|
|
percentMouse = 1 - percentMouse;
|
|
}
|
|
|
|
valueTotal = this._valueMax() - this._valueMin();
|
|
valueMouse = this._valueMin() + percentMouse * valueTotal;
|
|
|
|
return this._trimAlignValue(valueMouse);
|
|
},
|
|
|
|
_uiHash: function (index, value, values) {
|
|
var uiHash = {
|
|
handle: this.handles[index],
|
|
handleIndex: index,
|
|
value: value !== undefined ? value : this.value()
|
|
};
|
|
|
|
if (this._hasMultipleValues()) {
|
|
uiHash.value = value !== undefined ? value : this.values(index);
|
|
uiHash.values = values || this.values();
|
|
}
|
|
|
|
return uiHash;
|
|
},
|
|
|
|
_hasMultipleValues: function () {
|
|
return this.options.values && this.options.values.length;
|
|
},
|
|
|
|
_start: function (event, index) {
|
|
return this._trigger("start", event, this._uiHash(index));
|
|
},
|
|
|
|
_slide: function (event, index, newVal) {
|
|
var allowed, otherVal,
|
|
currentValue = this.value(),
|
|
newValues = this.values();
|
|
|
|
if (this._hasMultipleValues()) {
|
|
otherVal = this.values(index ? 0 : 1);
|
|
currentValue = this.values(index);
|
|
|
|
if (this.options.values.length === 2 && this.options.range === true) {
|
|
newVal = index === 0 ? Math.min(otherVal, newVal) : Math.max(otherVal, newVal);
|
|
}
|
|
|
|
newValues[index] = newVal;
|
|
}
|
|
|
|
if (newVal === currentValue) {
|
|
return;
|
|
}
|
|
|
|
allowed = this._trigger("slide", event, this._uiHash(index, newVal, newValues));
|
|
|
|
// A slide can be canceled by returning false from the slide callback
|
|
if (allowed === false) {
|
|
return;
|
|
}
|
|
|
|
if (this._hasMultipleValues()) {
|
|
this.values(index, newVal);
|
|
} else {
|
|
this.value(newVal);
|
|
}
|
|
},
|
|
|
|
_stop: function (event, index) {
|
|
this._trigger("stop", event, this._uiHash(index));
|
|
},
|
|
|
|
_change: function (event, index) {
|
|
if (!this._keySliding && !this._mouseSliding) {
|
|
//store the last changed value index for reference when handles overlap
|
|
this._lastChangedValue = index;
|
|
this._trigger("change", event, this._uiHash(index));
|
|
}
|
|
},
|
|
|
|
value: function (newValue) {
|
|
if (arguments.length) {
|
|
this.options.value = this._trimAlignValue(newValue);
|
|
this._refreshValue();
|
|
this._change(null, 0);
|
|
return;
|
|
}
|
|
|
|
return this._value();
|
|
},
|
|
|
|
values: function (index, newValue) {
|
|
var vals,
|
|
newValues,
|
|
i;
|
|
|
|
if (arguments.length > 1) {
|
|
this.options.values[index] = this._trimAlignValue(newValue);
|
|
this._refreshValue();
|
|
this._change(null, index);
|
|
return;
|
|
}
|
|
|
|
if (arguments.length) {
|
|
if ($.isArray(arguments[0])) {
|
|
vals = this.options.values;
|
|
newValues = arguments[0];
|
|
for (i = 0; i < vals.length; i += 1) {
|
|
vals[i] = this._trimAlignValue(newValues[i]);
|
|
this._change(null, i);
|
|
}
|
|
this._refreshValue();
|
|
} else {
|
|
if (this._hasMultipleValues()) {
|
|
return this._values(index);
|
|
} else {
|
|
return this.value();
|
|
}
|
|
}
|
|
} else {
|
|
return this._values();
|
|
}
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
var i,
|
|
valsLength = 0;
|
|
|
|
if (key === "range" && this.options.range === true) {
|
|
if (value === "min") {
|
|
this.options.value = this._values(0);
|
|
this.options.values = null;
|
|
} else if (value === "max") {
|
|
this.options.value = this._values(this.options.values.length - 1);
|
|
this.options.values = null;
|
|
}
|
|
}
|
|
|
|
if ($.isArray(this.options.values)) {
|
|
valsLength = this.options.values.length;
|
|
}
|
|
|
|
this._super(key, value);
|
|
|
|
switch (key) {
|
|
case "orientation":
|
|
this._detectOrientation();
|
|
this._removeClass("ui-slider-horizontal ui-slider-vertical")
|
|
._addClass("ui-slider-" + this.orientation);
|
|
this._refreshValue();
|
|
if (this.options.range) {
|
|
this._refreshRange(value);
|
|
}
|
|
|
|
// Reset positioning from previous orientation
|
|
this.handles.css(value === "horizontal" ? "bottom" : "left", "");
|
|
break;
|
|
case "value":
|
|
this._animateOff = true;
|
|
this._refreshValue();
|
|
this._change(null, 0);
|
|
this._animateOff = false;
|
|
break;
|
|
case "values":
|
|
this._animateOff = true;
|
|
this._refreshValue();
|
|
|
|
// Start from the last handle to prevent unreachable handles (#9046)
|
|
for (i = valsLength - 1; i >= 0; i--) {
|
|
this._change(null, i);
|
|
}
|
|
this._animateOff = false;
|
|
break;
|
|
case "step":
|
|
case "min":
|
|
case "max":
|
|
this._animateOff = true;
|
|
this._calculateNewMax();
|
|
this._refreshValue();
|
|
this._animateOff = false;
|
|
break;
|
|
case "range":
|
|
this._animateOff = true;
|
|
this._refresh();
|
|
this._animateOff = false;
|
|
break;
|
|
}
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this._super(value);
|
|
|
|
this._toggleClass(null, "ui-state-disabled", !!value);
|
|
},
|
|
|
|
//internal value getter
|
|
// _value() returns value trimmed by min and max, aligned by step
|
|
_value: function () {
|
|
var val = this.options.value;
|
|
val = this._trimAlignValue(val);
|
|
|
|
return val;
|
|
},
|
|
|
|
//internal values getter
|
|
// _values() returns array of values trimmed by min and max, aligned by step
|
|
// _values( index ) returns single value trimmed by min and max, aligned by step
|
|
_values: function (index) {
|
|
var val,
|
|
vals,
|
|
i;
|
|
|
|
if (arguments.length) {
|
|
val = this.options.values[index];
|
|
val = this._trimAlignValue(val);
|
|
|
|
return val;
|
|
} else if (this._hasMultipleValues()) {
|
|
// .slice() creates a copy of the array
|
|
// this copy gets trimmed by min and max and then returned
|
|
vals = this.options.values.slice();
|
|
for (i = 0; i < vals.length; i += 1) {
|
|
vals[i] = this._trimAlignValue(vals[i]);
|
|
}
|
|
|
|
return vals;
|
|
} else {
|
|
return [];
|
|
}
|
|
},
|
|
|
|
// Returns the step-aligned value that val is closest to, between (inclusive) min and max
|
|
_trimAlignValue: function (val) {
|
|
if (val <= this._valueMin()) {
|
|
return this._valueMin();
|
|
}
|
|
if (val >= this._valueMax()) {
|
|
return this._valueMax();
|
|
}
|
|
var step = (this.options.step > 0) ? this.options.step : 1,
|
|
valModStep = (val - this._valueMin()) % step,
|
|
alignValue = val - valModStep;
|
|
|
|
if (Math.abs(valModStep) * 2 >= step) {
|
|
alignValue += (valModStep > 0) ? step : (-step);
|
|
}
|
|
|
|
// Since JavaScript has problems with large floats, round
|
|
// the final value to 5 digits after the decimal point (see #4124)
|
|
return parseFloat(alignValue.toFixed(5));
|
|
},
|
|
|
|
_calculateNewMax: function () {
|
|
var max = this.options.max,
|
|
min = this._valueMin(),
|
|
step = this.options.step,
|
|
aboveMin = Math.round((max - min) / step) * step;
|
|
max = aboveMin + min;
|
|
if (max > this.options.max) {
|
|
//If max is not divisible by step, rounding off may increase its value
|
|
max -= step;
|
|
}
|
|
this.max = parseFloat(max.toFixed(this._precision()));
|
|
},
|
|
|
|
_precision: function () {
|
|
var precision = this._precisionOf(this.options.step);
|
|
if (this.options.min !== null) {
|
|
precision = Math.max(precision, this._precisionOf(this.options.min));
|
|
}
|
|
return precision;
|
|
},
|
|
|
|
_precisionOf: function (num) {
|
|
var str = num.toString(),
|
|
decimal = str.indexOf(".");
|
|
return decimal === -1 ? 0 : str.length - decimal - 1;
|
|
},
|
|
|
|
_valueMin: function () {
|
|
return this.options.min;
|
|
},
|
|
|
|
_valueMax: function () {
|
|
return this.max;
|
|
},
|
|
|
|
_refreshRange: function (orientation) {
|
|
if (orientation === "vertical") {
|
|
this.range.css({ "width": "", "left": "" });
|
|
}
|
|
if (orientation === "horizontal") {
|
|
this.range.css({ "height": "", "bottom": "" });
|
|
}
|
|
},
|
|
|
|
_refreshValue: function () {
|
|
var lastValPercent, valPercent, value, valueMin, valueMax,
|
|
oRange = this.options.range,
|
|
o = this.options,
|
|
that = this,
|
|
animate = (!this._animateOff) ? o.animate : false,
|
|
_set = {};
|
|
|
|
if (this._hasMultipleValues()) {
|
|
this.handles.each(function (i) {
|
|
valPercent = (that.values(i) - that._valueMin()) / (that._valueMax() -
|
|
that._valueMin()) * 100;
|
|
_set[that.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%";
|
|
$(this).stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);
|
|
if (that.options.range === true) {
|
|
if (that.orientation === "horizontal") {
|
|
if (i === 0) {
|
|
that.range.stop(1, 1)[animate ? "animate" : "css"]({
|
|
left: valPercent + "%"
|
|
}, o.animate);
|
|
}
|
|
if (i === 1) {
|
|
that.range[animate ? "animate" : "css"]({
|
|
width: (valPercent - lastValPercent) + "%"
|
|
}, {
|
|
queue: false,
|
|
duration: o.animate
|
|
});
|
|
}
|
|
} else {
|
|
if (i === 0) {
|
|
that.range.stop(1, 1)[animate ? "animate" : "css"]({
|
|
bottom: (valPercent) + "%"
|
|
}, o.animate);
|
|
}
|
|
if (i === 1) {
|
|
that.range[animate ? "animate" : "css"]({
|
|
height: (valPercent - lastValPercent) + "%"
|
|
}, {
|
|
queue: false,
|
|
duration: o.animate
|
|
});
|
|
}
|
|
}
|
|
}
|
|
lastValPercent = valPercent;
|
|
});
|
|
} else {
|
|
value = this.value();
|
|
valueMin = this._valueMin();
|
|
valueMax = this._valueMax();
|
|
valPercent = (valueMax !== valueMin) ?
|
|
(value - valueMin) / (valueMax - valueMin) * 100 :
|
|
0;
|
|
_set[this.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%";
|
|
this.handle.stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);
|
|
|
|
if (oRange === "min" && this.orientation === "horizontal") {
|
|
this.range.stop(1, 1)[animate ? "animate" : "css"]({
|
|
width: valPercent + "%"
|
|
}, o.animate);
|
|
}
|
|
if (oRange === "max" && this.orientation === "horizontal") {
|
|
this.range.stop(1, 1)[animate ? "animate" : "css"]({
|
|
width: (100 - valPercent) + "%"
|
|
}, o.animate);
|
|
}
|
|
if (oRange === "min" && this.orientation === "vertical") {
|
|
this.range.stop(1, 1)[animate ? "animate" : "css"]({
|
|
height: valPercent + "%"
|
|
}, o.animate);
|
|
}
|
|
if (oRange === "max" && this.orientation === "vertical") {
|
|
this.range.stop(1, 1)[animate ? "animate" : "css"]({
|
|
height: (100 - valPercent) + "%"
|
|
}, o.animate);
|
|
}
|
|
}
|
|
},
|
|
|
|
_handleEvents: {
|
|
keydown: function (event) {
|
|
var allowed, curVal, newVal, step,
|
|
index = $(event.target).data("ui-slider-handle-index");
|
|
|
|
switch (event.keyCode) {
|
|
case $.ui.keyCode.HOME:
|
|
case $.ui.keyCode.END:
|
|
case $.ui.keyCode.PAGE_UP:
|
|
case $.ui.keyCode.PAGE_DOWN:
|
|
case $.ui.keyCode.UP:
|
|
case $.ui.keyCode.RIGHT:
|
|
case $.ui.keyCode.DOWN:
|
|
case $.ui.keyCode.LEFT:
|
|
event.preventDefault();
|
|
if (!this._keySliding) {
|
|
this._keySliding = true;
|
|
this._addClass($(event.target), null, "ui-state-active");
|
|
allowed = this._start(event, index);
|
|
if (allowed === false) {
|
|
return;
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
|
|
step = this.options.step;
|
|
if (this._hasMultipleValues()) {
|
|
curVal = newVal = this.values(index);
|
|
} else {
|
|
curVal = newVal = this.value();
|
|
}
|
|
|
|
switch (event.keyCode) {
|
|
case $.ui.keyCode.HOME:
|
|
newVal = this._valueMin();
|
|
break;
|
|
case $.ui.keyCode.END:
|
|
newVal = this._valueMax();
|
|
break;
|
|
case $.ui.keyCode.PAGE_UP:
|
|
newVal = this._trimAlignValue(
|
|
curVal + ((this._valueMax() - this._valueMin()) / this.numPages)
|
|
);
|
|
break;
|
|
case $.ui.keyCode.PAGE_DOWN:
|
|
newVal = this._trimAlignValue(
|
|
curVal - ((this._valueMax() - this._valueMin()) / this.numPages));
|
|
break;
|
|
case $.ui.keyCode.UP:
|
|
case $.ui.keyCode.RIGHT:
|
|
if (curVal === this._valueMax()) {
|
|
return;
|
|
}
|
|
newVal = this._trimAlignValue(curVal + step);
|
|
break;
|
|
case $.ui.keyCode.DOWN:
|
|
case $.ui.keyCode.LEFT:
|
|
if (curVal === this._valueMin()) {
|
|
return;
|
|
}
|
|
newVal = this._trimAlignValue(curVal - step);
|
|
break;
|
|
}
|
|
|
|
this._slide(event, index, newVal);
|
|
},
|
|
keyup: function (event) {
|
|
var index = $(event.target).data("ui-slider-handle-index");
|
|
|
|
if (this._keySliding) {
|
|
this._keySliding = false;
|
|
this._stop(event, index);
|
|
this._change(event, index);
|
|
this._removeClass($(event.target), null, "ui-state-active");
|
|
}
|
|
}
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Sortable 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Sortable
|
|
//>>group: Interactions
|
|
//>>description: Enables items in a list to be sorted using the mouse.
|
|
//>>docs: http://api.jqueryui.com/sortable/
|
|
//>>demos: http://jqueryui.com/sortable/
|
|
//>>css.structure: ../../themes/base/sortable.css
|
|
|
|
var widgetsSortable = $.widget("ui.sortable", $.ui.mouse, {
|
|
version: "1.12.1",
|
|
widgetEventPrefix: "sort",
|
|
ready: false,
|
|
options: {
|
|
appendTo: "parent",
|
|
axis: false,
|
|
connectWith: false,
|
|
containment: false,
|
|
cursor: "auto",
|
|
cursorAt: false,
|
|
dropOnEmpty: true,
|
|
forcePlaceholderSize: false,
|
|
forceHelperSize: false,
|
|
grid: false,
|
|
handle: false,
|
|
helper: "original",
|
|
items: "> *",
|
|
opacity: false,
|
|
placeholder: false,
|
|
revert: false,
|
|
scroll: true,
|
|
scrollSensitivity: 20,
|
|
scrollSpeed: 20,
|
|
scope: "default",
|
|
tolerance: "intersect",
|
|
zIndex: 1000,
|
|
|
|
// Callbacks
|
|
activate: null,
|
|
beforeStop: null,
|
|
change: null,
|
|
deactivate: null,
|
|
out: null,
|
|
over: null,
|
|
receive: null,
|
|
remove: null,
|
|
sort: null,
|
|
start: null,
|
|
stop: null,
|
|
update: null
|
|
},
|
|
|
|
_isOverAxis: function (x, reference, size) {
|
|
return (x >= reference) && (x < (reference + size));
|
|
},
|
|
|
|
_isFloating: function (item) {
|
|
return (/left|right/).test(item.css("float")) ||
|
|
(/inline|table-cell/).test(item.css("display"));
|
|
},
|
|
|
|
_create: function () {
|
|
this.containerCache = {};
|
|
this._addClass("ui-sortable");
|
|
|
|
//Get the items
|
|
this.refresh();
|
|
|
|
//Let's determine the parent's offset
|
|
this.offset = this.element.offset();
|
|
|
|
//Initialize mouse events for interaction
|
|
this._mouseInit();
|
|
|
|
this._setHandleClassName();
|
|
|
|
//We're ready to go
|
|
this.ready = true;
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
this._super(key, value);
|
|
|
|
if (key === "handle") {
|
|
this._setHandleClassName();
|
|
}
|
|
},
|
|
|
|
_setHandleClassName: function () {
|
|
var that = this;
|
|
this._removeClass(this.element.find(".ui-sortable-handle"), "ui-sortable-handle");
|
|
$.each(this.items, function () {
|
|
that._addClass(
|
|
this.instance.options.handle ?
|
|
this.item.find(this.instance.options.handle) :
|
|
this.item,
|
|
"ui-sortable-handle"
|
|
);
|
|
});
|
|
},
|
|
|
|
_destroy: function () {
|
|
this._mouseDestroy();
|
|
|
|
for (var i = this.items.length - 1; i >= 0; i--) {
|
|
this.items[i].item.removeData(this.widgetName + "-item");
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
_mouseCapture: function (event, overrideHandle) {
|
|
var currentItem = null,
|
|
validHandle = false,
|
|
that = this;
|
|
|
|
if (this.reverting) {
|
|
return false;
|
|
}
|
|
|
|
if (this.options.disabled || this.options.type === "static") {
|
|
return false;
|
|
}
|
|
|
|
//We have to refresh the items data once first
|
|
this._refreshItems(event);
|
|
|
|
//Find out if the clicked node (or one of its parents) is a actual item in this.items
|
|
$(event.target).parents().each(function () {
|
|
if ($.data(this, that.widgetName + "-item") === that) {
|
|
currentItem = $(this);
|
|
return false;
|
|
}
|
|
});
|
|
if ($.data(event.target, that.widgetName + "-item") === that) {
|
|
currentItem = $(event.target);
|
|
}
|
|
|
|
if (!currentItem) {
|
|
return false;
|
|
}
|
|
if (this.options.handle && !overrideHandle) {
|
|
$(this.options.handle, currentItem).find("*").addBack().each(function () {
|
|
if (this === event.target) {
|
|
validHandle = true;
|
|
}
|
|
});
|
|
if (!validHandle) {
|
|
return false;
|
|
}
|
|
}
|
|
|
|
this.currentItem = currentItem;
|
|
this._removeCurrentsFromItems();
|
|
return true;
|
|
},
|
|
|
|
_mouseStart: function (event, overrideHandle, noActivation) {
|
|
var i, body,
|
|
o = this.options;
|
|
|
|
this.currentContainer = this;
|
|
|
|
//We only need to call refreshPositions, because the refreshItems call has been moved to
|
|
// mouseCapture
|
|
this.refreshPositions();
|
|
|
|
//Create and append the visible helper
|
|
this.helper = this._createHelper(event);
|
|
|
|
//Cache the helper size
|
|
this._cacheHelperProportions();
|
|
|
|
/*
|
|
* - Position generation -
|
|
* This block generates everything position related - it's the core of draggables.
|
|
*/
|
|
|
|
//Cache the margins of the original element
|
|
this._cacheMargins();
|
|
|
|
//Get the next scrolling parent
|
|
this.scrollParent = this.helper.scrollParent();
|
|
|
|
//The element's absolute position on the page minus margins
|
|
this.offset = this.currentItem.offset();
|
|
this.offset = {
|
|
top: this.offset.top - this.margins.top,
|
|
left: this.offset.left - this.margins.left
|
|
};
|
|
|
|
$.extend(this.offset, {
|
|
click: { //Where the click happened, relative to the element
|
|
left: event.pageX - this.offset.left,
|
|
top: event.pageY - this.offset.top
|
|
},
|
|
parent: this._getParentOffset(),
|
|
|
|
// This is a relative to absolute position minus the actual position calculation -
|
|
// only used for relative positioned helper
|
|
relative: this._getRelativeOffset()
|
|
});
|
|
|
|
// Only after we got the offset, we can change the helper's position to absolute
|
|
// TODO: Still need to figure out a way to make relative sorting possible
|
|
this.helper.css("position", "absolute");
|
|
this.cssPosition = this.helper.css("position");
|
|
|
|
//Generate the original position
|
|
this.originalPosition = this._generatePosition(event);
|
|
this.originalPageX = event.pageX;
|
|
this.originalPageY = event.pageY;
|
|
|
|
//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
|
|
(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
|
|
|
|
//Cache the former DOM position
|
|
this.domPosition = {
|
|
prev: this.currentItem.prev()[0],
|
|
parent: this.currentItem.parent()[0]
|
|
};
|
|
|
|
// If the helper is not the original, hide the original so it's not playing any role during
|
|
// the drag, won't cause anything bad this way
|
|
if (this.helper[0] !== this.currentItem[0]) {
|
|
this.currentItem.hide();
|
|
}
|
|
|
|
//Create the placeholder
|
|
this._createPlaceholder();
|
|
|
|
//Set a containment if given in the options
|
|
if (o.containment) {
|
|
this._setContainment();
|
|
}
|
|
|
|
if (o.cursor && o.cursor !== "auto") { // cursor option
|
|
body = this.document.find("body");
|
|
|
|
// Support: IE
|
|
this.storedCursor = body.css("cursor");
|
|
body.css("cursor", o.cursor);
|
|
|
|
this.storedStylesheet =
|
|
$("<style>*{ cursor: " + o.cursor + " !important; }</style>").appendTo(body);
|
|
}
|
|
|
|
if (o.opacity) { // opacity option
|
|
if (this.helper.css("opacity")) {
|
|
this._storedOpacity = this.helper.css("opacity");
|
|
}
|
|
this.helper.css("opacity", o.opacity);
|
|
}
|
|
|
|
if (o.zIndex) { // zIndex option
|
|
if (this.helper.css("zIndex")) {
|
|
this._storedZIndex = this.helper.css("zIndex");
|
|
}
|
|
this.helper.css("zIndex", o.zIndex);
|
|
}
|
|
|
|
//Prepare scrolling
|
|
if (this.scrollParent[0] !== this.document[0] &&
|
|
this.scrollParent[0].tagName !== "HTML") {
|
|
this.overflowOffset = this.scrollParent.offset();
|
|
}
|
|
|
|
//Call callbacks
|
|
this._trigger("start", event, this._uiHash());
|
|
|
|
//Recache the helper size
|
|
if (!this._preserveHelperProportions) {
|
|
this._cacheHelperProportions();
|
|
}
|
|
|
|
//Post "activate" events to possible containers
|
|
if (!noActivation) {
|
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
|
this.containers[i]._trigger("activate", event, this._uiHash(this));
|
|
}
|
|
}
|
|
|
|
//Prepare possible droppables
|
|
if ($.ui.ddmanager) {
|
|
$.ui.ddmanager.current = this;
|
|
}
|
|
|
|
if ($.ui.ddmanager && !o.dropBehaviour) {
|
|
$.ui.ddmanager.prepareOffsets(this, event);
|
|
}
|
|
|
|
this.dragging = true;
|
|
|
|
this._addClass(this.helper, "ui-sortable-helper");
|
|
|
|
// Execute the drag once - this causes the helper not to be visiblebefore getting its
|
|
// correct position
|
|
this._mouseDrag(event);
|
|
return true;
|
|
},
|
|
|
|
_mouseDrag: function (event) {
|
|
var i, item, itemElement, intersection,
|
|
o = this.options,
|
|
scrolled = false;
|
|
|
|
//Compute the helpers position
|
|
this.position = this._generatePosition(event);
|
|
this.positionAbs = this._convertPositionTo("absolute");
|
|
|
|
if (!this.lastPositionAbs) {
|
|
this.lastPositionAbs = this.positionAbs;
|
|
}
|
|
|
|
//Do scrolling
|
|
if (this.options.scroll) {
|
|
if (this.scrollParent[0] !== this.document[0] &&
|
|
this.scrollParent[0].tagName !== "HTML") {
|
|
if ((this.overflowOffset.top + this.scrollParent[0].offsetHeight) -
|
|
event.pageY < o.scrollSensitivity) {
|
|
this.scrollParent[0].scrollTop =
|
|
scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
|
|
} else if (event.pageY - this.overflowOffset.top < o.scrollSensitivity) {
|
|
this.scrollParent[0].scrollTop =
|
|
scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
|
|
}
|
|
|
|
if ((this.overflowOffset.left + this.scrollParent[0].offsetWidth) -
|
|
event.pageX < o.scrollSensitivity) {
|
|
this.scrollParent[0].scrollLeft = scrolled =
|
|
this.scrollParent[0].scrollLeft + o.scrollSpeed;
|
|
} else if (event.pageX - this.overflowOffset.left < o.scrollSensitivity) {
|
|
this.scrollParent[0].scrollLeft = scrolled =
|
|
this.scrollParent[0].scrollLeft - o.scrollSpeed;
|
|
}
|
|
} else {
|
|
if (event.pageY - this.document.scrollTop() < o.scrollSensitivity) {
|
|
scrolled = this.document.scrollTop(this.document.scrollTop() - o.scrollSpeed);
|
|
} else if (this.window.height() - (event.pageY - this.document.scrollTop()) <
|
|
o.scrollSensitivity) {
|
|
scrolled = this.document.scrollTop(this.document.scrollTop() + o.scrollSpeed);
|
|
}
|
|
|
|
if (event.pageX - this.document.scrollLeft() < o.scrollSensitivity) {
|
|
scrolled = this.document.scrollLeft(
|
|
this.document.scrollLeft() - o.scrollSpeed
|
|
);
|
|
} else if (this.window.width() - (event.pageX - this.document.scrollLeft()) <
|
|
o.scrollSensitivity) {
|
|
scrolled = this.document.scrollLeft(
|
|
this.document.scrollLeft() + o.scrollSpeed
|
|
);
|
|
}
|
|
}
|
|
|
|
if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
|
|
$.ui.ddmanager.prepareOffsets(this, event);
|
|
}
|
|
}
|
|
|
|
//Regenerate the absolute position used for position checks
|
|
this.positionAbs = this._convertPositionTo("absolute");
|
|
|
|
//Set the helper position
|
|
if (!this.options.axis || this.options.axis !== "y") {
|
|
this.helper[0].style.left = this.position.left + "px";
|
|
}
|
|
if (!this.options.axis || this.options.axis !== "x") {
|
|
this.helper[0].style.top = this.position.top + "px";
|
|
}
|
|
|
|
//Rearrange
|
|
for (i = this.items.length - 1; i >= 0; i--) {
|
|
//Cache variables and intersection, continue if no intersection
|
|
item = this.items[i];
|
|
itemElement = item.item[0];
|
|
intersection = this._intersectsWithPointer(item);
|
|
if (!intersection) {
|
|
continue;
|
|
}
|
|
|
|
// Only put the placeholder inside the current Container, skip all
|
|
// items from other containers. This works because when moving
|
|
// an item from one container to another the
|
|
// currentContainer is switched before the placeholder is moved.
|
|
//
|
|
// Without this, moving items in "sub-sortables" can cause
|
|
// the placeholder to jitter between the outer and inner container.
|
|
if (item.instance !== this.currentContainer) {
|
|
continue;
|
|
}
|
|
|
|
// Cannot intersect with itself
|
|
// no useless actions that have been done before
|
|
// no action if the item moved is the parent of the item checked
|
|
if (itemElement !== this.currentItem[0] &&
|
|
this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement &&
|
|
!$.contains(this.placeholder[0], itemElement) &&
|
|
(this.options.type === "semi-dynamic" ?
|
|
!$.contains(this.element[0], itemElement) :
|
|
true
|
|
)
|
|
) {
|
|
this.direction = intersection === 1 ? "down" : "up";
|
|
|
|
if (this.options.tolerance === "pointer" || this._intersectsWithSides(item)) {
|
|
this._rearrange(event, item);
|
|
} else {
|
|
break;
|
|
}
|
|
|
|
this._trigger("change", event, this._uiHash());
|
|
break;
|
|
}
|
|
}
|
|
|
|
//Post events to containers
|
|
this._contactContainers(event);
|
|
|
|
//Interconnect with droppables
|
|
if ($.ui.ddmanager) {
|
|
$.ui.ddmanager.drag(this, event);
|
|
}
|
|
|
|
//Call callbacks
|
|
this._trigger("sort", event, this._uiHash());
|
|
|
|
this.lastPositionAbs = this.positionAbs;
|
|
return false;
|
|
},
|
|
|
|
_mouseStop: function (event, noPropagation) {
|
|
if (!event) {
|
|
return;
|
|
}
|
|
|
|
//If we are using droppables, inform the manager about the drop
|
|
if ($.ui.ddmanager && !this.options.dropBehaviour) {
|
|
$.ui.ddmanager.drop(this, event);
|
|
}
|
|
|
|
if (this.options.revert) {
|
|
var that = this,
|
|
cur = this.placeholder.offset(),
|
|
axis = this.options.axis,
|
|
animation = {};
|
|
|
|
if (!axis || axis === "x") {
|
|
animation.left = cur.left - this.offset.parent.left - this.margins.left +
|
|
(this.offsetParent[0] === this.document[0].body ?
|
|
0 :
|
|
this.offsetParent[0].scrollLeft
|
|
);
|
|
}
|
|
if (!axis || axis === "y") {
|
|
animation.top = cur.top - this.offset.parent.top - this.margins.top +
|
|
(this.offsetParent[0] === this.document[0].body ?
|
|
0 :
|
|
this.offsetParent[0].scrollTop
|
|
);
|
|
}
|
|
this.reverting = true;
|
|
$(this.helper).animate(
|
|
animation,
|
|
parseInt(this.options.revert, 10) || 500,
|
|
function () {
|
|
that._clear(event);
|
|
}
|
|
);
|
|
} else {
|
|
this._clear(event, noPropagation);
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
cancel: function () {
|
|
if (this.dragging) {
|
|
this._mouseUp(new $.Event("mouseup", { target: null }));
|
|
|
|
if (this.options.helper === "original") {
|
|
this.currentItem.css(this._storedCSS);
|
|
this._removeClass(this.currentItem, "ui-sortable-helper");
|
|
} else {
|
|
this.currentItem.show();
|
|
}
|
|
|
|
//Post deactivating events to containers
|
|
for (var i = this.containers.length - 1; i >= 0; i--) {
|
|
this.containers[i]._trigger("deactivate", null, this._uiHash(this));
|
|
if (this.containers[i].containerCache.over) {
|
|
this.containers[i]._trigger("out", null, this._uiHash(this));
|
|
this.containers[i].containerCache.over = 0;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (this.placeholder) {
|
|
//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
|
|
// it unbinds ALL events from the original node!
|
|
if (this.placeholder[0].parentNode) {
|
|
this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
|
|
}
|
|
if (this.options.helper !== "original" && this.helper &&
|
|
this.helper[0].parentNode) {
|
|
this.helper.remove();
|
|
}
|
|
|
|
$.extend(this, {
|
|
helper: null,
|
|
dragging: false,
|
|
reverting: false,
|
|
_noFinalSort: null
|
|
});
|
|
|
|
if (this.domPosition.prev) {
|
|
$(this.domPosition.prev).after(this.currentItem);
|
|
} else {
|
|
$(this.domPosition.parent).prepend(this.currentItem);
|
|
}
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
serialize: function (o) {
|
|
var items = this._getItemsAsjQuery(o && o.connected),
|
|
str = [];
|
|
o = o || {};
|
|
|
|
$(items).each(function () {
|
|
var res = ($(o.item || this).attr(o.attribute || "id") || "")
|
|
.match(o.expression || (/(.+)[\-=_](.+)/));
|
|
if (res) {
|
|
str.push(
|
|
(o.key || res[1] + "[]") +
|
|
"=" + (o.key && o.expression ? res[1] : res[2]));
|
|
}
|
|
});
|
|
|
|
if (!str.length && o.key) {
|
|
str.push(o.key + "=");
|
|
}
|
|
|
|
return str.join("&");
|
|
},
|
|
|
|
toArray: function (o) {
|
|
var items = this._getItemsAsjQuery(o && o.connected),
|
|
ret = [];
|
|
|
|
o = o || {};
|
|
|
|
items.each(function () {
|
|
ret.push($(o.item || this).attr(o.attribute || "id") || "");
|
|
});
|
|
return ret;
|
|
},
|
|
|
|
/* Be careful with the following core functions */
|
|
_intersectsWith: function (item) {
|
|
var x1 = this.positionAbs.left,
|
|
x2 = x1 + this.helperProportions.width,
|
|
y1 = this.positionAbs.top,
|
|
y2 = y1 + this.helperProportions.height,
|
|
l = item.left,
|
|
r = l + item.width,
|
|
t = item.top,
|
|
b = t + item.height,
|
|
dyClick = this.offset.click.top,
|
|
dxClick = this.offset.click.left,
|
|
isOverElementHeight = (this.options.axis === "x") || ((y1 + dyClick) > t &&
|
|
(y1 + dyClick) < b),
|
|
isOverElementWidth = (this.options.axis === "y") || ((x1 + dxClick) > l &&
|
|
(x1 + dxClick) < r),
|
|
isOverElement = isOverElementHeight && isOverElementWidth;
|
|
|
|
if (this.options.tolerance === "pointer" ||
|
|
this.options.forcePointerForContainers ||
|
|
(this.options.tolerance !== "pointer" &&
|
|
this.helperProportions[this.floating ? "width" : "height"] >
|
|
item[this.floating ? "width" : "height"])
|
|
) {
|
|
return isOverElement;
|
|
} else {
|
|
return (l < x1 + (this.helperProportions.width / 2) && // Right Half
|
|
x2 - (this.helperProportions.width / 2) < r && // Left Half
|
|
t < y1 + (this.helperProportions.height / 2) && // Bottom Half
|
|
y2 - (this.helperProportions.height / 2) < b); // Top Half
|
|
}
|
|
},
|
|
|
|
_intersectsWithPointer: function (item) {
|
|
var verticalDirection, horizontalDirection,
|
|
isOverElementHeight = (this.options.axis === "x") ||
|
|
this._isOverAxis(
|
|
this.positionAbs.top + this.offset.click.top, item.top, item.height),
|
|
isOverElementWidth = (this.options.axis === "y") ||
|
|
this._isOverAxis(
|
|
this.positionAbs.left + this.offset.click.left, item.left, item.width),
|
|
isOverElement = isOverElementHeight && isOverElementWidth;
|
|
|
|
if (!isOverElement) {
|
|
return false;
|
|
}
|
|
|
|
verticalDirection = this._getDragVerticalDirection();
|
|
horizontalDirection = this._getDragHorizontalDirection();
|
|
|
|
return this.floating ?
|
|
((horizontalDirection === "right" || verticalDirection === "down") ? 2 : 1)
|
|
: (verticalDirection && (verticalDirection === "down" ? 2 : 1));
|
|
},
|
|
|
|
_intersectsWithSides: function (item) {
|
|
var isOverBottomHalf = this._isOverAxis(this.positionAbs.top +
|
|
this.offset.click.top, item.top + (item.height / 2), item.height),
|
|
isOverRightHalf = this._isOverAxis(this.positionAbs.left +
|
|
this.offset.click.left, item.left + (item.width / 2), item.width),
|
|
verticalDirection = this._getDragVerticalDirection(),
|
|
horizontalDirection = this._getDragHorizontalDirection();
|
|
|
|
if (this.floating && horizontalDirection) {
|
|
return ((horizontalDirection === "right" && isOverRightHalf) ||
|
|
(horizontalDirection === "left" && !isOverRightHalf));
|
|
} else {
|
|
return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) ||
|
|
(verticalDirection === "up" && !isOverBottomHalf));
|
|
}
|
|
},
|
|
|
|
_getDragVerticalDirection: function () {
|
|
var delta = this.positionAbs.top - this.lastPositionAbs.top;
|
|
return delta !== 0 && (delta > 0 ? "down" : "up");
|
|
},
|
|
|
|
_getDragHorizontalDirection: function () {
|
|
var delta = this.positionAbs.left - this.lastPositionAbs.left;
|
|
return delta !== 0 && (delta > 0 ? "right" : "left");
|
|
},
|
|
|
|
refresh: function (event) {
|
|
this._refreshItems(event);
|
|
this._setHandleClassName();
|
|
this.refreshPositions();
|
|
return this;
|
|
},
|
|
|
|
_connectWith: function () {
|
|
var options = this.options;
|
|
return options.connectWith.constructor === String ?
|
|
[options.connectWith] :
|
|
options.connectWith;
|
|
},
|
|
|
|
_getItemsAsjQuery: function (connected) {
|
|
var i, j, cur, inst,
|
|
items = [],
|
|
queries = [],
|
|
connectWith = this._connectWith();
|
|
|
|
if (connectWith && connected) {
|
|
for (i = connectWith.length - 1; i >= 0; i--) {
|
|
cur = $(connectWith[i], this.document[0]);
|
|
for (j = cur.length - 1; j >= 0; j--) {
|
|
inst = $.data(cur[j], this.widgetFullName);
|
|
if (inst && inst !== this && !inst.options.disabled) {
|
|
queries.push([$.isFunction(inst.options.items) ?
|
|
inst.options.items.call(inst.element) :
|
|
$(inst.options.items, inst.element)
|
|
.not(".ui-sortable-helper")
|
|
.not(".ui-sortable-placeholder"), inst]);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
queries.push([$.isFunction(this.options.items) ?
|
|
this.options.items
|
|
.call(this.element, null, { options: this.options, item: this.currentItem }) :
|
|
$(this.options.items, this.element)
|
|
.not(".ui-sortable-helper")
|
|
.not(".ui-sortable-placeholder"), this]);
|
|
|
|
function addItems() {
|
|
items.push(this);
|
|
}
|
|
for (i = queries.length - 1; i >= 0; i--) {
|
|
queries[i][0].each(addItems);
|
|
}
|
|
|
|
return $(items);
|
|
},
|
|
|
|
_removeCurrentsFromItems: function () {
|
|
var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
|
|
|
|
this.items = $.grep(this.items, function (item) {
|
|
for (var j = 0; j < list.length; j++) {
|
|
if (list[j] === item.item[0]) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
});
|
|
},
|
|
|
|
_refreshItems: function (event) {
|
|
this.items = [];
|
|
this.containers = [this];
|
|
|
|
var i, j, cur, inst, targetData, _queries, item, queriesLength,
|
|
items = this.items,
|
|
queries = [[$.isFunction(this.options.items) ?
|
|
this.options.items.call(this.element[0], event, { item: this.currentItem }) :
|
|
$(this.options.items, this.element), this]],
|
|
connectWith = this._connectWith();
|
|
|
|
//Shouldn't be run the first time through due to massive slow-down
|
|
if (connectWith && this.ready) {
|
|
for (i = connectWith.length - 1; i >= 0; i--) {
|
|
cur = $(connectWith[i], this.document[0]);
|
|
for (j = cur.length - 1; j >= 0; j--) {
|
|
inst = $.data(cur[j], this.widgetFullName);
|
|
if (inst && inst !== this && !inst.options.disabled) {
|
|
queries.push([$.isFunction(inst.options.items) ?
|
|
inst.options.items
|
|
.call(inst.element[0], event, { item: this.currentItem }) :
|
|
$(inst.options.items, inst.element), inst]);
|
|
this.containers.push(inst);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
for (i = queries.length - 1; i >= 0; i--) {
|
|
targetData = queries[i][1];
|
|
_queries = queries[i][0];
|
|
|
|
for (j = 0, queriesLength = _queries.length; j < queriesLength; j++) {
|
|
item = $(_queries[j]);
|
|
|
|
// Data for target checking (mouse manager)
|
|
item.data(this.widgetName + "-item", targetData);
|
|
|
|
items.push({
|
|
item: item,
|
|
instance: targetData,
|
|
width: 0, height: 0,
|
|
left: 0, top: 0
|
|
});
|
|
}
|
|
}
|
|
},
|
|
|
|
refreshPositions: function (fast) {
|
|
// Determine whether items are being displayed horizontally
|
|
this.floating = this.items.length ?
|
|
this.options.axis === "x" || this._isFloating(this.items[0].item) :
|
|
false;
|
|
|
|
//This has to be redone because due to the item being moved out/into the offsetParent,
|
|
// the offsetParent's position will change
|
|
if (this.offsetParent && this.helper) {
|
|
this.offset.parent = this._getParentOffset();
|
|
}
|
|
|
|
var i, item, t, p;
|
|
|
|
for (i = this.items.length - 1; i >= 0; i--) {
|
|
item = this.items[i];
|
|
|
|
//We ignore calculating positions of all connected containers when we're not over them
|
|
if (item.instance !== this.currentContainer && this.currentContainer &&
|
|
item.item[0] !== this.currentItem[0]) {
|
|
continue;
|
|
}
|
|
|
|
t = this.options.toleranceElement ?
|
|
$(this.options.toleranceElement, item.item) :
|
|
item.item;
|
|
|
|
if (!fast) {
|
|
item.width = t.outerWidth();
|
|
item.height = t.outerHeight();
|
|
}
|
|
|
|
p = t.offset();
|
|
item.left = p.left;
|
|
item.top = p.top;
|
|
}
|
|
|
|
if (this.options.custom && this.options.custom.refreshContainers) {
|
|
this.options.custom.refreshContainers.call(this);
|
|
} else {
|
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
|
p = this.containers[i].element.offset();
|
|
this.containers[i].containerCache.left = p.left;
|
|
this.containers[i].containerCache.top = p.top;
|
|
this.containers[i].containerCache.width =
|
|
this.containers[i].element.outerWidth();
|
|
this.containers[i].containerCache.height =
|
|
this.containers[i].element.outerHeight();
|
|
}
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
_createPlaceholder: function (that) {
|
|
that = that || this;
|
|
var className,
|
|
o = that.options;
|
|
|
|
if (!o.placeholder || o.placeholder.constructor === String) {
|
|
className = o.placeholder;
|
|
o.placeholder = {
|
|
element: function () {
|
|
var nodeName = that.currentItem[0].nodeName.toLowerCase(),
|
|
element = $("<" + nodeName + ">", that.document[0]);
|
|
|
|
that._addClass(element, "ui-sortable-placeholder",
|
|
className || that.currentItem[0].className)
|
|
._removeClass(element, "ui-sortable-helper");
|
|
|
|
if (nodeName === "tbody") {
|
|
that._createTrPlaceholder(
|
|
that.currentItem.find("tr").eq(0),
|
|
$("<tr>", that.document[0]).appendTo(element)
|
|
);
|
|
} else if (nodeName === "tr") {
|
|
that._createTrPlaceholder(that.currentItem, element);
|
|
} else if (nodeName === "img") {
|
|
element.attr("src", that.currentItem.attr("src"));
|
|
}
|
|
|
|
if (!className) {
|
|
element.css("visibility", "hidden");
|
|
}
|
|
|
|
return element;
|
|
},
|
|
update: function (container, p) {
|
|
// 1. If a className is set as 'placeholder option, we don't force sizes -
|
|
// the class is responsible for that
|
|
// 2. The option 'forcePlaceholderSize can be enabled to force it even if a
|
|
// class name is specified
|
|
if (className && !o.forcePlaceholderSize) {
|
|
return;
|
|
}
|
|
|
|
//If the element doesn't have a actual height by itself (without styles coming
|
|
// from a stylesheet), it receives the inline height from the dragged item
|
|
if (!p.height()) {
|
|
p.height(
|
|
that.currentItem.innerHeight() -
|
|
parseInt(that.currentItem.css("paddingTop") || 0, 10) -
|
|
parseInt(that.currentItem.css("paddingBottom") || 0, 10));
|
|
}
|
|
if (!p.width()) {
|
|
p.width(
|
|
that.currentItem.innerWidth() -
|
|
parseInt(that.currentItem.css("paddingLeft") || 0, 10) -
|
|
parseInt(that.currentItem.css("paddingRight") || 0, 10));
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
//Create the placeholder
|
|
that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem));
|
|
|
|
//Append it after the actual current item
|
|
that.currentItem.after(that.placeholder);
|
|
|
|
//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
|
|
o.placeholder.update(that, that.placeholder);
|
|
},
|
|
|
|
_createTrPlaceholder: function (sourceTr, targetTr) {
|
|
var that = this;
|
|
|
|
sourceTr.children().each(function () {
|
|
$("<td> </td>", that.document[0])
|
|
.attr("colspan", $(this).attr("colspan") || 1)
|
|
.appendTo(targetTr);
|
|
});
|
|
},
|
|
|
|
_contactContainers: function (event) {
|
|
var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom,
|
|
floating, axis,
|
|
innermostContainer = null,
|
|
innermostIndex = null;
|
|
|
|
// Get innermost container that intersects with item
|
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
|
// Never consider a container that's located within the item itself
|
|
if ($.contains(this.currentItem[0], this.containers[i].element[0])) {
|
|
continue;
|
|
}
|
|
|
|
if (this._intersectsWith(this.containers[i].containerCache)) {
|
|
// If we've already found a container and it's more "inner" than this, then continue
|
|
if (innermostContainer &&
|
|
$.contains(
|
|
this.containers[i].element[0],
|
|
innermostContainer.element[0])) {
|
|
continue;
|
|
}
|
|
|
|
innermostContainer = this.containers[i];
|
|
innermostIndex = i;
|
|
} else {
|
|
// container doesn't intersect. trigger "out" event if necessary
|
|
if (this.containers[i].containerCache.over) {
|
|
this.containers[i]._trigger("out", event, this._uiHash(this));
|
|
this.containers[i].containerCache.over = 0;
|
|
}
|
|
}
|
|
}
|
|
|
|
// If no intersecting containers found, return
|
|
if (!innermostContainer) {
|
|
return;
|
|
}
|
|
|
|
// Move the item into the container if it's not there already
|
|
if (this.containers.length === 1) {
|
|
if (!this.containers[innermostIndex].containerCache.over) {
|
|
this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
|
|
this.containers[innermostIndex].containerCache.over = 1;
|
|
}
|
|
} else {
|
|
// When entering a new container, we will find the item with the least distance and
|
|
// append our item near it
|
|
dist = 10000;
|
|
itemWithLeastDistance = null;
|
|
floating = innermostContainer.floating || this._isFloating(this.currentItem);
|
|
posProperty = floating ? "left" : "top";
|
|
sizeProperty = floating ? "width" : "height";
|
|
axis = floating ? "pageX" : "pageY";
|
|
|
|
for (j = this.items.length - 1; j >= 0; j--) {
|
|
if (!$.contains(
|
|
this.containers[innermostIndex].element[0], this.items[j].item[0])
|
|
) {
|
|
continue;
|
|
}
|
|
if (this.items[j].item[0] === this.currentItem[0]) {
|
|
continue;
|
|
}
|
|
|
|
cur = this.items[j].item.offset()[posProperty];
|
|
nearBottom = false;
|
|
if (event[axis] - cur > this.items[j][sizeProperty] / 2) {
|
|
nearBottom = true;
|
|
}
|
|
|
|
if (Math.abs(event[axis] - cur) < dist) {
|
|
dist = Math.abs(event[axis] - cur);
|
|
itemWithLeastDistance = this.items[j];
|
|
this.direction = nearBottom ? "up" : "down";
|
|
}
|
|
}
|
|
|
|
//Check if dropOnEmpty is enabled
|
|
if (!itemWithLeastDistance && !this.options.dropOnEmpty) {
|
|
return;
|
|
}
|
|
|
|
if (this.currentContainer === this.containers[innermostIndex]) {
|
|
if (!this.currentContainer.containerCache.over) {
|
|
this.containers[innermostIndex]._trigger("over", event, this._uiHash());
|
|
this.currentContainer.containerCache.over = 1;
|
|
}
|
|
return;
|
|
}
|
|
|
|
itemWithLeastDistance ?
|
|
this._rearrange(event, itemWithLeastDistance, null, true) :
|
|
this._rearrange(event, null, this.containers[innermostIndex].element, true);
|
|
this._trigger("change", event, this._uiHash());
|
|
this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
|
|
this.currentContainer = this.containers[innermostIndex];
|
|
|
|
//Update the placeholder
|
|
this.options.placeholder.update(this.currentContainer, this.placeholder);
|
|
|
|
this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
|
|
this.containers[innermostIndex].containerCache.over = 1;
|
|
}
|
|
},
|
|
|
|
_createHelper: function (event) {
|
|
var o = this.options,
|
|
helper = $.isFunction(o.helper) ?
|
|
$(o.helper.apply(this.element[0], [event, this.currentItem])) :
|
|
(o.helper === "clone" ? this.currentItem.clone() : this.currentItem);
|
|
|
|
//Add the helper to the DOM if that didn't happen already
|
|
if (!helper.parents("body").length) {
|
|
$(o.appendTo !== "parent" ?
|
|
o.appendTo :
|
|
this.currentItem[0].parentNode)[0].appendChild(helper[0]);
|
|
}
|
|
|
|
if (helper[0] === this.currentItem[0]) {
|
|
this._storedCSS = {
|
|
width: this.currentItem[0].style.width,
|
|
height: this.currentItem[0].style.height,
|
|
position: this.currentItem.css("position"),
|
|
top: this.currentItem.css("top"),
|
|
left: this.currentItem.css("left")
|
|
};
|
|
}
|
|
|
|
if (!helper[0].style.width || o.forceHelperSize) {
|
|
helper.width(this.currentItem.width());
|
|
}
|
|
if (!helper[0].style.height || o.forceHelperSize) {
|
|
helper.height(this.currentItem.height());
|
|
}
|
|
|
|
return helper;
|
|
},
|
|
|
|
_adjustOffsetFromHelper: function (obj) {
|
|
if (typeof obj === "string") {
|
|
obj = obj.split(" ");
|
|
}
|
|
if ($.isArray(obj)) {
|
|
obj = { left: +obj[0], top: +obj[1] || 0 };
|
|
}
|
|
if ("left" in obj) {
|
|
this.offset.click.left = obj.left + this.margins.left;
|
|
}
|
|
if ("right" in obj) {
|
|
this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
|
|
}
|
|
if ("top" in obj) {
|
|
this.offset.click.top = obj.top + this.margins.top;
|
|
}
|
|
if ("bottom" in obj) {
|
|
this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
|
|
}
|
|
},
|
|
|
|
_getParentOffset: function () {
|
|
//Get the offsetParent and cache its position
|
|
this.offsetParent = this.helper.offsetParent();
|
|
var po = this.offsetParent.offset();
|
|
|
|
// This is a special case where we need to modify a offset calculated on start, since the
|
|
// following happened:
|
|
// 1. The position of the helper is absolute, so it's position is calculated based on the
|
|
// next positioned parent
|
|
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
|
|
// the document, which means that the scroll is included in the initial calculation of the
|
|
// offset of the parent, and never recalculated upon drag
|
|
if (this.cssPosition === "absolute" && this.scrollParent[0] !== this.document[0] &&
|
|
$.contains(this.scrollParent[0], this.offsetParent[0])) {
|
|
po.left += this.scrollParent.scrollLeft();
|
|
po.top += this.scrollParent.scrollTop();
|
|
}
|
|
|
|
// This needs to be actually done for all browsers, since pageX/pageY includes this
|
|
// information with an ugly IE fix
|
|
if (this.offsetParent[0] === this.document[0].body ||
|
|
(this.offsetParent[0].tagName &&
|
|
this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
|
|
po = { top: 0, left: 0 };
|
|
}
|
|
|
|
return {
|
|
top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
|
|
left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
|
|
};
|
|
},
|
|
|
|
_getRelativeOffset: function () {
|
|
if (this.cssPosition === "relative") {
|
|
var p = this.currentItem.position();
|
|
return {
|
|
top: p.top - (parseInt(this.helper.css("top"), 10) || 0) +
|
|
this.scrollParent.scrollTop(),
|
|
left: p.left - (parseInt(this.helper.css("left"), 10) || 0) +
|
|
this.scrollParent.scrollLeft()
|
|
};
|
|
} else {
|
|
return { top: 0, left: 0 };
|
|
}
|
|
},
|
|
|
|
_cacheMargins: function () {
|
|
this.margins = {
|
|
left: (parseInt(this.currentItem.css("marginLeft"), 10) || 0),
|
|
top: (parseInt(this.currentItem.css("marginTop"), 10) || 0)
|
|
};
|
|
},
|
|
|
|
_cacheHelperProportions: function () {
|
|
this.helperProportions = {
|
|
width: this.helper.outerWidth(),
|
|
height: this.helper.outerHeight()
|
|
};
|
|
},
|
|
|
|
_setContainment: function () {
|
|
var ce, co, over,
|
|
o = this.options;
|
|
if (o.containment === "parent") {
|
|
o.containment = this.helper[0].parentNode;
|
|
}
|
|
if (o.containment === "document" || o.containment === "window") {
|
|
this.containment = [
|
|
0 - this.offset.relative.left - this.offset.parent.left,
|
|
0 - this.offset.relative.top - this.offset.parent.top,
|
|
o.containment === "document" ?
|
|
this.document.width() :
|
|
this.window.width() - this.helperProportions.width - this.margins.left,
|
|
(o.containment === "document" ?
|
|
(this.document.height() || document.body.parentNode.scrollHeight) :
|
|
this.window.height() || this.document[0].body.parentNode.scrollHeight
|
|
) - this.helperProportions.height - this.margins.top
|
|
];
|
|
}
|
|
|
|
if (!(/^(document|window|parent)$/).test(o.containment)) {
|
|
ce = $(o.containment)[0];
|
|
co = $(o.containment).offset();
|
|
over = ($(ce).css("overflow") !== "hidden");
|
|
|
|
this.containment = [
|
|
co.left + (parseInt($(ce).css("borderLeftWidth"), 10) || 0) +
|
|
(parseInt($(ce).css("paddingLeft"), 10) || 0) - this.margins.left,
|
|
co.top + (parseInt($(ce).css("borderTopWidth"), 10) || 0) +
|
|
(parseInt($(ce).css("paddingTop"), 10) || 0) - this.margins.top,
|
|
co.left + (over ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) -
|
|
(parseInt($(ce).css("borderLeftWidth"), 10) || 0) -
|
|
(parseInt($(ce).css("paddingRight"), 10) || 0) -
|
|
this.helperProportions.width - this.margins.left,
|
|
co.top + (over ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) -
|
|
(parseInt($(ce).css("borderTopWidth"), 10) || 0) -
|
|
(parseInt($(ce).css("paddingBottom"), 10) || 0) -
|
|
this.helperProportions.height - this.margins.top
|
|
];
|
|
}
|
|
},
|
|
|
|
_convertPositionTo: function (d, pos) {
|
|
if (!pos) {
|
|
pos = this.position;
|
|
}
|
|
var mod = d === "absolute" ? 1 : -1,
|
|
scroll = this.cssPosition === "absolute" &&
|
|
!(this.scrollParent[0] !== this.document[0] &&
|
|
$.contains(this.scrollParent[0], this.offsetParent[0])) ?
|
|
this.offsetParent :
|
|
this.scrollParent,
|
|
scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
|
|
|
return {
|
|
top: (
|
|
|
|
// The absolute mouse position
|
|
pos.top +
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.top * mod +
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.top * mod -
|
|
((this.cssPosition === "fixed" ?
|
|
-this.scrollParent.scrollTop() :
|
|
(scrollIsRootNode ? 0 : scroll.scrollTop())) * mod)
|
|
),
|
|
left: (
|
|
|
|
// The absolute mouse position
|
|
pos.left +
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.left * mod +
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.left * mod -
|
|
((this.cssPosition === "fixed" ?
|
|
-this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 :
|
|
scroll.scrollLeft()) * mod)
|
|
)
|
|
};
|
|
},
|
|
|
|
_generatePosition: function (event) {
|
|
var top, left,
|
|
o = this.options,
|
|
pageX = event.pageX,
|
|
pageY = event.pageY,
|
|
scroll = this.cssPosition === "absolute" &&
|
|
!(this.scrollParent[0] !== this.document[0] &&
|
|
$.contains(this.scrollParent[0], this.offsetParent[0])) ?
|
|
this.offsetParent :
|
|
this.scrollParent,
|
|
scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
|
|
|
// This is another very weird special case that only happens for relative elements:
|
|
// 1. If the css position is relative
|
|
// 2. and the scroll parent is the document or similar to the offset parent
|
|
// we have to refresh the relative offset during the scroll so there are no jumps
|
|
if (this.cssPosition === "relative" && !(this.scrollParent[0] !== this.document[0] &&
|
|
this.scrollParent[0] !== this.offsetParent[0])) {
|
|
this.offset.relative = this._getRelativeOffset();
|
|
}
|
|
|
|
/*
|
|
* - Position constraining -
|
|
* Constrain the position to a mix of grid, containment.
|
|
*/
|
|
|
|
if (this.originalPosition) { //If we are not dragging yet, we won't check for options
|
|
if (this.containment) {
|
|
if (event.pageX - this.offset.click.left < this.containment[0]) {
|
|
pageX = this.containment[0] + this.offset.click.left;
|
|
}
|
|
if (event.pageY - this.offset.click.top < this.containment[1]) {
|
|
pageY = this.containment[1] + this.offset.click.top;
|
|
}
|
|
if (event.pageX - this.offset.click.left > this.containment[2]) {
|
|
pageX = this.containment[2] + this.offset.click.left;
|
|
}
|
|
if (event.pageY - this.offset.click.top > this.containment[3]) {
|
|
pageY = this.containment[3] + this.offset.click.top;
|
|
}
|
|
}
|
|
|
|
if (o.grid) {
|
|
top = this.originalPageY + Math.round((pageY - this.originalPageY) /
|
|
o.grid[1]) * o.grid[1];
|
|
pageY = this.containment ?
|
|
((top - this.offset.click.top >= this.containment[1] &&
|
|
top - this.offset.click.top <= this.containment[3]) ?
|
|
top :
|
|
((top - this.offset.click.top >= this.containment[1]) ?
|
|
top - o.grid[1] : top + o.grid[1])) :
|
|
top;
|
|
|
|
left = this.originalPageX + Math.round((pageX - this.originalPageX) /
|
|
o.grid[0]) * o.grid[0];
|
|
pageX = this.containment ?
|
|
((left - this.offset.click.left >= this.containment[0] &&
|
|
left - this.offset.click.left <= this.containment[2]) ?
|
|
left :
|
|
((left - this.offset.click.left >= this.containment[0]) ?
|
|
left - o.grid[0] : left + o.grid[0])) :
|
|
left;
|
|
}
|
|
}
|
|
|
|
return {
|
|
top: (
|
|
|
|
// The absolute mouse position
|
|
pageY -
|
|
|
|
// Click offset (relative to the element)
|
|
this.offset.click.top -
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.top -
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.top +
|
|
((this.cssPosition === "fixed" ?
|
|
-this.scrollParent.scrollTop() :
|
|
(scrollIsRootNode ? 0 : scroll.scrollTop())))
|
|
),
|
|
left: (
|
|
|
|
// The absolute mouse position
|
|
pageX -
|
|
|
|
// Click offset (relative to the element)
|
|
this.offset.click.left -
|
|
|
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
|
this.offset.relative.left -
|
|
|
|
// The offsetParent's offset without borders (offset + border)
|
|
this.offset.parent.left +
|
|
((this.cssPosition === "fixed" ?
|
|
-this.scrollParent.scrollLeft() :
|
|
scrollIsRootNode ? 0 : scroll.scrollLeft()))
|
|
)
|
|
};
|
|
},
|
|
|
|
_rearrange: function (event, i, a, hardRefresh) {
|
|
a ? a[0].appendChild(this.placeholder[0]) :
|
|
i.item[0].parentNode.insertBefore(this.placeholder[0],
|
|
(this.direction === "down" ? i.item[0] : i.item[0].nextSibling));
|
|
|
|
//Various things done here to improve the performance:
|
|
// 1. we create a setTimeout, that calls refreshPositions
|
|
// 2. on the instance, we have a counter variable, that get's higher after every append
|
|
// 3. on the local scope, we copy the counter variable, and check in the timeout,
|
|
// if it's still the same
|
|
// 4. this lets only the last addition to the timeout stack through
|
|
this.counter = this.counter ? ++this.counter : 1;
|
|
var counter = this.counter;
|
|
|
|
this._delay(function () {
|
|
if (counter === this.counter) {
|
|
//Precompute after each DOM insertion, NOT on mousemove
|
|
this.refreshPositions(!hardRefresh);
|
|
}
|
|
});
|
|
},
|
|
|
|
_clear: function (event, noPropagation) {
|
|
this.reverting = false;
|
|
|
|
// We delay all events that have to be triggered to after the point where the placeholder
|
|
// has been removed and everything else normalized again
|
|
var i,
|
|
delayedTriggers = [];
|
|
|
|
// We first have to update the dom position of the actual currentItem
|
|
// Note: don't do it if the current item is already removed (by a user), or it gets
|
|
// reappended (see #4088)
|
|
if (!this._noFinalSort && this.currentItem.parent().length) {
|
|
this.placeholder.before(this.currentItem);
|
|
}
|
|
this._noFinalSort = null;
|
|
|
|
if (this.helper[0] === this.currentItem[0]) {
|
|
for (i in this._storedCSS) {
|
|
if (this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") {
|
|
this._storedCSS[i] = "";
|
|
}
|
|
}
|
|
this.currentItem.css(this._storedCSS);
|
|
this._removeClass(this.currentItem, "ui-sortable-helper");
|
|
} else {
|
|
this.currentItem.show();
|
|
}
|
|
|
|
if (this.fromOutside && !noPropagation) {
|
|
delayedTriggers.push(function (event) {
|
|
this._trigger("receive", event, this._uiHash(this.fromOutside));
|
|
});
|
|
}
|
|
if ((this.fromOutside ||
|
|
this.domPosition.prev !==
|
|
this.currentItem.prev().not(".ui-sortable-helper")[0] ||
|
|
this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) {
|
|
// Trigger update callback if the DOM position has changed
|
|
delayedTriggers.push(function (event) {
|
|
this._trigger("update", event, this._uiHash());
|
|
});
|
|
}
|
|
|
|
// Check if the items Container has Changed and trigger appropriate
|
|
// events.
|
|
if (this !== this.currentContainer) {
|
|
if (!noPropagation) {
|
|
delayedTriggers.push(function (event) {
|
|
this._trigger("remove", event, this._uiHash());
|
|
});
|
|
delayedTriggers.push((function (c) {
|
|
return function (event) {
|
|
c._trigger("receive", event, this._uiHash(this));
|
|
};
|
|
}).call(this, this.currentContainer));
|
|
delayedTriggers.push((function (c) {
|
|
return function (event) {
|
|
c._trigger("update", event, this._uiHash(this));
|
|
};
|
|
}).call(this, this.currentContainer));
|
|
}
|
|
}
|
|
|
|
//Post events to containers
|
|
function delayEvent(type, instance, container) {
|
|
return function (event) {
|
|
container._trigger(type, event, instance._uiHash(instance));
|
|
};
|
|
}
|
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
|
if (!noPropagation) {
|
|
delayedTriggers.push(delayEvent("deactivate", this, this.containers[i]));
|
|
}
|
|
if (this.containers[i].containerCache.over) {
|
|
delayedTriggers.push(delayEvent("out", this, this.containers[i]));
|
|
this.containers[i].containerCache.over = 0;
|
|
}
|
|
}
|
|
|
|
//Do what was originally in plugins
|
|
if (this.storedCursor) {
|
|
this.document.find("body").css("cursor", this.storedCursor);
|
|
this.storedStylesheet.remove();
|
|
}
|
|
if (this._storedOpacity) {
|
|
this.helper.css("opacity", this._storedOpacity);
|
|
}
|
|
if (this._storedZIndex) {
|
|
this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex);
|
|
}
|
|
|
|
this.dragging = false;
|
|
|
|
if (!noPropagation) {
|
|
this._trigger("beforeStop", event, this._uiHash());
|
|
}
|
|
|
|
//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
|
|
// it unbinds ALL events from the original node!
|
|
this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
|
|
|
|
if (!this.cancelHelperRemoval) {
|
|
if (this.helper[0] !== this.currentItem[0]) {
|
|
this.helper.remove();
|
|
}
|
|
this.helper = null;
|
|
}
|
|
|
|
if (!noPropagation) {
|
|
for (i = 0; i < delayedTriggers.length; i++) {
|
|
// Trigger all delayed events
|
|
delayedTriggers[i].call(this, event);
|
|
}
|
|
this._trigger("stop", event, this._uiHash());
|
|
}
|
|
|
|
this.fromOutside = false;
|
|
return !this.cancelHelperRemoval;
|
|
},
|
|
|
|
_trigger: function () {
|
|
if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
|
|
this.cancel();
|
|
}
|
|
},
|
|
|
|
_uiHash: function (_inst) {
|
|
var inst = _inst || this;
|
|
return {
|
|
helper: inst.helper,
|
|
placeholder: inst.placeholder || $([]),
|
|
position: inst.position,
|
|
originalPosition: inst.originalPosition,
|
|
offset: inst.positionAbs,
|
|
item: inst.currentItem,
|
|
sender: _inst ? _inst.element : null
|
|
};
|
|
}
|
|
});
|
|
|
|
/*!
|
|
* jQuery UI Spinner 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Spinner
|
|
//>>group: Widgets
|
|
//>>description: Displays buttons to easily input numbers via the keyboard or mouse.
|
|
//>>docs: http://api.jqueryui.com/spinner/
|
|
//>>demos: http://jqueryui.com/spinner/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/spinner.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
function spinnerModifer(fn) {
|
|
return function () {
|
|
var previous = this.element.val();
|
|
fn.apply(this, arguments);
|
|
this._refresh();
|
|
if (previous !== this.element.val()) {
|
|
this._trigger("change");
|
|
}
|
|
};
|
|
}
|
|
|
|
$.widget("ui.spinner", {
|
|
version: "1.12.1",
|
|
defaultElement: "<input>",
|
|
widgetEventPrefix: "spin",
|
|
options: {
|
|
classes: {
|
|
"ui-spinner": "ui-corner-all",
|
|
"ui-spinner-down": "ui-corner-br",
|
|
"ui-spinner-up": "ui-corner-tr"
|
|
},
|
|
culture: null,
|
|
icons: {
|
|
down: "ui-icon-triangle-1-s",
|
|
up: "ui-icon-triangle-1-n"
|
|
},
|
|
incremental: true,
|
|
max: null,
|
|
min: null,
|
|
numberFormat: null,
|
|
page: 10,
|
|
step: 1,
|
|
|
|
change: null,
|
|
spin: null,
|
|
start: null,
|
|
stop: null
|
|
},
|
|
|
|
_create: function () {
|
|
// handle string values that need to be parsed
|
|
this._setOption("max", this.options.max);
|
|
this._setOption("min", this.options.min);
|
|
this._setOption("step", this.options.step);
|
|
|
|
// Only format if there is a value, prevents the field from being marked
|
|
// as invalid in Firefox, see #9573.
|
|
if (this.value() !== "") {
|
|
// Format the value, but don't constrain.
|
|
this._value(this.element.val(), true);
|
|
}
|
|
|
|
this._draw();
|
|
this._on(this._events);
|
|
this._refresh();
|
|
|
|
// Turning off autocomplete prevents the browser from remembering the
|
|
// value when navigating through history, so we re-enable autocomplete
|
|
// if the page is unloaded before the widget is destroyed. #7790
|
|
this._on(this.window, {
|
|
beforeunload: function () {
|
|
this.element.removeAttr("autocomplete");
|
|
}
|
|
});
|
|
},
|
|
|
|
_getCreateOptions: function () {
|
|
var options = this._super();
|
|
var element = this.element;
|
|
|
|
$.each(["min", "max", "step"], function (i, option) {
|
|
var value = element.attr(option);
|
|
if (value != null && value.length) {
|
|
options[option] = value;
|
|
}
|
|
});
|
|
|
|
return options;
|
|
},
|
|
|
|
_events: {
|
|
keydown: function (event) {
|
|
if (this._start(event) && this._keydown(event)) {
|
|
event.preventDefault();
|
|
}
|
|
},
|
|
keyup: "_stop",
|
|
focus: function () {
|
|
this.previous = this.element.val();
|
|
},
|
|
blur: function (event) {
|
|
if (this.cancelBlur) {
|
|
delete this.cancelBlur;
|
|
return;
|
|
}
|
|
|
|
this._stop();
|
|
this._refresh();
|
|
if (this.previous !== this.element.val()) {
|
|
this._trigger("change", event);
|
|
}
|
|
},
|
|
mousewheel: function (event, delta) {
|
|
if (!delta) {
|
|
return;
|
|
}
|
|
if (!this.spinning && !this._start(event)) {
|
|
return false;
|
|
}
|
|
|
|
this._spin((delta > 0 ? 1 : -1) * this.options.step, event);
|
|
clearTimeout(this.mousewheelTimer);
|
|
this.mousewheelTimer = this._delay(function () {
|
|
if (this.spinning) {
|
|
this._stop(event);
|
|
}
|
|
}, 100);
|
|
event.preventDefault();
|
|
},
|
|
"mousedown .ui-spinner-button": function (event) {
|
|
var previous;
|
|
|
|
// We never want the buttons to have focus; whenever the user is
|
|
// interacting with the spinner, the focus should be on the input.
|
|
// If the input is focused then this.previous is properly set from
|
|
// when the input first received focus. If the input is not focused
|
|
// then we need to set this.previous based on the value before spinning.
|
|
previous = this.element[0] === $.ui.safeActiveElement(this.document[0]) ?
|
|
this.previous : this.element.val();
|
|
function checkFocus() {
|
|
var isActive = this.element[0] === $.ui.safeActiveElement(this.document[0]);
|
|
if (!isActive) {
|
|
this.element.trigger("focus");
|
|
this.previous = previous;
|
|
|
|
// support: IE
|
|
// IE sets focus asynchronously, so we need to check if focus
|
|
// moved off of the input because the user clicked on the button.
|
|
this._delay(function () {
|
|
this.previous = previous;
|
|
});
|
|
}
|
|
}
|
|
|
|
// Ensure focus is on (or stays on) the text field
|
|
event.preventDefault();
|
|
checkFocus.call(this);
|
|
|
|
// Support: IE
|
|
// IE doesn't prevent moving focus even with event.preventDefault()
|
|
// so we set a flag to know when we should ignore the blur event
|
|
// and check (again) if focus moved off of the input.
|
|
this.cancelBlur = true;
|
|
this._delay(function () {
|
|
delete this.cancelBlur;
|
|
checkFocus.call(this);
|
|
});
|
|
|
|
if (this._start(event) === false) {
|
|
return;
|
|
}
|
|
|
|
this._repeat(null, $(event.currentTarget)
|
|
.hasClass("ui-spinner-up") ? 1 : -1, event);
|
|
},
|
|
"mouseup .ui-spinner-button": "_stop",
|
|
"mouseenter .ui-spinner-button": function (event) {
|
|
// button will add ui-state-active if mouse was down while mouseleave and kept down
|
|
if (!$(event.currentTarget).hasClass("ui-state-active")) {
|
|
return;
|
|
}
|
|
|
|
if (this._start(event) === false) {
|
|
return false;
|
|
}
|
|
this._repeat(null, $(event.currentTarget)
|
|
.hasClass("ui-spinner-up") ? 1 : -1, event);
|
|
},
|
|
|
|
// TODO: do we really want to consider this a stop?
|
|
// shouldn't we just stop the repeater and wait until mouseup before
|
|
// we trigger the stop event?
|
|
"mouseleave .ui-spinner-button": "_stop"
|
|
},
|
|
|
|
// Support mobile enhanced option and make backcompat more sane
|
|
_enhance: function () {
|
|
this.uiSpinner = this.element
|
|
.attr("autocomplete", "off")
|
|
.wrap("<span>")
|
|
.parent()
|
|
|
|
// Add buttons
|
|
.append(
|
|
"<a></a><a></a>"
|
|
);
|
|
},
|
|
|
|
_draw: function () {
|
|
this._enhance();
|
|
|
|
this._addClass(this.uiSpinner, "ui-spinner", "ui-widget ui-widget-content");
|
|
this._addClass("ui-spinner-input");
|
|
|
|
this.element.attr("role", "spinbutton");
|
|
|
|
// Button bindings
|
|
this.buttons = this.uiSpinner.children("a")
|
|
.attr("tabIndex", -1)
|
|
.attr("aria-hidden", true)
|
|
.button({
|
|
classes: {
|
|
"ui-button": ""
|
|
}
|
|
});
|
|
|
|
// TODO: Right now button does not support classes this is already updated in button PR
|
|
this._removeClass(this.buttons, "ui-corner-all");
|
|
|
|
this._addClass(this.buttons.first(), "ui-spinner-button ui-spinner-up");
|
|
this._addClass(this.buttons.last(), "ui-spinner-button ui-spinner-down");
|
|
this.buttons.first().button({
|
|
"icon": this.options.icons.up,
|
|
"showLabel": false
|
|
});
|
|
this.buttons.last().button({
|
|
"icon": this.options.icons.down,
|
|
"showLabel": false
|
|
});
|
|
|
|
// IE 6 doesn't understand height: 50% for the buttons
|
|
// unless the wrapper has an explicit height
|
|
if (this.buttons.height() > Math.ceil(this.uiSpinner.height() * 0.5) &&
|
|
this.uiSpinner.height() > 0) {
|
|
this.uiSpinner.height(this.uiSpinner.height());
|
|
}
|
|
},
|
|
|
|
_keydown: function (event) {
|
|
var options = this.options,
|
|
keyCode = $.ui.keyCode;
|
|
|
|
switch (event.keyCode) {
|
|
case keyCode.UP:
|
|
this._repeat(null, 1, event);
|
|
return true;
|
|
case keyCode.DOWN:
|
|
this._repeat(null, -1, event);
|
|
return true;
|
|
case keyCode.PAGE_UP:
|
|
this._repeat(null, options.page, event);
|
|
return true;
|
|
case keyCode.PAGE_DOWN:
|
|
this._repeat(null, -options.page, event);
|
|
return true;
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
_start: function (event) {
|
|
if (!this.spinning && this._trigger("start", event) === false) {
|
|
return false;
|
|
}
|
|
|
|
if (!this.counter) {
|
|
this.counter = 1;
|
|
}
|
|
this.spinning = true;
|
|
return true;
|
|
},
|
|
|
|
_repeat: function (i, steps, event) {
|
|
i = i || 500;
|
|
|
|
clearTimeout(this.timer);
|
|
this.timer = this._delay(function () {
|
|
this._repeat(40, steps, event);
|
|
}, i);
|
|
|
|
this._spin(steps * this.options.step, event);
|
|
},
|
|
|
|
_spin: function (step, event) {
|
|
var value = this.value() || 0;
|
|
|
|
if (!this.counter) {
|
|
this.counter = 1;
|
|
}
|
|
|
|
value = this._adjustValue(value + step * this._increment(this.counter));
|
|
|
|
if (!this.spinning || this._trigger("spin", event, { value: value }) !== false) {
|
|
this._value(value);
|
|
this.counter++;
|
|
}
|
|
},
|
|
|
|
_increment: function (i) {
|
|
var incremental = this.options.incremental;
|
|
|
|
if (incremental) {
|
|
return $.isFunction(incremental) ?
|
|
incremental(i) :
|
|
Math.floor(i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1);
|
|
}
|
|
|
|
return 1;
|
|
},
|
|
|
|
_precision: function () {
|
|
var precision = this._precisionOf(this.options.step);
|
|
if (this.options.min !== null) {
|
|
precision = Math.max(precision, this._precisionOf(this.options.min));
|
|
}
|
|
return precision;
|
|
},
|
|
|
|
_precisionOf: function (num) {
|
|
var str = num.toString(),
|
|
decimal = str.indexOf(".");
|
|
return decimal === -1 ? 0 : str.length - decimal - 1;
|
|
},
|
|
|
|
_adjustValue: function (value) {
|
|
var base, aboveMin,
|
|
options = this.options;
|
|
|
|
// Make sure we're at a valid step
|
|
// - find out where we are relative to the base (min or 0)
|
|
base = options.min !== null ? options.min : 0;
|
|
aboveMin = value - base;
|
|
|
|
// - round to the nearest step
|
|
aboveMin = Math.round(aboveMin / options.step) * options.step;
|
|
|
|
// - rounding is based on 0, so adjust back to our base
|
|
value = base + aboveMin;
|
|
|
|
// Fix precision from bad JS floating point math
|
|
value = parseFloat(value.toFixed(this._precision()));
|
|
|
|
// Clamp the value
|
|
if (options.max !== null && value > options.max) {
|
|
return options.max;
|
|
}
|
|
if (options.min !== null && value < options.min) {
|
|
return options.min;
|
|
}
|
|
|
|
return value;
|
|
},
|
|
|
|
_stop: function (event) {
|
|
if (!this.spinning) {
|
|
return;
|
|
}
|
|
|
|
clearTimeout(this.timer);
|
|
clearTimeout(this.mousewheelTimer);
|
|
this.counter = 0;
|
|
this.spinning = false;
|
|
this._trigger("stop", event);
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
var prevValue, first, last;
|
|
|
|
if (key === "culture" || key === "numberFormat") {
|
|
prevValue = this._parse(this.element.val());
|
|
this.options[key] = value;
|
|
this.element.val(this._format(prevValue));
|
|
return;
|
|
}
|
|
|
|
if (key === "max" || key === "min" || key === "step") {
|
|
if (typeof value === "string") {
|
|
value = this._parse(value);
|
|
}
|
|
}
|
|
if (key === "icons") {
|
|
first = this.buttons.first().find(".ui-icon");
|
|
this._removeClass(first, null, this.options.icons.up);
|
|
this._addClass(first, null, value.up);
|
|
last = this.buttons.last().find(".ui-icon");
|
|
this._removeClass(last, null, this.options.icons.down);
|
|
this._addClass(last, null, value.down);
|
|
}
|
|
|
|
this._super(key, value);
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this._super(value);
|
|
|
|
this._toggleClass(this.uiSpinner, null, "ui-state-disabled", !!value);
|
|
this.element.prop("disabled", !!value);
|
|
this.buttons.button(value ? "disable" : "enable");
|
|
},
|
|
|
|
_setOptions: spinnerModifer(function (options) {
|
|
this._super(options);
|
|
}),
|
|
|
|
_parse: function (val) {
|
|
if (typeof val === "string" && val !== "") {
|
|
val = window.Globalize && this.options.numberFormat ?
|
|
Globalize.parseFloat(val, 10, this.options.culture) : +val;
|
|
}
|
|
return val === "" || isNaN(val) ? null : val;
|
|
},
|
|
|
|
_format: function (value) {
|
|
if (value === "") {
|
|
return "";
|
|
}
|
|
return window.Globalize && this.options.numberFormat ?
|
|
Globalize.format(value, this.options.numberFormat, this.options.culture) :
|
|
value;
|
|
},
|
|
|
|
_refresh: function () {
|
|
this.element.attr({
|
|
"aria-valuemin": this.options.min,
|
|
"aria-valuemax": this.options.max,
|
|
|
|
// TODO: what should we do with values that can't be parsed?
|
|
"aria-valuenow": this._parse(this.element.val())
|
|
});
|
|
},
|
|
|
|
isValid: function () {
|
|
var value = this.value();
|
|
|
|
// Null is invalid
|
|
if (value === null) {
|
|
return false;
|
|
}
|
|
|
|
// If value gets adjusted, it's invalid
|
|
return value === this._adjustValue(value);
|
|
},
|
|
|
|
// Update the value without triggering change
|
|
_value: function (value, allowAny) {
|
|
var parsed;
|
|
if (value !== "") {
|
|
parsed = this._parse(value);
|
|
if (parsed !== null) {
|
|
if (!allowAny) {
|
|
parsed = this._adjustValue(parsed);
|
|
}
|
|
value = this._format(parsed);
|
|
}
|
|
}
|
|
this.element.val(value);
|
|
this._refresh();
|
|
},
|
|
|
|
_destroy: function () {
|
|
this.element
|
|
.prop("disabled", false)
|
|
.removeAttr("autocomplete role aria-valuemin aria-valuemax aria-valuenow");
|
|
|
|
this.uiSpinner.replaceWith(this.element);
|
|
},
|
|
|
|
stepUp: spinnerModifer(function (steps) {
|
|
this._stepUp(steps);
|
|
}),
|
|
_stepUp: function (steps) {
|
|
if (this._start()) {
|
|
this._spin((steps || 1) * this.options.step);
|
|
this._stop();
|
|
}
|
|
},
|
|
|
|
stepDown: spinnerModifer(function (steps) {
|
|
this._stepDown(steps);
|
|
}),
|
|
_stepDown: function (steps) {
|
|
if (this._start()) {
|
|
this._spin((steps || 1) * -this.options.step);
|
|
this._stop();
|
|
}
|
|
},
|
|
|
|
pageUp: spinnerModifer(function (pages) {
|
|
this._stepUp((pages || 1) * this.options.page);
|
|
}),
|
|
|
|
pageDown: spinnerModifer(function (pages) {
|
|
this._stepDown((pages || 1) * this.options.page);
|
|
}),
|
|
|
|
value: function (newVal) {
|
|
if (!arguments.length) {
|
|
return this._parse(this.element.val());
|
|
}
|
|
spinnerModifer(this._value).call(this, newVal);
|
|
},
|
|
|
|
widget: function () {
|
|
return this.uiSpinner;
|
|
}
|
|
});
|
|
|
|
// DEPRECATED
|
|
// TODO: switch return back to widget declaration at top of file when this is removed
|
|
if ($.uiBackCompat !== false) {
|
|
// Backcompat for spinner html extension points
|
|
$.widget("ui.spinner", $.ui.spinner, {
|
|
_enhance: function () {
|
|
this.uiSpinner = this.element
|
|
.attr("autocomplete", "off")
|
|
.wrap(this._uiSpinnerHtml())
|
|
.parent()
|
|
|
|
// Add buttons
|
|
.append(this._buttonHtml());
|
|
},
|
|
_uiSpinnerHtml: function () {
|
|
return "<span>";
|
|
},
|
|
|
|
_buttonHtml: function () {
|
|
return "<a></a><a></a>";
|
|
}
|
|
});
|
|
}
|
|
|
|
var widgetsSpinner = $.ui.spinner;
|
|
|
|
/*!
|
|
* jQuery UI Tabs 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Tabs
|
|
//>>group: Widgets
|
|
//>>description: Transforms a set of container elements into a tab structure.
|
|
//>>docs: http://api.jqueryui.com/tabs/
|
|
//>>demos: http://jqueryui.com/tabs/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/tabs.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.widget("ui.tabs", {
|
|
version: "1.12.1",
|
|
delay: 300,
|
|
options: {
|
|
active: null,
|
|
classes: {
|
|
"ui-tabs": "ui-corner-all",
|
|
"ui-tabs-nav": "ui-corner-all",
|
|
"ui-tabs-panel": "ui-corner-bottom",
|
|
"ui-tabs-tab": "ui-corner-top"
|
|
},
|
|
collapsible: false,
|
|
event: "click",
|
|
heightStyle: "content",
|
|
hide: null,
|
|
show: null,
|
|
|
|
// Callbacks
|
|
activate: null,
|
|
beforeActivate: null,
|
|
beforeLoad: null,
|
|
load: null
|
|
},
|
|
|
|
_isLocal: (function () {
|
|
var rhash = /#.*$/;
|
|
|
|
return function (anchor) {
|
|
var anchorUrl, locationUrl;
|
|
|
|
anchorUrl = anchor.href.replace(rhash, "");
|
|
locationUrl = location.href.replace(rhash, "");
|
|
|
|
// Decoding may throw an error if the URL isn't UTF-8 (#9518)
|
|
try {
|
|
anchorUrl = decodeURIComponent(anchorUrl);
|
|
} catch (error) { }
|
|
try {
|
|
locationUrl = decodeURIComponent(locationUrl);
|
|
} catch (error) { }
|
|
|
|
return anchor.hash.length > 1 && anchorUrl === locationUrl;
|
|
};
|
|
})(),
|
|
|
|
_create: function () {
|
|
var that = this,
|
|
options = this.options;
|
|
|
|
this.running = false;
|
|
|
|
this._addClass("ui-tabs", "ui-widget ui-widget-content");
|
|
this._toggleClass("ui-tabs-collapsible", null, options.collapsible);
|
|
|
|
this._processTabs();
|
|
options.active = this._initialActive();
|
|
|
|
// Take disabling tabs via class attribute from HTML
|
|
// into account and update option properly.
|
|
if ($.isArray(options.disabled)) {
|
|
options.disabled = $.unique(options.disabled.concat(
|
|
$.map(this.tabs.filter(".ui-state-disabled"), function (li) {
|
|
return that.tabs.index(li);
|
|
})
|
|
)).sort();
|
|
}
|
|
|
|
// Check for length avoids error when initializing empty list
|
|
if (this.options.active !== false && this.anchors.length) {
|
|
this.active = this._findActive(options.active);
|
|
} else {
|
|
this.active = $();
|
|
}
|
|
|
|
this._refresh();
|
|
|
|
if (this.active.length) {
|
|
this.load(options.active);
|
|
}
|
|
},
|
|
|
|
_initialActive: function () {
|
|
var active = this.options.active,
|
|
collapsible = this.options.collapsible,
|
|
locationHash = location.hash.substring(1);
|
|
|
|
if (active === null) {
|
|
// check the fragment identifier in the URL
|
|
if (locationHash) {
|
|
this.tabs.each(function (i, tab) {
|
|
if ($(tab).attr("aria-controls") === locationHash) {
|
|
active = i;
|
|
return false;
|
|
}
|
|
});
|
|
}
|
|
|
|
// Check for a tab marked active via a class
|
|
if (active === null) {
|
|
active = this.tabs.index(this.tabs.filter(".ui-tabs-active"));
|
|
}
|
|
|
|
// No active tab, set to false
|
|
if (active === null || active === -1) {
|
|
active = this.tabs.length ? 0 : false;
|
|
}
|
|
}
|
|
|
|
// Handle numbers: negative, out of range
|
|
if (active !== false) {
|
|
active = this.tabs.index(this.tabs.eq(active));
|
|
if (active === -1) {
|
|
active = collapsible ? false : 0;
|
|
}
|
|
}
|
|
|
|
// Don't allow collapsible: false and active: false
|
|
if (!collapsible && active === false && this.anchors.length) {
|
|
active = 0;
|
|
}
|
|
|
|
return active;
|
|
},
|
|
|
|
_getCreateEventData: function () {
|
|
return {
|
|
tab: this.active,
|
|
panel: !this.active.length ? $() : this._getPanelForTab(this.active)
|
|
};
|
|
},
|
|
|
|
_tabKeydown: function (event) {
|
|
var focusedTab = $($.ui.safeActiveElement(this.document[0])).closest("li"),
|
|
selectedIndex = this.tabs.index(focusedTab),
|
|
goingForward = true;
|
|
|
|
if (this._handlePageNav(event)) {
|
|
return;
|
|
}
|
|
|
|
switch (event.keyCode) {
|
|
case $.ui.keyCode.RIGHT:
|
|
case $.ui.keyCode.DOWN:
|
|
selectedIndex++;
|
|
break;
|
|
case $.ui.keyCode.UP:
|
|
case $.ui.keyCode.LEFT:
|
|
goingForward = false;
|
|
selectedIndex--;
|
|
break;
|
|
case $.ui.keyCode.END:
|
|
selectedIndex = this.anchors.length - 1;
|
|
break;
|
|
case $.ui.keyCode.HOME:
|
|
selectedIndex = 0;
|
|
break;
|
|
case $.ui.keyCode.SPACE:
|
|
|
|
// Activate only, no collapsing
|
|
event.preventDefault();
|
|
clearTimeout(this.activating);
|
|
this._activate(selectedIndex);
|
|
return;
|
|
case $.ui.keyCode.ENTER:
|
|
|
|
// Toggle (cancel delayed activation, allow collapsing)
|
|
event.preventDefault();
|
|
clearTimeout(this.activating);
|
|
|
|
// Determine if we should collapse or activate
|
|
this._activate(selectedIndex === this.options.active ? false : selectedIndex);
|
|
return;
|
|
default:
|
|
return;
|
|
}
|
|
|
|
// Focus the appropriate tab, based on which key was pressed
|
|
event.preventDefault();
|
|
clearTimeout(this.activating);
|
|
selectedIndex = this._focusNextTab(selectedIndex, goingForward);
|
|
|
|
// Navigating with control/command key will prevent automatic activation
|
|
if (!event.ctrlKey && !event.metaKey) {
|
|
// Update aria-selected immediately so that AT think the tab is already selected.
|
|
// Otherwise AT may confuse the user by stating that they need to activate the tab,
|
|
// but the tab will already be activated by the time the announcement finishes.
|
|
focusedTab.attr("aria-selected", "false");
|
|
this.tabs.eq(selectedIndex).attr("aria-selected", "true");
|
|
|
|
this.activating = this._delay(function () {
|
|
this.option("active", selectedIndex);
|
|
}, this.delay);
|
|
}
|
|
},
|
|
|
|
_panelKeydown: function (event) {
|
|
if (this._handlePageNav(event)) {
|
|
return;
|
|
}
|
|
|
|
// Ctrl+up moves focus to the current tab
|
|
if (event.ctrlKey && event.keyCode === $.ui.keyCode.UP) {
|
|
event.preventDefault();
|
|
this.active.trigger("focus");
|
|
}
|
|
},
|
|
|
|
// Alt+page up/down moves focus to the previous/next tab (and activates)
|
|
_handlePageNav: function (event) {
|
|
if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP) {
|
|
this._activate(this._focusNextTab(this.options.active - 1, false));
|
|
return true;
|
|
}
|
|
if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN) {
|
|
this._activate(this._focusNextTab(this.options.active + 1, true));
|
|
return true;
|
|
}
|
|
},
|
|
|
|
_findNextTab: function (index, goingForward) {
|
|
var lastTabIndex = this.tabs.length - 1;
|
|
|
|
function constrain() {
|
|
if (index > lastTabIndex) {
|
|
index = 0;
|
|
}
|
|
if (index < 0) {
|
|
index = lastTabIndex;
|
|
}
|
|
return index;
|
|
}
|
|
|
|
while ($.inArray(constrain(), this.options.disabled) !== -1) {
|
|
index = goingForward ? index + 1 : index - 1;
|
|
}
|
|
|
|
return index;
|
|
},
|
|
|
|
_focusNextTab: function (index, goingForward) {
|
|
index = this._findNextTab(index, goingForward);
|
|
this.tabs.eq(index).trigger("focus");
|
|
return index;
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
if (key === "active") {
|
|
// _activate() will handle invalid values and update this.options
|
|
this._activate(value);
|
|
return;
|
|
}
|
|
|
|
this._super(key, value);
|
|
|
|
if (key === "collapsible") {
|
|
this._toggleClass("ui-tabs-collapsible", null, value);
|
|
|
|
// Setting collapsible: false while collapsed; open first panel
|
|
if (!value && this.options.active === false) {
|
|
this._activate(0);
|
|
}
|
|
}
|
|
|
|
if (key === "event") {
|
|
this._setupEvents(value);
|
|
}
|
|
|
|
if (key === "heightStyle") {
|
|
this._setupHeightStyle(value);
|
|
}
|
|
},
|
|
|
|
_sanitizeSelector: function (hash) {
|
|
return hash ? hash.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&") : "";
|
|
},
|
|
|
|
refresh: function () {
|
|
var options = this.options,
|
|
lis = this.tablist.children(":has(a[href])");
|
|
|
|
// Get disabled tabs from class attribute from HTML
|
|
// this will get converted to a boolean if needed in _refresh()
|
|
options.disabled = $.map(lis.filter(".ui-state-disabled"), function (tab) {
|
|
return lis.index(tab);
|
|
});
|
|
|
|
this._processTabs();
|
|
|
|
// Was collapsed or no tabs
|
|
if (options.active === false || !this.anchors.length) {
|
|
options.active = false;
|
|
this.active = $();
|
|
|
|
// was active, but active tab is gone
|
|
} else if (this.active.length && !$.contains(this.tablist[0], this.active[0])) {
|
|
// all remaining tabs are disabled
|
|
if (this.tabs.length === options.disabled.length) {
|
|
options.active = false;
|
|
this.active = $();
|
|
|
|
// activate previous tab
|
|
} else {
|
|
this._activate(this._findNextTab(Math.max(0, options.active - 1), false));
|
|
}
|
|
|
|
// was active, active tab still exists
|
|
} else {
|
|
// make sure active index is correct
|
|
options.active = this.tabs.index(this.active);
|
|
}
|
|
|
|
this._refresh();
|
|
},
|
|
|
|
_refresh: function () {
|
|
this._setOptionDisabled(this.options.disabled);
|
|
this._setupEvents(this.options.event);
|
|
this._setupHeightStyle(this.options.heightStyle);
|
|
|
|
this.tabs.not(this.active).attr({
|
|
"aria-selected": "false",
|
|
"aria-expanded": "false",
|
|
tabIndex: -1
|
|
});
|
|
this.panels.not(this._getPanelForTab(this.active))
|
|
.hide()
|
|
.attr({
|
|
"aria-hidden": "true"
|
|
});
|
|
|
|
// Make sure one tab is in the tab order
|
|
if (!this.active.length) {
|
|
this.tabs.eq(0).attr("tabIndex", 0);
|
|
} else {
|
|
this.active
|
|
.attr({
|
|
"aria-selected": "true",
|
|
"aria-expanded": "true",
|
|
tabIndex: 0
|
|
});
|
|
this._addClass(this.active, "ui-tabs-active", "ui-state-active");
|
|
this._getPanelForTab(this.active)
|
|
.show()
|
|
.attr({
|
|
"aria-hidden": "false"
|
|
});
|
|
}
|
|
},
|
|
|
|
_processTabs: function () {
|
|
var that = this,
|
|
prevTabs = this.tabs,
|
|
prevAnchors = this.anchors,
|
|
prevPanels = this.panels;
|
|
|
|
this.tablist = this._getList().attr("role", "tablist");
|
|
this._addClass(this.tablist, "ui-tabs-nav",
|
|
"ui-helper-reset ui-helper-clearfix ui-widget-header");
|
|
|
|
// Prevent users from focusing disabled tabs via click
|
|
this.tablist
|
|
.on("mousedown" + this.eventNamespace, "> li", function (event) {
|
|
if ($(this).is(".ui-state-disabled")) {
|
|
event.preventDefault();
|
|
}
|
|
})
|
|
|
|
// Support: IE <9
|
|
// Preventing the default action in mousedown doesn't prevent IE
|
|
// from focusing the element, so if the anchor gets focused, blur.
|
|
// We don't have to worry about focusing the previously focused
|
|
// element since clicking on a non-focusable element should focus
|
|
// the body anyway.
|
|
.on("focus" + this.eventNamespace, ".ui-tabs-anchor", function () {
|
|
if ($(this).closest("li").is(".ui-state-disabled")) {
|
|
this.blur();
|
|
}
|
|
});
|
|
|
|
this.tabs = this.tablist.find("> li:has(a[href])")
|
|
.attr({
|
|
role: "tab",
|
|
tabIndex: -1
|
|
});
|
|
this._addClass(this.tabs, "ui-tabs-tab", "ui-state-default");
|
|
|
|
this.anchors = this.tabs.map(function () {
|
|
return $("a", this)[0];
|
|
})
|
|
.attr({
|
|
role: "presentation",
|
|
tabIndex: -1
|
|
});
|
|
this._addClass(this.anchors, "ui-tabs-anchor");
|
|
|
|
this.panels = $();
|
|
|
|
this.anchors.each(function (i, anchor) {
|
|
var selector, panel, panelId,
|
|
anchorId = $(anchor).uniqueId().attr("id"),
|
|
tab = $(anchor).closest("li"),
|
|
originalAriaControls = tab.attr("aria-controls");
|
|
|
|
// Inline tab
|
|
if (that._isLocal(anchor)) {
|
|
selector = anchor.hash;
|
|
panelId = selector.substring(1);
|
|
panel = that.element.find(that._sanitizeSelector(selector));
|
|
|
|
// remote tab
|
|
} else {
|
|
// If the tab doesn't already have aria-controls,
|
|
// generate an id by using a throw-away element
|
|
panelId = tab.attr("aria-controls") || $({}).uniqueId()[0].id;
|
|
selector = "#" + panelId;
|
|
panel = that.element.find(selector);
|
|
if (!panel.length) {
|
|
panel = that._createPanel(panelId);
|
|
panel.insertAfter(that.panels[i - 1] || that.tablist);
|
|
}
|
|
panel.attr("aria-live", "polite");
|
|
}
|
|
|
|
if (panel.length) {
|
|
that.panels = that.panels.add(panel);
|
|
}
|
|
if (originalAriaControls) {
|
|
tab.data("ui-tabs-aria-controls", originalAriaControls);
|
|
}
|
|
tab.attr({
|
|
"aria-controls": panelId,
|
|
"aria-labelledby": anchorId
|
|
});
|
|
panel.attr("aria-labelledby", anchorId);
|
|
});
|
|
|
|
this.panels.attr("role", "tabpanel");
|
|
this._addClass(this.panels, "ui-tabs-panel", "ui-widget-content");
|
|
|
|
// Avoid memory leaks (#10056)
|
|
if (prevTabs) {
|
|
this._off(prevTabs.not(this.tabs));
|
|
this._off(prevAnchors.not(this.anchors));
|
|
this._off(prevPanels.not(this.panels));
|
|
}
|
|
},
|
|
|
|
// Allow overriding how to find the list for rare usage scenarios (#7715)
|
|
_getList: function () {
|
|
return this.tablist || this.element.find("ol, ul").eq(0);
|
|
},
|
|
|
|
_createPanel: function (id) {
|
|
return $("<div>")
|
|
.attr("id", id)
|
|
.data("ui-tabs-destroy", true);
|
|
},
|
|
|
|
_setOptionDisabled: function (disabled) {
|
|
var currentItem, li, i;
|
|
|
|
if ($.isArray(disabled)) {
|
|
if (!disabled.length) {
|
|
disabled = false;
|
|
} else if (disabled.length === this.anchors.length) {
|
|
disabled = true;
|
|
}
|
|
}
|
|
|
|
// Disable tabs
|
|
for (i = 0; (li = this.tabs[i]); i++) {
|
|
currentItem = $(li);
|
|
if (disabled === true || $.inArray(i, disabled) !== -1) {
|
|
currentItem.attr("aria-disabled", "true");
|
|
this._addClass(currentItem, null, "ui-state-disabled");
|
|
} else {
|
|
currentItem.removeAttr("aria-disabled");
|
|
this._removeClass(currentItem, null, "ui-state-disabled");
|
|
}
|
|
}
|
|
|
|
this.options.disabled = disabled;
|
|
|
|
this._toggleClass(this.widget(), this.widgetFullName + "-disabled", null,
|
|
disabled === true);
|
|
},
|
|
|
|
_setupEvents: function (event) {
|
|
var events = {};
|
|
if (event) {
|
|
$.each(event.split(" "), function (index, eventName) {
|
|
events[eventName] = "_eventHandler";
|
|
});
|
|
}
|
|
|
|
this._off(this.anchors.add(this.tabs).add(this.panels));
|
|
|
|
// Always prevent the default action, even when disabled
|
|
this._on(true, this.anchors, {
|
|
click: function (event) {
|
|
event.preventDefault();
|
|
}
|
|
});
|
|
this._on(this.anchors, events);
|
|
this._on(this.tabs, { keydown: "_tabKeydown" });
|
|
this._on(this.panels, { keydown: "_panelKeydown" });
|
|
|
|
this._focusable(this.tabs);
|
|
this._hoverable(this.tabs);
|
|
},
|
|
|
|
_setupHeightStyle: function (heightStyle) {
|
|
var maxHeight,
|
|
parent = this.element.parent();
|
|
|
|
if (heightStyle === "fill") {
|
|
maxHeight = parent.height();
|
|
maxHeight -= this.element.outerHeight() - this.element.height();
|
|
|
|
this.element.siblings(":visible").each(function () {
|
|
var elem = $(this),
|
|
position = elem.css("position");
|
|
|
|
if (position === "absolute" || position === "fixed") {
|
|
return;
|
|
}
|
|
maxHeight -= elem.outerHeight(true);
|
|
});
|
|
|
|
this.element.children().not(this.panels).each(function () {
|
|
maxHeight -= $(this).outerHeight(true);
|
|
});
|
|
|
|
this.panels.each(function () {
|
|
$(this).height(Math.max(0, maxHeight -
|
|
$(this).innerHeight() + $(this).height()));
|
|
})
|
|
.css("overflow", "auto");
|
|
} else if (heightStyle === "auto") {
|
|
maxHeight = 0;
|
|
this.panels.each(function () {
|
|
maxHeight = Math.max(maxHeight, $(this).height("").height());
|
|
}).height(maxHeight);
|
|
}
|
|
},
|
|
|
|
_eventHandler: function (event) {
|
|
var options = this.options,
|
|
active = this.active,
|
|
anchor = $(event.currentTarget),
|
|
tab = anchor.closest("li"),
|
|
clickedIsActive = tab[0] === active[0],
|
|
collapsing = clickedIsActive && options.collapsible,
|
|
toShow = collapsing ? $() : this._getPanelForTab(tab),
|
|
toHide = !active.length ? $() : this._getPanelForTab(active),
|
|
eventData = {
|
|
oldTab: active,
|
|
oldPanel: toHide,
|
|
newTab: collapsing ? $() : tab,
|
|
newPanel: toShow
|
|
};
|
|
|
|
event.preventDefault();
|
|
|
|
if (tab.hasClass("ui-state-disabled") ||
|
|
|
|
// tab is already loading
|
|
tab.hasClass("ui-tabs-loading") ||
|
|
|
|
// can't switch durning an animation
|
|
this.running ||
|
|
|
|
// click on active header, but not collapsible
|
|
(clickedIsActive && !options.collapsible) ||
|
|
|
|
// allow canceling activation
|
|
(this._trigger("beforeActivate", event, eventData) === false)) {
|
|
return;
|
|
}
|
|
|
|
options.active = collapsing ? false : this.tabs.index(tab);
|
|
|
|
this.active = clickedIsActive ? $() : tab;
|
|
if (this.xhr) {
|
|
this.xhr.abort();
|
|
}
|
|
|
|
if (!toHide.length && !toShow.length) {
|
|
$.error("jQuery UI Tabs: Mismatching fragment identifier.");
|
|
}
|
|
|
|
if (toShow.length) {
|
|
this.load(this.tabs.index(tab), event);
|
|
}
|
|
this._toggle(event, eventData);
|
|
},
|
|
|
|
// Handles show/hide for selecting tabs
|
|
_toggle: function (event, eventData) {
|
|
var that = this,
|
|
toShow = eventData.newPanel,
|
|
toHide = eventData.oldPanel;
|
|
|
|
this.running = true;
|
|
|
|
function complete() {
|
|
that.running = false;
|
|
that._trigger("activate", event, eventData);
|
|
}
|
|
|
|
function show() {
|
|
that._addClass(eventData.newTab.closest("li"), "ui-tabs-active", "ui-state-active");
|
|
|
|
if (toShow.length && that.options.show) {
|
|
that._show(toShow, that.options.show, complete);
|
|
} else {
|
|
toShow.show();
|
|
complete();
|
|
}
|
|
}
|
|
|
|
// Start out by hiding, then showing, then completing
|
|
if (toHide.length && this.options.hide) {
|
|
this._hide(toHide, this.options.hide, function () {
|
|
that._removeClass(eventData.oldTab.closest("li"),
|
|
"ui-tabs-active", "ui-state-active");
|
|
show();
|
|
});
|
|
} else {
|
|
this._removeClass(eventData.oldTab.closest("li"),
|
|
"ui-tabs-active", "ui-state-active");
|
|
toHide.hide();
|
|
show();
|
|
}
|
|
|
|
toHide.attr("aria-hidden", "true");
|
|
eventData.oldTab.attr({
|
|
"aria-selected": "false",
|
|
"aria-expanded": "false"
|
|
});
|
|
|
|
// If we're switching tabs, remove the old tab from the tab order.
|
|
// If we're opening from collapsed state, remove the previous tab from the tab order.
|
|
// If we're collapsing, then keep the collapsing tab in the tab order.
|
|
if (toShow.length && toHide.length) {
|
|
eventData.oldTab.attr("tabIndex", -1);
|
|
} else if (toShow.length) {
|
|
this.tabs.filter(function () {
|
|
return $(this).attr("tabIndex") === 0;
|
|
})
|
|
.attr("tabIndex", -1);
|
|
}
|
|
|
|
toShow.attr("aria-hidden", "false");
|
|
eventData.newTab.attr({
|
|
"aria-selected": "true",
|
|
"aria-expanded": "true",
|
|
tabIndex: 0
|
|
});
|
|
},
|
|
|
|
_activate: function (index) {
|
|
var anchor,
|
|
active = this._findActive(index);
|
|
|
|
// Trying to activate the already active panel
|
|
if (active[0] === this.active[0]) {
|
|
return;
|
|
}
|
|
|
|
// Trying to collapse, simulate a click on the current active header
|
|
if (!active.length) {
|
|
active = this.active;
|
|
}
|
|
|
|
anchor = active.find(".ui-tabs-anchor")[0];
|
|
this._eventHandler({
|
|
target: anchor,
|
|
currentTarget: anchor,
|
|
preventDefault: $.noop
|
|
});
|
|
},
|
|
|
|
_findActive: function (index) {
|
|
return index === false ? $() : this.tabs.eq(index);
|
|
},
|
|
|
|
_getIndex: function (index) {
|
|
// meta-function to give users option to provide a href string instead of a numerical index.
|
|
if (typeof index === "string") {
|
|
index = this.anchors.index(this.anchors.filter("[href$='" +
|
|
$.ui.escapeSelector(index) + "']"));
|
|
}
|
|
|
|
return index;
|
|
},
|
|
|
|
_destroy: function () {
|
|
if (this.xhr) {
|
|
this.xhr.abort();
|
|
}
|
|
|
|
this.tablist
|
|
.removeAttr("role")
|
|
.off(this.eventNamespace);
|
|
|
|
this.anchors
|
|
.removeAttr("role tabIndex")
|
|
.removeUniqueId();
|
|
|
|
this.tabs.add(this.panels).each(function () {
|
|
if ($.data(this, "ui-tabs-destroy")) {
|
|
$(this).remove();
|
|
} else {
|
|
$(this).removeAttr("role tabIndex " +
|
|
"aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded");
|
|
}
|
|
});
|
|
|
|
this.tabs.each(function () {
|
|
var li = $(this),
|
|
prev = li.data("ui-tabs-aria-controls");
|
|
if (prev) {
|
|
li
|
|
.attr("aria-controls", prev)
|
|
.removeData("ui-tabs-aria-controls");
|
|
} else {
|
|
li.removeAttr("aria-controls");
|
|
}
|
|
});
|
|
|
|
this.panels.show();
|
|
|
|
if (this.options.heightStyle !== "content") {
|
|
this.panels.css("height", "");
|
|
}
|
|
},
|
|
|
|
enable: function (index) {
|
|
var disabled = this.options.disabled;
|
|
if (disabled === false) {
|
|
return;
|
|
}
|
|
|
|
if (index === undefined) {
|
|
disabled = false;
|
|
} else {
|
|
index = this._getIndex(index);
|
|
if ($.isArray(disabled)) {
|
|
disabled = $.map(disabled, function (num) {
|
|
return num !== index ? num : null;
|
|
});
|
|
} else {
|
|
disabled = $.map(this.tabs, function (li, num) {
|
|
return num !== index ? num : null;
|
|
});
|
|
}
|
|
}
|
|
this._setOptionDisabled(disabled);
|
|
},
|
|
|
|
disable: function (index) {
|
|
var disabled = this.options.disabled;
|
|
if (disabled === true) {
|
|
return;
|
|
}
|
|
|
|
if (index === undefined) {
|
|
disabled = true;
|
|
} else {
|
|
index = this._getIndex(index);
|
|
if ($.inArray(index, disabled) !== -1) {
|
|
return;
|
|
}
|
|
if ($.isArray(disabled)) {
|
|
disabled = $.merge([index], disabled).sort();
|
|
} else {
|
|
disabled = [index];
|
|
}
|
|
}
|
|
this._setOptionDisabled(disabled);
|
|
},
|
|
|
|
load: function (index, event) {
|
|
index = this._getIndex(index);
|
|
var that = this,
|
|
tab = this.tabs.eq(index),
|
|
anchor = tab.find(".ui-tabs-anchor"),
|
|
panel = this._getPanelForTab(tab),
|
|
eventData = {
|
|
tab: tab,
|
|
panel: panel
|
|
},
|
|
complete = function (jqXHR, status) {
|
|
if (status === "abort") {
|
|
that.panels.stop(false, true);
|
|
}
|
|
|
|
that._removeClass(tab, "ui-tabs-loading");
|
|
panel.removeAttr("aria-busy");
|
|
|
|
if (jqXHR === that.xhr) {
|
|
delete that.xhr;
|
|
}
|
|
};
|
|
|
|
// Not remote
|
|
if (this._isLocal(anchor[0])) {
|
|
return;
|
|
}
|
|
|
|
this.xhr = $.ajax(this._ajaxSettings(anchor, event, eventData));
|
|
|
|
// Support: jQuery <1.8
|
|
// jQuery <1.8 returns false if the request is canceled in beforeSend,
|
|
// but as of 1.8, $.ajax() always returns a jqXHR object.
|
|
if (this.xhr && this.xhr.statusText !== "canceled") {
|
|
this._addClass(tab, "ui-tabs-loading");
|
|
panel.attr("aria-busy", "true");
|
|
|
|
this.xhr
|
|
.done(function (response, status, jqXHR) {
|
|
// support: jQuery <1.8
|
|
// http://bugs.jquery.com/ticket/11778
|
|
setTimeout(function () {
|
|
panel.html(response);
|
|
that._trigger("load", event, eventData);
|
|
|
|
complete(jqXHR, status);
|
|
}, 1);
|
|
})
|
|
.fail(function (jqXHR, status) {
|
|
// support: jQuery <1.8
|
|
// http://bugs.jquery.com/ticket/11778
|
|
setTimeout(function () {
|
|
complete(jqXHR, status);
|
|
}, 1);
|
|
});
|
|
}
|
|
},
|
|
|
|
_ajaxSettings: function (anchor, event, eventData) {
|
|
var that = this;
|
|
return {
|
|
// Support: IE <11 only
|
|
// Strip any hash that exists to prevent errors with the Ajax request
|
|
url: anchor.attr("href").replace(/#.*$/, ""),
|
|
beforeSend: function (jqXHR, settings) {
|
|
return that._trigger("beforeLoad", event,
|
|
$.extend({ jqXHR: jqXHR, ajaxSettings: settings }, eventData));
|
|
}
|
|
};
|
|
},
|
|
|
|
_getPanelForTab: function (tab) {
|
|
var id = $(tab).attr("aria-controls");
|
|
return this.element.find(this._sanitizeSelector("#" + id));
|
|
}
|
|
});
|
|
|
|
// DEPRECATED
|
|
// TODO: Switch return back to widget declaration at top of file when this is removed
|
|
if ($.uiBackCompat !== false) {
|
|
// Backcompat for ui-tab class (now ui-tabs-tab)
|
|
$.widget("ui.tabs", $.ui.tabs, {
|
|
_processTabs: function () {
|
|
this._superApply(arguments);
|
|
this._addClass(this.tabs, "ui-tab");
|
|
}
|
|
});
|
|
}
|
|
|
|
var widgetsTabs = $.ui.tabs;
|
|
|
|
/*!
|
|
* jQuery UI Tooltip 1.12.1
|
|
* http://jqueryui.com
|
|
*
|
|
* Copyright jQuery Foundation and other contributors
|
|
* Released under the MIT license.
|
|
* http://jquery.org/license
|
|
*/
|
|
|
|
//>>label: Tooltip
|
|
//>>group: Widgets
|
|
//>>description: Shows additional information for any element on hover or focus.
|
|
//>>docs: http://api.jqueryui.com/tooltip/
|
|
//>>demos: http://jqueryui.com/tooltip/
|
|
//>>css.structure: ../../themes/base/core.css
|
|
//>>css.structure: ../../themes/base/tooltip.css
|
|
//>>css.theme: ../../themes/base/theme.css
|
|
|
|
$.widget("ui.tooltip", {
|
|
version: "1.12.1",
|
|
options: {
|
|
classes: {
|
|
"ui-tooltip": "ui-corner-all ui-widget-shadow"
|
|
},
|
|
content: function () {
|
|
// support: IE<9, Opera in jQuery <1.7
|
|
// .text() can't accept undefined, so coerce to a string
|
|
var title = $(this).attr("title") || "";
|
|
|
|
// Escape title, since we're going from an attribute to raw HTML
|
|
return $("<a>").text(title).html();
|
|
},
|
|
hide: true,
|
|
|
|
// Disabled elements have inconsistent behavior across browsers (#8661)
|
|
items: "[title]:not([disabled])",
|
|
position: {
|
|
my: "left top+15",
|
|
at: "left bottom",
|
|
collision: "flipfit flip"
|
|
},
|
|
show: true,
|
|
track: false,
|
|
|
|
// Callbacks
|
|
close: null,
|
|
open: null
|
|
},
|
|
|
|
_addDescribedBy: function (elem, id) {
|
|
var describedby = (elem.attr("aria-describedby") || "").split(/\s+/);
|
|
describedby.push(id);
|
|
elem
|
|
.data("ui-tooltip-id", id)
|
|
.attr("aria-describedby", $.trim(describedby.join(" ")));
|
|
},
|
|
|
|
_removeDescribedBy: function (elem) {
|
|
var id = elem.data("ui-tooltip-id"),
|
|
describedby = (elem.attr("aria-describedby") || "").split(/\s+/),
|
|
index = $.inArray(id, describedby);
|
|
|
|
if (index !== -1) {
|
|
describedby.splice(index, 1);
|
|
}
|
|
|
|
elem.removeData("ui-tooltip-id");
|
|
describedby = $.trim(describedby.join(" "));
|
|
if (describedby) {
|
|
elem.attr("aria-describedby", describedby);
|
|
} else {
|
|
elem.removeAttr("aria-describedby");
|
|
}
|
|
},
|
|
|
|
_create: function () {
|
|
this._on({
|
|
mouseover: "open",
|
|
focusin: "open"
|
|
});
|
|
|
|
// IDs of generated tooltips, needed for destroy
|
|
this.tooltips = {};
|
|
|
|
// IDs of parent tooltips where we removed the title attribute
|
|
this.parents = {};
|
|
|
|
// Append the aria-live region so tooltips announce correctly
|
|
this.liveRegion = $("<div>")
|
|
.attr({
|
|
role: "log",
|
|
"aria-live": "assertive",
|
|
"aria-relevant": "additions"
|
|
})
|
|
.appendTo(this.document[0].body);
|
|
this._addClass(this.liveRegion, null, "ui-helper-hidden-accessible");
|
|
|
|
this.disabledTitles = $([]);
|
|
},
|
|
|
|
_setOption: function (key, value) {
|
|
var that = this;
|
|
|
|
this._super(key, value);
|
|
|
|
if (key === "content") {
|
|
$.each(this.tooltips, function (id, tooltipData) {
|
|
that._updateContent(tooltipData.element);
|
|
});
|
|
}
|
|
},
|
|
|
|
_setOptionDisabled: function (value) {
|
|
this[value ? "_disable" : "_enable"]();
|
|
},
|
|
|
|
_disable: function () {
|
|
var that = this;
|
|
|
|
// Close open tooltips
|
|
$.each(this.tooltips, function (id, tooltipData) {
|
|
var event = $.Event("blur");
|
|
event.target = event.currentTarget = tooltipData.element[0];
|
|
that.close(event, true);
|
|
});
|
|
|
|
// Remove title attributes to prevent native tooltips
|
|
this.disabledTitles = this.disabledTitles.add(
|
|
this.element.find(this.options.items).addBack()
|
|
.filter(function () {
|
|
var element = $(this);
|
|
if (element.is("[title]")) {
|
|
return element
|
|
.data("ui-tooltip-title", element.attr("title"))
|
|
.removeAttr("title");
|
|
}
|
|
})
|
|
);
|
|
},
|
|
|
|
_enable: function () {
|
|
// restore title attributes
|
|
this.disabledTitles.each(function () {
|
|
var element = $(this);
|
|
if (element.data("ui-tooltip-title")) {
|
|
element.attr("title", element.data("ui-tooltip-title"));
|
|
}
|
|
});
|
|
this.disabledTitles = $([]);
|
|
},
|
|
|
|
open: function (event) {
|
|
var that = this,
|
|
target = $(event ? event.target : this.element)
|
|
|
|
// we need closest here due to mouseover bubbling,
|
|
// but always pointing at the same event target
|
|
.closest(this.options.items);
|
|
|
|
// No element to show a tooltip for or the tooltip is already open
|
|
if (!target.length || target.data("ui-tooltip-id")) {
|
|
return;
|
|
}
|
|
|
|
if (target.attr("title")) {
|
|
target.data("ui-tooltip-title", target.attr("title"));
|
|
}
|
|
|
|
target.data("ui-tooltip-open", true);
|
|
|
|
// Kill parent tooltips, custom or native, for hover
|
|
if (event && event.type === "mouseover") {
|
|
target.parents().each(function () {
|
|
var parent = $(this),
|
|
blurEvent;
|
|
if (parent.data("ui-tooltip-open")) {
|
|
blurEvent = $.Event("blur");
|
|
blurEvent.target = blurEvent.currentTarget = this;
|
|
that.close(blurEvent, true);
|
|
}
|
|
if (parent.attr("title")) {
|
|
parent.uniqueId();
|
|
that.parents[this.id] = {
|
|
element: this,
|
|
title: parent.attr("title")
|
|
};
|
|
parent.attr("title", "");
|
|
}
|
|
});
|
|
}
|
|
|
|
this._registerCloseHandlers(event, target);
|
|
this._updateContent(target, event);
|
|
},
|
|
|
|
_updateContent: function (target, event) {
|
|
var content,
|
|
contentOption = this.options.content,
|
|
that = this,
|
|
eventType = event ? event.type : null;
|
|
|
|
if (typeof contentOption === "string" || contentOption.nodeType ||
|
|
contentOption.jquery) {
|
|
return this._open(event, target, contentOption);
|
|
}
|
|
|
|
content = contentOption.call(target[0], function (response) {
|
|
// IE may instantly serve a cached response for ajax requests
|
|
// delay this call to _open so the other call to _open runs first
|
|
that._delay(function () {
|
|
// Ignore async response if tooltip was closed already
|
|
if (!target.data("ui-tooltip-open")) {
|
|
return;
|
|
}
|
|
|
|
// JQuery creates a special event for focusin when it doesn't
|
|
// exist natively. To improve performance, the native event
|
|
// object is reused and the type is changed. Therefore, we can't
|
|
// rely on the type being correct after the event finished
|
|
// bubbling, so we set it back to the previous value. (#8740)
|
|
if (event) {
|
|
event.type = eventType;
|
|
}
|
|
this._open(event, target, response);
|
|
});
|
|
});
|
|
if (content) {
|
|
this._open(event, target, content);
|
|
}
|
|
},
|
|
|
|
_open: function (event, target, content) {
|
|
var tooltipData, tooltip, delayedShow, a11yContent,
|
|
positionOption = $.extend({}, this.options.position);
|
|
|
|
if (!content) {
|
|
return;
|
|
}
|
|
|
|
// Content can be updated multiple times. If the tooltip already
|
|
// exists, then just update the content and bail.
|
|
tooltipData = this._find(target);
|
|
if (tooltipData) {
|
|
tooltipData.tooltip.find(".ui-tooltip-content").html(content);
|
|
return;
|
|
}
|
|
|
|
// If we have a title, clear it to prevent the native tooltip
|
|
// we have to check first to avoid defining a title if none exists
|
|
// (we don't want to cause an element to start matching [title])
|
|
//
|
|
// We use removeAttr only for key events, to allow IE to export the correct
|
|
// accessible attributes. For mouse events, set to empty string to avoid
|
|
// native tooltip showing up (happens only when removing inside mouseover).
|
|
if (target.is("[title]")) {
|
|
if (event && event.type === "mouseover") {
|
|
target.attr("title", "");
|
|
} else {
|
|
target.removeAttr("title");
|
|
}
|
|
}
|
|
|
|
tooltipData = this._tooltip(target);
|
|
tooltip = tooltipData.tooltip;
|
|
this._addDescribedBy(target, tooltip.attr("id"));
|
|
tooltip.find(".ui-tooltip-content").html(content);
|
|
|
|
// Support: Voiceover on OS X, JAWS on IE <= 9
|
|
// JAWS announces deletions even when aria-relevant="additions"
|
|
// Voiceover will sometimes re-read the entire log region's contents from the beginning
|
|
this.liveRegion.children().hide();
|
|
a11yContent = $("<div>").html(tooltip.find(".ui-tooltip-content").html());
|
|
a11yContent.removeAttr("name").find("[name]").removeAttr("name");
|
|
a11yContent.removeAttr("id").find("[id]").removeAttr("id");
|
|
a11yContent.appendTo(this.liveRegion);
|
|
|
|
function position(event) {
|
|
positionOption.of = event;
|
|
if (tooltip.is(":hidden")) {
|
|
return;
|
|
}
|
|
tooltip.position(positionOption);
|
|
}
|
|
if (this.options.track && event && /^mouse/.test(event.type)) {
|
|
this._on(this.document, {
|
|
mousemove: position
|
|
});
|
|
|
|
// trigger once to override element-relative positioning
|
|
position(event);
|
|
} else {
|
|
tooltip.position($.extend({
|
|
of: target
|
|
}, this.options.position));
|
|
}
|
|
|
|
tooltip.hide();
|
|
|
|
this._show(tooltip, this.options.show);
|
|
|
|
// Handle tracking tooltips that are shown with a delay (#8644). As soon
|
|
// as the tooltip is visible, position the tooltip using the most recent
|
|
// event.
|
|
// Adds the check to add the timers only when both delay and track options are set (#14682)
|
|
if (this.options.track && this.options.show && this.options.show.delay) {
|
|
delayedShow = this.delayedShow = setInterval(function () {
|
|
if (tooltip.is(":visible")) {
|
|
position(positionOption.of);
|
|
clearInterval(delayedShow);
|
|
}
|
|
}, $.fx.interval);
|
|
}
|
|
|
|
this._trigger("open", event, { tooltip: tooltip });
|
|
},
|
|
|
|
_registerCloseHandlers: function (event, target) {
|
|
var events = {
|
|
keyup: function (event) {
|
|
if (event.keyCode === $.ui.keyCode.ESCAPE) {
|
|
var fakeEvent = $.Event(event);
|
|
fakeEvent.currentTarget = target[0];
|
|
this.close(fakeEvent, true);
|
|
}
|
|
}
|
|
};
|
|
|
|
// Only bind remove handler for delegated targets. Non-delegated
|
|
// tooltips will handle this in destroy.
|
|
if (target[0] !== this.element[0]) {
|
|
events.remove = function () {
|
|
this._removeTooltip(this._find(target).tooltip);
|
|
};
|
|
}
|
|
|
|
if (!event || event.type === "mouseover") {
|
|
events.mouseleave = "close";
|
|
}
|
|
if (!event || event.type === "focusin") {
|
|
events.focusout = "close";
|
|
}
|
|
this._on(true, target, events);
|
|
},
|
|
|
|
close: function (event) {
|
|
var tooltip,
|
|
that = this,
|
|
target = $(event ? event.currentTarget : this.element),
|
|
tooltipData = this._find(target);
|
|
|
|
// The tooltip may already be closed
|
|
if (!tooltipData) {
|
|
// We set ui-tooltip-open immediately upon open (in open()), but only set the
|
|
// additional data once there's actually content to show (in _open()). So even if the
|
|
// tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in
|
|
// the period between open() and _open().
|
|
target.removeData("ui-tooltip-open");
|
|
return;
|
|
}
|
|
|
|
tooltip = tooltipData.tooltip;
|
|
|
|
// Disabling closes the tooltip, so we need to track when we're closing
|
|
// to avoid an infinite loop in case the tooltip becomes disabled on close
|
|
if (tooltipData.closing) {
|
|
return;
|
|
}
|
|
|
|
// Clear the interval for delayed tracking tooltips
|
|
clearInterval(this.delayedShow);
|
|
|
|
// Only set title if we had one before (see comment in _open())
|
|
// If the title attribute has changed since open(), don't restore
|
|
if (target.data("ui-tooltip-title") && !target.attr("title")) {
|
|
target.attr("title", target.data("ui-tooltip-title"));
|
|
}
|
|
|
|
this._removeDescribedBy(target);
|
|
|
|
tooltipData.hiding = true;
|
|
tooltip.stop(true);
|
|
this._hide(tooltip, this.options.hide, function () {
|
|
that._removeTooltip($(this));
|
|
});
|
|
|
|
target.removeData("ui-tooltip-open");
|
|
this._off(target, "mouseleave focusout keyup");
|
|
|
|
// Remove 'remove' binding only on delegated targets
|
|
if (target[0] !== this.element[0]) {
|
|
this._off(target, "remove");
|
|
}
|
|
this._off(this.document, "mousemove");
|
|
|
|
if (event && event.type === "mouseleave") {
|
|
$.each(this.parents, function (id, parent) {
|
|
$(parent.element).attr("title", parent.title);
|
|
delete that.parents[id];
|
|
});
|
|
}
|
|
|
|
tooltipData.closing = true;
|
|
this._trigger("close", event, { tooltip: tooltip });
|
|
if (!tooltipData.hiding) {
|
|
tooltipData.closing = false;
|
|
}
|
|
},
|
|
|
|
_tooltip: function (element) {
|
|
var tooltip = $("<div>").attr("role", "tooltip"),
|
|
content = $("<div>").appendTo(tooltip),
|
|
id = tooltip.uniqueId().attr("id");
|
|
|
|
this._addClass(content, "ui-tooltip-content");
|
|
this._addClass(tooltip, "ui-tooltip", "ui-widget ui-widget-content");
|
|
|
|
tooltip.appendTo(this._appendTo(element));
|
|
|
|
return this.tooltips[id] = {
|
|
element: element,
|
|
tooltip: tooltip
|
|
};
|
|
},
|
|
|
|
_find: function (target) {
|
|
var id = target.data("ui-tooltip-id");
|
|
return id ? this.tooltips[id] : null;
|
|
},
|
|
|
|
_removeTooltip: function (tooltip) {
|
|
tooltip.remove();
|
|
delete this.tooltips[tooltip.attr("id")];
|
|
},
|
|
|
|
_appendTo: function (target) {
|
|
var element = target.closest(".ui-front, dialog");
|
|
|
|
if (!element.length) {
|
|
element = this.document[0].body;
|
|
}
|
|
|
|
return element;
|
|
},
|
|
|
|
_destroy: function () {
|
|
var that = this;
|
|
|
|
// Close open tooltips
|
|
$.each(this.tooltips, function (id, tooltipData) {
|
|
// Delegate to close method to handle common cleanup
|
|
var event = $.Event("blur"),
|
|
element = tooltipData.element;
|
|
event.target = event.currentTarget = element[0];
|
|
that.close(event, true);
|
|
|
|
// Remove immediately; destroying an open tooltip doesn't use the
|
|
// hide animation
|
|
$("#" + id).remove();
|
|
|
|
// Restore the title
|
|
if (element.data("ui-tooltip-title")) {
|
|
// If the title attribute has changed since open(), don't restore
|
|
if (!element.attr("title")) {
|
|
element.attr("title", element.data("ui-tooltip-title"));
|
|
}
|
|
element.removeData("ui-tooltip-title");
|
|
}
|
|
});
|
|
this.liveRegion.remove();
|
|
}
|
|
});
|
|
|
|
// DEPRECATED
|
|
// TODO: Switch return back to widget declaration at top of file when this is removed
|
|
if ($.uiBackCompat !== false) {
|
|
// Backcompat for tooltipClass option
|
|
$.widget("ui.tooltip", $.ui.tooltip, {
|
|
options: {
|
|
tooltipClass: null
|
|
},
|
|
_tooltip: function () {
|
|
var tooltipData = this._superApply(arguments);
|
|
if (this.options.tooltipClass) {
|
|
tooltipData.tooltip.addClass(this.options.tooltipClass);
|
|
}
|
|
return tooltipData;
|
|
}
|
|
});
|
|
}
|
|
|
|
var widgetsTooltip = $.ui.tooltip;
|
|
}));
|